{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "793fa8be-4206-44ea-8fd4-463c63b99788",
          "code": "D01AE18",
          "comments": "ATC|DERMATOLOGICALS|ANTIFUNGALS FOR DERMATOLOGICAL USE|ANTIFUNGALS FOR TOPICAL USE|Other antifungals for topical use|tolnaftate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D01AE18&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "1bd79dc5-c251-4b0d-aef2-315cef0e9f89",
          "code": "QD01AE18",
          "comments": "VATC|ANTIFUNGALS FOR DERMATOLOGICAL USE|ANTIFUNGALS FOR TOPICAL USE|Other antifungals for topical use|tolnaftate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD01AE18&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "e337187b-3ceb-4f27-be75-b3c07af4ecaf",
          "code": "2398-96-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2398-96-1",
          "code_system": "CAS",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b",
            "152d9988-9cc5-4443-af15-575b438726fd"
          ]
        },
        {
          "uuid": "2764fc2b-1bd0-405a-bc4d-8c672f5e1416",
          "code": "C47763",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47763",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "f6172f23-3cfc-4208-b2c8-3abcfe8e164a",
          "code": "21 CFR 333.210",
          "comments": "PART 333 -- TOPICAL ANTIMICROBIAL DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart C--Topical Antifungal Drug Products|Sec. 333.210 Antifungal active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=333.210",
          "code_system": "CFR",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "9ab20843-fc3b-4f87-bfb6-cd8353537ec5",
          "code": "D014047",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014047",
          "code_system": "MESH",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "5a44d55a-8cc8-47ec-9802-bb0e9a5c3da7",
          "code": "TOLNAFTATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tolnaftate",
          "code_system": "WIKIPEDIA",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "0e0ea2d6-277e-4415-a3b4-513c8299554c",
          "code": "SUB11163MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "4ab90987-e891-4d53-a499-d4872f0c7474",
          "code": "122901",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1734",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "374a6e8c-99c3-4956-9e7e-94aec8b47864",
          "code": "1730",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1730",
          "code_system": "INN",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "0b4498d9-47a6-4a81-9ddb-880a7c1d9a06",
          "code": "10637",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10637/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "d9777dc0-f8b4-45cd-b41f-abd6f47c0cb9",
          "code": "m10948",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10948?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "ef10b4e3-50fb-4e1c-a925-c0c055da77a2",
          "code": "DB00525",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00525",
          "code_system": "DRUG BANK",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "3edbfab0-2e76-4b38-9f8f-0070ddff731b",
          "code": "21 CFR 524.2350",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.2350 Tolnaftate cream.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.2350",
          "code_system": "CFR",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "3405bf27-7477-429c-9069-0ffa964dd34e",
          "code": "CHEMBL83668",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL83668",
          "code_system": "ChEMBL",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "05a94faa-2650-4ad7-86d4-bffb6494f0db",
          "code": "5510",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5510",
          "code_system": "PUBCHEM",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "3975aa78-579b-4c27-85e3-b636cad01ef2",
          "code": "219-266-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.516",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b"
          ]
        },
        {
          "uuid": "1162d498-a477-c107-8a1c-1b417ac415c5",
          "code": "DTXSID3042477",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3042477",
          "code_system": "EPA CompTox",
          "references": [
            "0a99e087-4ed0-c982-0135-0b6c13a84303"
          ]
        },
        {
          "uuid": "9204cbd4-29ad-4e47-d784-2ecbfb1898d2",
          "code": "Tolnaftate",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM557/",
          "code_system": "LACTMED",
          "references": [
            "c65844d7-3400-f5fd-880f-ff35adac564e"
          ]
        },
        {
          "uuid": "4bc3c1e4-49f8-3212-a808-005837615cbe",
          "code": "C514",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antifungal Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C514",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c65844d7-3400-f5fd-880f-ff35adac564e"
          ]
        },
        {
          "uuid": "fde12a5a-b008-4b01-944e-981a1a77b2a3",
          "code": "06KB629TKV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0bfb0f8b-ce18-4d97-be0e-73cf1cfff8d3",
          "code": "3617",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3617",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c65844d7-3400-f5fd-880f-ff35adac564e"
          ]
        },
        {
          "uuid": "879e352e-3401-665d-7394-18408bdf10f6",
          "code": "1671006",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1671006",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "c65844d7-3400-f5fd-880f-ff35adac564e"
          ]
        },
        {
          "uuid": "02e4fcc4-43af-29a4-90f4-014a22eb24cd",
          "code": "9620",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9620",
          "code_system": "CHEBI",
          "references": [
            "c65844d7-3400-f5fd-880f-ff35adac564e"
          ]
        },
        {
          "uuid": "632fab4c-224c-f6ec-c527-d09d34d4f04e",
          "code": "06KB629TKV",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=06KB629TKV",
          "code_system": "DAILYMED",
          "references": [
            "91a66e94-655d-3bd6-cfed-756ea8a6108e"
          ]
        },
        {
          "uuid": "206def38-15f9-9919-a49e-ef3f9d855a1f",
          "code": "100000077758",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c73c4da5-f48f-4cf7-589f-e7461d4bb6fd"
          ]
        },
        {
          "uuid": "77abc3b0-547f-72e4-82e5-a6a4f6b116e5",
          "code": "233648",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=233648",
          "code_system": "NSC",
          "references": [
            "c7b38675-a988-ff9f-3ffd-3628aac827cd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3dfb1287-e9aa-47c7-94b4-06429b40d071",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a5356e76-d496-480a-9c4f-37b0f855d3c5",
            "refuuid": "9f75cb6e-0e00-4153-9390-a0f578c387e6",
            "name": "TOLNAFTATE",
            "unii": "06KB629TKV",
            "linking_id": "06KB629TKV",
            "ref_pname": "TOLNAFTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9aa83e47-d8c7-4c44-af12-6b47938c105c",
          "amount": {
            "uuid": "bc2a0f6b-4156-472e-8389-de174cebf28d",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "54d33d75-dc68-4e44-9a81-1db8b7503083"
          ],
          "related_substance": {
            "uuid": "7b0c0076-9812-4d9e-a43f-5db981c602b1",
            "refuuid": "ac372df2-9bed-4b17-bee6-6b8fd5ae291a",
            "name": "BETANAPHTHOL",
            "unii": "P2Z71CIK5H",
            "linking_id": "P2Z71CIK5H",
            "ref_pname": "BETANAPHTHOL"
          }
        },
        {
          "uuid": "e4ac8cf4-e051-4e48-8eb6-05cf3d722242",
          "amount": {
            "uuid": "65e7c59f-72a3-4dc0-9ed1-adf75adae972",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0ce06a7d-55ab-441c-a11d-a42d93e4faeb"
          ],
          "related_substance": {
            "uuid": "218dcbb8-58fd-466c-85fa-19d69dac7c96",
            "refuuid": "7fdfddb6-fa4b-421b-b7c3-d0f0fb97fd48",
            "name": "CARBONOTHIOIC ACID, O,O-DI-2-NAPHTHALENYL ESTER",
            "unii": "G8D9NF66MA",
            "linking_id": "G8D9NF66MA",
            "ref_pname": "CARBONOTHIOIC ACID, O,O-DI-2-NAPHTHALENYL ESTER"
          }
        },
        {
          "uuid": "9971b33f-dc47-4083-98b5-f6cbeed7a149",
          "type": "TARGET->INHIBITOR",
          "references": [
            "8f64d55a-a123-6c82-25a0-bd719b54e6a3"
          ],
          "related_substance": {
            "uuid": "d13044e2-e693-4958-9d9b-f01e68a60808",
            "refuuid": "458ad5bb-bd3a-44b5-b4a8-de5a21f1e2a1",
            "name": "SQUALENE MONOOXYGENASE",
            "unii": "CWM8T0VKS2",
            "linking_id": "CWM8T0VKS2",
            "ref_pname": "SQUALENE MONOOXYGENASE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "521e1c3d-3a6d-46fb-8510-f2ba2852b8bc",
          "name": "CARBAMOTHIOIC ACID, METHYL(3-METHYLPHENYL)-, O-2-NAPHTHALENYL ESTER",
          "stdName": "CARBAMOTHIOIC ACID, METHYL(3-METHYLPHENYL)-, O-2-NAPHTHALENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef7dd9dc-a20b-4fee-8f81-169d19f24489"
          ],
          "display_name": false
        },
        {
          "uuid": "0e8ecfce-735f-46ec-ba58-3a811f5d886e",
          "name": "NSC-233648",
          "stdName": "NSC-233648",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acb4a787-66b1-4d40-83f5-b48898b99f6f"
          ],
          "display_name": false
        },
        {
          "uuid": "32594486-6f72-432e-b372-2cada396eda4",
          "name": "O-2-NAPHTHYL M,N-DIMETHYLTHIOCARBANILATE",
          "stdName": "O-2-NAPHTHYL M,N-DIMETHYLTHIOCARBANILATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef7dd9dc-a20b-4fee-8f81-169d19f24489"
          ],
          "display_name": false
        },
        {
          "uuid": "41f3b2be-18e2-4235-ad2c-e07bce59be9d",
          "name": "SCH 10144",
          "stdName": "SCH 10144",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b11aede-6fe4-4697-8403-e80aa76d26bb"
          ],
          "display_name": false
        },
        {
          "uuid": "687e17c1-2376-4d24-948e-dbe47ab2ee84",
          "name": "SCH-10144",
          "stdName": "SCH-10144",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b11aede-6fe4-4697-8403-e80aa76d26bb"
          ],
          "display_name": false
        },
        {
          "uuid": "e7fd7cd8-5f74-476b-8da1-52662a8fa00c",
          "name": "SEPARIN",
          "stdName": "SEPARIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fbd3ff4e-4e11-4fa3-9fa8-909b2b5da7e4",
            "9608253f-1107-4859-99b5-c9aa7e3f7517"
          ],
          "display_name": false
        },
        {
          "uuid": "9b188bf2-eabc-4618-ac9f-584b23d5424f",
          "name": "TOLNAFTATE",
          "stdName": "TOLNAFTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5769ef80-3ebe-4f4d-b504-22f773daaabc",
            "fb4020c3-88c1-4680-a14b-8e21257ac8d0",
            "cd1667df-0c16-4b68-ad1d-cee82a37428d",
            "ab837d7b-ce0b-48b4-b701-095b49c6b494",
            "7f4556f0-b2d0-4fdc-89bb-9f8921c1354f",
            "40f73977-7d1e-4e2e-8fcb-e05d91e2f0da",
            "f1934550-04c6-4a0d-99a9-cad4381cc86f",
            "c54baf89-d597-4b92-827e-fff771cf4e90",
            "f6b9e2d3-f4c4-48ba-bdfd-e93832570d91",
            "8b1870be-5d7d-4a56-b86a-5788ce9ca5f3",
            "db0bc0f6-286b-4e7b-835d-a773e752aac2",
            "15407dc7-b6c5-419d-a5fe-4d3326262efd",
            "a75383d0-5fe4-44b6-87b2-bb3aab6db11a",
            "89e71c55-a144-4cf8-8280-2d8a72739ec5",
            "a7671860-38df-432e-872e-8e4141072bfb",
            "c6fca43c-b2e0-4084-9ab8-c3e4fe350b86",
            "f734ddb5-3868-4062-8df0-98ea4089d6a1",
            "04372b5a-4a8e-447a-9648-8879e56f1cc6",
            "76142c2a-0244-4fc2-b569-4c274430bc00",
            "b4b759c6-f3ca-4eba-b415-993c6e25893d",
            "088a761f-5f2a-411a-b30f-e4e6401898b2",
            "f23ba6ba-ef1b-4070-8c66-2ae1b5578503",
            "ecd22db9-4fb5-49ce-b371-6c984049bcd4"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6fb095b0-3eb1-4396-918c-d8df9c647fe9",
              "name_org": "INN"
            },
            {
              "uuid": "2cf2f8a1-d884-477a-94d0-41fdc5a71840",
              "name_org": "USAN"
            },
            {
              "uuid": "be208914-677a-4e68-92d0-c2f74623c82d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "31870051-ebd6-c429-7624-2fba38416ea6",
          "name": "TOLNAFTATE [EP MONOGRAPH]",
          "stdName": "TOLNAFTATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0eac23-a654-10b1-2890-a18d5cdebc00"
          ],
          "display_name": false
        },
        {
          "uuid": "eddd0fe0-3a42-42e0-b9cc-f6f4f8a29bdf",
          "name": "TOLNAFTATE [GREEN BOOK]",
          "stdName": "TOLNAFTATE [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "088a761f-5f2a-411a-b30f-e4e6401898b2"
          ],
          "display_name": false
        },
        {
          "uuid": "a40d6732-6337-aa9b-ee23-0a5d9a0e6671",
          "name": "TOLNAFTATE [JAN]",
          "stdName": "TOLNAFTATE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8aec3b5b-94ff-0034-c87e-78fef3d5e7e3"
          ],
          "display_name": false
        },
        {
          "uuid": "f52d1f95-6d97-448f-ae9a-beec8e64e1ba",
          "name": "TOLNAFTATE [MART.]",
          "stdName": "TOLNAFTATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4b759c6-f3ca-4eba-b415-993c6e25893d"
          ],
          "display_name": false
        },
        {
          "uuid": "bf738df9-cab6-45c4-a281-eb5919b30b34",
          "name": "TOLNAFTATE [MI]",
          "stdName": "TOLNAFTATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f4556f0-b2d0-4fdc-89bb-9f8921c1354f"
          ],
          "display_name": false
        },
        {
          "uuid": "ef187e0f-d270-430b-948f-3d69dec68a2b",
          "name": "TOLNAFTATE [USAN]",
          "stdName": "TOLNAFTATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76142c2a-0244-4fc2-b569-4c274430bc00"
          ],
          "display_name": false
        },
        {
          "uuid": "e8b58902-0d8d-59fd-d31e-63a5345f5b10",
          "name": "TOLNAFTATE [USP MONOGRAPH]",
          "stdName": "TOLNAFTATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2a98327-94a4-3b5b-de9a-af8df86b1feb"
          ],
          "display_name": false
        },
        {
          "uuid": "50627c48-800e-4032-a1ad-a6ebf6e5e3b8",
          "name": "TOLNAFTATE [USP-RS]",
          "stdName": "TOLNAFTATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecd22db9-4fb5-49ce-b371-6c984049bcd4"
          ],
          "display_name": false
        },
        {
          "uuid": "1526f149-21c4-42ca-bb99-f1a0fa703377",
          "name": "TOLNAFTATE [VANDF]",
          "stdName": "TOLNAFTATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6fca43c-b2e0-4084-9ab8-c3e4fe350b86"
          ],
          "display_name": false
        },
        {
          "uuid": "8704a99d-b186-fb3c-7b2f-c3d7588e9934",
          "name": "Tolnaftate [WHO-DD]",
          "stdName": "TOLNAFTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da69b824-f70e-c3db-007e-3ec9a9db45a6"
          ],
          "display_name": false
        },
        {
          "uuid": "9bc9b0c4-59c1-46d0-b53b-727b7ca06a18",
          "name": "tolnaftate [INN]",
          "stdName": "TOLNAFTATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab837d7b-ce0b-48b4-b701-095b49c6b494"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "db0bc0f6-286b-4e7b-835d-a773e752aac2",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8b11aede-6fe4-4697-8403-e80aa76d26bb",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef7dd9dc-a20b-4fee-8f81-169d19f24489",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab837d7b-ce0b-48b4-b701-095b49c6b494",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76142c2a-0244-4fc2-b569-4c274430bc00",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5769ef80-3ebe-4f4d-b504-22f773daaabc",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15407dc7-b6c5-419d-a5fe-4d3326262efd",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4b759c6-f3ca-4eba-b415-993c6e25893d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f4556f0-b2d0-4fdc-89bb-9f8921c1354f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9608253f-1107-4859-99b5-c9aa7e3f7517",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbd3ff4e-4e11-4fa3-9fa8-909b2b5da7e4",
          "citation": "D00381",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "088a761f-5f2a-411a-b30f-e4e6401898b2",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f23ba6ba-ef1b-4070-8c66-2ae1b5578503",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecd22db9-4fb5-49ce-b371-6c984049bcd4",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b1870be-5d7d-4a56-b86a-5788ce9ca5f3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6fca43c-b2e0-4084-9ab8-c3e4fe350b86",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acb4a787-66b1-4d40-83f5-b48898b99f6f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a8f0db5-5320-4a78-9dfc-4b649bf2d97b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389665000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9e3dcb1-2933-400c-a11e-8be2a1d896b5",
          "citation": "SRS import [06KB629TKV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=06KB629TKV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389665000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e58dcfa-6183-473e-b035-7915382600f8",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6b9e2d3-f4c4-48ba-bdfd-e93832570d91",
          "citation": "TOLNAFTATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "04372b5a-4a8e-447a-9648-8879e56f1cc6",
          "citation": "TOLNAFTATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a75383d0-5fe4-44b6-87b2-bb3aab6db11a",
          "citation": "TOLNAFTATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7671860-38df-432e-872e-8e4141072bfb",
          "citation": "TOLNAFTATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f734ddb5-3868-4062-8df0-98ea4089d6a1",
          "citation": "TOLNAFTATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb4020c3-88c1-4680-a14b-8e21257ac8d0",
          "citation": "TOLNAFTATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c54baf89-d597-4b92-827e-fff771cf4e90",
          "citation": "TOLNAFTATE [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40f73977-7d1e-4e2e-8fcb-e05d91e2f0da",
          "citation": "TOLNAFTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89e71c55-a144-4cf8-8280-2d8a72739ec5",
          "citation": "TOLNAFTATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd1667df-0c16-4b68-ad1d-cee82a37428d",
          "citation": "TOLNAFTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1934550-04c6-4a0d-99a9-cad4381cc86f",
          "citation": "TOLNAFTATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0a99e087-4ed0-c982-0135-0b6c13a84303",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2398-96-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "96522424-7b00-e5f2-10e9-13e4c9dac15a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+2398-96-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f64d55a-a123-6c82-25a0-bd719b54e6a3",
          "citation": "https://www.drugbank.ca/drugs/DB00525",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "c73c4da5-f48f-4cf7-589f-e7461d4bb6fd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c65844d7-3400-f5fd-880f-ff35adac564e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8aec3b5b-94ff-0034-c87e-78fef3d5e7e3",
          "citation": "JAN",
          "doc_type": "JAN",
          "public_domain": true
        },
        {
          "uuid": "0ce06a7d-55ab-441c-a11d-a42d93e4faeb",
          "citation": "European Pharmacopoeia Online 9.8, Tolnaftate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "54d33d75-dc68-4e44-9a81-1db8b7503083",
          "citation": "European Pharmacopoeia Online 9.8, Tolnaftate Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "152d9988-9cc5-4443-af15-575b438726fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "33be536a-5851-c818-629e-b2b02be0faec",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "d2a98327-94a4-3b5b-de9a-af8df86b1feb",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7c0eac23-a654-10b1-2890-a18d5cdebc00",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "c7b38675-a988-ff9f-3ffd-3628aac827cd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "91a66e94-655d-3bd6-cfed-756ea8a6108e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "da69b824-f70e-c3db-007e-3ec9a9db45a6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a0292af7-cca0-433c-a0e4-377da4d198c9",
          "id": "a0292af7-cca0-433c-a0e4-377da4d198c9",
          "molfile": "\n  Marvin  01132108192D          \n\n 22 24  0  0  0  0            999 V2000\n    2.8560    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8560   -0.8245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5926   -1.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5926   -2.0547    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2749   -0.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0115   -1.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0115   -2.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7326   -2.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4433   -2.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1593   -2.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8778   -2.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8700   -1.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1438   -0.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4356   -1.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7171   -0.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1504   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1504   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4215   -2.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7237   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7237   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4138   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 16  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 15  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 22 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(c1)N(C)C(=S)Oc2ccc3ccccc3c2",
          "formula": "C19H17NOS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "33ee22fb-ac20-4e17-98cd-88d7f82b1f0d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "307.4112",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9f75cb6e-0e00-4153-9390-a0f578c387e6",
      "version": "31",
      "structure": {
        "id": "ad60efc8-f8ca-47f0-91ec-d4304ef79c47",
        "molfile": "\n  Marvin  01132109002D          \n\n 22 24  0  0  0  0            999 V2000\n    3.5926   -1.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8560   -0.8245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1504   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2749   -0.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5926   -2.0547    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0115   -1.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4356   -1.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4138   -0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7171   -0.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4433   -2.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7326   -2.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0115   -2.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7237   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1504   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8560    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4215   -2.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1438   -0.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7237   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1593   -2.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8700   -1.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8778   -2.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  9  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12  6  2  0  0  0  0\n 13  8  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17  7  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 10  1  0  0  0  0\n 20 13  1  0  0  0  0\n 21 17  2  0  0  0  0\n 22 19  2  0  0  0  0\n  7 10  1  0  0  0  0\n 13 18  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "Cc1cccc(c1)N(C)C(=S)Oc2ccc3ccccc3c2",
        "formula": "C19H17NOS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "307.4112",
        "optical_activity": "NONE",
        "references": [
          "3e58dcfa-6183-473e-b035-7915382600f8",
          "d9e3dcb1-2933-400c-a11e-8be2a1d896b5",
          "ab837d7b-ce0b-48b4-b701-095b49c6b494"
        ],
        "stereo_centers": 0
      },
      "unii": "06KB629TKV"
    }
  ]
}