{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b0538d42-1f99-4bce-a0e7-26ec24697f21", "code": "6829-55-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6829-55-6", "code_system": "CAS", "references": [ "915bb475-e592-4d3a-8aa1-168fe6e37bdb", "af40882f-cb92-42f7-acd9-eb04e0285074" ] }, { "uuid": "24b322e8-e497-4e0b-882c-f2d552c430e2", "code": "C68318", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68318", "code_system": "NCI_THESAURUS", "references": [ "915bb475-e592-4d3a-8aa1-168fe6e37bdb" ] }, { "uuid": "dacd4b41-6cfb-4185-bc89-f9039b073a88", "code": "SUB33162", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "915bb475-e592-4d3a-8aa1-168fe6e37bdb" ] }, { "uuid": "835da812-897d-4842-9057-d2303a7047fa", "code": "9929901", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9929901", "code_system": "PUBCHEM", "references": [ "915bb475-e592-4d3a-8aa1-168fe6e37bdb" ] }, { "uuid": "36618b65-2fbb-4379-acc7-77711542f7a7", "code": "1424648", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1424648/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "768f6828-2a75-8229-9004-34b223d2377a" ] }, { "uuid": "fe103d9c-909a-ced3-d542-86e02a83a4fc", "code": "87672-2", "comments": "LOINC|ACTIVE|CHEM|XXX|Tocopherol+tocotrienol [Mass/mass] in Unspecified specimen", "type": "PRIMARY", "url": "https://loinc.org/87672-2/", "code_system": "LOINC", "references": [ "0edab77e-1641-cf98-0278-5394c005344a" ] }, { "uuid": "abe8f585-1fd7-4b3a-2ee1-3eea3efa6299", "code": "DB12647", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB12647", "code_system": "DRUG BANK", "references": [ "0edab77e-1641-cf98-0278-5394c005344a" ] }, { "uuid": "cb359e3c-b759-40a3-98b7-d998cc65bfd6", "code": "0867I0N41V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8b862010-f1d9-b10a-391b-2a4d001ea288", "code": "3105 (Number of products:2036)", "comments": "Dietary Supplement Label Database|vitamin|Vitamin E (unspecified)", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3105&item=Vitamin E (unspecified)", "code_system": "DSLD", "references": [ "0edab77e-1641-cf98-0278-5394c005344a" ] }, { "uuid": "7b858e15-2c4d-9b69-995a-e4812fa886ca", "code": "33235", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33235", "code_system": "CHEBI", "references": [ "0edab77e-1641-cf98-0278-5394c005344a" ] }, { "uuid": "722fa732-f3e0-c26c-943b-fb9eb645649c", "code": "0867I0N41V", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0867I0N41V", "code_system": "DAILYMED", "references": [ "afca99f5-552d-1fae-8635-5f32c4645041" ] }, { "uuid": "2075f040-2dbc-3d0c-cfbe-52ca01f77ef9", "code": "100000126121", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "fc73d27f-4675-e617-2902-e2550d954ce8" ] }, { "uuid": "fb250881-b8b3-3ddc-10a2-814c49122599", "code": "DTXSID001021938", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001021938", "code_system": "EPA CompTox", "references": [ "0edab77e-1641-cf98-0278-5394c005344a" ] } ], "relationships": [ { "uuid": "8d85c7d1-f4d8-4369-a132-f5d52c2129a3", "type": "SUB_CONCEPT->SUBSTANCE", "references": [ "768f6828-2a75-8229-9004-34b223d2377a" ], "related_substance": { "uuid": "73919b79-d260-410c-a74e-37cbb60932f3", "refuuid": "913ea0dd-6c46-4eb7-afc6-294e62735d6c", "name": "TOCOTRIENOL, ALPHA", "linking_id": "913ea0dd-6c46-4eb7-afc6-294e62735d6c", "ref_pname": "TOCOTRIENOL, ALPHA", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "e6033045-bc67-4189-bba9-52f9190a08b4", "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2-METHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-", "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2-METHYL-2-(4,8,12-TRIMETHYL-3,7,11-TRIDECATRIENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4c17172e-0cca-4682-9e04-000362b9df23", "f64af057-001a-46f8-9b10-96224e196d8f" ], "display_name": false }, { "uuid": "bd96dbf2-dead-49f1-afb5-db4a294e4581", "name": "TOCOTRIENOL", "stdName": "TOCOTRIENOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4c17172e-0cca-4682-9e04-000362b9df23", "335d3dc4-cb0d-4f9f-97cf-432ebf0a19ac" ], "display_name": true } ], "references": [ { "uuid": "f64af057-001a-46f8-9b10-96224e196d8f", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4c17172e-0cca-4682-9e04-000362b9df23", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "335d3dc4-cb0d-4f9f-97cf-432ebf0a19ac", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "915bb475-e592-4d3a-8aa1-168fe6e37bdb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392562000, "tags": [ "NOMEN" ] }, { "uuid": "eec65f6d-7832-4cf6-8b26-e9a9ad19e1e9", "citation": "SRS import [0867I0N41V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0867I0N41V", "doc_type": "SRS", "public_domain": true, "document_date": 1493392562000, "tags": [ "NOMEN" ] }, { "uuid": "768f6828-2a75-8229-9004-34b223d2377a", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "fc73d27f-4675-e617-2902-e2550d954ce8", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "0edab77e-1641-cf98-0278-5394c005344a", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "af40882f-cb92-42f7-acd9-eb04e0285074", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "afca99f5-552d-1fae-8635-5f32c4645041", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "efa117c3-129d-6604-f36d-0a9bc2a9f9ed", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "057b3ca2-48a4-4d73-bb11-0ef55cb9c41c", "id": "057b3ca2-48a4-4d73-bb11-0ef55cb9c41c", "molfile": "\n Marvin 01132100352D \n\n 28 29 0 0 0 0 999 V2000\n -2.3009 -2.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5796 -1.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5657 -0.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8721 -2.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1509 -1.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5567 -2.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2779 -1.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2918 -0.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9853 -2.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7067 -1.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4141 -2.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1354 -1.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1493 -0.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8429 -2.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5641 -1.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5780 -0.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2994 -0.5240 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.7798 0.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5684 -1.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3783 -1.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9192 -0.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7291 -0.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2700 -0.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0799 -0.5286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0010 0.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1909 0.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6502 -0.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8401 0.0990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 1 0 0 0 0\n 17 28 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 27 21 2 0 0 0 0\n 23 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CCC1(C)CCc2cc(ccc2O1)O)/C)/C)C", "formula": "C26H38O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "37449d7d-6a34-425b-a366-487e9ef00348" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "382.5797", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "648cfe5d-5bb5-4ba9-a61a-15d47e0cb36b", "version": "12", "structure": { "id": "86651c33-3627-4f07-b837-090c4dc47ced", "molfile": "\n Marvin 01132106582D \n\n 28 29 0 0 0 0 999 V2000\n 9.0010 0.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1909 0.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6502 -0.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8401 0.0990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2994 -0.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7798 0.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5780 -0.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5641 -1.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8429 -2.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1354 -1.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4141 -2.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7067 -1.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9853 -2.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2779 -1.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5567 -2.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1509 -1.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8721 -2.0536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5796 -1.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3009 -2.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5657 -0.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2918 -0.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1493 -0.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5684 -1.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3783 -1.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9192 -0.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7291 -0.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2700 -0.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0799 -0.5286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 14 21 1 0 0 0 0\n 10 22 1 0 0 0 0\n 23 5 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 3 25 1 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 1 27 2 0 0 0 0\nM END", "smiles": "CC(=CCC/C(=C/CC/C(=C/CCC1(C)CCc2cc(ccc2O1)O)/C)/C)C", "formula": "C26H38O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "382.5797", "optical_activity": "( + / - )", "references": [ "335d3dc4-cb0d-4f9f-97cf-432ebf0a19ac", "eec65f6d-7832-4cf6-8b26-e9a9ad19e1e9" ], "stereo_centers": 1 }, "unii": "0867I0N41V" } ] }