{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b04c2772-a42f-4e3f-88d0-3210f3f744cc",
          "code": "15520-11-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15520-11-3",
          "code_system": "CAS",
          "references": [
            "562bced6-d1eb-4eb6-8930-a96c505425f6",
            "c16b086d-8a8f-4c3f-811d-8338ae9e8e6c"
          ]
        },
        {
          "uuid": "6e796a53-f607-4342-a585-d71a699b81e1",
          "code": "239-557-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.946",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "562bced6-d1eb-4eb6-8930-a96c505425f6"
          ]
        },
        {
          "uuid": "f541e26b-b6ca-4b53-9e5a-e60d71fdfa8c",
          "code": "C83666",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83666",
          "code_system": "NCI_THESAURUS",
          "references": [
            "562bced6-d1eb-4eb6-8930-a96c505425f6"
          ]
        },
        {
          "uuid": "c753a836-88e3-4f01-9654-ebaf73ed04a6",
          "code": "1310539",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1310539/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "562bced6-d1eb-4eb6-8930-a96c505425f6"
          ]
        },
        {
          "uuid": "2bf3a927-449a-4001-b655-11184affb031",
          "code": "84964",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84964",
          "code_system": "PUBCHEM",
          "references": [
            "562bced6-d1eb-4eb6-8930-a96c505425f6"
          ]
        },
        {
          "uuid": "cee79167-097e-c54e-e41e-986e2d3bed1a",
          "code": "DTXSID8065907",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8065907",
          "code_system": "EPA CompTox",
          "references": [
            "30b312c1-f7a3-d5a1-5a9b-832baad6da44"
          ]
        },
        {
          "uuid": "6fd52747-4fd6-cebb-3cbb-b6c51ee2fc56",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4ad030be-a0ba-49af-b2c7-7063d4f00a7e"
          ]
        },
        {
          "uuid": "b88ea41b-edfc-4006-8adb-0c0c77a570cb",
          "code": "076NU497LZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f9abe651-4def-fc5e-025e-aa25a4edda16",
          "code": "076NU497LZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=076NU497LZ",
          "code_system": "DAILYMED",
          "references": [
            "ef6e0c71-ffe2-96ca-9d47-b13845366153"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6dd90349-0163-41bf-89c5-cebce25780aa",
          "name": "BIS(4-TERT-BUTYLCYCLOHEXYL) PEROXYDICARBONATE",
          "stdName": "BIS(4-TERT-BUTYLCYCLOHEXYL) PEROXYDICARBONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "811f1158-22be-4cf9-a998-16db450221bd",
            "100ed1f0-3ebe-49e7-a56b-e92979dbcc91"
          ],
          "display_name": false
        },
        {
          "uuid": "0079a5af-e902-4403-bc64-9c945332c73b",
          "name": "DI-(4-TERT-BUTYLCYCLOHEXYL)PEROXYDICARBONATE",
          "stdName": "DI-(4-TERT-BUTYLCYCLOHEXYL)PEROXYDICARBONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6415e806-c015-444c-a6fe-bcc8796f2fec",
            "100ed1f0-3ebe-49e7-a56b-e92979dbcc91"
          ],
          "display_name": true
        },
        {
          "uuid": "31a92686-5eae-4635-857d-657bdde6fc1a",
          "name": "PERKADOX 16",
          "stdName": "PERKADOX 16",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be8c9f1d-0674-4033-9eeb-39736edb23ef",
            "100ed1f0-3ebe-49e7-a56b-e92979dbcc91"
          ],
          "display_name": false
        },
        {
          "uuid": "7b9c0fe2-31f9-4227-8a3d-457cbd08b11a",
          "name": "PEROXYDICARBONIC ACID, BIS(4-(1,1-DIMETHYLETHYL)CYCLOHEXYL) ESTER",
          "stdName": "PEROXYDICARBONIC ACID, BIS(4-(1,1-DIMETHYLETHYL)CYCLOHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6415e806-c015-444c-a6fe-bcc8796f2fec",
            "100ed1f0-3ebe-49e7-a56b-e92979dbcc91"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6415e806-c015-444c-a6fe-bcc8796f2fec",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "100ed1f0-3ebe-49e7-a56b-e92979dbcc91",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be8c9f1d-0674-4033-9eeb-39736edb23ef",
          "citation": "Akzo Nobel",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "811f1158-22be-4cf9-a998-16db450221bd",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "562bced6-d1eb-4eb6-8930-a96c505425f6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37a15770-06de-4256-a80d-c31994cfa49c",
          "citation": "SRS import [076NU497LZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=076NU497LZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390716000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30b312c1-f7a3-d5a1-5a9b-832baad6da44",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15520-11-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4ad030be-a0ba-49af-b2c7-7063d4f00a7e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c16b086d-8a8f-4c3f-811d-8338ae9e8e6c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ef6e0c71-ffe2-96ca-9d47-b13845366153",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "96cd6c22-939f-48ca-9d6c-6f33638978b7",
          "id": "96cd6c22-939f-48ca-9d6c-6f33638978b7",
          "molfile": "\n  Marvin  01132107502D          \n\n 28 29  0  0  0  0            999 V2000\n   11.1545  -10.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7434   -9.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3322   -8.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0281  -10.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4587   -9.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4587   -8.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1711   -8.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8853   -8.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8853   -9.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1711   -9.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6037   -8.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3187   -8.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3187   -9.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0279   -8.0275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0279   -7.1986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7355   -6.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7355   -5.9594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4550   -7.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1689   -6.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8831   -7.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5955   -6.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5955   -5.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8831   -5.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1689   -5.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3108   -5.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8997   -4.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7220   -6.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0261   -5.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 24 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 25  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)C1CCC(CC1)OC(=O)OOC(=O)OC2CCC(CC2)C(C)(C)C",
          "formula": "C22H38O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e38b3d10-f134-4ea9-8357-8f2d8544183e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "398.5344",
          "optical_activity": "NONE",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "041f78cf-9d68-4354-86bb-bb589c3821ad",
      "version": "5",
      "structure": {
        "id": "71700d92-d6e9-4ae8-a707-14fd1bd3686c",
        "molfile": "\n  Marvin  01132105532D          \n\n 28 29  0  0  0  0            999 V2000\n   14.3187   -9.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3187   -8.4376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6037   -8.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8853   -8.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1711   -8.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4587   -8.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4587   -9.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7434   -9.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1545  -10.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3322   -8.9606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0281  -10.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1711   -9.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8853   -9.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0279   -8.0275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0279   -7.1986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7355   -6.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7355   -5.9594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4550   -7.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1689   -6.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8831   -7.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5955   -6.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5955   -5.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3108   -5.5502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8997   -4.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7220   -6.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0261   -5.1391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8831   -5.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1689   -5.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13  4  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 22 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 19  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)C1CCC(CC1)OC(=O)OOC(=O)OC2CCC(CC2)C(C)(C)C",
        "formula": "C22H38O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "398.5344",
        "optical_activity": "NONE",
        "references": [
          "6415e806-c015-444c-a6fe-bcc8796f2fec",
          "37a15770-06de-4256-a80d-c31994cfa49c"
        ],
        "stereo_centers": 4
      },
      "unii": "076NU497LZ"
    }
  ]
}