{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "74b38c50-0f3e-42a5-9d99-77d821225267",
          "code": "82857-69-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82857-69-0",
          "code_system": "CAS",
          "references": [
            "cfc4fa70-5f3f-447b-8b1d-9700edb80e7a",
            "18638c34-ae38-48df-9468-42a51b4bd58a"
          ]
        },
        {
          "uuid": "b5f69311-b97f-411f-bb6d-b1f4e0f52ebd",
          "code": "54929",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54929",
          "code_system": "PUBCHEM",
          "references": [
            "cfc4fa70-5f3f-447b-8b1d-9700edb80e7a"
          ]
        },
        {
          "uuid": "b00867aa-3036-9bca-f38a-f547da113824",
          "code": "DTXSID30232034",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30232034",
          "code_system": "EPA CompTox",
          "references": [
            "d353a28e-1b7c-9f8a-5bd8-c3fa75303cf6"
          ]
        },
        {
          "uuid": "679d7e03-dd82-a2d5-db1a-88f306444691",
          "code": "DB07437",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB07437",
          "code_system": "DRUG BANK",
          "references": [
            "2472897d-ca0e-ed6e-ddee-04e114c7ea70"
          ]
        },
        {
          "uuid": "8f549ba9-f5bf-4f92-a895-2cfa1cd190ca",
          "code": "0H851I3O9D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7e4ae05f-1b41-7923-135c-4e783f8c7397",
          "code": "41037",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:41037",
          "code_system": "CHEBI",
          "references": [
            "2472897d-ca0e-ed6e-ddee-04e114c7ea70"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2cd33681-8815-47f8-b58c-43f61af12f44",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "63f2d254-66b9-4e92-a7e4-97393be2f1c1",
            "refuuid": "c58a6ba2-065e-48bf-ba51-abb12275f917",
            "name": "5-BENZYLACYCLOURIDINE",
            "unii": "0H851I3O9D",
            "linking_id": "0H851I3O9D",
            "ref_pname": "5-BENZYLACYCLOURIDINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0caa0cb-a63b-439e-a3a4-12062970a107",
          "name": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-((2-HYDROXYETHOXY)METHYL)-5-(PHENYLMETHYL)-",
          "stdName": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-((2-HYDROXYETHOXY)METHYL)-5-(PHENYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01559b4d-ef56-46da-872a-385ee328438e",
            "d75f146d-b049-4f52-802e-742221a229b7"
          ],
          "display_name": false
        },
        {
          "uuid": "8344989b-668b-4f8e-91b7-f7e8358fbe3a",
          "name": "5-BACU",
          "stdName": "5-BACU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01559b4d-ef56-46da-872a-385ee328438e",
            "ac8920ba-157b-4f6c-8348-5ec65a01b9c2"
          ],
          "display_name": false
        },
        {
          "uuid": "d5ebd178-6627-4a01-8efc-bad77cd712d4",
          "name": "5-BENZYL-1-(2-HYDROXYETHOXYMETHYL)URACIL",
          "stdName": "5-BENZYL-1-(2-HYDROXYETHOXYMETHYL)URACIL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01559b4d-ef56-46da-872a-385ee328438e",
            "d75f146d-b049-4f52-802e-742221a229b7"
          ],
          "display_name": false
        },
        {
          "uuid": "2c48fbff-f1b1-4b5a-9aea-7c6e0b2ca1ce",
          "name": "5-BENZYLACYCLOURIDINE",
          "stdName": "5-BENZYLACYCLOURIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01559b4d-ef56-46da-872a-385ee328438e",
            "d75f146d-b049-4f52-802e-742221a229b7"
          ],
          "display_name": true
        },
        {
          "uuid": "c9769fd1-f5c2-4e27-bf00-d4b71b948fa8",
          "name": "BAU",
          "stdName": "BAU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01559b4d-ef56-46da-872a-385ee328438e",
            "d75f146d-b049-4f52-802e-742221a229b7"
          ],
          "display_name": false
        },
        {
          "uuid": "3d61b88e-c8e1-40d5-af75-6107f9175574",
          "name": "BENZYLACYCLOURIDINE",
          "stdName": "BENZYLACYCLOURIDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01559b4d-ef56-46da-872a-385ee328438e",
            "d75f146d-b049-4f52-802e-742221a229b7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d75f146d-b049-4f52-802e-742221a229b7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "01559b4d-ef56-46da-872a-385ee328438e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac8920ba-157b-4f6c-8348-5ec65a01b9c2",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfc4fa70-5f3f-447b-8b1d-9700edb80e7a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390312000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd2d3c53-9cc9-434e-adbf-b4920059cc45",
          "citation": "SRS import [0H851I3O9D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0H851I3O9D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390312000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d353a28e-1b7c-9f8a-5bd8-c3fa75303cf6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82857-69-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2472897d-ca0e-ed6e-ddee-04e114c7ea70",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "18638c34-ae38-48df-9468-42a51b4bd58a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "06b41a2d-7f34-487d-9062-1203660d95c3",
          "id": "06b41a2d-7f34-487d-9062-1203660d95c3",
          "molfile": "\n  Marvin  01132100382D          \n\n 20 21  0  0  0  0            999 V2000\n    7.8178   -4.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5387   -5.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2555   -4.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9681   -5.0632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6890   -4.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6932   -3.8297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9806   -3.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9806   -2.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2638   -2.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5429   -2.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5429   -3.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8303   -3.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1135   -3.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1177   -2.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8344   -2.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6932   -2.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6890   -1.3502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4099   -2.5879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4099   -3.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1184   -3.8297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 19  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 16  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 16 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)Cc2cn(COCCO)c(=O)[nH]c2=O",
          "formula": "C14H16N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b12bc968-2687-4e4e-b2cb-895c58a52141"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "276.2884",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c58a6ba2-065e-48bf-ba51-abb12275f917",
      "version": "5",
      "structure": {
        "id": "8cd2be71-e16c-4f85-abb0-f8cb209e6bf2",
        "molfile": "\n  Marvin  01132107192D          \n\n 20 21  0  0  0  0            999 V2000\n   11.4099   -2.5879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6932   -3.8297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4099   -3.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9806   -2.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6932   -2.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9806   -3.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2638   -2.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1184   -3.8297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6890   -4.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6890   -1.3502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5429   -2.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9681   -5.0632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8178   -4.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5387   -5.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2555   -4.6507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8344   -2.1628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5429   -3.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8303   -3.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1177   -2.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1135   -3.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  2  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 17 11  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 16  1  0  0  0  0\n 20 18  1  0  0  0  0\n  6  4  2  0  0  0  0\n 20 19  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)Cc2cn(COCCO)c(=O)[nH]c2=O",
        "formula": "C14H16N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "276.2884",
        "optical_activity": "NONE",
        "references": [
          "fd2d3c53-9cc9-434e-adbf-b4920059cc45",
          "d75f146d-b049-4f52-802e-742221a229b7"
        ],
        "stereo_centers": 0
      },
      "unii": "0H851I3O9D"
    }
  ]
}