{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4a5d9c6d-6b68-4a17-b181-c08513328de7",
          "code": "517-88-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=517-88-4",
          "code_system": "CAS",
          "references": [
            "57258403-9f21-4891-9ceb-ab4197e37fbc",
            "b212e8da-b933-4e02-90f5-9fa3adaf9b9c"
          ]
        },
        {
          "uuid": "9dad620c-7072-4438-85ee-4c2dfee0b5c1",
          "code": "C018204",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67018204",
          "code_system": "MESH",
          "references": [
            "57258403-9f21-4891-9ceb-ab4197e37fbc"
          ]
        },
        {
          "uuid": "5d75d05c-d49f-48bf-a837-8dd5ef64708f",
          "code": "ALKANNIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Alkannin",
          "code_system": "WIKIPEDIA",
          "references": [
            "57258403-9f21-4891-9ceb-ab4197e37fbc"
          ]
        },
        {
          "uuid": "3cfaf5d6-5ec9-4428-ae0c-0180de514016",
          "code": "208-245-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.497",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "57258403-9f21-4891-9ceb-ab4197e37fbc"
          ]
        },
        {
          "uuid": "83cbc60b-6f95-4fa7-9199-664e60b168db",
          "code": "m1519",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1519?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "57258403-9f21-4891-9ceb-ab4197e37fbc"
          ]
        },
        {
          "uuid": "4f1a9734-69c3-4170-a4fc-fec95a2f0128",
          "code": "72521",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72521",
          "code_system": "PUBCHEM",
          "references": [
            "57258403-9f21-4891-9ceb-ab4197e37fbc"
          ]
        },
        {
          "uuid": "85c3ce02-775a-4ba7-a2fd-81356ab49772",
          "code": "075CRZ9995",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "70f9ad10-df91-6a8d-302b-8f5a6d2f8902",
          "code": "DTXSID201029621",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201029621",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "1a387496-0b01-b27f-7d11-0e118738d009",
          "code": "94524",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=94524",
          "code_system": "NSC",
          "references": [
            "dde89e5b-d470-bb49-8412-ecdad32996b6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a4252f12-7370-4ca4-a919-0f5ecce258f2",
          "name": "(-)-5,8-DIHYDROXY-2-(1-HYDROXY-4-METHYL-3-PENTENYL)-1,4-NAPHTHOQUINONE",
          "stdName": "(-)-5,8-DIHYDROXY-2-(1-HYDROXY-4-METHYL-3-PENTENYL)-1,4-NAPHTHOQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "260fb8a6-703a-4db7-a3b6-5556824dcb8e"
          ],
          "display_name": false
        },
        {
          "uuid": "25f39c10-b9b6-416a-98ac-d2d5e978c543",
          "name": "5,8-DIHYDROXY-2-((1S)-1-HYDROXY-4-METHYLPENT-3-EN-1-YL)NAPHTHALENE-1,4-DIONE",
          "stdName": "5,8-DIHYDROXY-2-((1S)-1-HYDROXY-4-METHYLPENT-3-EN-1-YL)NAPHTHALENE-1,4-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "73bfdb5c-db3b-4999-9913-14adac2d276f"
          ],
          "display_name": false
        },
        {
          "uuid": "85de358c-bc98-46fc-89e7-45c7d734212f",
          "name": "ALKANNA RED",
          "stdName": "ALKANNA RED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "260fb8a6-703a-4db7-a3b6-5556824dcb8e"
          ],
          "display_name": false
        },
        {
          "uuid": "0416536b-bdec-4511-9a41-ee3ca68c3c57",
          "name": "ALKANNIN",
          "stdName": "ALKANNIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "a190f7c5-ea8b-43f8-8164-a920b259acd8",
            "260fb8a6-703a-4db7-a3b6-5556824dcb8e",
            "7e715a8b-ac83-4303-9ddc-4971be1dfd2d"
          ],
          "display_name": true
        },
        {
          "uuid": "7b5f51e8-d3e8-44da-85e6-0c95505e4725",
          "name": "ALKANNIN [MI]",
          "stdName": "ALKANNIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "a190f7c5-ea8b-43f8-8164-a920b259acd8"
          ],
          "display_name": false
        },
        {
          "uuid": "02614ba1-350b-4cc1-b718-9d5915310be6",
          "name": "ANCHUSA ACID",
          "stdName": "ANCHUSA ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "260fb8a6-703a-4db7-a3b6-5556824dcb8e"
          ],
          "display_name": false
        },
        {
          "uuid": "2824e2bf-2284-4663-bd5f-173ef2eed142",
          "name": "ANCHUSIN",
          "stdName": "ANCHUSIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "260fb8a6-703a-4db7-a3b6-5556824dcb8e"
          ],
          "display_name": false
        },
        {
          "uuid": "716db37b-26e4-449b-808e-a376d6425a90",
          "name": "C.I. NATURAL RED 20",
          "stdName": "C.I. NATURAL RED 20",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "73bfdb5c-db3b-4999-9913-14adac2d276f"
          ],
          "display_name": false
        },
        {
          "uuid": "dcb67d23-d47b-43af-ad29-1d6e5bbed3bf",
          "name": "NSC-94524",
          "stdName": "NSC-94524",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
            "95dddc9c-c21c-4317-93e5-cce4eb055b36"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "260fb8a6-703a-4db7-a3b6-5556824dcb8e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a190f7c5-ea8b-43f8-8164-a920b259acd8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61f5c0b2-b482-45dc-b3b8-c000736d5e23",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73bfdb5c-db3b-4999-9913-14adac2d276f",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95dddc9c-c21c-4317-93e5-cce4eb055b36",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57258403-9f21-4891-9ceb-ab4197e37fbc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391001000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34b9c8fd-c84c-4f75-ae2e-7423a2712ac9",
          "citation": "SRS import [075CRZ9995]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=075CRZ9995",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391001000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "814a9bbb-ddd1-41f9-94ba-2e1054769191",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e715a8b-ac83-4303-9ddc-4971be1dfd2d",
          "citation": "ALKANNIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dde89e5b-d470-bb49-8412-ecdad32996b6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b212e8da-b933-4e02-90f5-9fa3adaf9b9c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4639ce56-b49f-4441-bad7-9826889844ec",
          "id": "4639ce56-b49f-4441-bad7-9826889844ec",
          "molfile": "\n  Marvin  01132103412D          \n\n 21 22  0  0  1  0            999 V2000\n    7.1787   -4.3590    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1787   -3.5653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9012   -4.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6013   -4.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2701   -4.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8498   -4.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2701   -5.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4384   -4.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4384   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -6.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -6.7716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9670   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -6.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -6.6689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5221   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5221   -4.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -4.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -3.5653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9670   -4.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -4.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -3.6902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 20  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 19  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
          "smiles": "CC(=CC[C@@H](C1=CC(=O)c2c(ccc(c2C1=O)O)O)O)C",
          "formula": "C16H16O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c53b8dd0-922e-4b08-9c24-16427215da18"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "288.2959",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3835bf98-4726-441b-b3da-bdbaa713ff06",
      "version": "4",
      "structure": {
        "id": "c247afaf-1224-45a6-8eb9-8a4bcf8093b4",
        "molfile": "\n  Marvin  01132110032D          \n\n 21 22  0  0  1  0            999 V2000\n    5.7117   -4.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4384   -4.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4384   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -6.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -6.7716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9670   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9670   -4.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -4.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5221   -4.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5221   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -6.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -6.6689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2534   -3.5653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1787   -4.3590    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9012   -4.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6013   -4.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2701   -4.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8498   -4.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2701   -5.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1787   -3.5653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7117   -3.6902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 14 20  1  1  0  0  0\n 21  1  2  0  0  0  0\nM  END",
        "smiles": "CC(=CC[C@@H](C1=CC(=O)c2c(ccc(c2C1=O)O)O)O)C",
        "formula": "C16H16O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "288.2959",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "34b9c8fd-c84c-4f75-ae2e-7423a2712ac9",
          "814a9bbb-ddd1-41f9-94ba-2e1054769191"
        ],
        "stereo_centers": 1
      },
      "unii": "075CRZ9995"
    }
  ]
}