{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "deac423d-8270-4035-87d0-0a833e6b4f54",
          "code": "62608",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62608",
          "code_system": "PUBCHEM",
          "references": [
            "99c3b0ad-ad74-4137-a906-f750cedf8102"
          ]
        },
        {
          "uuid": "e5ffe9e3-f8fa-4283-b8f6-9081709639f8",
          "code": "6416-57-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6416-57-5",
          "code_system": "CAS",
          "references": [
            "99c3b0ad-ad74-4137-a906-f750cedf8102",
            "cde2fc6f-ad0f-4cbd-900a-8b99a9ced869"
          ]
        },
        {
          "uuid": "c4d44a08-662c-494c-8b89-c2c99a247550",
          "code": "229-127-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.479",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "99c3b0ad-ad74-4137-a906-f750cedf8102"
          ]
        },
        {
          "uuid": "dda385ee-12eb-bbe6-dcbc-76f245c53789",
          "code": "DTXSID0064339",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0064339",
          "code_system": "EPA CompTox",
          "references": [
            "33f8f611-d2bc-404d-22bd-4c7e6186f22d"
          ]
        },
        {
          "uuid": "e598a184-67f7-c434-9bec-697ba578ddf3",
          "code": "2003383",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2003383/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "895977ce-cde5-0f4b-fc70-b2d686a214bf"
          ]
        },
        {
          "uuid": "8806ec71-c439-4a1d-98c4-842f01c9eb03",
          "code": "0AL30EZ5L1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6116d60e-14f3-aa92-84b6-ae4931c559be",
          "code": "0AL30EZ5L1",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0AL30EZ5L1",
          "code_system": "DAILYMED",
          "references": [
            "74b171eb-4c8a-cd1b-77e1-c401dcff9f12"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f162c368-b0da-4daf-a429-a09a70d52c3d",
          "name": "1,3-BENZENEDIAMINE, 4-(1-NAPHTHALENYLAZO)-",
          "stdName": "1,3-BENZENEDIAMINE, 4-(1-NAPHTHALENYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1598f281-6ce3-4690-946f-5fb6847567b6",
            "36ec59a3-c87e-436f-ad5c-d760145598c1"
          ],
          "display_name": false
        },
        {
          "uuid": "8265a91c-e700-4115-b623-b32e78875745",
          "name": "1,3-BENZENEDIAMINE, 4-(2-(1-NAPHTHALENYL)DIAZENYL)-",
          "stdName": "1,3-BENZENEDIAMINE, 4-(2-(1-NAPHTHALENYL)DIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1598f281-6ce3-4690-946f-5fb6847567b6",
            "36ec59a3-c87e-436f-ad5c-d760145598c1"
          ],
          "display_name": false
        },
        {
          "uuid": "b9b33372-44f9-4b52-a4bb-e67dcf7ad808",
          "name": "C.I. 11285",
          "stdName": "C.I. 11285",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1598f281-6ce3-4690-946f-5fb6847567b6",
            "36ec59a3-c87e-436f-ad5c-d760145598c1"
          ],
          "display_name": false
        },
        {
          "uuid": "8ca5ebdc-edc0-434a-a28f-710d9d04b189",
          "name": "C.I. SOLVENT BROWN 1",
          "stdName": "C.I. SOLVENT BROWN 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1598f281-6ce3-4690-946f-5fb6847567b6",
            "36ec59a3-c87e-436f-ad5c-d760145598c1"
          ],
          "display_name": false
        },
        {
          "uuid": "b6a83c7e-4138-4e74-88bd-c8f3ddcdb6df",
          "name": "FAT BROWN",
          "stdName": "FAT BROWN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1598f281-6ce3-4690-946f-5fb6847567b6",
            "36ec59a3-c87e-436f-ad5c-d760145598c1"
          ],
          "display_name": false
        },
        {
          "uuid": "f5aa6035-9589-402c-aa34-f2a21ae87327",
          "name": "SOLVENT BROWN 1",
          "stdName": "SOLVENT BROWN 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1598f281-6ce3-4690-946f-5fb6847567b6",
            "36ec59a3-c87e-436f-ad5c-d760145598c1"
          ],
          "display_name": true
        },
        {
          "uuid": "64bba83e-34a1-4afc-b2c7-1dd1b1d0721d",
          "name": "SUDAN BROWN RR",
          "stdName": "SUDAN BROWN RR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ae78435-6a6a-41e8-899b-ae4eaf7e2869"
          ],
          "display_name": false
        },
        {
          "uuid": "edabaa52-e7b3-038d-9627-acee39e5aae2",
          "name": "SUDAN BROWN RR [IARC]",
          "stdName": "SUDAN BROWN RR [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "640010d3-b78a-bde7-bea3-041668404644"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5ae78435-6a6a-41e8-899b-ae4eaf7e2869",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1598f281-6ce3-4690-946f-5fb6847567b6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36ec59a3-c87e-436f-ad5c-d760145598c1",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99c3b0ad-ad74-4137-a906-f750cedf8102",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae2a7a95-5c13-4268-bff6-f3a692b4fb90",
          "citation": "SRS import [0AL30EZ5L1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0AL30EZ5L1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84dc0039-a7c3-45df-8852-2ab6937ff065",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33f8f611-d2bc-404d-22bd-4c7e6186f22d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6416-57-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "640010d3-b78a-bde7-bea3-041668404644",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "895977ce-cde5-0f4b-fc70-b2d686a214bf",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "cde2fc6f-ad0f-4cbd-900a-8b99a9ced869",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74b171eb-4c8a-cd1b-77e1-c401dcff9f12",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22e6e992-6ef0-468c-beb2-b702faf98fe4",
          "id": "22e6e992-6ef0-468c-beb2-b702faf98fe4",
          "molfile": "\n  Marvin  01132101572D          \n\n 20 22  0  0  0  0            999 V2000\n    3.4274   -6.8063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1419   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8564   -6.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5708   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5708   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2853   -5.1562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9997   -5.5687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7142   -5.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7142   -4.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4288   -3.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1431   -4.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1431   -5.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8576   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8576   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1431   -6.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4288   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4288   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8564   -5.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8564   -4.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1419   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 20  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 18  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 17  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)cccc2/N=N/c3ccc(cc3N)N",
          "formula": "C16H14N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "06eabd3d-7e1a-43ad-baa5-08dd58a1c19d"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "262.3098",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c41c807-c277-4954-a098-2f9ec651b33d",
      "version": "7",
      "structure": {
        "id": "377b03b1-6319-4e53-a719-a8caf4698ed1",
        "molfile": "\n  Marvin  01132102572D          \n\n 20 22  0  0  0  0            999 V2000\n    4.8564   -4.3313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8564   -5.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5708   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5708   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8564   -6.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1419   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1419   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4274   -6.8063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2853   -5.1562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9997   -5.5687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7142   -5.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7142   -4.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4288   -3.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1431   -4.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1431   -5.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4288   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4288   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1431   -6.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8576   -6.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8576   -5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 11  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)cccc2/N=N/c3ccc(cc3N)N",
        "formula": "C16H14N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "262.3098",
        "optical_activity": "NONE",
        "references": [
          "ae2a7a95-5c13-4268-bff6-f3a692b4fb90",
          "84dc0039-a7c3-45df-8852-2ab6937ff065"
        ],
        "stereo_centers": 0
      },
      "unii": "0AL30EZ5L1"
    }
  ]
}