{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e9de5805-3aca-48f9-a064-5a1472d1b10c",
          "code": "N06AB04",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Selective serotonin reuptake inhibitors|citalopram",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AB04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "f47ede2b-69c1-4a1d-8224-8d83a5bcc8cb",
          "code": "N0000000109",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Serotonin Transporter Interactions [MoA]|Serotonin Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000109",
          "code_system": "NDF-RT",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "e07ea0f5-41b7-4ffd-a067-bb65445d5cac",
          "code": "N0000175696",
          "comments": "Established Pharmacologic Class [EPC]|Serotonin Reuptake Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175696",
          "code_system": "NDF-RT",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "cf6e79cf-3c37-4ffb-b2fe-c5f1ef118706",
          "code": "QN06AB04",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Selective serotonin reuptake inhibitors|citalopram",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AB04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "23d54f9d-8975-4235-a778-b4c8ca5480b4",
          "code": "59729-33-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=59729-33-8",
          "code_system": "CAS",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7",
            "d47e2de4-d696-4cca-9a40-79b7d10f0932"
          ]
        },
        {
          "uuid": "c717b689-ed8a-4833-9f73-d8780b4c5baf",
          "code": "C61680",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61680",
          "code_system": "NCI_THESAURUS",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "80c87c89-5daa-4c93-b388-ea69242e108b",
          "code": "D015283",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68015283",
          "code_system": "MESH",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "3d3ec2c5-db97-412c-90d0-bd83dc4cfa88",
          "code": "212",
          "comments": "LiverTox|CNS|Antidepressant|SSRI",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Citalopram.htm",
          "code_system": "LIVERTOX",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "31ce3aaa-efc4-4260-bb68-d52c7e3062cb",
          "code": "CITALOPRAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Citalopram",
          "code_system": "WIKIPEDIA",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "79dc055d-9af9-4e52-9fb3-3849365abca5",
          "code": "SUB07485MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "1ed984db-1636-48d8-812b-a480148fb49f",
          "code": "4138",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4138",
          "code_system": "INN",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "0bee28f8-e52e-4323-bccd-64846707032d",
          "code": "261-891-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.247",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "e1358e0b-6918-4ead-8831-33512c104c09",
          "code": "7547",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7547",
          "code_system": "IUPHAR",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "307a3d02-453a-47fc-a3a5-b3e38e902be2",
          "code": "2556",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2556/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "a6c11767-89e7-483e-9bd2-f935c99773d7",
          "code": "m3587",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3587?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "f72f0987-c7d7-429a-a7a1-32a126de7c21",
          "code": "DB00215",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00215",
          "code_system": "DRUG BANK",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "d4835fa8-defe-4c1f-a2a1-da664cd613bc",
          "code": "CHEMBL549",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL549",
          "code_system": "ChEMBL",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "54063505-7e98-4dbf-996d-76cde054daf5",
          "code": "2771",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2771",
          "code_system": "PUBCHEM",
          "references": [
            "81b904d4-928c-41fc-a229-170a80e77ff7"
          ]
        },
        {
          "uuid": "a001d58b-abcb-fdd1-906e-063985cfb2f4",
          "code": "DTXSID8022826",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8022826",
          "code_system": "EPA CompTox",
          "references": [
            "7aff36f7-bee3-0c98-8602-75ac393b6931"
          ]
        },
        {
          "uuid": "5568c56d-51eb-bbd1-721e-e5b22e6a47a2",
          "code": "C94725",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Selective Serotonin Reuptake Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C94725",
          "code_system": "NCI_THESAURUS",
          "references": [
            "eaa8709c-f3c5-1fb0-eb3b-36f68bf5d7d0"
          ]
        },
        {
          "uuid": "4b09350e-9a32-d565-b1f6-53aafe5de82f",
          "code": "C265",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265",
          "code_system": "NCI_THESAURUS",
          "references": [
            "eaa8709c-f3c5-1fb0-eb3b-36f68bf5d7d0"
          ]
        },
        {
          "uuid": "cfadfffb-1a00-40e5-93f3-d39469a9b7c2",
          "code": "0DHU5B8D6V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "03451621-33e6-49cb-16b8-10498b76c601",
          "code": "Citalopram",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM322/",
          "code_system": "LACTMED",
          "references": [
            "eaa8709c-f3c5-1fb0-eb3b-36f68bf5d7d0"
          ]
        },
        {
          "uuid": "48cf7df3-9577-7d35-7f8a-3566738d33b2",
          "code": "663",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/663",
          "code_system": "DRUG CENTRAL",
          "references": [
            "eaa8709c-f3c5-1fb0-eb3b-36f68bf5d7d0"
          ]
        },
        {
          "uuid": "3483f83f-ebc2-81a4-8021-1efef209ec95",
          "code": "3723",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3723",
          "code_system": "CHEBI",
          "references": [
            "eaa8709c-f3c5-1fb0-eb3b-36f68bf5d7d0"
          ]
        },
        {
          "uuid": "97b582c8-cade-417b-59aa-c3ba0587aa5d",
          "code": "100000091311",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a3e20f0c-9822-24eb-5d57-5b4089fb00b8"
          ]
        },
        {
          "uuid": "6e1ae35f-97bf-da58-c88f-d7f94882d86b",
          "code": "0DHU5B8D6V",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0DHU5B8D6V",
          "code_system": "DAILYMED",
          "references": [
            "db073d28-6ef8-aa5a-c21e-f20fb05b88de"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "987ced71-e4ee-4720-af08-16747a33c3fa",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "59deef33-20e0-4757-83d2-9ccd200bed0a",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0dbf924-66dd-4808-9aff-f410e12e3994",
          "citation": "INN Proposed List 37",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL37.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "75dd70d0-2599-48dc-9abe-3da62e541348",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3054bf76-1076-4b24-b72d-36a9d3d92d92",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2aee7cd2-11c4-4c51-be57-1470e45bd64a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b7223f6-a1da-4cd9-8635-703391ea5d64",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa4914b7-bae8-484d-87a8-5143e234d47c",
          "citation": "D07704",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22122a79-6118-4cc3-b12d-a3447103dca9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4f2ca36-b651-47c3-9042-eaf254a7c145",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81b904d4-928c-41fc-a229-170a80e77ff7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dbf5cfc-09ae-4983-bae3-adc93ae51c77",
          "citation": "CHIRALITY\\\\nVOLUME 9, ISSUE 7, PAGES 686?692, 1997",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/(SICI)1520-636X(1997)9:7%3C686::AID-CHIR9%3E3.0.CO;2-5/pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72794803-1ccc-472d-a6ab-8534899b684b",
          "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=6c96373f-6744-49d4-aec5-3720bc993fab#nlm34067-9",
          "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=6c96373f-6744-49d4-aec5-3720bc993fab#nlm34067-9",
          "doc_type": "DRUG PRODUCT LABEL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efdada73-bb89-4700-9350-6ee7979641d2",
          "citation": "JOURNAL OF CHROMATOGRAPHY B: BIOMEDICAL SCIENCES AND APPLICATIONS \\\\nVOLUME 308, 8 JUNE 1984, PAGES 199?208",
          "url": "http://www.sciencedirect.com/science/article/pii/0378434784802091",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "493fe1a0-74b3-4561-a05b-82dc7391eecb",
          "citation": "SRS import [0DHU5B8D6V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0DHU5B8D6V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b197a019-5dc4-4275-a1bb-ee4c39698f12",
          "citation": "CITALOPRAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ff1133c-ff49-45c4-b981-6430c854b96e",
          "citation": "CITALOPRAM [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4fd55d12-0a9b-4b25-b926-db0c67354c41",
          "citation": "CITALOPRAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8176de3a-aa25-4430-acd7-fa30ef944ea7",
          "citation": "CITALOPRAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bba06de8-3bfa-492f-9dbb-2b0dc406a53a",
          "citation": "CITALOPRAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "546ce492-5cb2-452f-a99f-3cbc6f0f579e",
          "citation": "CITALOPRAM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b90e983d-626d-bf16-6311-6d6e41f9fe24",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "7aff36f7-bee3-0c98-8602-75ac393b6931",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59729-33-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dbb796e0-fef6-b65a-3046-1d88db608f3f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+59729-33-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3228731c-5d62-7a0d-09dd-ace4ac5dd4ca",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549311#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "a3e20f0c-9822-24eb-5d57-5b4089fb00b8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "eaa8709c-f3c5-1fb0-eb3b-36f68bf5d7d0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d47e2de4-d696-4cca-9a40-79b7d10f0932",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8a7a8f08-812e-20f3-cd67-d1d2482f74c0",
          "citation": "Yu, Bang-Ning, et al. \"Pharmacokinetics of citalopram in relation to genetic polymorphism of CYP2C19.\" Drug metabolism and disposition 31.10 (2003): 1255-1259.",
          "url": "https://dmd.aspetjournals.org/content/dmd/31/10/1255.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "937d76d6-9856-022c-2107-0dac16deeaf6",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/1998/20822lbl.pdf",
          "doc_type": "FDA APPROVED DRUG LABEL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ec9b763-2db0-4dbb-938e-c737bdb86738",
          "citation": "Psychopharmacology (Berlin) 1985;86(1-2):156",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e944dbcd-aacd-431e-8aea-2e04f7287fad",
          "citation": "Psychopharmacology (Berlin) 1985;86(1-2):156",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b4142c31-f96c-4ae0-82ec-8b042e6f51a7",
          "citation": "Int Clin Psychopharmacol 1987;2(3):225",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ab6d6cf5-164a-4a46-9dca-a9b53fcf9fd5",
          "citation": "J Chromatogr 1990;527(1):226",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "db073d28-6ef8-aa5a-c21e-f20fb05b88de",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d2303b1e-0422-4b74-b40c-58f8bf1c024c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7ce0a473-d153-4850-b20c-a0b61116eba7",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "906f08cd-5b8b-4e2b-9187-a4d74c4ef2cf",
          "citation": "https://www.eurofinsdiscovery.com/catalogmanagement/viewItem/439",
          "url": "https://www.eurofinsdiscovery.com/catalogmanagement/viewItem/439",
          "doc_type": "ASSAY REFERENCE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "45a85de6-b5c0-44f9-8cc8-d633bea50da7",
          "citation": "Kikuchi, Ryota, Sonia M. de Morais, and J. Cory Kalvass. \"In vitro P-glycoprotein efflux ratio can predict the in vivo brain penetration regardless of biopharmaceutics drug disposition classification system class.\" Drug Metabolism and Disposition 41.12 (2013): 2012-2017.",
          "url": "https://dmd.aspetjournals.org/content/dmd/41/12/2012.full.pdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "3dea92c4-acc8-4e8a-b438-6fbcee218f4e",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c99a63dc-6a83-4a32-9871-24a1e5694aa1",
          "id": "c99a63dc-6a83-4a32-9871-24a1e5694aa1",
          "molfile": "\n  Marvin  01132110252D          \n\n 24 26  0  0  0  0            999 V2000\n    2.9433   -0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9433   -1.3790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6379   -1.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2023   -1.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4974   -1.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7564   -1.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0721   -1.3018    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.5506   -0.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1003    0.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6843   -0.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3944    0.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1122   -0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1354   -0.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4330   -1.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6843   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8172    0.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5350    0.7075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2907   -2.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1037   -2.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4716   -2.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0188   -3.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3713   -4.2734    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1826   -3.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1698   -2.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 15  7  1  0  0  0  0\n 18  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 16 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  3  0  0  0  0\n 19 18  1  0  0  0  0\n 24 18  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CN(C)CCCC1(c2ccc(cc2)F)c3ccc(cc3CO1)C#N",
          "formula": "C20H21FN2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4e0a58da-37b5-48af-a10a-5c9eb0d22fa2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "324.3927",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "87ac0121-f698-4b47-b330-7a60e77925f3",
      "version": "39",
      "structure": {
        "id": "138bfcd2-cd18-4990-a30e-a752a35a8e8f",
        "molfile": "\n  Marvin  01132101132D          \n\n 24 26  0  0  0  0            999 V2000\n    0.0721   -1.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6843   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5506   -0.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6843   -0.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5350    0.7075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2907   -2.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8172    0.2907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4330   -1.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1003    0.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3944    0.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1122   -0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1698   -2.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1037   -2.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1354   -0.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0188   -3.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7564   -1.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9433   -1.3790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4716   -2.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1826   -3.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3713   -4.2734    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4974   -1.3558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2023   -1.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9433   -0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6379   -1.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  7  3  0  0  0  0\n  6  1  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  6  2  0  0  0  0\n 14  8  2  0  0  0  0\n 15 18  2  0  0  0  0\n 16  1  1  0  0  0  0\n 17 22  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19 12  2  0  0  0  0\n 20 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 17  1  0  0  0  0\n 24 17  1  0  0  0  0\n  4  9  1  0  0  0  0\n 19 15  1  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
        "smiles": "CN(C)CCCC1(c2ccc(cc2)F)c3ccc(cc3CO1)C#N",
        "formula": "C20H21FN2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "324.3927",
        "optical_activity": "( + / - )",
        "references": [
          "493fe1a0-74b3-4561-a05b-82dc7391eecb",
          "59deef33-20e0-4757-83d2-9ccd200bed0a",
          "a0dbf924-66dd-4808-9aff-f410e12e3994"
        ],
        "stereo_centers": 1
      },
      "unii": "0DHU5B8D6V",
      "relationships": [
        {
          "uuid": "55fba74d-91f6-4554-8727-698dcc2e505a",
          "amount": {
            "uuid": "b0d3de38-82f5-4d13-9309-724debcb96eb"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c0f898c2-a81c-4d37-a70f-a56262bf6479",
            "refuuid": "87ac0121-f698-4b47-b330-7a60e77925f3",
            "name": "CITALOPRAM",
            "unii": "0DHU5B8D6V",
            "linking_id": "0DHU5B8D6V",
            "ref_pname": "CITALOPRAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "95e66d8d-8ef2-4fa3-be63-f3e777e60c3b",
          "amount": {
            "uuid": "fee533a1-7e8e-40b5-bf15-ae17e6924516"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "513efc46-c6c6-4f5c-849f-e51aa0fc000a",
            "refuuid": "84759bcc-9738-445a-a3c0-afb97f8a4696",
            "name": "CITALOPRAM HYDROBROMIDE",
            "unii": "I1E9D14F36",
            "linking_id": "I1E9D14F36",
            "ref_pname": "CITALOPRAM HYDROBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "57608fab-dd6d-42e9-bc72-d615b50cf339",
          "amount": {
            "uuid": "c205bc9b-4fe8-4aed-b213-bd2775a1640f"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "48009d87-69f9-43b9-b286-8a53b6c7b5e1",
            "refuuid": "d7a99099-f1a6-430c-a7bd-e1fd17fd8e24",
            "name": "CITALOPRAM HYDROCHLORIDE",
            "unii": "4DY48G26JY",
            "linking_id": "4DY48G26JY",
            "ref_pname": "CITALOPRAM HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "22c2bc2a-cbd4-4fdd-a3ce-b9a35747f4ed",
          "amount": {
            "uuid": "4418034a-10b3-4197-822e-8a6366ed611d"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "ab6d6cf5-164a-4a46-9dca-a9b53fcf9fd5"
          ],
          "related_substance": {
            "uuid": "7e83e8f4-166c-4933-9a1c-68b73e484c83",
            "refuuid": "c1380989-feb0-40c6-8f2a-984dd5952bf1",
            "name": "DIDESMETHYLCITALOPRAM",
            "unii": "ZE9YVI4ZEE",
            "linking_id": "ZE9YVI4ZEE",
            "ref_pname": "DIDESMETHYLCITALOPRAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "441f4e2a-03c6-4526-95fd-da781e61d891",
          "amount": {
            "uuid": "4b361169-cfb5-4d68-913d-fd6e1e1fb17a"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "e944dbcd-aacd-431e-8aea-2e04f7287fad",
            "b4142c31-f96c-4ae0-82ec-8b042e6f51a7"
          ],
          "related_substance": {
            "uuid": "06e6c9f2-486e-42d0-93e3-755fb59f621c",
            "refuuid": "2ff0faf9-a013-4cac-9fc1-4f7df77a163f",
            "name": "DESMETHYLCITALOPRAM",
            "unii": "3KBX9104IR",
            "linking_id": "3KBX9104IR",
            "ref_pname": "DESMETHYLCITALOPRAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "69349ac9-237c-4c43-9631-c4b2107b37ee",
          "amount": {
            "uuid": "cfa27def-463a-472a-822e-90bab2b3133c"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "72794803-1ccc-472d-a6ab-8534899b684b"
          ],
          "related_substance": {
            "uuid": "c6156833-b1c9-4898-ab80-80d5b34bedcc",
            "refuuid": "03dac30a-ea4f-4f51-b384-66adf8e61ab6",
            "name": "CITALOPRAM NITRILE OXIDE",
            "unii": "5PF4599LDY",
            "linking_id": "5PF4599LDY",
            "ref_pname": "CITALOPRAM NITRILE OXIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9a2de5e8-3ccc-486b-95f4-794bfec79b88",
          "amount": {
            "uuid": "5d4dc584-34f2-48a8-ac07-75f119086b6c"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "72794803-1ccc-472d-a6ab-8534899b684b"
          ],
          "related_substance": {
            "uuid": "952062ea-ad35-4396-96f3-f938257f54ac",
            "refuuid": "f4009cb3-c9c1-4c57-be8a-2c7a81507e74",
            "name": "5-CYANO-1-(4-FLUOROPHENYL)-1,3-DIHYDRO-1-ISOBENZOFURANBUTANOIC ACID",
            "unii": "DK983N4H8X",
            "linking_id": "DK983N4H8X",
            "ref_pname": "5-CYANO-1-(4-FLUOROPHENYL)-1,3-DIHYDRO-1-ISOBENZOFURANBUTANOIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4fd46232-5fa4-4f21-97cb-6d7f8884549d",
          "amount": {
            "uuid": "7e09030d-3e15-4c83-89ca-b9e99313898f"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "d4ee3a0b-2591-4cf9-88a8-df6597a8df05",
            "refuuid": "ff615e62-45f4-4d28-8654-3bd3e9a65fea",
            "name": "CITALOPRAM, (R)-",
            "unii": "1TH2C9NJHL",
            "linking_id": "1TH2C9NJHL",
            "ref_pname": "CITALOPRAM, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "63a4efca-cca7-41c3-8e1c-ee80fd491a2a",
          "amount": {
            "uuid": "6d6927a9-0c10-48ad-b53c-58a2372e5ea4"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f0cc70f7-e65e-45ad-b6fe-034aee11c8df",
            "refuuid": "4b170ecb-6f25-4e1b-93de-29c888bb8a32",
            "name": "ESCITALOPRAM",
            "unii": "4O4S742ANY",
            "linking_id": "4O4S742ANY",
            "ref_pname": "ESCITALOPRAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f28fc161-11ac-48d1-87d4-5020f77420ec",
          "amount": {
            "uuid": "0cafd274-8efb-464e-843c-6d63e5988f28"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "dee8f171-f3d9-4a80-9196-841eb4f2b16f",
            "refuuid": "1b7631ca-84aa-4448-8ca3-466d41de2832",
            "name": "CITALOPRAM OXALATE",
            "unii": "B5RDX2419X",
            "linking_id": "B5RDX2419X",
            "ref_pname": "CITALOPRAM OXALATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d684afa2-097d-4e60-9ff7-9c2c1651e92b",
          "amount": {
            "uuid": "9353f43c-166d-40b6-86b0-189a98a16e5c",
            "average": 80,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "b90e983d-626d-bf16-6311-6d6e41f9fe24"
          ],
          "related_substance": {
            "uuid": "34ce47f6-ffab-4506-b38b-2ed10c9e8f66",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2cbb731f-54ac-4bf3-91ca-c37d6f1012d6",
          "amount": {
            "uuid": "7dd7cf19-5df5-4394-bafa-f3e58cece4a0"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "dee91bde-25cb-467e-94f2-fdc2af18769a",
            "refuuid": "38432094-ffd3-400c-acb8-f3b47d4a6951",
            "name": "1-(4-FLUOROPHENYL)-1-(4-OXOBUTYL)-3H-ISOBENZOFURAN-5-CARBONITRILE",
            "unii": "M29NF68JC8",
            "linking_id": "M29NF68JC8",
            "ref_pname": "1-(4-FLUOROPHENYL)-1-(4-OXOBUTYL)-3H-ISOBENZOFURAN-5-CARBONITRILE"
          }
        },
        {
          "uuid": "cc3b4c4f-019b-437f-af44-968eb64e5234",
          "amount": {
            "uuid": "fdee5b1e-df49-4df0-891a-16f32db775b4",
            "average": 3.8,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "interaction_type": "BINDING",
          "references": [
            "72794803-1ccc-472d-a6ab-8534899b684b",
            "906f08cd-5b8b-4e2b-9187-a4d74c4ef2cf"
          ],
          "related_substance": {
            "uuid": "06cd2481-1a5b-40e6-a6c3-1cdb0dc28ed1",
            "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405",
            "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "unii": "CJZ26L1EGI",
            "linking_id": "CJZ26L1EGI",
            "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "787ed4c4-4a0b-4ac9-bc87-dfcb1b64184d",
          "amount": {
            "uuid": "9d9e9a0f-9913-44d4-95d7-4d9e14e45a2a"
          },
          "comments": "IN VITRO",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "8a7a8f08-812e-20f3-cd67-d1d2482f74c0",
            "937d76d6-9856-022c-2107-0dac16deeaf6"
          ],
          "related_substance": {
            "uuid": "9cacce70-87bf-41b5-8f4b-4e072e0c2e08",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "78ff308f-2ce7-47e6-82d4-e0315cda6992",
          "amount": {
            "uuid": "7486e7e0-9717-4e0d-8c94-8edb81123ce6"
          },
          "comments": "IN VITRO",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "8a7a8f08-812e-20f3-cd67-d1d2482f74c0"
          ],
          "related_substance": {
            "uuid": "3c2ccd4e-fa4d-453f-97c5-6f5409e26e2d",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "840fd10f-0356-4964-af0a-a62b78e7e074",
          "amount": {
            "uuid": "4127fe11-88fe-44c7-91c8-60afb3baa130"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "3dea92c4-acc8-4e8a-b438-6fbcee218f4e"
          ],
          "related_substance": {
            "uuid": "afddb39e-67d7-4dfc-8d6f-f91b6072e500",
            "refuuid": "f463e316-26c9-4d5c-9cad-47172089cedc",
            "name": "N-nitroso-desmethyl-citalopram",
            "unii": "9U82EJ4VMV",
            "linking_id": "9U82EJ4VMV",
            "ref_pname": "N-nitroso-desmethyl-citalopram",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c6d4f14-e14b-4ef7-9358-3628dbb1e81d",
          "amount": {
            "uuid": "8fd9e1d3-81b4-4b09-b845-d57f7f9da796",
            "average": 20.1
          },
          "comments": "in vitro ER in the MDCK-MDR1 cell line from National Institutes of Health. Weak substrate in-vivo.",
          "qualification": "EFFLUX RATIO",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "45a85de6-b5c0-44f9-8cc8-d633bea50da7"
          ],
          "related_substance": {
            "uuid": "49e4a0f9-9373-4b78-8989-6d38450ed7e6",
            "refuuid": "3921aa0b-fd6d-40ec-9c07-d83e5c6f124a",
            "name": "MULTIDRUG RESISTANCE PROTEIN 1",
            "unii": "22ES734693",
            "linking_id": "22ES734693",
            "ref_pname": "MULTIDRUG RESISTANCE PROTEIN 1",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "d3c7deaa-7b2f-4273-9dc9-96184c51db78",
          "name": "1-(3-(DIMETHYLAMINO)PROPYL)-1-(P-FLUOROPHENYL)-5-PHTHALANCARBONITRILE",
          "stdName": "1-(3-(DIMETHYLAMINO)PROPYL)-1-(P-FLUOROPHENYL)-5-PHTHALANCARBONITRILE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deef33-20e0-4757-83d2-9ccd200bed0a"
          ],
          "display_name": false
        },
        {
          "uuid": "9b739bb3-1991-41b2-bb1d-fc786edecfcc",
          "name": "CITADUR",
          "stdName": "CITADUR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b7223f6-a1da-4cd9-8635-703391ea5d64",
            "fa4914b7-bae8-484d-87a8-5143e234d47c"
          ],
          "display_name": false
        },
        {
          "uuid": "476a7d27-a793-4820-bc32-bf8efd8ec2e3",
          "name": "CITALOPRAM",
          "stdName": "CITALOPRAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fd55d12-0a9b-4b25-b926-db0c67354c41",
            "2aee7cd2-11c4-4c51-be57-1470e45bd64a",
            "4ff1133c-ff49-45c4-b981-6430c854b96e",
            "3054bf76-1076-4b24-b72d-36a9d3d92d92",
            "546ce492-5cb2-452f-a99f-3cbc6f0f579e",
            "987ced71-e4ee-4720-af08-16747a33c3fa",
            "8176de3a-aa25-4430-acd7-fa30ef944ea7",
            "22122a79-6118-4cc3-b12d-a3447103dca9",
            "bba06de8-3bfa-492f-9dbb-2b0dc406a53a",
            "a0dbf924-66dd-4808-9aff-f410e12e3994",
            "75dd70d0-2599-48dc-9abe-3da62e541348",
            "e4f2ca36-b651-47c3-9042-eaf254a7c145",
            "b197a019-5dc4-4275-a1bb-ee4c39698f12"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2d82e2b3-7e4f-454a-badc-63740fe1ba48",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "6251e2af-0ccc-4235-a254-e7cb95b6b557",
          "name": "CITALOPRAM [MART.]",
          "stdName": "CITALOPRAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3054bf76-1076-4b24-b72d-36a9d3d92d92"
          ],
          "display_name": false
        },
        {
          "uuid": "4e53fb77-f783-431f-b9d6-ac8c7615d922",
          "name": "CITALOPRAM [MI]",
          "stdName": "CITALOPRAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2aee7cd2-11c4-4c51-be57-1470e45bd64a"
          ],
          "display_name": false
        },
        {
          "uuid": "c9c40db5-1c2e-2337-825e-7c3ce533c803",
          "name": "CITALOPRAM [USP IMPURITY]",
          "stdName": "CITALOPRAM [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75dd70d0-2599-48dc-9abe-3da62e541348"
          ],
          "display_name": false
        },
        {
          "uuid": "64820f9a-2bbb-4efa-9126-ab1a7b1c3d2f",
          "name": "CITALOPRAM [VANDF]",
          "stdName": "CITALOPRAM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4f2ca36-b651-47c3-9042-eaf254a7c145"
          ],
          "display_name": false
        },
        {
          "uuid": "522db1be-8d17-ea36-242a-75c379d52f70",
          "name": "Citalopram [WHO-DD]",
          "stdName": "CITALOPRAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2303b1e-0422-4b74-b40c-58f8bf1c024c"
          ],
          "display_name": false
        },
        {
          "uuid": "a117a510-3959-48cd-ba6a-d6355ffbc839",
          "name": "citalopram [INN]",
          "stdName": "CITALOPRAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0dbf924-66dd-4808-9aff-f410e12e3994"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "8799e5c3-0868-47a6-aa66-ec3a71188184",
          "name": "Biological Half-life",
          "value": {
            "uuid": "fdaaa79f-5187-4809-b002-a94799f28891",
            "high": 48,
            "low": 24,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "3228731c-5d62-7a0d-09dd-ace4ac5dd4ca"
          ]
        },
        {
          "uuid": "abfb72b0-c74b-43f1-a648-c65c1742255d",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "1a9dc80e-4293-462e-b06d-ecca18065ad7",
            "average": 12,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "3228731c-5d62-7a0d-09dd-ace4ac5dd4ca"
          ]
        }
      ],
      "modifications": {
        "uuid": "75d286c3-196f-4bff-bae0-bdb6bf4e4a6c"
      }
    }
  ]
}