{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4e69d811-21b0-426f-aefb-ca291eed5de8",
          "code": "2832-40-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2832-40-8",
          "code_system": "CAS",
          "references": [
            "13b1f9ed-f372-40dc-8dac-b04e5c0700f6",
            "dd37b7bb-03ea-41ba-97fe-96ca80145a33"
          ]
        },
        {
          "uuid": "05f4bba9-8485-4ab2-9c2d-17b7445254aa",
          "code": "220-600-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.728",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "13b1f9ed-f372-40dc-8dac-b04e5c0700f6"
          ]
        },
        {
          "uuid": "385ad5c5-5f93-48f0-b118-31fbe8281472",
          "code": "SUB169564",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "13b1f9ed-f372-40dc-8dac-b04e5c0700f6"
          ]
        },
        {
          "uuid": "1e6fd191-6f1c-2f54-8060-427a3ba3c194",
          "code": "4096",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4096",
          "code_system": "HSDB",
          "references": [
            "815376a3-ad8e-a045-330e-b13c1543297d"
          ]
        },
        {
          "uuid": "6a3ced01-a1de-9b6a-4571-302424c2fc6b",
          "code": "DTXSID6021450",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6021450",
          "code_system": "EPA CompTox",
          "references": [
            "be2ce36d-a6b6-1e90-b27a-ad548c03cbdd"
          ]
        },
        {
          "uuid": "b32a5d9a-f425-4760-a5a4-23ee36b7d862",
          "code": "0890872E2E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4da81a0d-2f1e-4d73-a6cd-2e96c6f148b3",
          "code": "53617",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53617",
          "code_system": "CHEBI",
          "references": [
            "16eb5888-ed13-5001-61f1-9acb6c02764b"
          ]
        },
        {
          "uuid": "fcbbef7e-c866-9c22-88f4-e8a9a8387cbc",
          "code": "86126",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:86126",
          "code_system": "CHEBI",
          "references": [
            "16eb5888-ed13-5001-61f1-9acb6c02764b"
          ]
        },
        {
          "uuid": "9ba74b3c-b361-8c86-b0ee-b8efbfb16932",
          "code": "100000159443",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "47174351-5e8f-2768-ae44-4924e2127dc4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fef1a113-44ca-4af9-bdd3-2ecf10364bf1",
          "name": "4-ACETAMIDO-2'-HYDROXY-5'-METHYLAZOBENZENE",
          "stdName": "4-ACETAMIDO-2'-HYDROXY-5'-METHYLAZOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "392af981-f0c9-4992-bbb0-7352ee0fbfdd",
          "name": "ACETAMIDE, N-(4-(2-(2-HYDROXY-5-METHYLPHENYL)DIAZENYL)PHENYL)-",
          "stdName": "ACETAMIDE, N-(4-(2-(2-HYDROXY-5-METHYLPHENYL)DIAZENYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "b4fd995f-ce3a-4752-a863-8a704cfcf6b1",
          "name": "C.I. 11855",
          "stdName": "C.I. 11855",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "8d62cd98-7006-4b7a-96d3-35a4614a6b7e"
          ],
          "display_name": false
        },
        {
          "uuid": "9f809efb-a46c-44a2-89de-918bdb0466ef",
          "name": "C.I. DISPERSE YELLOW 3",
          "stdName": "C.I. DISPERSE YELLOW 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "a240c2e2-b46f-498b-b5b3-46302118fdd8"
          ],
          "display_name": false
        },
        {
          "uuid": "387b63ba-97aa-4f5b-bdce-21b1a2a3bdf9",
          "name": "C.I. SOLVENT YELLOW 77",
          "stdName": "C.I. SOLVENT YELLOW 77",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "29022ae3-e2ea-44cb-8144-6fc9c47c0b5b",
          "name": "C.I. SOLVENT YELLOW 92",
          "stdName": "C.I. SOLVENT YELLOW 92",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "aee999bc-f38b-4996-85d6-7945f9a293d3",
          "name": "C.I. SOLVENT YELLOW 99",
          "stdName": "C.I. SOLVENT YELLOW 99",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "8687435a-83e5-4d25-9d4d-9604ba75157c",
          "name": "C.I.-11855",
          "stdName": "C.I.-11855",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "8d62cd98-7006-4b7a-96d3-35a4614a6b7e"
          ],
          "display_name": false
        },
        {
          "uuid": "f2d762a2-f6ef-4bfd-945d-a529f5f62876",
          "name": "CI 11855",
          "stdName": "CI 11855",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d66ebf0-17a9-498a-8251-c8ec56f76297",
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc"
          ],
          "display_name": false
        },
        {
          "uuid": "3c0c0122-47ee-4a02-bc40-cd06b877c540",
          "name": "CI DISPERSE YELLOW 3",
          "stdName": "CI DISPERSE YELLOW 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8815c766-b219-4303-b378-ef4f9d65d16b",
            "a50eb657-4ec6-4895-aa05-45507b742a83",
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "faa5f084-473c-406a-83fc-a347da838845"
          ],
          "display_name": false
        },
        {
          "uuid": "39825d2c-4025-4347-9160-bc6a4a588eb4",
          "name": "CI DISPERSE YELLOW 3 [HSDB]",
          "stdName": "CI DISPERSE YELLOW 3 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a50eb657-4ec6-4895-aa05-45507b742a83",
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc"
          ],
          "display_name": false
        },
        {
          "uuid": "b53082ea-9274-4b5c-b744-320fc9bd5df3",
          "name": "CI-11855",
          "stdName": "CI-11855",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "8d62cd98-7006-4b7a-96d3-35a4614a6b7e"
          ],
          "display_name": false
        },
        {
          "uuid": "e920a387-667c-41e7-8b1a-50510a0650ac",
          "name": "DIRECT YELLOW G",
          "stdName": "DIRECT YELLOW G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "dab62792-05a9-4ade-9654-636ec7b6555f",
          "name": "DISPERSE YELLOW 3",
          "stdName": "DISPERSE YELLOW 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d66ebf0-17a9-498a-8251-c8ec56f76297",
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc"
          ],
          "display_name": true
        },
        {
          "uuid": "eae7aa41-7728-3658-0372-421fe054325a",
          "name": "DISPERSE YELLOW 3 [IARC]",
          "stdName": "DISPERSE YELLOW 3 [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0216cda-8310-e3e9-7833-8b64cd368c0b"
          ],
          "display_name": false
        },
        {
          "uuid": "f874c5d0-fb5b-4472-b324-622b1e8d0499",
          "name": "DISPERSE YELLOW G",
          "stdName": "DISPERSE YELLOW G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "59b69c31-2819-46d5-ba43-26501ac9c709",
          "name": "DISPERSE YELLOW Z",
          "stdName": "DISPERSE YELLOW Z",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "c4f6bbd9-59e3-4792-9729-89184fdd0570",
          "name": "FAST YELLOW G",
          "stdName": "FAST YELLOW G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "1504044d-05f7-4ad0-900e-eb01ffc7404a"
          ],
          "display_name": false
        },
        {
          "uuid": "a664dc7c-ef89-42dd-a584-de9f514666ab",
          "name": "N-(4-((2-HYDROXY-5-METHYLPHENYL)AZO)PHENYL)ACETAMIDE",
          "stdName": "N-(4-((2-HYDROXY-5-METHYLPHENYL)AZO)PHENYL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
            "8d62cd98-7006-4b7a-96d3-35a4614a6b7e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8815c766-b219-4303-b378-ef4f9d65d16b",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a50eb657-4ec6-4895-aa05-45507b742a83",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c66e0a4-100d-47fc-8ee1-e337ba303dbc",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d62cd98-7006-4b7a-96d3-35a4614a6b7e",
          "citation": "http://www.chemblink.com/products/2832-40-8.htm",
          "url": "http://www.chemblink.com/products/2832-40-8.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d66ebf0-17a9-498a-8251-c8ec56f76297",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1504044d-05f7-4ad0-900e-eb01ffc7404a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a240c2e2-b46f-498b-b5b3-46302118fdd8",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13b1f9ed-f372-40dc-8dac-b04e5c0700f6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6660beb-90d1-42fb-9c66-6d6b918ca08f",
          "citation": "SRS import [0890872E2E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0890872E2E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c3ea44d-46a8-4759-affa-fb2b25465de6",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "faa5f084-473c-406a-83fc-a347da838845",
          "citation": "CI DISPERSE YELLOW 3 [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "815376a3-ad8e-a045-330e-b13c1543297d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2832-40-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "be2ce36d-a6b6-1e90-b27a-ad548c03cbdd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2832-40-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a0216cda-8310-e3e9-7833-8b64cd368c0b",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "16eb5888-ed13-5001-61f1-9acb6c02764b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dd37b7bb-03ea-41ba-97fe-96ca80145a33",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47174351-5e8f-2768-ae44-4924e2127dc4",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c59a587f-4bd0-4049-8c1d-ba0707e0c21b",
          "id": "c59a587f-4bd0-4049-8c1d-ba0707e0c21b",
          "molfile": "\n  Marvin  01132110132D          \n\n 20 21  0  0  0  0            999 V2000\n    8.9417   -5.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3542   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1792   -4.8089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9417   -4.0946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1168   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -3.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8793   -3.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4668   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8793   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6419   -4.0946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2294   -4.8089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4044   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9919   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1669   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7544   -3.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7544   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1669   -5.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9919   -5.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4044   -6.2379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 19  2  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(c(c1)/N=N/c2ccc(cc2)NC(=O)C)O",
          "formula": "C15H15N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0f4ebb52-8e82-4490-adaa-e838cb73e072"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "269.2991",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5cd3dba1-de7e-4f4e-8781-4ebc5e294a4c",
      "version": "9",
      "structure": {
        "id": "44effc1a-186f-4b1f-a37c-296217b41ae4",
        "molfile": "\n  Marvin  01132103382D          \n\n 20 21  0  0  0  0            999 V2000\n    3.1669   -5.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7544   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1669   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9919   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4044   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9919   -5.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4044   -6.2379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2294   -4.8089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6419   -4.0946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4668   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8793   -3.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -3.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1168   -4.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8793   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9417   -4.0946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3542   -4.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9417   -5.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1792   -4.8089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7544   -3.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n  3 20  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(c(c1)/N=N/c2ccc(cc2)NC(=O)C)O",
        "formula": "C15H15N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "269.2991",
        "optical_activity": "NONE",
        "references": [
          "f6660beb-90d1-42fb-9c66-6d6b918ca08f",
          "9c3ea44d-46a8-4759-affa-fb2b25465de6"
        ],
        "stereo_centers": 0
      },
      "unii": "0890872E2E"
    }
  ]
}