{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d0c7c93d-3a0b-423d-8dc7-757beaffd840",
          "code": "126-14-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-14-7",
          "code_system": "CAS",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801",
            "4818ac82-40a1-4704-9a06-f6e795a6c58a"
          ]
        },
        {
          "uuid": "26675a29-d422-4a30-83dc-7e00dd4f8617",
          "code": "C026879",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026879",
          "code_system": "MESH",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "c77d5d98-5e6c-4e0d-b30f-c5555cc3b9e4",
          "code": "SUCROSE OCTAACETATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sucrose_octaacetate",
          "code_system": "WIKIPEDIA",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "04d8dc00-9cf1-4e8a-a60f-5477051c8176",
          "code": "21 CFR 310.536",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.536 Drug products containing active ingredients offered over-the-counter (OTC) for use as a nailbiting or thumbsucking deterrent.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.536",
          "code_system": "CFR",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "2f9bf33e-ffc3-4a47-927a-e86a5675fa85",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "708bc656-1983-4ae2-8186-4514fdabe59b",
          "code": "37296",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/37296/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "85482533-9298-417b-ade1-01831a7b579b",
          "code": "m10283",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10283?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "14320c38-46f1-4af1-82aa-a5d047ed265e",
          "code": "CHEMBL2105790",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105790",
          "code_system": "ChEMBL",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "cf1d7bb8-eac1-4264-a5d6-6b06b746b7a6",
          "code": "SUB15422MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "6c561a0e-ae1f-44c0-8813-be2e2a65399f",
          "code": "204-772-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.339",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "d7a764c6-b84a-4709-9774-a12164e76eea",
          "code": "31340",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31340",
          "code_system": "PUBCHEM",
          "references": [
            "c1c30683-8419-4ebf-9cf1-011d0e0ea801"
          ]
        },
        {
          "uuid": "6ab4ad55-592c-10ec-4288-2d1a467dd441",
          "code": "DTXSID3042423",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3042423",
          "code_system": "EPA CompTox",
          "references": [
            "68d5490e-03c3-db21-c033-c126bb379c21"
          ]
        },
        {
          "uuid": "9ee739f0-e143-45af-9b21-50e2a56d896d",
          "code": "1623615",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1623615",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "76df7c91-2836-c818-4c2b-e261be6ebd75"
          ]
        },
        {
          "uuid": "bf4668c3-ec33-421b-9755-6228f1155e12",
          "code": "07V591057T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c5d40d48-76f1-fccb-f84f-7ce36104e787",
          "code": "07V591057T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=07V591057T",
          "code_system": "DAILYMED",
          "references": [
            "a9622b52-8418-5886-884d-4c89313b0b33"
          ]
        },
        {
          "uuid": "91f007ca-658c-94ce-ad14-3deb8e7fd26c",
          "code": "100000078071",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ce9f7616-327b-e1bf-f837-2db1e1c35170"
          ]
        },
        {
          "uuid": "40c9726a-0e0c-dd6e-ee2e-a864750b4bab",
          "code": "1695",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1695",
          "code_system": "NSC",
          "references": [
            "a49bf399-d3e8-f94c-3c63-c5582dcb8690"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "195e48b1-9e2f-4956-b587-e0c2e555f12a",
          "name": ".ALPHA.-D-GLUCOPYRANOSIDE, 1,3,4,6-TETRA-O-ACETYL-.BETA.-D-FRUCTOFURANOSYL, TETRAACETATE",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSIDE, 1,3,4,6-TETRA-O-ACETYL-.BETA.-D-FRUCTOFURANOSYL, TETRAACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c3ea405-593b-4221-8b7a-e3cd4bdca88c"
          ],
          "display_name": false
        },
        {
          "uuid": "0cbf848b-ddd1-4ab7-97ea-d61c7a53f2ed",
          "name": "FEMA NO. 3038",
          "stdName": "FEMA NO. 3038",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa4ee9fb-5227-45d5-9113-974d08fd31ae"
          ],
          "display_name": false
        },
        {
          "uuid": "fb769911-45b3-485c-9d84-3b7887dd552c",
          "name": "NSC-1695",
          "stdName": "NSC-1695",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ddd6b33-457f-4703-9649-674c4d8b61ea"
          ],
          "display_name": false
        },
        {
          "uuid": "c052e15b-1059-45ad-aeb5-351ff643391e",
          "name": "SUCROSE OCTA-ACETATE",
          "stdName": "SUCROSE OCTA-ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f9a894c-8fe4-4873-902e-e85b946a6adc",
            "5730e7d4-b6ec-4761-913b-61eea94dfd77",
            "986a645c-9151-4eae-985b-68092fd267ef",
            "30142999-44b1-409c-876a-565d892ca8a7",
            "6ee60f03-5ee4-43ba-831e-dea9c0206b00"
          ],
          "display_name": false
        },
        {
          "uuid": "4f342b61-4b01-4280-8a84-af9e9097b3cd",
          "name": "SUCROSE OCTA-ACETATE [MART.]",
          "stdName": "SUCROSE OCTA-ACETATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "986a645c-9151-4eae-985b-68092fd267ef"
          ],
          "display_name": false
        },
        {
          "uuid": "de5ecf90-9162-42bd-9f18-99ae2c84a729",
          "name": "SUCROSE OCTAACETATE",
          "stdName": "SUCROSE OCTAACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d40d5aa-28d0-46bb-a9e4-722afb056e07",
            "9cda22b8-d631-4f31-8273-ab6ddaa5349f",
            "4337ce25-8d9b-4fd6-aa70-d566d3d90ec2",
            "4661804e-75f1-4827-8cf4-a15cff18f774",
            "ed13270b-96e7-4184-b170-ccd74f1509fe",
            "cbffa3f3-18ba-4ebd-95e2-92c9d1e34ce4",
            "aec3506b-0821-4929-b41a-b58c6d60d9b7",
            "62d9aedd-7f3a-44f8-b07d-51949efc8dab",
            "1947149d-36bf-499c-bc94-54e692bcb7e2"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "93647a52-4c8f-4d83-b999-90862c5b77f5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0794909d-110d-48af-a423-cd5919e97d20",
          "name": "SUCROSE OCTAACETATE [FHFI]",
          "stdName": "SUCROSE OCTAACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4661804e-75f1-4827-8cf4-a15cff18f774"
          ],
          "display_name": false
        },
        {
          "uuid": "80b67eec-b091-41cf-97a7-1c6f0d42ae39",
          "name": "SUCROSE OCTAACETATE [MI]",
          "stdName": "SUCROSE OCTAACETATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cda22b8-d631-4f31-8273-ab6ddaa5349f"
          ],
          "display_name": false
        },
        {
          "uuid": "5c0e4e35-82a8-413f-9e65-528765434c9b",
          "name": "SUCROSE OCTAACETATE [USP-RS]",
          "stdName": "SUCROSE OCTAACETATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1947149d-36bf-499c-bc94-54e692bcb7e2"
          ],
          "display_name": false
        },
        {
          "uuid": "6c59bfb0-a64d-cd0c-3b68-af9c676e0a15",
          "name": "Sucrose octa-acetate [WHO-DD]",
          "stdName": "SUCROSE OCTA-ACETATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4bc5f759-b99f-1ac7-bd0d-baf712da12e3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "62d9aedd-7f3a-44f8-b07d-51949efc8dab",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4c3ea405-593b-4221-8b7a-e3cd4bdca88c",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa4ee9fb-5227-45d5-9113-974d08fd31ae",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "986a645c-9151-4eae-985b-68092fd267ef",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9cda22b8-d631-4f31-8273-ab6ddaa5349f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aec3506b-0821-4929-b41a-b58c6d60d9b7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4661804e-75f1-4827-8cf4-a15cff18f774",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1947149d-36bf-499c-bc94-54e692bcb7e2",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30142999-44b1-409c-876a-565d892ca8a7",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ee60f03-5ee4-43ba-831e-dea9c0206b00",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ddd6b33-457f-4703-9649-674c4d8b61ea",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1c30683-8419-4ebf-9cf1-011d0e0ea801",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bff091aa-4662-4ee4-9ef4-6892216c7105",
          "citation": "SRS import [07V591057T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=07V591057T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8706ccb5-6c83-4242-92da-81b64c212bf0",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5730e7d4-b6ec-4761-913b-61eea94dfd77",
          "citation": "SUCROSE OCTA-ACETATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ed13270b-96e7-4184-b170-ccd74f1509fe",
          "citation": "SUCROSE OCTAACETATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cbffa3f3-18ba-4ebd-95e2-92c9d1e34ce4",
          "citation": "SUCROSE OCTAACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d40d5aa-28d0-46bb-a9e4-722afb056e07",
          "citation": "SUCROSE OCTAACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4337ce25-8d9b-4fd6-aa70-d566d3d90ec2",
          "citation": "SUCROSE OCTAACETATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5f9a894c-8fe4-4873-902e-e85b946a6adc",
          "citation": "SUCROSE OCTA-ACETATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68d5490e-03c3-db21-c033-c126bb379c21",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126-14-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ce9f7616-327b-e1bf-f837-2db1e1c35170",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "7563c339-d168-cadb-3ac5-e807d79233e2",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4818ac82-40a1-4704-9a06-f6e795a6c58a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "76df7c91-2836-c818-4c2b-e261be6ebd75",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a49bf399-d3e8-f94c-3c63-c5582dcb8690",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a9622b52-8418-5886-884d-4c89313b0b33",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4bc5f759-b99f-1ac7-bd0d-baf712da12e3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e21b2bc5-5741-47d8-a598-3168c100bb1d",
          "id": "e21b2bc5-5741-47d8-a598-3168c100bb1d",
          "molfile": "\n  Marvin  01132111422D          \n\n 47 48  0  0  1  0            999 V2000\n   10.4594   -4.9501    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.4594   -4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1658   -3.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8817   -4.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8817   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5929   -3.6984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7765   -4.4569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1128   -4.9406    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.1128   -4.1156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3827   -3.6984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3827   -2.8734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0939   -2.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6667   -2.4609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7568   -4.9406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4007   -4.9310    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9882   -4.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1585   -4.2056    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.7507   -3.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1585   -2.7596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7365   -2.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1490   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -2.0484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7412   -4.9216    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.9162   -4.9216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4990   -4.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9067   -3.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6740   -4.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1490   -5.6423    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.7317   -6.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9067   -6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4848   -7.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4848   -5.6281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9835   -5.6423    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3865   -6.3677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3865   -7.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0977   -7.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6659   -7.6005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3735   -5.7181    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8948   -6.3914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8948   -7.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6060   -7.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1788   -7.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2080   -5.7181    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.6964   -6.3914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5214   -6.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9292   -7.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9292   -5.6754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  7  1  0  0  0  0\n  1 43  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 14  1  6  0  0  0\n 38  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 15 14  1  6  0  0  0\n 15 16  1  0  0  0  0\n 33 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 23 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  2  0  0  0  0\n 23 24  1  6  0  0  0\n 28 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 25  2  0  0  0  0\n 28 29  1  1  0  0  0\n 33 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 30  2  0  0  0  0\n 33 34  1  6  0  0  0\n 35 34  1  0  0  0  0\n 36 35  1  0  0  0  0\n 37 35  2  0  0  0  0\n 38 39  1  6  0  0  0\n 43 38  1  0  0  0  0\n 40 39  1  0  0  0  0\n 41 40  1  0  0  0  0\n 42 40  2  0  0  0  0\n 43 44  1  1  0  0  0\n 45 44  1  0  0  0  0\n 46 45  1  0  0  0  0\n 47 45  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@]2(COC(=O)C)[C@H]([C@@H]([C@@H](COC(=O)C)O2)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C",
          "formula": "C28H38O19",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bc9d2c89-af5c-457a-96e8-960a89c503eb"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "678.591",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "32058c12-077b-476b-bc4d-4a86b50b5ecc",
      "version": "12",
      "structure": {
        "id": "5d095c5e-6c58-41b7-a532-b14dbc88b4fc",
        "molfile": "\n  Marvin  01132104492D          \n\n 47 48  0  0  1  0            999 V2000\n    9.1128   -4.9406    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.3735   -5.7181    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.2080   -5.7181    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6964   -6.3914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5214   -6.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9292   -5.6754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9292   -7.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4594   -4.9501    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7765   -4.4569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4594   -4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1658   -3.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8817   -4.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5929   -3.6984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8817   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8948   -6.3914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8948   -7.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1788   -7.6289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6060   -7.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7568   -4.9406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4007   -4.9310    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9835   -5.6423    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.1490   -5.6423    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7412   -4.9216    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9162   -4.9216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4990   -4.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6740   -4.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9067   -3.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1585   -4.2056    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9882   -4.2056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7507   -3.4849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1585   -2.7596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7365   -2.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -2.0484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1490   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7317   -6.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9067   -6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4848   -5.6281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4848   -7.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3865   -6.3677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3865   -7.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6659   -7.6005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0977   -7.6052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1128   -4.1156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3827   -3.6984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3827   -2.8734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6667   -2.4609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0939   -2.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n  8 10  1  6  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n  2 15  1  6  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19  1  1  0  0  0  0\n 20 19  1  6  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  6  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 25  1  0  0  0  0\n 28 23  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 20  1  0  0  0  0\n 28 30  1  1  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  2  0  0  0  0\n 34 32  1  0  0  0  0\n 22 35  1  1  0  0  0\n 36 35  1  0  0  0  0\n 37 36  2  0  0  0  0\n 38 36  1  0  0  0  0\n 21 39  1  6  0  0  0\n 40 39  1  0  0  0  0\n 41 40  2  0  0  0  0\n 42 40  1  0  0  0  0\n  1 43  1  1  0  0  0\n 44 43  1  0  0  0  0\n 45 44  1  0  0  0  0\n 46 45  2  0  0  0  0\n 47 45  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@]2(COC(=O)C)[C@H]([C@@H]([C@@H](COC(=O)C)O2)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C",
        "formula": "C28H38O19",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "678.591",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bff091aa-4662-4ee4-9ef4-6892216c7105",
          "8706ccb5-6c83-4242-92da-81b64c212bf0"
        ],
        "stereo_centers": 9
      },
      "unii": "07V591057T"
    }
  ]
}