{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "75e8a12c-e46c-43ad-88fa-0a384d162390",
          "code": "17021-26-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17021-26-0",
          "code_system": "CAS",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f",
            "1c3ffefb-a31a-47ad-a4f9-064e5501b0fe"
          ]
        },
        {
          "uuid": "035170a7-abd9-43c6-80ea-438900770622",
          "code": "C337",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C337",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "a9457bf5-e441-4f79-9849-0701c86c77ed",
          "code": "C073055",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67073055",
          "code_system": "MESH",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "5087caaf-13c6-4b16-8e4a-91f772729bcc",
          "code": "SUB06060MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "3a405a8f-88f3-483b-89fb-afb726e58a00",
          "code": "2873",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2873",
          "code_system": "INN",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "6726e40a-fdb4-4da8-944c-bb9ca3d24d2e",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "98f56f02-6012-43dd-b394-8fff9465bdf0",
          "code": "m2994",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2994?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "1e8a5e56-e2f4-46ae-acde-c61dde2f3728",
          "code": "CHEMBL455706",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL455706",
          "code_system": "ChEMBL",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "8ce15759-b8ae-4572-b2d4-6f65868183ec",
          "code": "28204",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28204",
          "code_system": "PUBCHEM",
          "references": [
            "d5479980-4828-4338-86d3-ecf76f7d952f"
          ]
        },
        {
          "uuid": "c9c32738-597f-f195-8ef0-c2cc6a45cedc",
          "code": "3210",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3210",
          "code_system": "HSDB",
          "references": [
            "12404fc5-ac36-1cab-b208-f50aa201d941"
          ]
        },
        {
          "uuid": "db907c88-e104-76d1-38aa-2719618bd824",
          "code": "DTXSID0022723",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022723",
          "code_system": "EPA CompTox",
          "references": [
            "2a5787bc-fb4e-063c-74b4-0bcb36142e03"
          ]
        },
        {
          "uuid": "2f122303-66c3-4694-0eda-c55b64df0b25",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4c74287c-bf65-d025-b9f6-096693115185"
          ]
        },
        {
          "uuid": "2ea3667e-59b7-d9d1-6d4b-b429e60a82cf",
          "code": "C243",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Therapeutic Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C243",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4c74287c-bf65-d025-b9f6-096693115185"
          ]
        },
        {
          "uuid": "fc27102a-69bb-448c-aa6a-b04ff8bb5399",
          "code": "0678G6Q58A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4d520dee-4c6a-7b30-d694-a590563face0",
          "code": "468",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/468",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4c74287c-bf65-d025-b9f6-096693115185"
          ]
        },
        {
          "uuid": "8dff04ae-f73d-dd72-6601-9afa139932fa",
          "code": "DB01564",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01564",
          "code_system": "DRUG BANK",
          "references": [
            "4c74287c-bf65-d025-b9f6-096693115185"
          ]
        },
        {
          "uuid": "3c4a441b-8f56-3068-1df5-32f61453e7de",
          "code": "Calusterone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Calusterone",
          "code_system": "WIKIPEDIA",
          "references": [
            "90a54a1e-1d45-857e-0e6e-9d3776490bfc"
          ]
        },
        {
          "uuid": "5af0d5be-5629-a9a4-62d6-36e7fc64b9cd",
          "code": "88536",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=88536",
          "code_system": "NSC",
          "references": [
            "f7a8c748-62c0-b5b7-c59e-3072730da0fd"
          ]
        },
        {
          "uuid": "48c871a6-ee9e-8cb9-1b9b-1b28d71071a7",
          "code": "100000081615",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f029f164-b534-766f-9eb4-10b2c1254c8d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "36e3aae6-3c49-440f-907c-ec58a039d9d6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b19ecbd0-9f5c-42e3-ade1-7c3c574770c7",
            "refuuid": "8993d88e-1fbc-41bf-beb3-2e4fffa1ea97",
            "name": "CALUSTERONE",
            "unii": "0678G6Q58A",
            "linking_id": "0678G6Q58A",
            "ref_pname": "CALUSTERONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8c8dd094-4604-4242-a9ea-e1871d5b3416",
          "name": "17β-Hydroxy-7β,17-dimethylandrost-4-en-3-one",
          "stdName": "17.BETA.-HYDROXY-7.BETA.,17-DIMETHYLANDROST-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "418aacc6-3221-448c-a948-f67d936d4d83"
          ],
          "display_name": false
        },
        {
          "uuid": "a342a26e-5600-8d01-b653-904194f98811",
          "name": "7.BETA.,17.ALPHA.-DIMETHYL-17.BETA.-HYDROXYANDROST-4-EN-3-ONE",
          "stdName": "7.BETA.,17.ALPHA.-DIMETHYL-17.BETA.-HYDROXYANDROST-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be5f31c1-e6ed-00c5-e48f-00bcb43ca36e"
          ],
          "display_name": false
        },
        {
          "uuid": "4a5b89e6-7574-4760-be8d-775853412c2d",
          "name": "7.BETA.,17.ALPHA.-DIMETHYLTESTOSTERONE",
          "stdName": "7.BETA.,17.ALPHA.-DIMETHYLTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "418aacc6-3221-448c-a948-f67d936d4d83"
          ],
          "display_name": false
        },
        {
          "uuid": "015db043-7737-4ba4-bd76-70bfad904114",
          "name": "ANDROST-4-EN-3-ONE, 17-HYDROXY-7,17-DIMETHYL-, (7.BETA.,17.BETA.)-",
          "stdName": "ANDROST-4-EN-3-ONE, 17-HYDROXY-7,17-DIMETHYL-, (7.BETA.,17.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "418aacc6-3221-448c-a948-f67d936d4d83"
          ],
          "display_name": false
        },
        {
          "uuid": "e36856f5-5cb4-4989-b2a8-41ff61e73ceb",
          "name": "CALUSTERONE",
          "stdName": "CALUSTERONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645e88a6-6872-41b5-a4cc-04d1e29bf8ad",
            "c85cf7af-48b2-4366-bf1a-9a8938e48e13",
            "df058c2a-e7a8-493a-bd16-70b6b12cdc00",
            "3c652064-7a2c-4e98-a6e5-f0afc379ef31",
            "0c4f2bbd-2a88-4a6d-a2b6-ca17c5e298bc",
            "45d63b1e-bce6-4d37-b12d-0966d03dbe41",
            "f0e95fcd-4c76-4d6f-831b-d62e2901b3a8",
            "8f076769-da0b-4bae-b4a0-852660a417e0",
            "e869037b-28a2-4893-a7d9-d538d3a80f6e",
            "1117d9b8-21a4-4cf0-8315-9647885beca6",
            "418aacc6-3221-448c-a948-f67d936d4d83",
            "ab8fd9ac-ef4f-431e-aab8-16369d5521f9",
            "add15c32-7c67-4dff-82a5-3667240d3c10"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "675e909b-f400-4bcb-9538-f6973bd697c6",
              "name_org": "INN"
            },
            {
              "uuid": "6b3713cd-5d92-444d-a3f7-03a045fd72a7",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "c2715cfb-0b26-4ef3-9521-3f3e31dcedcb",
          "name": "CALUSTERONE [HSDB]",
          "stdName": "CALUSTERONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1117d9b8-21a4-4cf0-8315-9647885beca6"
          ],
          "display_name": false
        },
        {
          "uuid": "ec8a187f-8ae5-4051-92c0-fa703997c0a6",
          "name": "CALUSTERONE [MART.]",
          "stdName": "CALUSTERONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c652064-7a2c-4e98-a6e5-f0afc379ef31"
          ],
          "display_name": false
        },
        {
          "uuid": "3e904322-fae0-4a31-965d-7e8475148afa",
          "name": "CALUSTERONE [MI]",
          "stdName": "CALUSTERONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f076769-da0b-4bae-b4a0-852660a417e0"
          ],
          "display_name": false
        },
        {
          "uuid": "ffba0c29-3b85-46b6-9ed3-0781caefef50",
          "name": "CALUSTERONE [USAN]",
          "stdName": "CALUSTERONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c85cf7af-48b2-4366-bf1a-9a8938e48e13"
          ],
          "display_name": false
        },
        {
          "uuid": "6b243bd5-32f2-d02d-75a4-07a65a6856b8",
          "name": "Calusterone [WHO-DD]",
          "stdName": "CALUSTERONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e3a96a4-6061-6222-d482-1e084a0d12c1"
          ],
          "display_name": false
        },
        {
          "uuid": "ea7592b5-77bb-4f7f-a092-58caf1f218b4",
          "name": "DIMETHYLTESTOSTERONE",
          "stdName": "DIMETHYLTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e603773-f246-7049-6c42-6353e5ef9d85"
          ],
          "display_name": false
        },
        {
          "uuid": "ac1b2d2e-b157-4e94-b7d8-29d05c6d949f",
          "name": "METHOSARB",
          "stdName": "METHOSARB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad902dfc-3630-4e2e-bf15-988f32112f85"
          ],
          "display_name": false
        },
        {
          "uuid": "8a336fd6-cf8b-4cdd-96bb-f7199c830836",
          "name": "NSC-88536",
          "stdName": "NSC-88536",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "418aacc6-3221-448c-a948-f67d936d4d83"
          ],
          "display_name": false
        },
        {
          "uuid": "e8b5ea7b-ae4e-4672-a873-8902f1fe5758",
          "name": "U-22,550",
          "stdName": "U-22,550",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "418aacc6-3221-448c-a948-f67d936d4d83"
          ],
          "display_name": false
        },
        {
          "uuid": "064b33b7-3ff8-450d-a7ae-e486c4269b77",
          "name": "U-22550",
          "stdName": "U-22550",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c49fa7d7-02d2-4880-983f-b3fc3bf19bde"
          ],
          "display_name": false
        },
        {
          "uuid": "3a1a6aa2-96cd-40e1-9b46-850e76a560e6",
          "name": "calusterone [INN]",
          "stdName": "CALUSTERONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0e95fcd-4c76-4d6f-831b-d62e2901b3a8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "418aacc6-3221-448c-a948-f67d936d4d83",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f0e95fcd-4c76-4d6f-831b-d62e2901b3a8",
          "citation": "INN Proposed List 23",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL23.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c85cf7af-48b2-4366-bf1a-9a8938e48e13",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c652064-7a2c-4e98-a6e5-f0afc379ef31",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f076769-da0b-4bae-b4a0-852660a417e0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1117d9b8-21a4-4cf0-8315-9647885beca6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "645e88a6-6872-41b5-a4cc-04d1e29bf8ad",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad902dfc-3630-4e2e-bf15-988f32112f85",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c49fa7d7-02d2-4880-983f-b3fc3bf19bde",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5479980-4828-4338-86d3-ecf76f7d952f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390724000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8856cff-d1a5-4011-9822-b69f7bd30052",
          "citation": "SRS import [0678G6Q58A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0678G6Q58A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390724000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f773e9d-650b-414f-bb05-f94b13ff69df",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e869037b-28a2-4893-a7d9-d538d3a80f6e",
          "citation": "CALUSTERONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df058c2a-e7a8-493a-bd16-70b6b12cdc00",
          "citation": "CALUSTERONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "add15c32-7c67-4dff-82a5-3667240d3c10",
          "citation": "CALUSTERONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45d63b1e-bce6-4d37-b12d-0966d03dbe41",
          "citation": "CALUSTERONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab8fd9ac-ef4f-431e-aab8-16369d5521f9",
          "citation": "CALUSTERONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c4f2bbd-2a88-4a6d-a2b6-ca17c5e298bc",
          "citation": "CALUSTERONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e603773-f246-7049-6c42-6353e5ef9d85",
          "citation": "https://www.ncbi.nlm.nih.gov/pubmed/5457511",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12404fc5-ac36-1cab-b208-f50aa201d941",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+17021-26-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a5787bc-fb4e-063c-74b4-0bcb36142e03",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17021-26-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f029f164-b534-766f-9eb4-10b2c1254c8d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "be5f31c1-e6ed-00c5-e48f-00bcb43ca36e",
          "citation": "Controlled Substances - by DEA Drug Code Number",
          "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/d_cs_drugcode.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "4c74287c-bf65-d025-b9f6-096693115185",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1c3ffefb-a31a-47ad-a4f9-064e5501b0fe",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "90a54a1e-1d45-857e-0e6e-9d3776490bfc",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "6e3a96a4-6061-6222-d482-1e084a0d12c1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f7a8c748-62c0-b5b7-c59e-3072730da0fd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aab3b134-09dc-49eb-8cf0-0a030102ae86",
          "id": "aab3b134-09dc-49eb-8cf0-0a030102ae86",
          "molfile": "\n  Marvin  01132108512D          \n\n 23 26  0  0  1  0            999 V2000\n    4.3244   -2.2845    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1189   -2.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5990   -1.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1189   -1.2077    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8348   -0.7945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1189   -0.3842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3244   -1.4638    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.3244   -0.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6085   -1.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9014   -1.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9014   -2.2845    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.6085   -2.7064    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.6085   -3.5329    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3215   -3.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9014   -3.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1884   -3.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4667   -3.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7508   -3.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0292   -3.9373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7508   -2.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4667   -2.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1884   -2.7064    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.1884   -1.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n 12  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  6  0  0  0\n 11 22  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 22 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1CC2=CC(=O)CC[C@]2(C)[C@@H]3CC[C@@]4(C)[C@@H](CC[C@]4(C)O)[C@H]13",
          "formula": "C21H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1d38ba00-2280-4957-9286-f5aec48cca61"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "316.4784",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8993d88e-1fbc-41bf-beb3-2e4fffa1ea97",
      "version": "17",
      "structure": {
        "id": "0c878073-aca4-490e-8d2b-44317a80f18f",
        "molfile": "\n  Marvin  01132100542D          \n\n 26 29  0  0  1  0            999 V2000\n    2.1909   -2.7095    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1909   -3.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9047   -2.2871    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3293   -2.2871    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3293   -1.4655    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6126   -2.7095    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6126   -3.5369    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.4684   -3.9390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1247   -1.2091    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.9047   -3.9390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6126   -1.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9047   -1.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1247   -2.5434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4684   -2.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7517   -3.5369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6054   -1.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0292   -3.9418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7517   -2.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1247   -0.3846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1909   -1.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3293   -0.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3264   -3.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8414   -0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3293   -3.1115    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8959   -3.1115    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6126   -1.8850    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  5  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 14  1  0  0  0  0\n  9 19  1  1  0  0  0\n  1 20  1  1  0  0  0\n  5 21  1  1  0  0  0\n  7 22  1  1  0  0  0\n  9 23  1  6  0  0  0\n  4 24  1  6  0  0  0\n  3 25  1  6  0  0  0\n  6 26  1  1  0  0  0\n 10  7  1  0  0  0  0\n  8 15  1  0  0  0  0\n  4  5  1  0  0  0  0\n 16  9  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1CC2=CC(=O)CC[C@]2(C)[C@@]3([H])CC[C@@]4(C)[C@@]([H])(CC[C@]4(C)O)[C@]13[H]",
        "formula": "C21H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "316.4784",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f8856cff-d1a5-4011-9822-b69f7bd30052",
          "6f773e9d-650b-414f-bb05-f94b13ff69df",
          "f0e95fcd-4c76-4d6f-831b-d62e2901b3a8"
        ],
        "stereo_centers": 7
      },
      "unii": "0678G6Q58A"
    }
  ]
}