{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b808d2f9-8948-478f-b7a1-50005c071756",
          "code": "950890-74-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=950890-74-1",
          "code_system": "CAS",
          "references": [
            "6a3e9bb0-c619-4829-920e-afd66d328d4a",
            "ec839550-be44-4361-8880-1fc50f06ead1"
          ]
        },
        {
          "uuid": "b8c7c6d4-62b9-4c9e-b624-17cfc20938ac",
          "code": "25059665",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25059665",
          "code_system": "PUBCHEM",
          "references": [
            "6a3e9bb0-c619-4829-920e-afd66d328d4a"
          ]
        },
        {
          "uuid": "5e6b9047-c7c5-6e60-4729-a93cab4fc178",
          "code": "2107305",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2107305/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5e33f07a-53b1-ff5a-c937-6a05a64df2d4"
          ]
        },
        {
          "uuid": "8cd0f438-c640-4175-bd18-ffe3c4cb5398",
          "code": "0774Y45BEE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b37b033-b58e-2270-c247-6e3987683152",
          "code": "0774Y45BEE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0774Y45BEE",
          "code_system": "DAILYMED",
          "references": [
            "3f7ded98-033e-4be4-f4b4-d673cc3da1c9"
          ]
        },
        {
          "uuid": "a568d7b0-6a45-42a5-8a82-a8cae3b3ef45",
          "code": "2598850-43-0",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2598850-43-0",
          "code_system": "CAS",
          "references": [
            "ec839550-be44-4361-8880-1fc50f06ead1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7083d932-cf9e-4a9b-8477-78cd29b0650d",
          "name": "ARGININE FERULATE",
          "stdName": "ARGININE FERULATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5977e181-d9d8-4596-8d32-8700a730dc28",
            "59823b34-c5af-4a9c-b31f-adbb5d237696",
            "c76aba9b-dcf6-42bc-86b9-497d6b367047"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "275d6ae1-7de6-4a46-b7c6-84ff699377f8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "011a9287-a3ef-47c3-9fa8-6d43fb0c3f5f",
          "name": "L-Arginine, 3-(4-hydroxy-3-methoxyphenyl)-2-propenoate (1:1)",
          "stdName": "L-ARGININE, 3-(4-HYDROXY-3-METHOXYPHENYL)-2-PROPENOATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c349358e-8ccc-442a-98bd-d19be2e35baa",
            "c76aba9b-dcf6-42bc-86b9-497d6b367047"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "59823b34-c5af-4a9c-b31f-adbb5d237696",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c76aba9b-dcf6-42bc-86b9-497d6b367047",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c349358e-8ccc-442a-98bd-d19be2e35baa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a3e9bb0-c619-4829-920e-afd66d328d4a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b466eab0-dcbb-4dc8-8405-4b7cc27d8972",
          "citation": "SRS import [0774Y45BEE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0774Y45BEE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393046000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5977e181-d9d8-4596-8d32-8700a730dc28",
          "citation": "ARGININE FERULATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5e33f07a-53b1-ff5a-c937-6a05a64df2d4",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "ec839550-be44-4361-8880-1fc50f06ead1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3f7ded98-033e-4be4-f4b4-d673cc3da1c9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6133e6fc-62c1-45f5-9959-c97ee763770b",
          "id": "6133e6fc-62c1-45f5-9959-c97ee763770b",
          "molfile": "\n  Marvin  01132105022D          \n\n 12 11  0  0  1  0            999 V2000\n   10.9657  -10.3554    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.9657  -11.1802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6802   -9.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3946  -10.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1091   -9.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8235  -10.3554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5379   -9.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5379   -9.1178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2523  -10.3554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2513   -9.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2513   -9.1178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5369  -10.3554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N",
          "formula": "C6H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c98ec3bc-b8a8-40f1-afa3-7b2be352ece4"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.2012",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "edfd8579-14cf-4c47-b492-5217608d45b1",
          "id": "edfd8579-14cf-4c47-b492-5217608d45b1",
          "molfile": "\n  Marvin  01132112192D          \n\n 14 14  0  0  1  0            999 V2000\n    9.4691   -6.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1826   -6.4586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1826   -5.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8962   -5.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8962   -4.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6097   -3.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3276   -4.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0366   -3.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0366   -3.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7546   -4.3964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1826   -3.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4691   -4.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4691   -5.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7557   -5.6347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 13  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(ccc1O)/C=C/C(=O)O",
          "formula": "C10H10O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96d63b64-0c25-4bdc-952d-8afc46163726"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "194.1844",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "14e1da13-8ba7-423c-9f7f-40cce1a06814",
      "version": "9",
      "structure": {
        "id": "0a36b306-3901-4a07-a6e4-56931f57aadf",
        "molfile": "\n  Marvin  01132100472D          \n\n 26 25  0  0  1  0            999 V2000\n   13.7189   -9.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7189   -8.6042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0448   -9.7720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3706   -9.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6964   -9.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0222   -9.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3480   -9.7720    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.6738   -9.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6738   -8.6042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9996   -9.7720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3480  -10.5504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3931   -9.7720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6231   -3.9868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3419   -4.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0517   -3.9868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0517   -3.1619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7705   -4.4015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9088   -4.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9088   -5.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1944   -5.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1944   -6.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4801   -6.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4801   -5.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4801   -4.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1944   -3.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7658   -5.6412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n  7 11  1  6  0  0  0\n 12  1  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 18 25  2  0  0  0  0\n 23 26  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(ccc1O)/C=C/C(=O)O.C(C[C@@H](C(=O)O)N)CNC(=N)N",
        "formula": "C10H10O4.C6H14N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 1,
        "molecular_weight": "368.3856",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c349358e-8ccc-442a-98bd-d19be2e35baa",
          "b466eab0-dcbb-4dc8-8405-4b7cc27d8972"
        ],
        "stereo_centers": 1
      },
      "unii": "0774Y45BEE"
    }
  ]
}