{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d9ef19f5-af45-42ca-927d-6cddb7c83308",
          "code": "1341-23-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1341-23-7",
          "code_system": "CAS",
          "references": [
            "741c8cff-c131-433f-a6d0-79e2dacba095",
            "13bf5d66-e354-4fd1-835c-b36face8ae82"
          ]
        },
        {
          "uuid": "7f574f1a-2347-ce17-e5c6-00c10581e7e5",
          "code": "548716",
          "comments": "ORPHAN DRUG|Designated|Treatment of mitochondrial encephalopathy, lactic acidosis, and stroke-like episodes syndrome (MELAS)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=548716",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "283c3f72-5d3b-e1e3-878b-03be4ac26e07",
          "code": "628218",
          "comments": "ORPHAN DRUG|Designated|Treatment of Amyotrophic Lateral Sclerosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=628218",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "62bdf90b-ea48-f065-b410-d24e89c565d8",
          "code": "439924",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439924",
          "code_system": "PUBCHEM",
          "references": [
            "fc864ee9-8ffb-deb9-1c7b-b1b02f96bf35"
          ]
        },
        {
          "uuid": "125879d4-9a3b-e65b-281e-4263b2ed5b2e",
          "code": "DB14933",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14933",
          "code_system": "DRUG BANK",
          "references": [
            "6ffc0082-c11d-66be-3bb9-60c459ff205b"
          ]
        },
        {
          "uuid": "ac19a4c5-57bb-47fc-a257-8b344c6b6782",
          "code": "0I8H2M0L7N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "80c87135-5001-4e6a-7e35-a4e064363c31",
          "code": "15927",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15927",
          "code_system": "CHEBI",
          "references": [
            "6ffc0082-c11d-66be-3bb9-60c459ff205b"
          ]
        },
        {
          "uuid": "c20d63fa-6822-2252-8f35-b811316817d2",
          "code": "Nicotinamide riboside",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nicotinamide_riboside",
          "code_system": "WIKIPEDIA",
          "references": [
            "bbd51074-9c01-0756-6093-5dc1471e0fe9"
          ]
        },
        {
          "uuid": "2800b842-995e-a861-dc59-4b813d00931b",
          "code": "100000177681",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "408a2be5-2281-7908-86fc-accccf4c5e02"
          ]
        },
        {
          "uuid": "3cafc1bb-4946-e81e-68b2-47d40164f1bd",
          "code": "C158078",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C158078",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7ed434c6-e69e-b6ef-53fd-89f0f5256d81"
          ]
        },
        {
          "uuid": "db23bd88-0b00-8998-e972-e9f44234cb75",
          "code": "DTXSID501010039",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501010039",
          "code_system": "EPA CompTox",
          "references": [
            "79e270fc-cc22-880c-83c7-809ab1949744"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "055b52ad-7f21-4003-a45f-dcfda5c0edf9",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "cf5ecdb3-e5ec-43d1-b9d0-9e4f28edff6b",
            "refuuid": "28396807-ae13-49f8-a22f-77db56866985",
            "name": "NICOTINAMIDE RIBOSIDE",
            "unii": "0I8H2M0L7N",
            "linking_id": "0I8H2M0L7N",
            "ref_pname": "NICOTINAMIDE RIBOSIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3905786c-e7e2-483b-9215-e988b06d5ce1",
          "type": "IONIC MOIETY",
          "references": [
            "b28d1b6b-c25d-428f-a6c3-364427edd4e8"
          ],
          "related_substance": {
            "uuid": "5a5b264f-8b57-460c-a313-878bf2c828b0",
            "refuuid": "28396807-ae13-49f8-a22f-77db56866985",
            "name": "NICOTINAMIDE RIBOSIDE",
            "unii": "0I8H2M0L7N",
            "linking_id": "0I8H2M0L7N",
            "ref_pname": "NICOTINAMIDE RIBOSIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a3329979-7065-41e1-b62a-11b29cb83cf4",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "b28d1b6b-c25d-428f-a6c3-364427edd4e8"
          ],
          "related_substance": {
            "uuid": "3c1cc196-91e6-45d4-83f5-80a5eae03f2d",
            "refuuid": "2dbc6656-1822-4fe7-828a-74edb0b32990",
            "name": "NICOTINAMIDE RIBOSIDE CHLORIDE",
            "unii": "8XM2XT8VWI",
            "linking_id": "8XM2XT8VWI",
            "ref_pname": "NICOTINAMIDE RIBOSIDE CHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9eacb7f5-4a41-47d5-a79f-9c7d3ed65389",
          "name": "NICOTINAMIDE RIBONUCLEOSIDE",
          "stdName": "NICOTINAMIDE RIBONUCLEOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01275705-c527-4235-8533-26631895ab39"
          ],
          "display_name": false
        },
        {
          "uuid": "46f0d8f6-c263-45d0-8440-3ab64d36241e",
          "name": "NICOTINAMIDE RIBOSE",
          "stdName": "NICOTINAMIDE RIBOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01275705-c527-4235-8533-26631895ab39"
          ],
          "display_name": false
        },
        {
          "uuid": "77be9f76-e45b-4eb1-84d8-0aa012115b9a",
          "name": "NICOTINAMIDE RIBOSIDE",
          "stdName": "NICOTINAMIDE RIBOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b28d1b6b-c25d-428f-a6c3-364427edd4e8"
          ],
          "display_name": true
        },
        {
          "uuid": "f2d1e95c-4212-b013-8b95-862e5a2ff1af",
          "name": "Nicotinamide riboside [WHO-DD]",
          "stdName": "NICOTINAMIDE RIBOSIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8b30976-93df-b9c6-00a4-b1c4d571947e"
          ],
          "display_name": false
        },
        {
          "uuid": "c1f92b4e-c4ab-4c1d-8c86-9bf5bca6068b",
          "name": "PYRIDINIUM, 3-(AMINOCARBONYL)-1-.BETA.-D-RIBOFURANOSYL-",
          "stdName": "PYRIDINIUM, 3-(AMINOCARBONYL)-1-.BETA.-D-RIBOFURANOSYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01275705-c527-4235-8533-26631895ab39"
          ],
          "display_name": false
        },
        {
          "uuid": "86234ebb-2b63-40a9-a091-626a7ce528e2",
          "name": "RIBOSYLNICOTINAMIDE",
          "stdName": "RIBOSYLNICOTINAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01275705-c527-4235-8533-26631895ab39"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b28d1b6b-c25d-428f-a6c3-364427edd4e8",
          "citation": "https://en.wikipedia.org/wiki/Nicotinamide_riboside",
          "url": "https://en.wikipedia.org/wiki/Nicotinamide_riboside",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "01275705-c527-4235-8533-26631895ab39",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "741c8cff-c131-433f-a6d0-79e2dacba095",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394444000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77acd21e-4d62-4cc7-a64f-91f1a94d3381",
          "citation": "SRS import [0I8H2M0L7N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0I8H2M0L7N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394444000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8b30976-93df-b9c6-00a4-b1c4d571947e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "408a2be5-2281-7908-86fc-accccf4c5e02",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6ffc0082-c11d-66be-3bb9-60c459ff205b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "13bf5d66-e354-4fd1-835c-b36face8ae82",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bbd51074-9c01-0756-6093-5dc1471e0fe9",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "fc864ee9-8ffb-deb9-1c7b-b1b02f96bf35",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "7ed434c6-e69e-b6ef-53fd-89f0f5256d81",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "1f3ad08e-3dc5-e1af-47ff-194eeb075fbc",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        },
        {
          "uuid": "79e270fc-cc22-880c-83c7-809ab1949744",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "79af61d2-a39b-425e-a272-6c529ff26005",
          "id": "79af61d2-a39b-425e-a272-6c529ff26005",
          "molfile": "\n  Marvin  01132106192D          \n\n 18 19  0  0  1  0            999 V2000\n    4.4463   -6.5265    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.6212   -6.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2088   -7.2410    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.9312   -5.8590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158   -6.1140    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3832   -5.6291    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.1370   -5.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8045   -5.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7182   -4.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9645   -4.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2971   -4.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8782   -3.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5457   -3.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1246   -3.1676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158   -6.9390    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.3832   -7.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9312   -7.1940    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.6763   -7.9787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 17  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n 15  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  6  0  0  0\nM  CHG  2   3  -1   6   1\nM  END",
          "smiles": "c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@@H](C[O-])O2)O)O)C(=O)N",
          "formula": "C11H14N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "498c31b7-ebd9-4b2b-9f49-9ad031d56eb9"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "254.2397",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "28396807-ae13-49f8-a22f-77db56866985",
      "version": "24",
      "structure": {
        "id": "51c01bef-d4bd-4dfc-821f-1c17b0894705",
        "molfile": "\n  Marvin  01132104152D          \n\n 18 19  0  0  1  0            999 V2000\n    6.8782   -3.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9645   -4.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7182   -4.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8045   -5.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1370   -5.9647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3832   -5.6291    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.2971   -4.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158   -6.1140    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9312   -5.8590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4463   -6.5265    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6212   -6.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2088   -7.2410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9312   -7.1940    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6763   -7.9787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7158   -6.9390    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3832   -7.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1246   -3.1676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5457   -3.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  8  6  1  1  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 11 12  1  0  0  0  0\n 13 10  1  0  0  0  0\n 13 14  1  6  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  6  0  0  0\n  8 15  1  0  0  0  0\n  1 17  2  0  0  0  0\n  1 18  1  0  0  0  0\nM  CHG  1   6   1\nM  END",
        "smiles": "c1cc(c[n+](c1)[C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)C(=O)N",
        "formula": "C11H15N2O5",
        "atropisomerism": "No",
        "charge": 1,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "255.2476",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "77acd21e-4d62-4cc7-a64f-91f1a94d3381",
          "b28d1b6b-c25d-428f-a6c3-364427edd4e8"
        ],
        "stereo_centers": 4
      },
      "unii": "0I8H2M0L7N"
    }
  ]
}