{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "805a3605-9455-4bb3-8d3c-7299153260ef", "code": "3254-93-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3254-93-1", "code_system": "CAS", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36", "2fea6d7e-ba37-4371-bb0c-6a424b0cc224" ] }, { "uuid": "679a5493-8506-495e-a014-5dc423ec23aa", "code": "C81468", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81468", "code_system": "NCI_THESAURUS", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "9c2896e5-c418-4446-a88c-c238d6a73098", "code": "SUB06386MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "03dc6ea6-cfe7-4c63-8df4-fc32548c0ac4", "code": "3548", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3548", "code_system": "INN", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "f724feb1-3ca5-4a88-9afc-ae86201c0d53", "code": "m711", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m711?q=authorize", "code_system": "MERCK INDEX", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "36369666-142b-4210-add9-e744e5ffefc2", "code": "CHEMBL92974", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL92974", "code_system": "ChEMBL", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "f9a036dd-685d-4869-9dbe-06ecae21d65b", "code": "221-851-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.865", "code_system": "ECHA (EC/EINECS)", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "dcc6665b-bb0f-4e57-b315-783b3cd152d1", "code": "18622", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18622", "code_system": "PUBCHEM", "references": [ "09a5fd4e-cc5b-4855-9069-d58826606b36" ] }, { "uuid": "207e9f4a-79b3-7d2e-aa13-ce12443d20a5", "code": "DTXSID70186249", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70186249", "code_system": "EPA CompTox", "references": [ "54e9e53f-7ed8-fa56-196c-e07089f6c5d7" ] }, { "uuid": "d380e83b-232c-45ac-c943-bf24432d36a5", "code": "C264", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264", "code_system": "NCI_THESAURUS", "references": [ "0ac3028b-8b0d-59a3-a691-dcaf4f24a4e7" ] }, { "uuid": "52cc6442-eb82-4047-bb17-ad043f4f4df9", "code": "0K2ALD8B7K", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f60d8a95-dc8f-fa86-36c3-b3017926688c", "code": "100000080793", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "9a3bf394-c7ce-682d-f09a-2e41e93209e7" ] } ], "relationships": [ { "uuid": "b1f838b4-311c-487b-9135-7a8441ab8c4e", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "0b16989b-dd35-4797-84a5-cfca447d62fa", "refuuid": "60eac43c-a139-45d1-b91f-4a49c3bcd859", "name": "DOXENITOIN", "unii": "0K2ALD8B7K", "linking_id": "0K2ALD8B7K", "ref_pname": "DOXENITOIN", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "c3729734-b99c-4db4-988c-87e9bf4cfae0", "name": "5,5-DIPHENYL-4-IMIDAZOLIDINONE", "stdName": "5,5-DIPHENYL-4-IMIDAZOLIDINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "11782f43-77fa-4866-954f-4c684614f58f" ], "display_name": false }, { "uuid": "f288a677-5afe-4767-96cf-0ea03983ae13", "name": "DOXENITOIN", "stdName": "DOXENITOIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "87118318-acb4-4232-b6e3-f382329e3b05", "845e4861-d2e1-4a74-93cb-24fc6d90d5ee", "a9e14fef-4498-4e96-aca2-606a75710377", "075d94cf-8931-4f33-91f5-5e22677f913c", "7677686a-b98f-4fde-918a-63dbc9ffa016" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "acb47307-3f0d-47bf-814c-737d09354d36", "name_org": "INN" } ] }, { "uuid": "bac5cb73-c85b-41f8-958c-b072465ec8d0", "name": "DOXENITOIN [MI]", "stdName": "DOXENITOIN [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "075d94cf-8931-4f33-91f5-5e22677f913c" ], "display_name": false }, { "uuid": "9a9d7df1-bb0b-47d4-8892-bfff2e356ba3", "name": "SKF 2599", "stdName": "SKF 2599", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "11782f43-77fa-4866-954f-4c684614f58f" ], "display_name": false }, { "uuid": "51499cd0-29d5-457e-80a4-040bddabe242", "name": "SKF-2599", "stdName": "SKF-2599", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "11782f43-77fa-4866-954f-4c684614f58f" ], "display_name": false }, { "uuid": "c8da91cf-5e03-4bfe-aaeb-b5cded31655c", "name": "doxenitoin [INN]", "stdName": "DOXENITOIN [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7677686a-b98f-4fde-918a-63dbc9ffa016" ], "display_name": false } ], "references": [ { "uuid": "87118318-acb4-4232-b6e3-f382329e3b05", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "11782f43-77fa-4866-954f-4c684614f58f", "citation": "USP DICTIONARY", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7677686a-b98f-4fde-918a-63dbc9ffa016", "citation": "INN Proposed List 31", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL31.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "075d94cf-8931-4f33-91f5-5e22677f913c", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "09a5fd4e-cc5b-4855-9069-d58826606b36", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389689000, "tags": [ "NOMEN" ] }, { "uuid": "eaabc3ec-939e-4533-a3b6-22d808866425", "citation": "SRS import [0K2ALD8B7K]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0K2ALD8B7K", "doc_type": "SRS", "public_domain": true, "document_date": 1493389689000, "tags": [ "NOMEN" ] }, { "uuid": "a9e14fef-4498-4e96-aca2-606a75710377", "citation": "DOXENITOIN [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "845e4861-d2e1-4a74-93cb-24fc6d90d5ee", "citation": "DOXENITOIN [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "54e9e53f-7ed8-fa56-196c-e07089f6c5d7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3254-93-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9a3bf394-c7ce-682d-f09a-2e41e93209e7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "0ac3028b-8b0d-59a3-a691-dcaf4f24a4e7", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "2fea6d7e-ba37-4371-bb0c-6a424b0cc224", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d6f7d40f-2d2a-488f-8e77-93467277761f", "id": "d6f7d40f-2d2a-488f-8e77-93467277761f", "molfile": "\n Marvin 01132111082D \n\n 18 20 0 0 0 0 999 V2000\n 1.5723 -3.5939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0921 -2.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2582 -2.9304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6661 -1.6730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3400 -2.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0862 -2.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1714 -3.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9304 -3.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5939 -3.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5036 -2.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7523 -1.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7531 -1.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5741 -1.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9691 -0.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5586 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7453 -0.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3193 -0.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 3 2 1 0 0 0 0\n 2 6 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 13 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 12 7 2 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 18 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C2(c3ccccc3)C(=O)NCN2", "formula": "C15H14N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3dcce951-b03b-4b87-a5e7-734ea549b379" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "238.285", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "60eac43c-a139-45d1-b91f-4a49c3bcd859", "version": "7", "structure": { "id": "4720d20b-7c69-4fd2-8136-b1273a528044", "molfile": "\n Marvin 01132103442D \n\n 18 20 0 0 0 0 999 V2000\n 1.3400 -2.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0921 -2.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2582 -2.9304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6661 -1.6730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.1533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5723 -3.5939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0862 -2.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7531 -1.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7523 -1.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1714 -3.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5741 -1.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3193 -0.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9304 -3.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9691 -0.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7453 -0.0026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5036 -2.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5939 -3.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5586 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 2 2 0 0 0 0\n 7 1 1 0 0 0 0\n 8 1 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 7 2 0 0 0 0\n 11 8 2 0 0 0 0\n 12 8 1 0 0 0 0\n 13 10 1 0 0 0 0\n 14 11 1 0 0 0 0\n 15 12 2 0 0 0 0\n 16 9 2 0 0 0 0\n 17 13 2 0 0 0 0\n 18 15 1 0 0 0 0\n 5 3 1 0 0 0 0\n 18 14 2 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)C2(c3ccccc3)C(=O)NCN2", "formula": "C15H14N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "238.285", "optical_activity": "NONE", "references": [ "87118318-acb4-4232-b6e3-f382329e3b05", "eaabc3ec-939e-4533-a3b6-22d808866425", "7677686a-b98f-4fde-918a-63dbc9ffa016" ], "stereo_centers": 0 }, "unii": "0K2ALD8B7K" } ] }