{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "119c4b98-f3ed-44ee-bf70-dbedd3ab2991",
          "code": "5131-58-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5131-58-8",
          "code_system": "CAS",
          "references": [
            "c8829e82-91e3-415f-949c-51f8dedb42a9",
            "b629a752-e0a5-4ea8-91bd-a33dacc45769"
          ]
        },
        {
          "uuid": "b73767ce-c4e2-4898-93b6-0e845fbdbe6e",
          "code": "225-876-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.524",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c8829e82-91e3-415f-949c-51f8dedb42a9"
          ]
        },
        {
          "uuid": "d10701a3-a8a0-4ecf-82f5-d07e1af1448e",
          "code": "21208",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21208",
          "code_system": "PUBCHEM",
          "references": [
            "c8829e82-91e3-415f-949c-51f8dedb42a9"
          ]
        },
        {
          "uuid": "422fe308-e11e-e662-9b6b-95c26eb54ea8",
          "code": "6243",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6243",
          "code_system": "HSDB",
          "references": [
            "7bedd52d-0918-67bd-ba43-748ce8fd3920"
          ]
        },
        {
          "uuid": "29276351-06ad-851d-2fdc-42e454c20611",
          "code": "DTXSID1025770",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1025770",
          "code_system": "EPA CompTox",
          "references": [
            "0d1b5739-7a26-5312-1ca1-cd43b4a1e688"
          ]
        },
        {
          "uuid": "96bc57ab-8b09-4a68-bdeb-18641fc7e47d",
          "code": "0D5U5EW62Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d905b095-acd1-3c22-8d3f-8a93d36f5eec",
          "code": "9575",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9575",
          "code_system": "NSC",
          "references": [
            "8c14f086-9ba4-3a4b-a71d-2b61f6e3442d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cfa8a3db-1cd9-4110-9480-302528766081",
          "name": "1,3-BENZENEDIAMINE, 4-NITRO-",
          "stdName": "1,3-BENZENEDIAMINE, 4-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "98b9bf65-806f-4ddc-a165-30609b31d8d6",
          "name": "1,3-DIAMINO-4-NITROBENZENE",
          "stdName": "1,3-DIAMINO-4-NITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "dc7a87ab-bad0-4738-80f6-8ef3ca18a225",
          "name": "2,4-DIAMINONITROBENZENE",
          "stdName": "2,4-DIAMINONITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "02a92e9c-33c0-4d5a-bfe0-160c0b14b964",
          "name": "4-NITRO-1,3-BENZENEDIAMINE",
          "stdName": "4-NITRO-1,3-BENZENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5172e78-4444-4bfd-94ca-9901fdc765a8",
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "4b899fac-4491-48ab-9f95-cc1868ced34c",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "a428b865-e123-412d-ae58-fcee5a685940",
          "name": "4-NITRO-1,3-BENZENEDIAMINE [HSDB]",
          "stdName": "4-NITRO-1,3-BENZENEDIAMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5172e78-4444-4bfd-94ca-9901fdc765a8",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "891c7a8a-6c3e-4126-a11b-25954bd16fde",
          "name": "4-NITRO-1,3-DIAMINOBENZENE",
          "stdName": "4-NITRO-1,3-DIAMINOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "961cbb89-3646-427b-a49c-0333949922e8",
          "name": "4-NITRO-M-PHENYLENEDIAMINE",
          "stdName": "4-NITRO-M-PHENYLENEDIAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ebc3830-4556-4574-b0b4-486ca3158aa6",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a",
            "45658676-ec2b-4f1f-b768-ac5b0e27f549"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "17b78257-d096-440e-b593-85788fb82914",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2f00f5a4-1058-4419-8b9b-5d5f8fcc4027",
          "name": "C.I. 76030",
          "stdName": "C.I. 76030",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "13c0accc-5901-4624-b0f2-abdeb4e76d97",
          "name": "M-PHENYLENEDIAMINE, 4-NITRO-",
          "stdName": "M-PHENYLENEDIAMINE, 4-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "7573d275-f293-4e25-958b-94f9bdeb89e9",
          "name": "NITRO-M-PHENYLENEDIAMINE, 4-",
          "stdName": "NITRO-M-PHENYLENEDIAMINE, 4-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33cb5295-8b3c-4fd4-88f4-6c954ebe427b",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "c9dc74ee-356c-4b62-afc4-eb1b0e7608f2",
          "name": "NSC-9575",
          "stdName": "NSC-9575",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e59744ef-95d1-4f88-9416-25c2dc0343b1",
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a"
          ],
          "display_name": false
        },
        {
          "uuid": "aa7a3089-c50d-48d2-8b5a-67a59ea85ab3",
          "name": "RODOL LY",
          "stdName": "RODOL LY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a",
            "45658676-ec2b-4f1f-b768-ac5b0e27f549"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "45658676-ec2b-4f1f-b768-ac5b0e27f549",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "95ce49a9-bbb0-4902-8ef5-c385ffe27d3a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e59744ef-95d1-4f88-9416-25c2dc0343b1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5172e78-4444-4bfd-94ca-9901fdc765a8",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33cb5295-8b3c-4fd4-88f4-6c954ebe427b",
          "citation": "ICSAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8829e82-91e3-415f-949c-51f8dedb42a9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391408000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a7801b2-ac95-450f-8512-728199b0653f",
          "citation": "SRS import [0D5U5EW62Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0D5U5EW62Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391408000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ebc3830-4556-4574-b0b4-486ca3158aa6",
          "citation": "4-NITRO-M-PHENYLENEDIAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b899fac-4491-48ab-9f95-cc1868ced34c",
          "citation": "4-NITRO-1,3-BENZENEDIAMINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7bedd52d-0918-67bd-ba43-748ce8fd3920",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+5131-58-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d1b5739-7a26-5312-1ca1-cd43b4a1e688",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5131-58-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b629a752-e0a5-4ea8-91bd-a33dacc45769",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8c14f086-9ba4-3a4b-a71d-2b61f6e3442d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "91d636ab-7050-40c8-aa5c-cd86f83c0e3f",
          "id": "91d636ab-7050-40c8-aa5c-cd86f83c0e3f",
          "molfile": "\n  Marvin  01132107342D          \n\n 11 11  0  0  0  0            999 V2000\n    8.4571   -6.3480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7339   -5.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0247   -6.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3064   -5.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3064   -5.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9969   -4.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9969   -3.9146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7339   -5.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5879   -4.7442    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.8603   -5.1800    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.5879   -3.9378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\nM  CHG  2   9   1  10  -1\nM  END",
          "smiles": "c1cc(c(cc1N)N)[N+](=O)[O-]",
          "formula": "C6H7N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "500a91c7-aed4-45d9-8644-3c529eb3c767"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "153.1389",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "93c09e56-19a1-41b5-8f34-7a56724b4167",
      "version": "7",
      "structure": {
        "id": "a6f12b1f-e5a3-4cd4-a00e-e67c7faa9238",
        "molfile": "\n  Marvin  01132108402D          \n\n 11 11  0  0  0  0            999 V2000\n    6.3064   -5.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9969   -4.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7339   -5.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7339   -5.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4571   -6.3480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0247   -6.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3064   -5.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9969   -3.9146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5879   -4.7442    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.8603   -5.1800    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.5879   -3.9378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  1  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\nM  CHG  2   9   1  10  -1\nM  END",
        "smiles": "c1cc(c(cc1N)N)[N+](=O)[O-]",
        "formula": "C6H7N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "153.1389",
        "optical_activity": "NONE",
        "references": [
          "2a7801b2-ac95-450f-8512-728199b0653f",
          "45658676-ec2b-4f1f-b768-ac5b0e27f549"
        ],
        "stereo_centers": 0
      },
      "unii": "0D5U5EW62Z"
    }
  ]
}