{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2232609f-d210-49e4-8ba3-35700bc9cfee",
          "code": "486455-65-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=486455-65-6",
          "code_system": "CAS",
          "references": [
            "c0d109e9-79ba-4299-8655-c2cfabb31866",
            "9010135a-3d1d-4d2d-ada7-86702f53df64"
          ]
        },
        {
          "uuid": "de3bdff6-985d-4cdb-8a94-a7c82faa5d2f",
          "code": "861390-34-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=861390-34-3",
          "code_system": "CAS",
          "references": [
            "c0d109e9-79ba-4299-8655-c2cfabb31866",
            "a0f6a19d-2300-468c-839f-3d7e404051f3"
          ]
        },
        {
          "uuid": "1fb1326e-99ec-4d67-acc1-e9242486cc61",
          "code": "1370107",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1370107/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c0d109e9-79ba-4299-8655-c2cfabb31866"
          ]
        },
        {
          "uuid": "29f035f2-8ac5-4e8c-bac7-2095a6b45f10",
          "code": "11417726",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11417726",
          "code_system": "PUBCHEM",
          "references": [
            "c0d109e9-79ba-4299-8655-c2cfabb31866"
          ]
        },
        {
          "uuid": "ec8e384a-b9b3-46e4-4180-e5219778a1cd",
          "code": "DTXSID10197571",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10197571",
          "code_system": "EPA CompTox",
          "references": [
            "d7a5bb41-4808-d8ac-6e57-e3e8c01c564c"
          ]
        },
        {
          "uuid": "72dbcdd6-c9c2-49da-a148-406d5e19da32",
          "code": "0IAF2L30VS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "92746dfb-8080-5ae6-3212-5ef5f726659e",
          "code": "0IAF2L30VS",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0IAF2L30VS",
          "code_system": "DAILYMED",
          "references": [
            "bc33c472-db33-6e41-8688-f4f0bd1e7fb5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "152c2326-2c5c-42e0-a2a0-255e4208713a",
          "name": "DIBUTYL ETHYLHEXANOYL GLUTAMIDE",
          "stdName": "DIBUTYL ETHYLHEXANOYL GLUTAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b951d84-93ff-4683-a329-ed4ac2f8f6da",
            "c54dd1b1-e6b1-4038-bb66-5ac71e779e6d",
            "6db28e49-5942-4506-9937-286692aa4e1f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "65275d5d-b45a-4d7d-8e1c-3db94a529b12",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e2a1a1f5-3e6c-49fd-9916-e35d56f7b95f",
          "name": "EB-21",
          "stdName": "EB-21",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c54dd1b1-e6b1-4038-bb66-5ac71e779e6d",
            "6db28e49-5942-4506-9937-286692aa4e1f"
          ],
          "display_name": false
        },
        {
          "uuid": "ac2f94a2-b780-48c8-aba2-a71d5a8cfaea",
          "name": "PENTANEDIAMIDE N,N'-DIBUTYL-2-((2-ETHYL-1-OXOHEXYL)AMINO)-",
          "stdName": "PENTANEDIAMIDE N,N'-DIBUTYL-2-((2-ETHYL-1-OXOHEXYL)AMINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c54dd1b1-e6b1-4038-bb66-5ac71e779e6d",
            "6db28e49-5942-4506-9937-286692aa4e1f"
          ],
          "display_name": false
        },
        {
          "uuid": "772fabe5-7c9c-4add-85f7-324aa40443cc",
          "name": "PENTANEDIAMIDE, N1,N5-DIBUTYL-2-((2-ETHYL-1-OXOHEXYL)AMINO)-, (2S)-",
          "stdName": "PENTANEDIAMIDE, N1,N5-DIBUTYL-2-((2-ETHYL-1-OXOHEXYL)AMINO)-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33f9e182-5514-4ca8-a0fa-fcf450feeb59",
            "6db28e49-5942-4506-9937-286692aa4e1f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c54dd1b1-e6b1-4038-bb66-5ac71e779e6d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6db28e49-5942-4506-9937-286692aa4e1f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33f9e182-5514-4ca8-a0fa-fcf450feeb59",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0d109e9-79ba-4299-8655-c2cfabb31866",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35c2db02-e1fa-4195-b98f-37bfe21b0636",
          "citation": "SRS import [0IAF2L30VS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0IAF2L30VS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b951d84-93ff-4683-a329-ed4ac2f8f6da",
          "citation": "DIBUTYL ETHYLHEXANOYL GLUTAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7a5bb41-4808-d8ac-6e57-e3e8c01c564c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=486455-65-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a0f6a19d-2300-468c-839f-3d7e404051f3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9010135a-3d1d-4d2d-ada7-86702f53df64",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bc33c472-db33-6e41-8688-f4f0bd1e7fb5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "93758926-d848-430d-a60c-e0910b2dd089",
          "id": "93758926-d848-430d-a60c-e0910b2dd089",
          "molfile": "\n  Marvin  01132107392D          \n\n 27 26  0  0  1  0            999 V2000\n    7.4058   -4.0962    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.6913   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6913   -2.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -2.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -2.8587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -1.6212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -1.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5479   -1.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8334   -1.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1189   -1.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -4.9212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6913   -5.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6913   -6.1587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -4.9212    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.9768   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -5.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -6.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -6.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -7.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1202   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1202   -2.8587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8347   -4.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5491   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2636   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9781   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6926   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 11  1  1  0  0  0\n  1 21  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)C(=O)N[C@@H](CCC(=O)NCCCC)C(=O)NCCCC",
          "formula": "C21H41N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "339a940d-a910-458e-ad91-93e6355718b8"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "383.5693",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8b958fe5-6cb0-4827-9349-ff5d4d76cd8a",
      "version": "5",
      "structure": {
        "id": "c66532a1-363a-4b92-a1be-f8da6680ab32",
        "molfile": "\n  Marvin  01132110152D          \n\n 27 26  0  0  1  0            999 V2000\n    7.4058   -4.0962    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6913   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6913   -2.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -2.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -2.8587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -1.6212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -1.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5479   -1.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8334   -1.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1189   -1.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4058   -4.9212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6913   -5.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6913   -6.1587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -4.9212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -5.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2624   -6.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -6.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9768   -7.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1202   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1202   -2.8587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8347   -4.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5491   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2636   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9781   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6926   -4.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 11  1  1  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)C(=O)N[C@@H](CCC(=O)NCCCC)C(=O)NCCCC",
        "formula": "C21H41N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "383.5693",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "35c2db02-e1fa-4195-b98f-37bfe21b0636",
          "33f9e182-5514-4ca8-a0fa-fcf450feeb59"
        ],
        "stereo_centers": 2
      },
      "unii": "0IAF2L30VS"
    }
  ]
}