{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d677ec52-cb34-4f75-b23d-5b8c206b2817",
          "code": "136426-54-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=136426-54-5",
          "code_system": "CAS",
          "references": [
            "105e6d5f-4b1d-4a69-b05e-e0bcd44a5610",
            "cc7cb6a7-5f40-41e7-a71b-e5ede4d24fd8"
          ]
        },
        {
          "uuid": "ca2232bc-4695-4047-ba9b-711be756a7c8",
          "code": "44500",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:29225",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "105e6d5f-4b1d-4a69-b05e-e0bcd44a5610"
          ]
        },
        {
          "uuid": "7fbcd0d3-64a5-41b5-afc0-c69294c872f2",
          "code": "m5496",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5496?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "105e6d5f-4b1d-4a69-b05e-e0bcd44a5610"
          ]
        },
        {
          "uuid": "34c67a0a-b89b-4b19-b62a-9d6afd7f9886",
          "code": "86417",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86417",
          "code_system": "PUBCHEM",
          "references": [
            "105e6d5f-4b1d-4a69-b05e-e0bcd44a5610"
          ]
        },
        {
          "uuid": "0e2b5884-a214-1be3-6744-eefa222b291f",
          "code": "DTXSID5057965",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5057965",
          "code_system": "EPA CompTox",
          "references": [
            "0ea10bbb-8818-d53e-5d6f-a8ba8e965878"
          ]
        },
        {
          "uuid": "8aa9725b-a026-468a-82cc-ab88639fa624",
          "code": "0AE2N0JNI1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "93b6780d-5157-7c4e-7d33-cef0b60a5cd1",
          "code": "83923",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83923",
          "code_system": "CHEBI",
          "references": [
            "1b2175b7-6e0c-0977-4783-0bbbe324b331"
          ]
        },
        {
          "uuid": "7a23de32-c966-8833-8c65-74ce174d7645",
          "code": "fluquinconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fluquinconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "394eeaf5-bd64-c66b-c03a-0cb0517c5648"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bb476eba-ecbe-428e-ab96-f92e1480533e",
          "name": "3-(2,4-DICHLOROPHENYL)-6-FLUORO-2-(1H-1,2,4-TRIAZOL-1-YL)-4(3H)-QUINAZOLINONE",
          "stdName": "3-(2,4-DICHLOROPHENYL)-6-FLUORO-2-(1H-1,2,4-TRIAZOL-1-YL)-4(3H)-QUINAZOLINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e913308-2930-4e15-af04-7be348cfb19f",
            "cc4289b7-12c0-4a6c-9ccb-494467426be6"
          ],
          "display_name": false
        },
        {
          "uuid": "35f34d50-32ce-479b-a8ab-5f575545c011",
          "name": "3-(2,4-DICHLOROPHENYL)-6-FLUORO-2-(1H-1,2,4-TRIAZOL-1-YL)QUINAZOLIN-4(3H)-ONE",
          "stdName": "3-(2,4-DICHLOROPHENYL)-6-FLUORO-2-(1H-1,2,4-TRIAZOL-1-YL)QUINAZOLIN-4(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e913308-2930-4e15-af04-7be348cfb19f",
            "f2a5488d-3e18-4b8e-ae83-22fdbbbe71d6"
          ],
          "display_name": false
        },
        {
          "uuid": "2d896b82-2666-45c3-a085-403e69eed544",
          "name": "CASTELLAN",
          "stdName": "CASTELLAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
            "e53b8d4e-b7e4-41bc-91ee-24564facbf30"
          ],
          "display_name": false
        },
        {
          "uuid": "a259c4d3-5ce4-4932-a7df-7c12731eac60",
          "name": "FLUQUINCONAZOLE",
          "stdName": "FLUQUINCONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
            "3bcc4941-7dc6-4ea5-80f0-cf3d9c25a5ff",
            "4f711167-7eb9-48ca-b624-775192285340",
            "7daff773-81f0-466c-80de-6420f8f4fcc2",
            "020442e7-8d93-4be5-93fb-7a5aa8b97c0d",
            "e724d236-7b4c-4f58-91c3-6cfafac86759"
          ],
          "display_name": true
        },
        {
          "uuid": "cd7566fc-11bb-4dc8-a617-b711a5333674",
          "name": "FLUQUINCONAZOLE [ISO]",
          "stdName": "FLUQUINCONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
            "7daff773-81f0-466c-80de-6420f8f4fcc2"
          ],
          "display_name": false
        },
        {
          "uuid": "969ce30e-69be-4795-9d58-9c9e72753af7",
          "name": "FLUQUINCONAZOLE [MI]",
          "stdName": "FLUQUINCONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
            "e724d236-7b4c-4f58-91c3-6cfafac86759"
          ],
          "display_name": false
        },
        {
          "uuid": "388072ea-b6f7-4c1d-9efd-284bd7eec1eb",
          "name": "JOCKEY",
          "stdName": "JOCKEY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
            "e53b8d4e-b7e4-41bc-91ee-24564facbf30"
          ],
          "display_name": false
        },
        {
          "uuid": "32c6e725-2bc8-4199-9cee-4981c66a4e57",
          "name": "SN-597265",
          "stdName": "SN-597265",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e92c28f1-a491-4a74-ae09-885b7f83f97f",
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2"
          ],
          "display_name": false
        },
        {
          "uuid": "3b19c128-df2c-44c8-b40f-bd75c723a1f3",
          "name": "VISTA",
          "stdName": "VISTA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
            "e53b8d4e-b7e4-41bc-91ee-24564facbf30"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "020442e7-8d93-4be5-93fb-7a5aa8b97c0d",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e913308-2930-4e15-af04-7be348cfb19f",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc4289b7-12c0-4a6c-9ccb-494467426be6",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2a5488d-3e18-4b8e-ae83-22fdbbbe71d6",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e724d236-7b4c-4f58-91c3-6cfafac86759",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51c05c83-1493-4c1e-b59d-8d7e6594d4c2",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e92c28f1-a491-4a74-ae09-885b7f83f97f",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e53b8d4e-b7e4-41bc-91ee-24564facbf30",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7daff773-81f0-466c-80de-6420f8f4fcc2",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "105e6d5f-4b1d-4a69-b05e-e0bcd44a5610",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca952bdb-b4b2-4405-841d-07a7774bb38a",
          "citation": "SRS import [0AE2N0JNI1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0AE2N0JNI1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f13ae98-9f4c-4623-8104-aea8bc26723b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f711167-7eb9-48ca-b624-775192285340",
          "citation": "FLUQUINCONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3bcc4941-7dc6-4ea5-80f0-cf3d9c25a5ff",
          "citation": "FLUQUINCONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ea10bbb-8818-d53e-5d6f-a8ba8e965878",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=136426-54-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "394eeaf5-bd64-c66b-c03a-0cb0517c5648",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "1b2175b7-6e0c-0977-4783-0bbbe324b331",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cc7cb6a7-5f40-41e7-a71b-e5ede4d24fd8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "37d91eae-f64e-4a41-a39e-55cf03e665e3",
          "id": "37d91eae-f64e-4a41-a39e-55cf03e665e3",
          "molfile": "\n  Marvin  01132102582D          \n\n 25 28  0  0  0  0            999 V2000\n    9.3948   -2.1202    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6811   -2.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9624   -2.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -2.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -3.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5315   -3.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5315   -4.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8179   -5.0095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0642   -4.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5081   -5.2951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9269   -6.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7340   -5.8381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -5.0085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -5.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -6.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -7.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2580   -7.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2580   -8.4714    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9686   -7.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9686   -6.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3979   -6.1617    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9624   -4.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6776   -5.0071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9624   -3.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6811   -3.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 25  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 24  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 12  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  1  0  0  0  0\n 14 15  1  0  0  0  0\n 20 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1Cl)Cl)-n2c(=O)c3cc(ccc3nc2-n4cncn4)F",
          "formula": "C16H8Cl2FN5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "071d64ea-03e5-4734-9865-adfc6787ea6d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "376.1725",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b6310cc8-f332-4330-a7e4-db51143c4323",
      "version": "5",
      "structure": {
        "id": "8bd6ee0a-aec9-4fb5-9be0-03a6fd03ea86",
        "molfile": "\n  Marvin  01132107162D          \n\n 25 28  0  0  0  0            999 V2000\n    9.3948   -2.1202    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6811   -2.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9624   -2.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -2.5336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -3.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5315   -3.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5315   -4.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8179   -5.0095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7340   -5.8381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9269   -6.0055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5081   -5.2951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0642   -4.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -5.0085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2502   -5.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -6.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -7.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2580   -7.6464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2580   -8.4714    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9686   -7.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9686   -6.4095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3979   -6.1617    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9624   -4.5960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6776   -5.0071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9624   -3.7710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6811   -3.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 14  2  0  0  0  0\n 20 21  1  0  0  0  0\n 13 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24  5  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25  2  2  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1Cl)Cl)-n2c(=O)c3cc(ccc3nc2-n4cncn4)F",
        "formula": "C16H8Cl2FN5O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "376.1725",
        "optical_activity": "NONE",
        "references": [
          "ca952bdb-b4b2-4405-841d-07a7774bb38a",
          "7f13ae98-9f4c-4623-8104-aea8bc26723b"
        ],
        "stereo_centers": 0
      },
      "unii": "0AE2N0JNI1"
    }
  ]
}