{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ec643778-49a6-4e0a-a1a0-1e4d0646b76c",
          "code": "A14AA01",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|androstanolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A14AA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "f58959b9-1cf3-41cf-9c8c-31e760f1468d",
          "code": "QG03BB02",
          "comments": "VATC|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|ANDROGENS|5-androstanon (3) derivatives|androstanolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG03BB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "e7aa8610-0ea7-4668-9a6e-1dec09aba4d2",
          "code": "QA14AA01",
          "comments": "VATC|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|androstanolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA14AA01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "1933a234-5f65-4296-b41d-855fbfbc6620",
          "code": "521-18-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=521-18-6",
          "code_system": "CAS",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b",
            "9c704b39-9d8d-480f-9cb3-7a0112156be5"
          ]
        },
        {
          "uuid": "1dea3821-b39c-465e-911c-cc8de792f6ca",
          "code": "C72098",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72098",
          "code_system": "NCI_THESAURUS",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "ad19b374-27c3-4e55-9e13-1beddaa5fb5f",
          "code": "D013196",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013196",
          "code_system": "MESH",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "ded297c0-b02f-45a7-9dce-165e4a7481b1",
          "code": "DIHYDROTESTOSTERONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dihydrotestosterone",
          "code_system": "WIKIPEDIA",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "9612d424-bc24-442d-9e4a-bc3bcddafb0c",
          "code": "SUB05509MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "b9f73a59-e0e2-47aa-baab-986b17909a09",
          "code": "238",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=238",
          "code_system": "INN",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "1b0fc120-7665-45aa-a9fc-d92143b6afad",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "3bf2b720-e030-40db-9af9-ca7d2d54282a",
          "code": "m10190",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10190?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "28041f3d-8dc0-4ebc-a0de-1fa43cb67961",
          "code": "CHEMBL27769",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL27769",
          "code_system": "ChEMBL",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "98115133-a0da-4ed8-a58a-090bbee22892",
          "code": "10635",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10635",
          "code_system": "PUBCHEM",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "6b761609-5845-45e0-b3bf-5df2436de751",
          "code": "208-307-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.554",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "691675c9-22b2-40ab-b051-806197ad48ed",
          "code": "G03BB02",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|SEX HORMONES AND MODULATORS OF THE GENITAL SYSTEM|ANDROGENS|5-androstanon (3) derivatives|androstanolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G03BB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "48c036e4-5d69-4f61-9d2c-e50ee853f56b"
          ]
        },
        {
          "uuid": "03620a3e-2712-9b8b-110e-e24787fcfe8c",
          "code": "DTXSID9022364",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022364",
          "code_system": "EPA CompTox",
          "references": [
            "0f7231cd-3b6c-b996-d726-11ca2ad36f9d"
          ]
        },
        {
          "uuid": "0fd9ade3-a9ee-920d-2028-40702c4df344",
          "code": "93995",
          "comments": "ORPHAN DRUG|Designated|Treatment of weight loss in AIDS patients with HIV-associated wasting.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=93995",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "1e9b432c-75c8-1c1d-8894-6805116a921e",
          "code": "C243",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Therapeutic Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C243",
          "code_system": "NCI_THESAURUS",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "08107971-f7be-0d04-54ba-49ced1e9d1a7",
          "code": "C2298",
          "comments": "Physiology-Regulatory Factor[C1899]|Hormone[C2315]|Steroid Hormone[C2289]|Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2298",
          "code_system": "NCI_THESAURUS",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "18c2c7e8-189b-7eb3-94f8-4268033543ee",
          "code": "1849-9",
          "comments": "LOINC|ACTIVE|CHEM|Semen|Androstanolone [Mass/volume] in Semen",
          "type": "PRIMARY",
          "url": "https://loinc.org/1849-9/",
          "code_system": "LOINC",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "b7f93055-c266-da99-bbd0-70fc9eab6933",
          "code": "6775-1",
          "comments": "LOINC|DEPRECATED|CHEM|Ser|Deprecated Androstanolone [Mass/volume] in Serum",
          "type": "PRIMARY",
          "url": "https://loinc.org/6775-1/",
          "code_system": "LOINC",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "ae6516f8-ebb1-8cff-b8d8-0ab9ddf3da75",
          "code": "35189-0",
          "comments": "LOINC|DISCOURAGED|CHEM|Ser/Plas|Androstanolone [Mass or Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/35189-0/",
          "code_system": "LOINC",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "f1cc2dbb-ee9a-e4ae-e368-296b414b07d5",
          "code": "1848-1",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Androstanolone [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/1848-1/",
          "code_system": "LOINC",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "2f50ec28-000a-f13e-267b-43a972c2236a",
          "code": "43826-7",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Androstanolone [Presence] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/43826-7/",
          "code_system": "LOINC",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "a6b6a297-f468-8fd8-dd90-3e58a0213f63",
          "code": "15057-3",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Androstanolone [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/15057-3/",
          "code_system": "LOINC",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "ce175d61-4b42-407e-a713-f71eb3b444f1",
          "code": "08J2K08A3Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7ca0e7ea-da04-2883-e691-4ad523368b19",
          "code": "DB02901",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02901",
          "code_system": "DRUG BANK",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "1b25a257-c535-64c8-751c-6bb24b39ef95",
          "code": "747120",
          "comments": "ORPHAN DRUG|Designated|Treatment of micropenis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=747120",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "25ec9092-a0eb-21eb-89eb-2d6e243a6793",
          "code": "3927",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3927",
          "code_system": "DRUG CENTRAL",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "2d59ce94-45a9-3f37-d927-fb0ed644b0da",
          "code": "85278",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:85278",
          "code_system": "CHEBI",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "2a2ec44b-b8e4-71f7-0ee9-f94354e430db",
          "code": "16330",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16330",
          "code_system": "CHEBI",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "566a48f6-8ca9-c896-1c52-498189478f4b",
          "code": "Designer-drugs-Dihydrotestosterone",
          "comments": "Wikipedia|List of designer drugs|Androgens|DHT based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "95c5199b-9670-1674-4649-63d03eb42d36"
          ]
        },
        {
          "uuid": "156904d6-ea61-812d-cd50-80d2f06e20e3",
          "code": "100000086923",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cef2a80f-45ec-9ccb-86dc-3b35ff1cc469"
          ]
        },
        {
          "uuid": "b56536c6-5f25-64a6-6b4e-1f3f15f45487",
          "code": "10972",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10972",
          "code_system": "NSC",
          "references": [
            "08dd3759-3a17-16a7-580c-0c6dc9b599e2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "842031fd-4af3-4b45-8a43-e42added8d9c",
          "amount": {
            "uuid": "565f2f03-05f8-403f-adbf-82bb6d300908"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2de9c19b-4814-47d2-8b2e-46f2e4315273",
            "refuuid": "a3b3fa6d-251e-4196-bf01-134140f54245",
            "name": "ANDROSTANOLONE",
            "unii": "08J2K08A3Y",
            "linking_id": "08J2K08A3Y",
            "ref_pname": "ANDROSTANOLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e109c866-d9ee-49ee-bc94-012be814aa85",
          "amount": {
            "uuid": "56a34284-2116-4204-ae05-5006488d1692"
          },
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "32ac49d9-f848-4add-aa22-50596ab7fa6b",
            "refuuid": "53389a82-61c4-4a11-84b6-1be471e934b3",
            "name": "ANDROGEN RECEPTOR",
            "unii": "EJC4C3UYXH",
            "linking_id": "EJC4C3UYXH",
            "ref_pname": "ANDROGEN RECEPTOR"
          }
        },
        {
          "uuid": "7f9c8f57-9e22-4c61-98b9-ab3b6eee3b10",
          "amount": {
            "uuid": "c47573e6-9d57-417a-b2ac-8e96f85ad846",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "446ecb85-26a6-b5f7-cc8a-72a932a9aa5b"
          ],
          "related_substance": {
            "uuid": "c09176c7-c039-4015-afd7-48655ffc40bb",
            "refuuid": "de5088e3-60d2-48db-8c91-311bd3435f32",
            "name": "TESTOSTERONE",
            "unii": "3XMK78S47O",
            "linking_id": "3XMK78S47O",
            "ref_pname": "TESTOSTERONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f0cc3037-f085-4376-a203-7e635d0a0737",
          "amount": {
            "uuid": "5cb7cbb6-017b-4808-93a7-3c19cf36b971"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "3d3b58b9-293b-41a1-a892-e8b4da0594bc"
          ],
          "related_substance": {
            "uuid": "98a59682-f23e-4207-9145-ce289e040d83",
            "refuuid": "5a1fd35f-e160-4962-a4b5-f86d47afb7e0",
            "name": "TESTOSTERONE UNDECANOATE",
            "unii": "H16A5VCT9C",
            "linking_id": "H16A5VCT9C",
            "ref_pname": "TESTOSTERONE UNDECANOATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a0563706-8ee8-4eb5-87a0-ceec9d2ff184",
          "amount": {
            "uuid": "8ff5ae41-0934-422d-a22e-9de1d6fbcd5a"
          },
          "type": "PRODRUG->METABOLITE ACTIVE",
          "references": [
            "cc23f94f-1084-461c-b733-ac384f5107a0"
          ],
          "related_substance": {
            "uuid": "5173806b-4f9d-4a31-ab1a-fc0c87bef7b6",
            "refuuid": "b7b44d7d-e3f8-4951-a8d7-59ac4d857963",
            "name": "ANDROSTANOLONE VALERATE",
            "unii": "B43U3P3X26",
            "linking_id": "B43U3P3X26",
            "ref_pname": "ANDROSTANOLONE VALERATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19613212-4c59-439b-ae79-35927f0852e3",
          "name": "17.BETA.-HYDROXY-5.ALPHA.-ANDROSTAN-3-ONE",
          "stdName": "17.BETA.-HYDROXY-5.ALPHA.-ANDROSTAN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "267ec4dd-ed93-4033-8d2c-32606e5e2133"
          ],
          "display_name": false
        },
        {
          "uuid": "c11d212d-a67c-4ecf-a75a-de0c0a5d2976",
          "name": "17.BETA.-HYDROXY-5.ALPHA.-ANDROSTANE-3-ONE",
          "stdName": "17.BETA.-HYDROXY-5.ALPHA.-ANDROSTANE-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dc854d8-0903-48b8-b124-0e45cf8af180",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "992685ed-696c-4c32-be5a-bfb50d8bf511",
          "name": "4-DIHYDROTESTOSTERONE",
          "stdName": "4-DIHYDROTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027fbbc3-7e5e-4e2a-b66a-7f356d88fd4a",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "ea54d21d-bd7c-4d25-9c4d-a5e16c5eedc2",
          "name": "5ALPHA-DIHYDROTESTOSTERONE",
          "stdName": "5ALPHA-DIHYDROTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5919636c-8a04-4f77-9cb6-44a9af93349b",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "830dd3fc-af2e-4b58-80c2-c03f609db07d",
          "name": "ANABOLEX",
          "stdName": "ANABOLEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027fbbc3-7e5e-4e2a-b66a-7f356d88fd4a",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "81acfb91-a73a-4fdb-bc82-2ccdf5cd9452",
          "name": "ANDRACTIM",
          "stdName": "ANDRACTIM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e2c49b6-425c-416e-b146-a86e1f2b45e0",
            "450f34ca-5e5d-434c-b7ed-1b5c9fdbe046"
          ],
          "display_name": false
        },
        {
          "uuid": "81ffe181-c76d-4e34-bdee-105140432769",
          "name": "ANDROSTANOLONE",
          "stdName": "ANDROSTANOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9fe53df-d579-4e38-9ca8-31e015211697",
            "62b7f8a5-43ef-4afd-86f7-96b4b3ae4ad6",
            "d0fd0efb-1d51-40d7-b967-b2c58ebd30f7",
            "267ec4dd-ed93-4033-8d2c-32606e5e2133",
            "33092091-03ce-46e5-95ae-b710d6b7c952",
            "f0a67b6e-0ecb-4966-9122-5035c0db611d",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f",
            "088f176c-5be5-44b1-a872-a9c34e00e48b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1481be9d-c706-4f14-bf0c-5a2faef06296",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d71e2f2c-a2b0-4826-8c62-fdb06ee9be0b",
          "name": "ANDROSTANOLONE [MART.]",
          "stdName": "ANDROSTANOLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a67b6e-0ecb-4966-9122-5035c0db611d"
          ],
          "display_name": false
        },
        {
          "uuid": "cd1a994f-6ca4-e2d7-3761-e176f383d8e1",
          "name": "Androstanolone [WHO-DD]",
          "stdName": "ANDROSTANOLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6d90d29-4f0d-4136-0130-f328f9ed31d4"
          ],
          "display_name": false
        },
        {
          "uuid": "03a89518-67a7-41a7-83c1-83bbb866b06e",
          "name": "DIHYDROTESTOSTERONE",
          "stdName": "DIHYDROTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b311894-b322-4b8c-9fcb-030e89fbe2e7"
          ],
          "display_name": false
        },
        {
          "uuid": "eac473a3-e738-4a53-8ab7-b828916a5373",
          "name": "DIHYDROTESTOSTERONE (DHT)",
          "stdName": "DIHYDROTESTOSTERONE (DHT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f3da6d1-d6a0-4bcc-8b51-bce2f2f6003f",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "eb661beb-144c-43cf-89d1-ca83069d5fa7",
          "name": "NEODROL",
          "stdName": "NEODROL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "267ec4dd-ed93-4033-8d2c-32606e5e2133"
          ],
          "display_name": false
        },
        {
          "uuid": "c16e85f5-ee12-4a8f-9fbb-d2a88405244e",
          "name": "NSC-10972",
          "stdName": "NSC-10972",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ac9bac4-f259-4a88-bf33-06ffa4af97ac",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "6fea9923-36df-482c-a735-348924df515e",
          "name": "STANOLONE",
          "stdName": "STANOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3752ac86-4612-42a9-af87-9e767f32f2b9",
            "4deed814-4e1c-4a82-adca-38768b15df92",
            "815434fa-4a9f-4447-a0da-67f7ddba3353",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "2ed697f4-331c-4be4-8fa7-5fe20562bd8c",
          "name": "STANOLONE [MI]",
          "stdName": "STANOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "815434fa-4a9f-4447-a0da-67f7ddba3353",
            "431f4d4e-bd19-49dd-9591-f9dd632fa74f"
          ],
          "display_name": false
        },
        {
          "uuid": "c9e93be1-052d-e653-7ce3-0111c8b50f43",
          "name": "TESTOSTERONE IMPURITY F [EP IMPURITY]",
          "stdName": "TESTOSTERONE IMPURITY F [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "446ecb85-26a6-b5f7-cc8a-72a932a9aa5b"
          ],
          "display_name": false
        },
        {
          "uuid": "8747812c-ac68-4b69-b76d-856b70e16eb4",
          "name": "androstanolone [INN]",
          "stdName": "ANDROSTANOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62b7f8a5-43ef-4afd-86f7-96b4b3ae4ad6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4deed814-4e1c-4a82-adca-38768b15df92",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0b311894-b322-4b8c-9fcb-030e89fbe2e7",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "267ec4dd-ed93-4033-8d2c-32606e5e2133",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62b7f8a5-43ef-4afd-86f7-96b4b3ae4ad6",
          "citation": "INN Proposed List 4",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL04.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0a67b6e-0ecb-4966-9122-5035c0db611d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "815434fa-4a9f-4447-a0da-67f7ddba3353",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "431f4d4e-bd19-49dd-9591-f9dd632fa74f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "450f34ca-5e5d-434c-b7ed-1b5c9fdbe046",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e2c49b6-425c-416e-b146-a86e1f2b45e0",
          "citation": "D07456",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33092091-03ce-46e5-95ae-b710d6b7c952",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f3da6d1-d6a0-4bcc-8b51-bce2f2f6003f",
          "citation": "http://www.accessdata.fda.gov/spl/data/b6cd73a8-8abb-4be4-9174-7215c1096287/b6cd73a8-8abb-4be4-9174-",
          "url": "http://www.accessdata.fda.gov/spl/data/b6cd73a8-8abb-4be4-9174-7215c1096287/b6cd73a8-8abb-4be4-9174-",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "027fbbc3-7e5e-4e2a-b66a-7f356d88fd4a",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5919636c-8a04-4f77-9cb6-44a9af93349b",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dc854d8-0903-48b8-b124-0e45cf8af180",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ac9bac4-f259-4a88-bf33-06ffa4af97ac",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48c036e4-5d69-4f61-9d2c-e50ee853f56b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47174cd3-f5ee-4e40-9797-5c9d6aeadbfe",
          "citation": "SRS import [08J2K08A3Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=08J2K08A3Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "088f176c-5be5-44b1-a872-a9c34e00e48b",
          "citation": "ANDROSTANOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9fe53df-d579-4e38-9ca8-31e015211697",
          "citation": "ANDROSTANOLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3752ac86-4612-42a9-af87-9e767f32f2b9",
          "citation": "STANOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0fd0efb-1d51-40d7-b967-b2c58ebd30f7",
          "citation": "ANDROSTANOLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f7231cd-3b6c-b996-d726-11ca2ad36f9d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=521-18-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cef2a80f-45ec-9ccb-86dc-3b35ff1cc469",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "95c5199b-9670-1674-4649-63d03eb42d36",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "446ecb85-26a6-b5f7-cc8a-72a932a9aa5b",
          "citation": "European Pharmacopoeia Online 9.8, Testosterone Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c704b39-9d8d-480f-9cb3-7a0112156be5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cc23f94f-1084-461c-b733-ac384f5107a0",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08dd3759-3a17-16a7-580c-0c6dc9b599e2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3d3b58b9-293b-41a1-a892-e8b4da0594bc",
          "citation": "Köhn, Frank-Michael, and Wolf-Bernhard Schill. \"A new oral testosterone undecanoate formulation.\" World journal of urology 21.5 (2003): 311-315.",
          "url": "https://link.springer.com/content/pdf/10.1007/s00345-003-0372-x.pdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "f6d90d29-4f0d-4136-0130-f328f9ed31d4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "43fe5eb4-acb3-4179-bfbe-471233e1e800",
          "id": "43fe5eb4-acb3-4179-bfbe-471233e1e800",
          "molfile": "\n  Marvin  08192213422D          \n\n 25 28  0  0  1  0            999 V2000\n   12.3338   -4.4013    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.4730   -3.1661    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.0459   -3.9799    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.4730   -3.9799    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.7609   -4.4013    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.3338   -5.2238    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.7609   -2.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0459   -3.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6189   -3.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7609   -5.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2635   -4.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2635   -2.9074    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.6189   -5.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0459   -5.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9068   -5.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7430   -3.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1890   -5.6364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9068   -4.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3605   -3.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2869   -2.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2548   -2.0849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7521   -3.5788    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4701   -4.8024    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3338   -6.0463    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0459   -4.8024    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n  1 19  1  1  0  0  0\n  2  7  1  0  0  0  0\n 12  2  1  0  0  0  0\n  2 20  1  1  0  0  0\n  2  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n  3 25  1  6  0  0  0\n  4  5  1  0  0  0  0\n 11  4  1  0  0  0  0\n  4 23  1  6  0  0  0\n 10  5  1  0  0  0  0\n  5 22  1  1  0  0  0\n 13  6  1  0  0  0  0\n 14  6  1  0  0  0  0\n  6 24  1  6  0  0  0\n  7  8  1  0  0  0  0\n 18  9  1  0  0  0  0\n 10 14  1  0  0  0  0\n 16 11  1  0  0  0  0\n 12 21  1  1  0  0  0\n 12 16  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 18  1  0  0  0  0\n 17 15  2  0  0  0  0\nM  END",
          "smiles": "C[C@@]12CCC(=O)C[C@]2([H])CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]31[H])O",
          "formula": "C19H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "97336ea0-8692-4efc-aaf9-83d028554420"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "290.441",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a3b3fa6d-251e-4196-bf01-134140f54245",
      "version": "33",
      "structure": {
        "id": "18b63f4c-e199-43d7-89bf-c16bb134937b",
        "molfile": "\n   JSDraw208192213422D\n\n 25 28  0  0  1  0              0 V2000\n   23.3473   -8.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3966   -5.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6952   -7.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3966   -7.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0487   -8.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3473   -9.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0487   -5.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6952   -5.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9940   -7.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0487   -9.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8930   -8.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8930   -5.5036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9940  -10.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6952  -10.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6461   -9.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8007   -6.7579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2873  -10.6695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.6461   -8.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3978   -6.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.5124   -4.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8766   -3.9467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0320   -6.7744    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3911   -9.0907    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3473  -11.4453    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6952   -9.0907    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18  9  1  0  0  0  0\n  1 19  1  1  0  0  0\n  2 20  1  1  0  0  0\n 12 21  1  1  0  0  0\n  5 22  1  1  0  0  0\n  4 23  1  6  0  0  0\n  6 24  1  6  0  0  0\n  3 25  1  6  0  0  0\n 10 14  1  0  0  0  0\n  2  4  1  0  0  0  0\n 15 13  1  0  0  0  0\n 12 16  1  0  0  0  0\nM  END",
        "smiles": "C[C@@]12CCC(=O)C[C@]2([H])CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]31[H])O",
        "formula": "C19H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "290.441",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4deed814-4e1c-4a82-adca-38768b15df92",
          "47174cd3-f5ee-4e40-9797-5c9d6aeadbfe",
          "62b7f8a5-43ef-4afd-86f7-96b4b3ae4ad6"
        ],
        "stereo_centers": 7
      },
      "unii": "08J2K08A3Y"
    }
  ]
}