{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6f1d11cc-ae1d-4e25-9ea0-42ba84eff088",
          "code": "85-85-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85-85-8",
          "code_system": "CAS",
          "references": [
            "a7fbb9be-da77-41e5-a726-cf288ab5e214",
            "471e8ec3-1f5d-462e-a0ad-18437e3eb0da"
          ]
        },
        {
          "uuid": "1c4950e5-1bb2-46fa-aa18-264c2e100438",
          "code": "C041728",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67041728",
          "code_system": "MESH",
          "references": [
            "a7fbb9be-da77-41e5-a726-cf288ab5e214"
          ]
        },
        {
          "uuid": "9704419e-b3e1-4831-b09e-9b1070282327",
          "code": "m8377",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8377?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a7fbb9be-da77-41e5-a726-cf288ab5e214"
          ]
        },
        {
          "uuid": "a14c1ae6-6cd4-4f7f-ac88-3e57a491b9da",
          "code": "201-637-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.489",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a7fbb9be-da77-41e5-a726-cf288ab5e214"
          ]
        },
        {
          "uuid": "4f77a040-8af0-41d9-bb61-48c3d2c59136",
          "code": "095B53Y3XV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "066ba049-161c-d5c7-ad8b-02783f103687",
          "code": "5332",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5332",
          "code_system": "NSC",
          "references": [
            "b4468b33-bdc7-cbfc-dbd6-599722798e98"
          ]
        },
        {
          "uuid": "5a110f64-e34b-336d-c5a7-39359aa3f9fe",
          "code": "DTXSID5058933",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5058933",
          "code_system": "EPA CompTox",
          "references": [
            "38ec696c-e9ca-2542-11f5-325b169a3aca"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fa7b5c92-846a-4408-baec-2efd01008f52",
          "name": "1-(2'-PYRIDYLAZO)-2-NAPHTHOL",
          "stdName": "1-(2'-PYRIDYLAZO)-2-NAPHTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "4ba82981-060c-4e44-91d8-cde446f2eace",
          "name": "1-(2-PYRIDYLAZO)-2-HYDROXYNAPHTHALENE",
          "stdName": "1-(2-PYRIDYLAZO)-2-HYDROXYNAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "aaeb832d-f9bf-463d-805c-fb6b95101150",
          "name": "1-(2-PYRIDYLAZO)-2-NAPHTHOL",
          "stdName": "1-(2-PYRIDYLAZO)-2-NAPHTHOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "27e8f826-cc8d-42bd-bc25-9da3b9602cb0"
          ],
          "display_name": true
        },
        {
          "uuid": "aee09e19-9c63-47cf-91d4-3c71a4f31db1",
          "name": "1-(2-PYRIDYLAZO)NAPHTHOL-2",
          "stdName": "1-(2-PYRIDYLAZO)NAPHTHOL-2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "5a46aa5f-2a65-46ee-a417-df74410076dc",
          "name": "1-(PYRIDIN-2-AZO)-2-NAPHTHOL",
          "stdName": "1-(PYRIDIN-2-AZO)-2-NAPHTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "a8f86e9b-c5e5-4a11-bae5-ead515f93f92",
          "name": "2-HYDROXY-1-(2-PYRIDYLAZO)NAPHTHALENE",
          "stdName": "2-HYDROXY-1-(2-PYRIDYLAZO)NAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "17ba0f76-ce3c-43ee-9e92-7abdeac6fb63",
          "name": "2-HYDROXY-1-(PYRIDIN-2-YLDIAZENYL)NAPHTHALENE",
          "stdName": "2-HYDROXY-1-(PYRIDIN-2-YLDIAZENYL)NAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "3aaec7f0-4da6-41fa-a71f-826531288ee3",
          "name": "2-NAPHTHALENOL, 1-(2-PYRIDINYLAZO)-",
          "stdName": "2-NAPHTHALENOL, 1-(2-PYRIDINYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "950af7d5-59b2-4a0c-a9a4-6fbdb6a10203",
          "name": "2-NAPHTHOL, 1-(2-PYRIDYLAZO)-",
          "stdName": "2-NAPHTHOL, 1-(2-PYRIDYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "a8c2ebc0-dcc0-41f7-8ff3-91d98ed410be",
          "name": "NSC-5332",
          "stdName": "NSC-5332",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "de053154-4a04-4178-9659-fd2f0a4c95ce",
          "name": "PAN",
          "stdName": "PAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba",
            "b0a3fe97-ad09-4c6b-ba8b-ff97116e8cfa",
            "d9b3881e-dc7c-423f-b908-c73723011d60"
          ],
          "display_name": false
        },
        {
          "uuid": "083a61ac-794b-4482-b8f9-eeebcc8144e7",
          "name": "PAN (INDICATOR)",
          "stdName": "PAN (INDICATOR)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        },
        {
          "uuid": "1226276a-25fc-44f2-ba19-3d60a72fd2ba",
          "name": "PAN [MI]",
          "stdName": "PAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "d9b3881e-dc7c-423f-b908-c73723011d60"
          ],
          "display_name": false
        },
        {
          "uuid": "d5bbacc1-0d9e-407e-9950-5cbbd4eed278",
          "name": "PYRIDINE, 2-(2-HYDROXY-1-NAPHTHYLAZO)-",
          "stdName": "PYRIDINE, 2-(2-HYDROXY-1-NAPHTHYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c386858d-07fd-426c-a279-e88992ba018a",
            "0011e3df-edbe-423a-b04e-cfe126d883ba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "27e8f826-cc8d-42bd-bc25-9da3b9602cb0",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c386858d-07fd-426c-a279-e88992ba018a",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0011e3df-edbe-423a-b04e-cfe126d883ba",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9b3881e-dc7c-423f-b908-c73723011d60",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7fbb9be-da77-41e5-a726-cf288ab5e214",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391700000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27150279-c4fe-4526-a357-44d0c84c4de7",
          "citation": "SRS import [095B53Y3XV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=095B53Y3XV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391700000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9be7fd77-bec3-442e-a235-466b6683435b",
          "citation": "CHEMID RECORD 85-85-8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0a3fe97-ad09-4c6b-ba8b-ff97116e8cfa",
          "citation": "PAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40657152-a737-9015-f657-567eefb853ec",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85-85-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "471e8ec3-1f5d-462e-a0ad-18437e3eb0da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b4468b33-bdc7-cbfc-dbd6-599722798e98",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "38ec696c-e9ca-2542-11f5-325b169a3aca",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "811bbcbe-7977-4a5d-a996-65e2b8acf26a",
          "id": "811bbcbe-7977-4a5d-a996-65e2b8acf26a",
          "molfile": "\n  Marvin  01132106422D          \n\n 19 21  0  0  0  0            999 V2000\n    1.9865   -0.5179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2779   -0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2779   -1.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5668   -2.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520   -1.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8606   -2.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5717   -1.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5717   -0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8606   -0.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520   -0.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5668   -0.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5668    0.2422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520    0.6673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520    1.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8709    1.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8709    2.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520    3.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5591    2.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5591    1.8577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 11  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccccn3)O",
          "formula": "C15H11N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1c2a5d18-a736-4d1f-b6c5-8841093d9fa8"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "249.2679",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2e11395e-d682-4554-b06a-f9e370a3587f",
      "version": "6",
      "structure": {
        "id": "eb282686-47ae-47f0-886e-3dddacf961c3",
        "molfile": "\n  Marvin  01132112102D          \n\n 19 21  0  0  0  0            999 V2000\n   -0.1520   -0.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5668   -0.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520   -1.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8606   -0.5720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5668    0.2422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2779   -0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5668   -2.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8606   -2.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5717   -0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520    0.6673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2779   -1.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9865   -0.5179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5717   -1.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520    1.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8709    1.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5591    1.8577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8709    2.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5591    2.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1520    3.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 15 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n  7 11  2  0  0  0  0\n  9 13  1  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccccn3)O",
        "formula": "C15H11N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "249.2679",
        "optical_activity": "NONE",
        "references": [
          "27150279-c4fe-4526-a357-44d0c84c4de7",
          "9be7fd77-bec3-442e-a235-466b6683435b"
        ],
        "stereo_centers": 0
      },
      "unii": "095B53Y3XV"
    }
  ]
}