{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "72593812-8e0d-4de4-b30c-2315273b3bbe",
          "code": "7758-04-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7758-04-5",
          "code_system": "CAS",
          "references": [
            "16e33361-a5c1-462a-88ef-b1639d227aab",
            "dd780494-5e63-48b2-a936-aab58a758179"
          ]
        },
        {
          "uuid": "36bdc78f-3b7d-4f68-838b-6a8c6eea5c62",
          "code": "23675766",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23675766",
          "code_system": "PUBCHEM",
          "references": [
            "16e33361-a5c1-462a-88ef-b1639d227aab"
          ]
        },
        {
          "uuid": "5ff54f4c-e330-c6a6-061e-9f28459f3977",
          "code": "1239",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1239",
          "code_system": "HSDB",
          "references": [
            "07e7ca3c-5b9c-f72b-5faa-db5c57541862"
          ]
        },
        {
          "uuid": "b5bb0989-4267-4cb1-9e77-aff7de7eefe4",
          "code": "0DS7R9NQB0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bd21a381-6706-cdee-5071-19d253202fd5",
          "code": "DTXSID60228248",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60228248",
          "code_system": "EPA CompTox",
          "references": [
            "ce4c6e96-092d-2eea-d290-82732dbba96a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "60c5ff63-62ab-4a3c-b7f0-12a63b4dee47",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e9a75a91-17bd-4fea-9f12-1cf5e901da34",
            "refuuid": "6acf30b2-7157-4866-8ce3-135d1ed80748",
            "name": "CYCLAMIC ACID",
            "unii": "HN3OFO5036",
            "linking_id": "HN3OFO5036",
            "ref_pname": "CYCLAMIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bd3fac41-04c4-40b8-8c9a-063242561fbd",
          "name": "CYCLAMATE POTASSIUM",
          "stdName": "CYCLAMATE POTASSIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9599a49a-4be0-403c-9723-6baabb0f8420",
            "51e3dbdf-2bbc-4cbb-940c-8458b0ca78b6"
          ],
          "display_name": false
        },
        {
          "uuid": "652a16ed-f3f3-4963-b559-06f130386b0b",
          "name": "MONOPOTASSIUM CYCLOHEXANESULFAMATE",
          "stdName": "MONOPOTASSIUM CYCLOHEXANESULFAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9599a49a-4be0-403c-9723-6baabb0f8420",
            "51e3dbdf-2bbc-4cbb-940c-8458b0ca78b6"
          ],
          "display_name": false
        },
        {
          "uuid": "93a52a8a-59d2-4848-8da8-6d19e2a6e2f5",
          "name": "POTASSIUM CYCLAMATE",
          "stdName": "POTASSIUM CYCLAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9599a49a-4be0-403c-9723-6baabb0f8420",
            "48eb7a3c-a152-40c4-9c13-1eff67eb07b8",
            "22f189b6-ff35-452e-ad54-8d6a8923c190",
            "cf94ab63-1fec-4544-ac1e-41a9615f688f",
            "51e3dbdf-2bbc-4cbb-940c-8458b0ca78b6",
            "dad585fc-1586-4bcf-bcd2-940c92e766c4"
          ],
          "display_name": true
        },
        {
          "uuid": "9be99c99-ddfc-4b60-acb5-d751eeb133c9",
          "name": "POTASSIUM CYCLAMATE [HSDB]",
          "stdName": "POTASSIUM CYCLAMATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9599a49a-4be0-403c-9723-6baabb0f8420",
            "22f189b6-ff35-452e-ad54-8d6a8923c190"
          ],
          "display_name": false
        },
        {
          "uuid": "223b4c7a-8882-4aa5-a828-ec0feab17f64",
          "name": "POTASSIUM CYCLAMATE [MART.]",
          "stdName": "POTASSIUM CYCLAMATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf94ab63-1fec-4544-ac1e-41a9615f688f"
          ],
          "display_name": false
        },
        {
          "uuid": "a589a1bf-df16-44fc-ab86-cce800e95d1f",
          "name": "POTASSIUM CYCLOHEXYLSULFAMATE",
          "stdName": "POTASSIUM CYCLOHEXYLSULFAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9599a49a-4be0-403c-9723-6baabb0f8420",
            "1acb7dcd-7a2a-4e68-b40d-ad9a5aff6469"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1acb7dcd-7a2a-4e68-b40d-ad9a5aff6469",
          "citation": "http://www.chemindustry.com/chemicals/0232186.html",
          "url": "http://www.chemindustry.com/chemicals/0232186.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9599a49a-4be0-403c-9723-6baabb0f8420",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51e3dbdf-2bbc-4cbb-940c-8458b0ca78b6",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf94ab63-1fec-4544-ac1e-41a9615f688f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22f189b6-ff35-452e-ad54-8d6a8923c190",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16e33361-a5c1-462a-88ef-b1639d227aab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389730000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b4862e6-f540-47ad-a3ff-528a41950b1f",
          "citation": "SRS import [0DS7R9NQB0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0DS7R9NQB0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389730000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99438cd4-df22-47c8-bc15-8ff0ee548381",
          "citation": "HAWLEYS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48eb7a3c-a152-40c4-9c13-1eff67eb07b8",
          "citation": "POTASSIUM CYCLAMATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dad585fc-1586-4bcf-bcd2-940c92e766c4",
          "citation": "POTASSIUM CYCLAMATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "07e7ca3c-5b9c-f72b-5faa-db5c57541862",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+7758-04-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "03b2690d-a826-28cd-2496-4ba7a0d57ec3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7758-04-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd780494-5e63-48b2-a936-aab58a758179",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ce4c6e96-092d-2eea-d290-82732dbba96a",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e61609f5-94f2-4e95-a0ea-b316bda48e6c",
          "id": "e61609f5-94f2-4e95-a0ea-b316bda48e6c",
          "molfile": "\n  Marvin  01132111552D          \n\n  1  0  0  0  0  0            999 V2000\n    0.0000   -0.3684    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8d41af5d-113d-4adb-8fd0-1c7c14bdf64f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "cafbdf8a-e630-48f6-ae0f-ac24c9c24218",
          "id": "cafbdf8a-e630-48f6-ae0f-ac24c9c24218",
          "molfile": "\n  Marvin  01132110292D          \n\n 11 11  0  0  0  0            999 V2000\n    1.0454   -0.6329    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.6757   -1.1699    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1737   -0.5136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0765   -1.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3994   -1.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1128   -1.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8209   -1.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5523   -1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5523   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8546    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1232   -0.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "C1CCC(CC1)NS(=O)(=O)[O-]",
          "formula": "C6H12NO3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0268eb00-a289-4a79-9e36-abd51a956dee"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "178.2307",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "157f46f1-6b94-419e-99c4-7f36cc7c6b14",
      "version": "6",
      "structure": {
        "id": "f6bffd57-3484-49f8-b757-0baff2a7fb04",
        "molfile": "\n  Marvin  01132112472D          \n\n 12 11  0  0  0  0            999 V2000\n    1.6757   -1.1699    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3994   -1.6109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0454   -0.6329    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1737   -0.5136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0765   -1.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1128   -1.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1232   -0.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8209   -1.6368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5523   -1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8546    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5523   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.3684    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  CHG  2   3  -1  12   1\nM  END",
        "smiles": "C1CCC(CC1)NS(=O)(=O)[O-].[K+]",
        "formula": "C6H12NO3S.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "217.329",
        "optical_activity": "NONE",
        "references": [
          "5b4862e6-f540-47ad-a3ff-528a41950b1f",
          "99438cd4-df22-47c8-bc15-8ff0ee548381"
        ],
        "stereo_centers": 0
      },
      "unii": "0DS7R9NQB0"
    }
  ]
}