{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a8aa6647-945c-48c9-8a8f-afb55a4d58e6",
          "code": "64896-70-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64896-70-4",
          "code_system": "CAS",
          "references": [
            "b5c8b63e-6321-4d4e-9f36-fa4eff78fb33",
            "24ee75d0-4450-4f24-898d-0551bd66330c"
          ]
        },
        {
          "uuid": "995f9b5e-9657-4312-a69f-975a56ce4412",
          "code": "10501064",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10501064",
          "code_system": "PUBCHEM",
          "references": [
            "b5c8b63e-6321-4d4e-9f36-fa4eff78fb33"
          ]
        },
        {
          "uuid": "fe62c20d-bbb1-fbc7-796e-4609ebd5258d",
          "code": "DTXSID60215219",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60215219",
          "code_system": "EPA CompTox",
          "references": [
            "77cca846-6f6c-ebc8-f939-aeb9c3d30487"
          ]
        },
        {
          "uuid": "4da1ccd7-a702-c708-9278-14af28fe7aaa",
          "code": "2002720",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2002720/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5be3a315-1716-550f-5e5d-af26c6e3e737"
          ]
        },
        {
          "uuid": "d38bed09-4d32-40f3-ae8e-eb9d929a857f",
          "code": "0IK29C4889",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4fc9fc4d-f1d0-41c7-8d22-d08227162e42",
          "code": "0IK29C4889",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0IK29C4889",
          "code_system": "DAILYMED",
          "references": [
            "d2fdb8d8-53a8-db7c-8b17-bb26e0b7c1dc"
          ]
        },
        {
          "uuid": "6c67f2c4-91b5-19ee-e11a-98dfa7eb9e5b",
          "code": "300000055234",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e45896c1-96bd-e966-7ee2-9d1b359bef23"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4666eabd-16cd-4fab-99c0-9c069b7d9ad8",
          "name": "D-GLUCITOL, 1,4:3,6-DIANHYDRO-, DIOCTANOATE",
          "stdName": "D-GLUCITOL, 1,4:3,6-DIANHYDRO-, DIOCTANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a4a201-a0c9-414f-926c-9bdaeadec9c2",
            "e1cb30be-241a-487b-8932-393e4390ee6a"
          ],
          "display_name": false
        },
        {
          "uuid": "8a7128e3-226d-4625-bf79-6ad0ce51abc1",
          "name": "ISOSORBIDE DICAPRYLATE",
          "stdName": "ISOSORBIDE DICAPRYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02aa5e3d-f96b-472b-9d92-4150c3cede6f",
            "49a4a201-a0c9-414f-926c-9bdaeadec9c2",
            "e1cb30be-241a-487b-8932-393e4390ee6a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "608e9dcd-5d82-49ef-8b31-63b85b896f14",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "aa139e35-7c1f-48d9-b437-5039d3931c7a",
          "name": "NIKKOL SORESTER 208",
          "stdName": "NIKKOL SORESTER 208",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a4a201-a0c9-414f-926c-9bdaeadec9c2",
            "e1cb30be-241a-487b-8932-393e4390ee6a"
          ],
          "display_name": false
        },
        {
          "uuid": "f6bf8765-6209-4263-9667-99b728fc99eb",
          "name": "SYNOVEA DOI",
          "stdName": "SYNOVEA DOI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a4a201-a0c9-414f-926c-9bdaeadec9c2",
            "e1cb30be-241a-487b-8932-393e4390ee6a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "49a4a201-a0c9-414f-926c-9bdaeadec9c2",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e1cb30be-241a-487b-8932-393e4390ee6a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db389c66-1314-481b-8a70-4c7a43425fb8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5c8b63e-6321-4d4e-9f36-fa4eff78fb33",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391532000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd9a6616-8ddb-49b1-bc38-5e11695df2de",
          "citation": "SRS import [0IK29C4889]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0IK29C4889",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391532000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02aa5e3d-f96b-472b-9d92-4150c3cede6f",
          "citation": "ISOSORBIDE DICAPRYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77cca846-6f6c-ebc8-f939-aeb9c3d30487",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64896-70-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5be3a315-1716-550f-5e5d-af26c6e3e737",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "24ee75d0-4450-4f24-898d-0551bd66330c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2fdb8d8-53a8-db7c-8b17-bb26e0b7c1dc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e45896c1-96bd-e966-7ee2-9d1b359bef23",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9824f942-1c68-41b7-aa98-178e5f3e96c5",
          "id": "9824f942-1c68-41b7-aa98-178e5f3e96c5",
          "molfile": "\n  Marvin  01132107542D          \n\n 28 29  0  0  1  0            999 V2000\n   12.3862  -15.4401    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.1292  -16.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7953  -16.7108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4640  -16.2276    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.2890  -16.2298    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   14.5461  -15.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8800  -14.9592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2112  -15.4423    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.7722  -16.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4346  -17.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9177  -18.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6138  -17.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2763  -18.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4556  -18.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1180  -19.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2973  -19.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9597  -20.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1390  -20.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9031  -14.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0823  -14.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7448  -15.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5993  -14.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7785  -14.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2955  -13.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4747  -13.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9916  -13.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709  -13.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6878  -12.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  8  1  1  0  0  0  0\n  1 19  1  1  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  9  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  1  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)O[C@@H]1CO[C@@H]2[C@H](CO[C@H]12)OC(=O)CCCCCCC",
          "formula": "C22H38O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3045556a-12ca-4ee1-bbba-cdfe803c577f"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "398.5344",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "47cc8e22-e819-41a3-91c9-e2fd618e9ab6",
      "version": "9",
      "structure": {
        "id": "8166508b-0a42-4728-bb68-c376ed94bb68",
        "molfile": "\n  Marvin  01132106432D          \n\n 30 31  0  0  1  0            999 V2000\n   11.0823  -14.8554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5993  -14.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7785  -14.2707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2955  -13.6020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4747  -13.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9916  -13.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1709  -13.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6878  -12.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7448  -15.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9031  -14.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3862  -15.4401    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.2112  -15.4423    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.4640  -16.2276    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.2890  -16.2298    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.7722  -16.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4346  -17.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9177  -18.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6138  -17.7354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2763  -18.4882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4556  -18.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1180  -19.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2973  -19.4090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9597  -20.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1390  -20.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5461  -15.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8800  -14.9592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7169  -17.0129    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7953  -16.7108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1292  -16.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9584  -14.6570    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  1  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 14 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 12 26  1  0  0  0  0\n 13 27  1  6  0  0  0\n 13 28  1  0  0  0  0\n 29 28  1  0  0  0  0\n 11 29  1  0  0  0  0\n 12 30  1  6  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)O[C@@H]1CO[C@]2([H])[C@H](CO[C@]12[H])OC(=O)CCCCCCC",
        "formula": "C22H38O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "398.5344",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cd9a6616-8ddb-49b1-bc38-5e11695df2de",
          "db389c66-1314-481b-8a70-4c7a43425fb8"
        ],
        "stereo_centers": 4
      },
      "unii": "0IK29C4889"
    }
  ]
}