{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "af250e16-f365-4adf-9a84-2cf2ecdf9389", "code": "4259-15-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4259-15-8", "code_system": "CAS", "references": [ "5a5d3ec5-1ccb-4240-8b29-cf894bddc18d", "fe951a85-cd4a-40ba-bf0b-721ca0f38e9e" ] }, { "uuid": "2c857ac1-a4ec-45d1-99e9-ada65236a777", "code": "61339", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61339", "code_system": "PUBCHEM", "references": [ "5a5d3ec5-1ccb-4240-8b29-cf894bddc18d" ] }, { "uuid": "3fcb8392-89a5-42d0-8a52-deccf5ce5441", "code": "224-235-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.032", "code_system": "ECHA (EC/EINECS)", "references": [ "5a5d3ec5-1ccb-4240-8b29-cf894bddc18d" ] }, { "uuid": "529ae7f8-6942-7144-a38d-a76a394357c0", "code": "DTXSID5027566", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5027566", "code_system": "EPA CompTox", "references": [ "b368e9a9-40a7-3193-ce9b-07f75d1f5860" ] }, { "uuid": "7150c16d-8b83-4290-94e9-88ca8deb5061", "code": "08VKE04H4Q", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "23fb7e31-ccdf-4c38-83dd-f6d53d80c864", "name": "1-HEXANOL, 2-ETHYL-, O,O-DIESTER WITH PHOSPHORODITHIOIC ACID, ZINC SALT", "stdName": "1-HEXANOL, 2-ETHYL-, O,O-DIESTER WITH PHOSPHORODITHIOIC ACID, ZINC SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "461ce800-e596-475f-9d89-966d60b88680", "name": "BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATE ZINC SALT", "stdName": "BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATE ZINC SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "c36a0581-8688-495c-b282-03b57a1935a3", "name": "PHOSPHORODITHIOIC ACID, O,O-BIS(2-ETHYLHEXYL) ESTER, ZINC COMPLEX", "stdName": "PHOSPHORODITHIOIC ACID, O,O-BIS(2-ETHYLHEXYL) ESTER, ZINC COMPLEX", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "16e9e3cb-d2f5-4d15-a0b2-a32baf812aa3", "name": "PHOSPHORODITHIOIC ACID, O,O-BIS(2-ETHYLHEXYL) ESTER, ZINC SALT", "stdName": "PHOSPHORODITHIOIC ACID, O,O-BIS(2-ETHYLHEXYL) ESTER, ZINC SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "5411a434-10b4-4b56-8808-99b389dfb046", "name": "PHOSPHORODITHIOIC ACID, O,O-BIS(2-ETHYLHEXYL) ESTER, ZN SALT", "stdName": "PHOSPHORODITHIOIC ACID, O,O-BIS(2-ETHYLHEXYL) ESTER, ZN SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "0ec63dac-edca-4a88-a413-abfc3affdd51", "name": "ZINC BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATE", "stdName": "ZINC BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "5a1ea3af-609c-4fb7-9f75-df6337fc7cfd", "name": "ZINC DI(2-ETHYLHEXYL) DITHIOPHOSPHATE", "stdName": "ZINC DI(2-ETHYLHEXYL) DITHIOPHOSPHATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": true }, { "uuid": "75b3ab86-01ac-4297-8bda-bc49ba30ec74", "name": "ZINC O,O'-DI-2-ETHYLHEXYLDITHIOPHOSPHATE", "stdName": "ZINC O,O'-DI-2-ETHYLHEXYLDITHIOPHOSPHATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "1513de62-7841-4cd6-92fd-7ae06080f150", "name": "ZINC O,O-BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATE", "stdName": "ZINC O,O-BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "5d8daf14-33cb-4426-bebf-243bd1259ee3", "name": "ZINC, BIS(O,O-BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATO-.KAPPA.S,.KAPPA.S')-, (T-4)-", "stdName": "ZINC, BIS(O,O-BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATO-.KAPPA.S,.KAPPA.S')-, (T-4)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0b29fa8e-5e08-4614-9557-bc55836ebb9c" ], "display_name": false }, { "uuid": "3f3c7649-975e-4181-9abc-a44e790024ba", "name": "ZINC, BIS(O,O-BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATO-S,S')-, (T-4)-", "stdName": "ZINC, BIS(O,O-BIS(2-ETHYLHEXYL) PHOSPHORODITHIOATO-S,S')-, (T-4)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false }, { "uuid": "09fb097a-fe37-4cf8-9c4b-c02f7f98c1f1", "name": "ZPTP 3", "stdName": "ZPTP 3", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "16ff1812-df88-4f0a-98f3-ccd54fa34da7" ], "display_name": false } ], "references": [ { "uuid": "0b29fa8e-5e08-4614-9557-bc55836ebb9c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "16ff1812-df88-4f0a-98f3-ccd54fa34da7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5a5d3ec5-1ccb-4240-8b29-cf894bddc18d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392822000, "tags": [ "NOMEN" ] }, { "uuid": "112948dd-7c43-4d51-84d8-32b0e5a1707d", "citation": "SRS import [08VKE04H4Q]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=08VKE04H4Q", "doc_type": "SRS", "public_domain": true, "document_date": 1493392822000, "tags": [ "NOMEN" ] }, { "uuid": "b368e9a9-40a7-3193-ce9b-07f75d1f5860", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4259-15-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fe951a85-cd4a-40ba-bf0b-721ca0f38e9e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "602d79bd-2b7e-4cc1-8198-e3c291c29693", "id": "602d79bd-2b7e-4cc1-8198-e3c291c29693", "molfile": "\n Marvin 01132104582D \n\n 1 0 0 0 0 0 999 V2000\n 14.4370 -4.2034 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Zn+2]", "formula": "Zn", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c78a73df-67d1-4a51-88cb-f45d09eb17db" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "65.3956", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "a22c4206-6a6b-488a-b752-aa281caf6342", "id": "a22c4206-6a6b-488a-b752-aa281caf6342", "molfile": "\n Marvin 01132108252D \n\n 21 20 0 0 0 0 999 V2000\n 5.5089 -0.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -1.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -2.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -3.8537 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.6839 -3.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2714 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -4.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7464 -4.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1589 -5.2919 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5603 -6.0054 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4454 -5.6933 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8725 -4.8682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5748 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2884 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.2884 -4.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0018 -3.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0018 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7266 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4400 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1536 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 18 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COP(=S)(OCC(CC)CCCC)S", "formula": "C16H35O2PS2", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "6c16babf-4163-4035-b4b9-6ccc5fc4edfd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "354.5544", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "c72a18e1-ddba-4070-9dfb-19fb75872cda", "version": "3", "structure": { "id": "3219cb94-d6d1-46d2-984b-623322b6d5e4", "molfile": "\n Marvin 01132102412D \n\n 43 40 0 0 0 0 999 V2000\n 14.4370 -4.2034 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\n 7.5603 -6.0054 0.0000 S 0 5 0 0 0 0 0 0 0 0 0 0\n 6.4454 -5.6933 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2714 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6839 -3.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -0.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -1.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -2.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -3.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -4.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7464 -4.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0018 -3.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2884 -4.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1536 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4400 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7266 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0018 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2884 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5748 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8725 -4.8682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1589 -5.2919 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5603 -6.0054 0.0000 S 0 5 0 0 0 0 0 0 0 0 0 0\n 6.4454 -5.6933 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2714 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6839 -3.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -0.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -1.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -2.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -3.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5089 -3.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9214 -4.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7464 -4.5783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0018 -3.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2884 -4.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1536 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4400 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7266 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0018 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2884 -4.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5748 -5.2919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8725 -4.8682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1589 -5.2919 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 5 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 5 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 14 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 12 1 0 0 0 0\n 22 3 2 0 0 0 0\n 22 2 1 0 0 0 0\n 43 23 1 0 0 0 0\n 43 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 31 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 43 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 40 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 1 0 0 0 0\nM CHG 3 1 2 2 -1 23 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 15 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31\nM SAL 1 12 32 33 34 35 36 37 38 39 40 41 42 43\nM SPA 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SPA 1 6 17 18 19 20 21 22\nM SDI 1 4 3.8514 -6.4254 3.8514 -0.5796\nM SDI 1 4 12.5736 -0.5796 12.5736 -6.4254\nM SMT 1 2\nM END", "smiles": "CCCCC(CC)COP(=S)(OCC(CC)CCCC)[S-].CCCCC(CC)COP(=S)(OCC(CC)CCCC)[S-].[Zn+2]", "formula": "2C16H34O2PS2.Zn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "772.4886", "optical_activity": "UNSPECIFIED", "references": [ "112948dd-7c43-4d51-84d8-32b0e5a1707d", "0b29fa8e-5e08-4614-9557-bc55836ebb9c" ], "stereo_centers": 4 }, "unii": "08VKE04H4Q" } ] }