{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "62f5f1fb-8e73-4793-bc7b-a5c30dd3ad96",
          "code": "1034-01-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1034-01-1",
          "code_system": "CAS",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393",
            "8ebe549d-dde3-4413-b5f9-4834fe552ba1"
          ]
        },
        {
          "uuid": "b7dd5ad1-89db-4017-8f84-d318c7d01dd6",
          "code": "C016627",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67016627",
          "code_system": "MESH",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393"
          ]
        },
        {
          "uuid": "ae6ceb56-0c38-436d-bb10-ea240a3745bf",
          "code": "OCTYL GALLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Octyl_gallate",
          "code_system": "WIKIPEDIA",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393"
          ]
        },
        {
          "uuid": "87471f69-29fc-4105-a51a-f5eda9b31e29",
          "code": "INS-311",
          "comments": "JECFA|Functional Classification|ANTIOXIDANT",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4118",
          "code_system": "JECFA EVALUATION",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393"
          ]
        },
        {
          "uuid": "ad337652-625b-4e08-a680-abe99f75c646",
          "code": "SUB14680MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393"
          ]
        },
        {
          "uuid": "b6e0ee6e-dafb-438a-9a16-45672b67b684",
          "code": "213-853-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.594",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393"
          ]
        },
        {
          "uuid": "6367e9fe-a140-4034-9c0d-ffb61cbae304",
          "code": "61253",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61253",
          "code_system": "PUBCHEM",
          "references": [
            "1a4d82de-decf-4de7-ae01-831a036cf393"
          ]
        },
        {
          "uuid": "abfffc7a-423c-dd9d-3d18-39d04ff2bba9",
          "code": "DTXSID4040713",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4040713",
          "code_system": "EPA CompTox",
          "references": [
            "0201b650-b457-01cb-5832-dd6d5e9fe346"
          ]
        },
        {
          "uuid": "e0823bf7-53d3-4532-8877-86946c433886",
          "code": "079IIA2811",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f0f0dcb1-4f3e-927a-994e-1b083d7347af",
          "code": "83631",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83631",
          "code_system": "CHEBI",
          "references": [
            "82fb17cf-06ac-10ac-5907-030e08cc1b7d"
          ]
        },
        {
          "uuid": "0eaffe90-2d23-b063-255f-a735f0ac9e7d",
          "code": "97419",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=97419",
          "code_system": "NSC",
          "references": [
            "c39a50df-6ad9-10cf-5dcc-96e74d9a8e6f"
          ]
        },
        {
          "uuid": "06024bf8-be31-ba06-4258-15286e2b0712",
          "code": "100000080009",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "adb37978-6e58-860c-d084-0009acd09248"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c1d305f0-da6d-4baf-b512-d72183f2051d",
          "name": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, OCTYL ESTER",
          "stdName": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, OCTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4317a1e-02dd-4c7c-bda3-870311ce1619"
          ],
          "display_name": false
        },
        {
          "uuid": "6a8f607b-eef8-421b-b26c-cd2f1c7d8bef",
          "name": "E-311",
          "stdName": "E-311",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "610b3451-0d18-4a1f-9015-048e6958ba99"
          ],
          "display_name": false
        },
        {
          "uuid": "447f38c8-50ef-49fd-afb5-fd236a69b05d",
          "name": "GALLIC ACID, OCTYL ESTER",
          "stdName": "GALLIC ACID, OCTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4317a1e-02dd-4c7c-bda3-870311ce1619"
          ],
          "display_name": false
        },
        {
          "uuid": "4fcaaaad-3a03-4e2d-913e-fbec7e358967",
          "name": "INS NO.311",
          "stdName": "INS NO.311",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "610b3451-0d18-4a1f-9015-048e6958ba99"
          ],
          "display_name": false
        },
        {
          "uuid": "f9414cab-3ff2-49ea-874e-fff97072f005",
          "name": "INS-311",
          "stdName": "INS-311",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "610b3451-0d18-4a1f-9015-048e6958ba99"
          ],
          "display_name": false
        },
        {
          "uuid": "3d8a775b-ac3b-402d-ab99-f31a3a414370",
          "name": "N-OCTYL ESTER OF 3,4,5-TRIHYDROXYBENZOIC ACID",
          "stdName": "N-OCTYL ESTER OF 3,4,5-TRIHYDROXYBENZOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bab3abc6-389d-48bc-9583-3b1aaf03b5d6"
          ],
          "display_name": false
        },
        {
          "uuid": "f2f0d723-df3f-4cf6-9948-cf1ff3118c48",
          "name": "N-OCTYL GALLATE",
          "stdName": "N-OCTYL GALLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4317a1e-02dd-4c7c-bda3-870311ce1619"
          ],
          "display_name": false
        },
        {
          "uuid": "64313066-1c3a-4d82-8da3-26f58599052f",
          "name": "NSC-97419",
          "stdName": "NSC-97419",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9c0ed10-d4bc-4f53-b5e5-511b0bee2e6d"
          ],
          "display_name": false
        },
        {
          "uuid": "ff09e9c6-edb5-49dd-a7a0-b1fbe893534b",
          "name": "OCTIL GALLATE [MART.]",
          "stdName": "OCTIL GALLATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55b9540d-dfbd-4d16-a452-e3752e2fced6"
          ],
          "display_name": false
        },
        {
          "uuid": "a20da140-d4c2-4208-ad4a-24a7cd7a6972",
          "name": "OCTYL 3,4,5-TRIHYDROXYBENZOATE",
          "stdName": "OCTYL 3,4,5-TRIHYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f07047bd-494d-41da-8bd6-ddf6ee933925"
          ],
          "display_name": false
        },
        {
          "uuid": "8504bdf4-0dd2-458f-b1c9-233c3a7b86f1",
          "name": "OCTYL ESTER OF GALLIC ACID",
          "stdName": "OCTYL ESTER OF GALLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bab3abc6-389d-48bc-9583-3b1aaf03b5d6"
          ],
          "display_name": false
        },
        {
          "uuid": "9f2c3f67-5ac8-463f-85d3-d1ace8a713ec",
          "name": "OCTYL GALLATE",
          "stdName": "OCTYL GALLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13079c3a-f50d-438d-8608-6ab70c6657fd",
            "58e19177-908f-42bf-8b40-a5ff49e50f16",
            "c60be520-112a-43a4-87bc-63f9807456cf",
            "2180c705-885e-4f1b-a21f-98f87058d08f",
            "93238cd0-0bb7-4bed-a25b-f92633d9dfc5"
          ],
          "display_name": true
        },
        {
          "uuid": "defadd5b-9a07-4fa6-95e4-5760994c4720",
          "name": "OCTYL GALLATE (E 311)",
          "stdName": "OCTYL GALLATE (E 311)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a062ba0-51d8-4301-b075-203bdf33d2bd"
          ],
          "display_name": false
        },
        {
          "uuid": "9357b393-2937-f097-f3cc-17c08372bd80",
          "name": "OCTYL GALLATE [EP MONOGRAPH]",
          "stdName": "OCTYL GALLATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8824f69b-96e6-15fc-cbe6-ecfa051177b1"
          ],
          "display_name": false
        },
        {
          "uuid": "88589445-f2e8-eaa7-36db-3570972c49ad",
          "name": "Octyl gallate [WHO-DD]",
          "stdName": "OCTYL GALLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ee1969d-cc31-6842-ee55-b206baeb5c7f"
          ],
          "display_name": false
        },
        {
          "uuid": "b19f4e96-3f1a-4e08-aa5a-ba26ad4e6c13",
          "name": "PPC-17",
          "stdName": "PPC-17",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4317a1e-02dd-4c7c-bda3-870311ce1619"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c60be520-112a-43a4-87bc-63f9807456cf",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58e19177-908f-42bf-8b40-a5ff49e50f16",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f07047bd-494d-41da-8bd6-ddf6ee933925",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55b9540d-dfbd-4d16-a452-e3752e2fced6",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2180c705-885e-4f1b-a21f-98f87058d08f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a062ba0-51d8-4301-b075-203bdf33d2bd",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bab3abc6-389d-48bc-9583-3b1aaf03b5d6",
          "citation": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4118",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4118",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "610b3451-0d18-4a1f-9015-048e6958ba99",
          "citation": "http://apps.who.int/food-additives-contaminants-jecfa-database/search.aspx",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/search.aspx",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9c0ed10-d4bc-4f53-b5e5-511b0bee2e6d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a4d82de-decf-4de7-ae01-831a036cf393",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "697ef77d-681e-438d-afe0-e8c8c38cad31",
          "citation": "SRS import [079IIA2811]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=079IIA2811",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390939000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f0b2b39-b8ec-4da5-aad2-f72712d5ccad",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93238cd0-0bb7-4bed-a25b-f92633d9dfc5",
          "citation": "OCTYL GALLATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "13079c3a-f50d-438d-8608-6ab70c6657fd",
          "citation": "OCTYL GALLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0201b650-b457-01cb-5832-dd6d5e9fe346",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1034-01-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "adb37978-6e58-860c-d084-0009acd09248",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b4317a1e-02dd-4c7c-bda3-870311ce1619",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ebe549d-dde3-4413-b5f9-4834fe552ba1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8824f69b-96e6-15fc-cbe6-ecfa051177b1",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "82fb17cf-06ac-10ac-5907-030e08cc1b7d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c39a50df-6ad9-10cf-5dcc-96e74d9a8e6f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6ee1969d-cc31-6842-ee55-b206baeb5c7f",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac1b7ffb-afa7-45e0-96d2-c711e45d9c65",
          "id": "ac1b7ffb-afa7-45e0-96d2-c711e45d9c65",
          "molfile": "\n  Marvin  01132108562D          \n\n 20 20  0  0  0  0            999 V2000\n   10.9739   -3.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2600   -3.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5473   -3.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8288   -3.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1160   -3.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3977   -3.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6848   -3.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9664   -3.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2537   -3.0171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -3.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8210   -3.0179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -4.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2530   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2530   -5.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9663   -5.9087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -5.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -6.7338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8217   -5.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1085   -5.9087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8217   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 20  2  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCOC(=O)c1cc(c(c(c1)O)O)O",
          "formula": "C15H22O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5bc3707a-b0df-41fe-a583-84e92883b398"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "282.3328",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "59134a69-ecf0-4faa-9982-e785314d77ba",
      "version": "12",
      "structure": {
        "id": "1f829eb4-167e-4a48-90f3-8e28243f5ef0",
        "molfile": "\n  Marvin  01132101482D          \n\n 20 20  0  0  0  0            999 V2000\n    3.8217   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8217   -5.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -5.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2530   -5.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2530   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -4.2540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -3.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2537   -3.0171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9664   -3.4305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6848   -3.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3977   -3.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1160   -3.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8288   -3.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5473   -3.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2600   -3.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9739   -3.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8210   -3.0179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9663   -5.9087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5351   -6.7338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1085   -5.9087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  7 17  2  0  0  0  0\n  4 18  1  0  0  0  0\n  3 19  1  0  0  0  0\n  2 20  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCOC(=O)c1cc(c(c(c1)O)O)O",
        "formula": "C15H22O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "282.3328",
        "optical_activity": "NONE",
        "references": [
          "0f0b2b39-b8ec-4da5-aad2-f72712d5ccad",
          "697ef77d-681e-438d-afe0-e8c8c38cad31"
        ],
        "stereo_centers": 0
      },
      "modifications": {
        "uuid": "9092fa4b-06f2-4524-ae4c-3ee549bf7343"
      },
      "unii": "079IIA2811"
    }
  ]
}