{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0e283c1b-23ef-4b27-af40-d909bcafcab9",
          "code": "B01AA08",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|ethyl biscoumacetate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B01AA08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "3ec771e4-0f59-4062-bfba-e9ea18ab89fb",
          "code": "QB01AA08",
          "comments": "VATC|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|ethyl biscoumacetate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB01AA08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "741089d1-608e-4572-9a82-396281e29b7d",
          "code": "548-00-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=548-00-5",
          "code_system": "CAS",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119",
            "926253b0-ce99-46d7-bd48-048e8d8734de"
          ]
        },
        {
          "uuid": "4bb83ed2-44c1-4e3d-b29a-f9b37a7ce099",
          "code": "C75157",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75157",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "4f2cc0d7-aa35-4158-b79d-110d44621ea2",
          "code": "D005017",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005017",
          "code_system": "MESH",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "50286802-6778-4938-8d20-f7e0d6c64d6a",
          "code": "SUB07285MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "dd024295-90c3-4a18-8b25-459f846f8c8a",
          "code": "11901",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1627",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "08e7126b-48a8-45f3-b883-a6bae0cf18cc",
          "code": "325",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=325",
          "code_system": "INN",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "0e29204f-9ccb-45e4-b6f4-d36ba8963908",
          "code": "208-940-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.128",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "1503a83e-1111-4025-9bed-afa740ae5b8f",
          "code": "m5095",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5095?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "85801ddd-9cb3-4010-a9a6-b3a9903b68ff",
          "code": "CHEMBL81697",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL81697",
          "code_system": "ChEMBL",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "8ca2b531-cf64-4152-a4e9-bbf917a72a45",
          "code": "54685524",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54685524",
          "code_system": "PUBCHEM",
          "references": [
            "ff61d8cc-5536-40a4-a622-cf38b5727119"
          ]
        },
        {
          "uuid": "73a6938f-c5e7-7ce9-739c-493b7ae08e98",
          "code": "Ethyl biscoumacetate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ethyl_biscoumacetate",
          "code_system": "WIKIPEDIA",
          "references": [
            "36eae062-b108-78f9-d1ad-9f71463324a2"
          ]
        },
        {
          "uuid": "e394eda9-60e9-0dae-faed-517835a42b69",
          "code": "DTXSID3057771",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3057771",
          "code_system": "EPA CompTox",
          "references": [
            "bb207d9e-2c25-c111-0ec2-b4350a6742b8"
          ]
        },
        {
          "uuid": "44f72b17-6745-7bec-c65d-6167d7599a7b",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "96365f04-c923-699a-fd48-e5fbf3df55f6"
          ]
        },
        {
          "uuid": "f13615ce-3f2c-47e5-aa9f-92580519c974",
          "code": "08KL644731",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0a15be16-4759-e95c-5398-abaf962576f4",
          "code": "1091",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1091",
          "code_system": "DRUG CENTRAL",
          "references": [
            "96365f04-c923-699a-fd48-e5fbf3df55f6"
          ]
        },
        {
          "uuid": "ccefd509-7bcd-1984-6648-805444daa62a",
          "code": "DB08794",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08794",
          "code_system": "DRUG BANK",
          "references": [
            "96365f04-c923-699a-fd48-e5fbf3df55f6"
          ]
        },
        {
          "uuid": "5bbf9516-2347-18e3-b4ff-ae135892de33",
          "code": "100000082601",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "52ba1e09-a113-d795-89e0-60f7edec8071"
          ]
        },
        {
          "uuid": "9a3283da-3053-eab4-7528-30ea2cfb16f1",
          "code": "36366",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=36366",
          "code_system": "NSC",
          "references": [
            "963b197b-d7a7-e63c-d40e-b5445008fcde"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9fce9867-2165-40ca-bb39-318f2e6bad5c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c257a9dd-d8f6-4996-a938-6d6a5f0a3ad9",
            "refuuid": "c9ecc15e-2af8-4a24-8fc0-109751f5e026",
            "name": "ETHYL BISCOUMACETATE",
            "unii": "08KL644731",
            "linking_id": "08KL644731",
            "ref_pname": "ETHYL BISCOUMACETATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4786560d-08e8-4a12-96df-6d3ef7579a5f",
          "name": "ETHYL BIS(4-HYDROXY-2-OXO-2H-1-BENZOPYRAN-3-YL)ACETATE",
          "stdName": "ETHYL BIS(4-HYDROXY-2-OXO-2H-1-BENZOPYRAN-3-YL)ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1f7b3ab-a021-4617-beae-7435b8eb3446"
          ],
          "display_name": false
        },
        {
          "uuid": "7fa8f345-7252-4b0a-948b-b1d8b0ded9f4",
          "name": "ETHYL BISCOUMACETATE",
          "stdName": "ETHYL BISCOUMACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2db380b-0947-4c89-ad7b-dd4401dbd7f4",
            "2071438a-e740-4593-b149-acf286bf7d37",
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "e66a5c77-d3ff-4aa4-9545-daf452fb7d92",
            "57c11083-02fc-48a5-be83-ff9f09cab2c0",
            "cf4eff1e-4c4d-4825-b9b5-5b2d5bbea2cb",
            "235ff14e-09f1-4056-9fd8-a3438b77551e",
            "d7bbb29a-9c75-4c01-ae1b-8d47b394e7ee",
            "8365a5be-f0e5-4c55-aff5-0705afa5ed98",
            "e1f7b3ab-a021-4617-beae-7435b8eb3446"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d59e8c85-6311-4635-8f23-5005a8207baf",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e6ccfb0e-f41e-47fd-a694-ad3ff3a56d6d",
          "name": "ETHYL BISCOUMACETATE [MART.]",
          "stdName": "ETHYL BISCOUMACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57c11083-02fc-48a5-be83-ff9f09cab2c0"
          ],
          "display_name": false
        },
        {
          "uuid": "bea9e8dd-be48-49b1-84c7-4c83ab234cf8",
          "name": "ETHYL BISCOUMACETATE [MI]",
          "stdName": "ETHYL BISCOUMACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "8365a5be-f0e5-4c55-aff5-0705afa5ed98"
          ],
          "display_name": false
        },
        {
          "uuid": "87764bae-ebf6-4f3b-9a94-912806863fd6",
          "name": "ETHYLDICOUMAROL",
          "stdName": "ETHYLDICOUMAROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1f7b3ab-a021-4617-beae-7435b8eb3446"
          ],
          "display_name": false
        },
        {
          "uuid": "0d050b77-8b7e-e042-517a-d66bcc563dcf",
          "name": "Ethyl biscoumacetate [WHO-DD]",
          "stdName": "ETHYL BISCOUMACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148222ca-c5a4-2a36-4292-a4b5f4e9f505"
          ],
          "display_name": false
        },
        {
          "uuid": "c856b7f3-643a-4bf0-9e80-3db7b930453b",
          "name": "NEODICUMARINUM",
          "stdName": "NEODICUMARINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "b7e2e19b-05ce-46a3-b3d0-015d9f1ee1c4"
          ],
          "display_name": false
        },
        {
          "uuid": "06ddc029-2792-4f3a-ae67-61c0a8ed93a0",
          "name": "NEODICUMAROL",
          "stdName": "NEODICUMAROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "b7e2e19b-05ce-46a3-b3d0-015d9f1ee1c4"
          ],
          "display_name": false
        },
        {
          "uuid": "426fdf6b-a8ad-4394-a96b-a742a47b6e9e",
          "name": "NSC-36366",
          "stdName": "NSC-36366",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "e5f30f54-6404-4596-a08e-7bd158eedef7"
          ],
          "display_name": false
        },
        {
          "uuid": "a92f12ef-e500-412a-ae08-c6162968cdf6",
          "name": "PELENTAN",
          "stdName": "PELENTAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "b7e2e19b-05ce-46a3-b3d0-015d9f1ee1c4"
          ],
          "display_name": false
        },
        {
          "uuid": "e3b82596-765f-4023-ab73-d650156aa7b4",
          "name": "STABILENE",
          "stdName": "STABILENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "b7e2e19b-05ce-46a3-b3d0-015d9f1ee1c4"
          ],
          "display_name": false
        },
        {
          "uuid": "433a6f77-3c55-4f52-a470-3eea570f2ad7",
          "name": "TROMBARIN",
          "stdName": "TROMBARIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10816ad2-0360-46e6-8079-fc5fe960b31e",
            "b7e2e19b-05ce-46a3-b3d0-015d9f1ee1c4"
          ],
          "display_name": false
        },
        {
          "uuid": "d114f778-4f82-4f4e-a502-7674a8566181",
          "name": "TROMEXAN",
          "stdName": "TROMEXAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f165990b-480a-43ce-bbfd-44d555f2bdfb",
            "10816ad2-0360-46e6-8079-fc5fe960b31e"
          ],
          "display_name": false
        },
        {
          "uuid": "7a9799d8-6d19-4cf7-9d7a-bd7061f2494b",
          "name": "ethyl biscoumacetate [INN]",
          "stdName": "ETHYL BISCOUMACETATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e66a5c77-d3ff-4aa4-9545-daf452fb7d92"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e1f7b3ab-a021-4617-beae-7435b8eb3446",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e66a5c77-d3ff-4aa4-9545-daf452fb7d92",
          "citation": "INN Proposed List 4",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL04.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "57c11083-02fc-48a5-be83-ff9f09cab2c0",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8365a5be-f0e5-4c55-aff5-0705afa5ed98",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10816ad2-0360-46e6-8079-fc5fe960b31e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2db380b-0947-4c89-ad7b-dd4401dbd7f4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7e2e19b-05ce-46a3-b3d0-015d9f1ee1c4",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f165990b-480a-43ce-bbfd-44d555f2bdfb",
          "citation": "JPET May 1953 vol. 108 no. 1 33-4",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5f30f54-6404-4596-a08e-7bd158eedef7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff61d8cc-5536-40a4-a622-cf38b5727119",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390556000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d617b9c3-2f4b-4bbc-8a19-aab2027697aa",
          "citation": "SRS import [08KL644731]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=08KL644731",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390556000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c80b5790-8aae-42fa-92a3-cc08ebcb85a3",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2071438a-e740-4593-b149-acf286bf7d37",
          "citation": "ETHYL BISCOUMACETATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "235ff14e-09f1-4056-9fd8-a3438b77551e",
          "citation": "ETHYL BISCOUMACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7bbb29a-9c75-4c01-ae1b-8d47b394e7ee",
          "citation": "ETHYL BISCOUMACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cf4eff1e-4c4d-4825-b9b5-5b2d5bbea2cb",
          "citation": "ETHYL BISCOUMACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36eae062-b108-78f9-d1ad-9f71463324a2",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Ethyl_biscoumacetate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bb207d9e-2c25-c111-0ec2-b4350a6742b8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=548-00-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "52ba1e09-a113-d795-89e0-60f7edec8071",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "96365f04-c923-699a-fd48-e5fbf3df55f6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "926253b0-ce99-46d7-bd48-048e8d8734de",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "148222ca-c5a4-2a36-4292-a4b5f4e9f505",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "963b197b-d7a7-e63c-d40e-b5445008fcde",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "10d606d7-9cdb-4771-bd56-3c6f69043c2a",
          "id": "10d606d7-9cdb-4771-bd56-3c6f69043c2a",
          "molfile": "\n  Marvin  01132101062D          \n\n 30 33  0  0  0  0            999 V2000\n    3.8097    0.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0956   -0.0555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0956   -0.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3766   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6803   -0.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3766   -2.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4532   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4532   -3.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1521   -3.8929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7342   -3.9131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0151   -3.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7014   -3.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4053   -3.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4053   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7014   -2.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0151   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7342   -2.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7493   -1.5516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3025   -2.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2874   -3.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5835   -3.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -3.9005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7255   -3.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4369   -3.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1408   -3.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1408   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4445   -2.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7255   -2.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -2.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0216   -1.5592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 19  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 17  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 20 19  2  0  0  0  0\n 29 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 28  2  0  0  0  0\n 25 24  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 29  2  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C(c1c(=O)c2ccccc2oc1O)c3c(=O)c4ccccc4oc3O",
          "formula": "C22H16O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bce2593a-618d-4601-95a0-ae8416fb99e3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "408.3585",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c9ecc15e-2af8-4a24-8fc0-109751f5e026",
      "version": "14",
      "structure": {
        "id": "86579cf9-ad97-4dad-a5a6-ac9c44ddcf55",
        "molfile": "\n  Marvin  01132106582D          \n\n 30 33  0  0  0  0            999 V2000\n    1.4532   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3025   -2.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7342   -2.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -2.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4532   -3.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2874   -3.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3766   -2.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -3.9005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7342   -3.9131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0151   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7255   -2.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7255   -3.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0151   -3.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3766   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1521   -3.8929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5835   -3.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6803   -0.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7493   -1.5516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0216   -1.5592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0956   -0.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7014   -2.2656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4445   -2.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7014   -3.9131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4369   -3.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0956   -0.0555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1408   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4053   -2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1408   -3.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4053   -3.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8097    0.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  7  1  0  0  0  0\n 15  5  2  0  0  0  0\n 16  6  2  0  0  0  0\n 17 14  2  0  0  0  0\n 18  3  1  0  0  0  0\n 19  4  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 10  1  0  0  0  0\n 22 11  1  0  0  0  0\n 23 13  1  0  0  0  0\n 24 12  1  0  0  0  0\n 25 20  1  0  0  0  0\n 26 22  2  0  0  0  0\n 27 21  2  0  0  0  0\n 28 24  2  0  0  0  0\n 29 23  2  0  0  0  0\n 30 25  1  0  0  0  0\n 13 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 29 27  1  0  0  0  0\n 28 26  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C(c1c(c2ccccc2oc1=O)O)c3c(c4ccccc4oc3=O)O",
        "formula": "C22H16O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "408.3585",
        "optical_activity": "NONE",
        "references": [
          "c80b5790-8aae-42fa-92a3-cc08ebcb85a3",
          "d617b9c3-2f4b-4bbc-8a19-aab2027697aa",
          "e66a5c77-d3ff-4aa4-9545-daf452fb7d92"
        ],
        "stereo_centers": 0
      },
      "unii": "08KL644731"
    }
  ]
}