{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1eccdb72-3c7e-46df-a655-ac5dc2f3c951",
          "code": "1778-02-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1778-02-5",
          "code_system": "CAS",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3",
            "42b1fd7c-bdef-4347-b38d-fe0ff2026995"
          ]
        },
        {
          "uuid": "2f68d482-98d0-4365-9300-2db74f3dd45c",
          "code": "C82316",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82316",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3"
          ]
        },
        {
          "uuid": "0397dd4b-67dd-4038-ab24-661cd20a1f24",
          "code": "21 CFR 310.530",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.530 Topically applied hormone-containing drug products for over-the-counter (OTC) human use.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.530",
          "code_system": "CFR",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3"
          ]
        },
        {
          "uuid": "043804b5-2d7d-463e-9bcb-2b3e8af71447",
          "code": "217-212-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.648",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3"
          ]
        },
        {
          "uuid": "b32a4bdb-6b2d-4c43-b513-635e0cf4d977",
          "code": "m9121",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9121?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3"
          ]
        },
        {
          "uuid": "779701d1-4a97-446b-a336-587034bae667",
          "code": "SUB04027MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3"
          ]
        },
        {
          "uuid": "99b26c02-ae42-4b64-919e-e25d68cc9f32",
          "code": "2723722",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2723722",
          "code_system": "PUBCHEM",
          "references": [
            "1daa6494-4377-4309-b3b4-50e3ee2090b3"
          ]
        },
        {
          "uuid": "7fa43267-945e-60d0-c3f1-da7bb3609495",
          "code": "Pregnenolone acetate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pregnenolone_acetate",
          "code_system": "WIKIPEDIA",
          "references": [
            "703fb814-92fd-08fe-4d78-44e0847ab713"
          ]
        },
        {
          "uuid": "bb4befe8-f80a-12b8-43e0-e3c92c5da8f7",
          "code": "DTXSID3048942",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3048942",
          "code_system": "EPA CompTox",
          "references": [
            "635f5acd-65a7-efdf-3032-1e5faf2a405d"
          ]
        },
        {
          "uuid": "98d4dc95-8dd5-376f-9ab9-8c67b5c2b753",
          "code": "C776",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Progestin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C776",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3a75190d-2bde-a6c1-948c-df0f89c56cbf"
          ]
        },
        {
          "uuid": "4080cdc9-3715-1979-2da2-d2f9744482e2",
          "code": "DB14626",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14626",
          "code_system": "DRUG BANK",
          "references": [
            "3a75190d-2bde-a6c1-948c-df0f89c56cbf"
          ]
        },
        {
          "uuid": "73e970b4-b06b-4f0e-9109-1a346853307f",
          "code": "0G0WWV404B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "882df326-4684-1a73-472f-e930d7a5e7e8",
          "code": "64827",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=64827",
          "code_system": "NSC",
          "references": [
            "3e2b7f20-b35e-5bf1-887b-9f784742634e"
          ]
        },
        {
          "uuid": "6b970107-4e65-6b21-4bc5-3a26a276cd9f",
          "code": "100000085095",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b834ae14-e3ef-11ab-e798-d62175d14a71"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "537e0deb-7f8d-4f44-a57b-f1db22a6a140",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b1f1540a-7f0e-40d5-af95-639d16343160",
            "refuuid": "d47bbda7-b9d6-467f-a7c1-e86dad5cb3bf",
            "name": "Pregnenolone",
            "unii": "73R90F7MQ8",
            "linking_id": "73R90F7MQ8",
            "ref_pname": "Pregnenolone",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "17aca262-91ef-1525-9c99-6902dffa953f",
          "name": "NSC-64827",
          "stdName": "NSC-64827",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e2b7f20-b35e-5bf1-887b-9f784742634e"
          ],
          "display_name": false
        },
        {
          "uuid": "d3a559e1-4797-4741-8fdb-6df0f0329582",
          "name": "PREGNENOLONE ACETATE",
          "stdName": "PREGNENOLONE ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0687afde-eae3-40ed-b98f-5a85eb51f5d5",
            "29e0728a-1da4-4334-8a14-4fa869ee84b2",
            "7301b24b-e6fe-4941-b79f-2fa791e8dd44",
            "b6e7d30c-7c75-42aa-b99c-18a99bf818cf",
            "04d7e732-354a-458c-a8c4-e410802eed97",
            "069381ab-55ff-4fa9-a1c6-da9eff1b55a9",
            "6bfa86f8-14cf-47d7-bce4-65265b4568f2",
            "0b074717-5622-4bfc-bdaa-e82ccf2f3eb7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "42f03cb8-bca4-4688-b9b9-4257cc3af070",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "248cbe13-a4c6-4785-8c2f-afa240b8fbff",
          "name": "PREGNENOLONE ACETATE [MI]",
          "stdName": "PREGNENOLONE ACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29e0728a-1da4-4334-8a14-4fa869ee84b2",
            "04d7e732-354a-458c-a8c4-e410802eed97"
          ],
          "display_name": false
        },
        {
          "uuid": "89822b1b-7ebd-2732-177f-b42ec244148c",
          "name": "Pregnenolone acetate [WHO-DD]",
          "stdName": "PREGNENOLONE ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "082a6904-5648-ad1c-5724-d36727d81fce"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0687afde-eae3-40ed-b98f-5a85eb51f5d5",
          "citation": "Merck Index 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "04d7e732-354a-458c-a8c4-e410802eed97",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "069381ab-55ff-4fa9-a1c6-da9eff1b55a9",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7301b24b-e6fe-4941-b79f-2fa791e8dd44",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29e0728a-1da4-4334-8a14-4fa869ee84b2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1daa6494-4377-4309-b3b4-50e3ee2090b3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b252f39b-8167-4ec1-be26-55d63f2a0803",
          "citation": "SRS import [0G0WWV404B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0G0WWV404B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b074717-5622-4bfc-bdaa-e82ccf2f3eb7",
          "citation": "PREGNENOLONE ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6e7d30c-7c75-42aa-b99c-18a99bf818cf",
          "citation": "PREGNENOLONE ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6bfa86f8-14cf-47d7-bce4-65265b4568f2",
          "citation": "PREGNENOLONE ACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "703fb814-92fd-08fe-4d78-44e0847ab713",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Pregnenolone_acetate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "635f5acd-65a7-efdf-3032-1e5faf2a405d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1778-02-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b834ae14-e3ef-11ab-e798-d62175d14a71",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3a75190d-2bde-a6c1-948c-df0f89c56cbf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "42b1fd7c-bdef-4347-b38d-fe0ff2026995",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3e2b7f20-b35e-5bf1-887b-9f784742634e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "082a6904-5648-ad1c-5724-d36727d81fce",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e173c8ee-f36d-bc11-743b-4223539a3d8b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a310dd43-c320-4716-b30d-c661bb73cca5",
          "id": "a310dd43-c320-4716-b30d-c661bb73cca5",
          "molfile": "\n  Marvin  01132108282D          \n\n 26 29  0  0  1  0            999 V2000\n    5.0189   -0.6680    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.4924   -1.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9957   -2.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2086   -1.7369    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.4941   -2.1464    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.4941   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7766   -3.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0651   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3535   -3.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6419   -2.9625    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.6419   -2.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3535   -1.7195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0680   -2.1377    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.0651   -1.3157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7825   -1.7252    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7912   -0.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5144   -0.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2289   -0.9120    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.2202   -0.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0755   -3.3721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7900   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5074   -3.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7900   -2.1406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0102    0.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7189    0.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2957    0.5664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 18  1  1  0  0  0  0\n  1 24  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  1  0  0  0\n  5  4  1  0  0  0  0\n  4 18  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 15  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 20  1  1  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 24  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OC(=O)C",
          "formula": "C23H34O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1d076a8-91f0-40f1-a7f2-c9a94a82a054"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "358.5151",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9dacb59e-45ec-4182-b2e3-f5472baaa7b3",
      "version": "19",
      "structure": {
        "id": "f56a08d2-bce1-4f73-bcdc-a8f88d6187d5",
        "molfile": "\n  Marvin  01132112432D          \n\n 29 32  0  0  1  0            999 V2000\n    4.2289   -0.9120    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0680   -2.1377    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0651   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2086   -1.7369    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7825   -1.7252    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4941   -2.1464    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0189   -0.6680    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7766   -3.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5144   -0.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4941   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7912   -0.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9957   -2.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3535   -1.7195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4924   -1.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0102    0.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3535   -3.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7900   -2.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0755   -3.3721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6419   -2.9625    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.7900   -2.1406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2957    0.5664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6419   -2.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2202   -0.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0651   -1.3157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5074   -3.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7189    0.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7796   -2.5472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2056   -2.5589    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4911   -1.3244    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14  7  1  0  0  0  0\n  7 15  1  1  0  0  0\n 16  3  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  1  0  0  0\n 19 22  1  0  0  0  0\n 20 17  2  0  0  0  0\n 21 15  2  0  0  0  0\n 22 13  1  0  0  0  0\n  1 23  1  1  0  0  0\n  2 24  1  1  0  0  0\n 25 17  1  0  0  0  0\n 26 15  1  0  0  0  0\n  5 27  1  6  0  0  0\n  4 28  1  6  0  0  0\n  6 29  1  1  0  0  0\n 12 14  1  0  0  0  0\n  5  6  1  0  0  0  0\n  3  8  2  0  0  0  0\n 16 19  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)[C@H]1CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OC(=O)C",
        "formula": "C23H34O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "358.5151",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0687afde-eae3-40ed-b98f-5a85eb51f5d5",
          "b252f39b-8167-4ec1-be26-55d63f2a0803"
        ],
        "stereo_centers": 7
      },
      "unii": "0G0WWV404B"
    }
  ]
}