{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f3fb27a8-2ac2-43a8-a5e1-3c5e5380d50c",
          "code": "824-35-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=824-35-1",
          "code_system": "CAS",
          "references": [
            "f40a9ba4-f098-497d-a608-766563fbb081",
            "2920af09-b19a-4304-9ce8-d54064656773"
          ]
        },
        {
          "uuid": "15746b0f-c45a-4dcf-864d-d18fbca0444b",
          "code": "C513091",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67513091",
          "code_system": "MESH",
          "references": [
            "f40a9ba4-f098-497d-a608-766563fbb081"
          ]
        },
        {
          "uuid": "c3d5f951-269e-4e1d-a92b-bb146c16309d",
          "code": "212-525-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.387",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f40a9ba4-f098-497d-a608-766563fbb081"
          ]
        },
        {
          "uuid": "94cc3d50-7033-42a1-b4d8-8083aea6cb05",
          "code": "C77337",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77337",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f40a9ba4-f098-497d-a608-766563fbb081"
          ]
        },
        {
          "uuid": "9b3cd47a-c6a8-4a56-bde8-48d268c50849",
          "code": "SUB13199MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f40a9ba4-f098-497d-a608-766563fbb081"
          ]
        },
        {
          "uuid": "2bcdb2b9-eab2-99f9-a043-414beb629e03",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f379ddcc-a361-aed9-d4f8-1fefee28e170"
          ]
        },
        {
          "uuid": "dbcbc737-6b00-a17f-932b-f6097f690ec9",
          "code": "517068",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/517068",
          "code_system": "PUBCHEM",
          "references": [
            "ce992914-9e51-e211-0484-7927984a9bd5"
          ]
        },
        {
          "uuid": "7357b327-91db-4c6d-89fb-56c19f2e8888",
          "code": "0841QCS0DK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "56784204-e18e-cc4a-4177-79afe555e035",
          "code": "DTXSID60890489",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60890489",
          "code_system": "EPA CompTox",
          "references": [
            "f379ddcc-a361-aed9-d4f8-1fefee28e170"
          ]
        },
        {
          "uuid": "1071e7c6-c536-ee33-fcc7-580ecb9e40f4",
          "code": "100000076614",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2a354fc5-114b-2151-6f10-5391bb08e9ac"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8bbee5e7-df35-44d8-a733-55a88db67dd2",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "856ca7af-9601-4fb0-8e37-4cfaaaefa9de",
            "refuuid": "77ecc185-155e-4f2d-8b74-81c91be840d2",
            "name": "Salicylic acid",
            "unii": "O414PZ4LPZ",
            "linking_id": "O414PZ4LPZ",
            "ref_pname": "Salicylic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f5c2ded1-16ab-47cc-905d-6bb70429067b",
          "name": "BENZOIC ACID, 2-HYDROXY-, CALCIUM SALT (2:1)",
          "stdName": "BENZOIC ACID, 2-HYDROXY-, CALCIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd3bee81-39c9-4971-84da-5d79d4a13299",
            "0ce9e75a-cecf-4003-91c0-8739d75640b0"
          ],
          "display_name": false
        },
        {
          "uuid": "5bfbdddf-2ab6-4423-b0f9-bdadfabf8605",
          "name": "CALCIUM DISALICYLATE",
          "stdName": "CALCIUM DISALICYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd3bee81-39c9-4971-84da-5d79d4a13299",
            "0ce9e75a-cecf-4003-91c0-8739d75640b0"
          ],
          "display_name": false
        },
        {
          "uuid": "2ead7921-16f2-4acb-8d13-84a027fa9854",
          "name": "CALCIUM SALICYLATE",
          "stdName": "CALCIUM SALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2daa2c23-3dad-4ea4-9c42-5624122bfe15",
            "3c0f880b-d9df-4143-8b30-9f1fcaa3574f",
            "220b0550-71f2-452f-9ac7-f86a9a3109f3",
            "fd3bee81-39c9-4971-84da-5d79d4a13299",
            "90f8c0ac-99bc-4a35-b1d8-b39c40c90ead",
            "3af5e1a6-4abb-449d-8a7e-3dceff97a0af",
            "c48ea5c9-0310-486f-a19f-80fc4391bd5a",
            "0ce9e75a-cecf-4003-91c0-8739d75640b0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "46303a83-0e59-4b41-9fef-f95c41e209c9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "37450f17-db9d-4e25-90e1-406574a8c121",
          "name": "CALCIUM SALICYLATE [II]",
          "stdName": "CALCIUM SALICYLATE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd3bee81-39c9-4971-84da-5d79d4a13299",
            "0ce9e75a-cecf-4003-91c0-8739d75640b0"
          ],
          "display_name": false
        },
        {
          "uuid": "49cf6d89-7369-7112-21d1-b5f84db88677",
          "name": "Calcium salicylate [WHO-DD]",
          "stdName": "CALCIUM SALICYLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ee64627-98f6-8807-cf4f-b685a0d8189d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fd3bee81-39c9-4971-84da-5d79d4a13299",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0ce9e75a-cecf-4003-91c0-8739d75640b0",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2daa2c23-3dad-4ea4-9c42-5624122bfe15",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3af5e1a6-4abb-449d-8a7e-3dceff97a0af",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c48ea5c9-0310-486f-a19f-80fc4391bd5a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f40a9ba4-f098-497d-a608-766563fbb081",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389688000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa360cf3-ef14-4e10-bb09-014a6b7c8f4a",
          "citation": "SRS import [0841QCS0DK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0841QCS0DK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389688000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "220b0550-71f2-452f-9ac7-f86a9a3109f3",
          "citation": "CALCIUM SALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90f8c0ac-99bc-4a35-b1d8-b39c40c90ead",
          "citation": "CALCIUM SALICYLATE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c0f880b-d9df-4143-8b30-9f1fcaa3574f",
          "citation": "CALCIUM SALICYLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a354fc5-114b-2151-6f10-5391bb08e9ac",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "f379ddcc-a361-aed9-d4f8-1fefee28e170",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2920af09-b19a-4304-9ce8-d54064656773",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ce992914-9e51-e211-0484-7927984a9bd5",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6ee64627-98f6-8807-cf4f-b685a0d8189d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "edbd1526-70ca-417a-bfb5-d6a4a2a9915e",
          "id": "edbd1526-70ca-417a-bfb5-d6a4a2a9915e",
          "molfile": "\n  Marvin  01132112182D          \n\n  1  0  0  0  0  0            999 V2000\n    4.8971   -9.8561    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2b3e97b1-ebd8-471a-a857-09fd34e9b370"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4e04d529-5fb4-497f-96de-d6219ffe6549",
          "id": "4e04d529-5fb4-497f-96de-d6219ffe6549",
          "molfile": "\n  Marvin  01132104042D          \n\n 10 10  0  0  0  0            999 V2000\n    1.5809  -11.1181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5941  -10.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8523   -9.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8643   -9.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5600   -8.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2861   -9.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2886   -9.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0055  -10.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7256   -9.8583    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0181  -11.0967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)[O-])O",
          "formula": "C7H5O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "c47b2d1a-e9fb-4dc4-a979-ede905719233"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "137.1131",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d5116090-14bd-4210-aa05-c7856ffe5bad",
      "version": "14",
      "structure": {
        "id": "faf0064d-dde5-4e7f-88bc-2f9bab96047f",
        "molfile": "\n  Marvin  01132113002D          \n\n 21 20  0  0  0  0            999 V2000\n    2.2886   -9.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0055  -10.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5941  -10.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7256   -9.8583    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0181  -11.0967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5809  -11.1181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2861   -9.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8523   -9.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5600   -8.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8643   -9.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8971   -9.8561    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    2.2886   -9.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0055  -10.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5941  -10.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7256   -9.8583    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0181  -11.0967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5809  -11.1181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2861   -9.0462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8523   -9.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5600   -8.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8643   -9.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n 18 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  2  0  0  0  0\n 17 14  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 19  2  0  0  0  0\n 21 20  1  0  0  0  0\nM  CHG  3   4  -1  11   2  15  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   1   2   3   4   5   6   7   8   9  10  12  13  14  15  16\nM  SAL   1  5  17  18  19  20  21\nM  SPA   1 10   1   2   3   4   5   6   7   8   9  10\nM  SDI   1  4    0.4323  -11.5381    0.4323   -8.2298\nM  SDI   1  4    4.1456   -8.2298    4.1456  -11.5381\nM  SMT   1 2\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)[O-])O.c1ccc(c(c1)C(=O)[O-])O.[Ca+2]",
        "formula": "2C7H5O3.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.3042",
        "optical_activity": "NONE",
        "references": [
          "fa360cf3-ef14-4e10-bb09-014a6b7c8f4a",
          "fd3bee81-39c9-4971-84da-5d79d4a13299"
        ],
        "stereo_centers": 0
      },
      "unii": "0841QCS0DK"
    }
  ]
}