{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6124b74b-db73-40c7-b5ff-10db7ec34223",
          "code": "133-32-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=133-32-4",
          "code_system": "CAS",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7",
            "ec968344-ae6e-410a-8124-e6954aa2221f"
          ]
        },
        {
          "uuid": "b0ad2bb8-0278-45f9-869a-c4f0c2d93fb3",
          "code": "C63656",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63656",
          "code_system": "NCI_THESAURUS",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "595f7f42-4a59-44ff-b414-c086783fc99c",
          "code": "C014612",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67014612",
          "code_system": "MESH",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "f31407b4-bd0e-4acf-8a69-516088c53a22",
          "code": "INDOLE-3-BUTYRIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Indole-3-butyric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "d3991385-d5e6-4a4b-98e1-ea1863155356",
          "code": "46701",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2583",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "f9575ab5-c314-48aa-a986-85facfe6574b",
          "code": "m6275",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6275?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "1466047a-4aa1-4d5f-aa11-22e6c19019a0",
          "code": "205-101-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.638",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "903ef882-a1d8-4895-9ebd-a285399f48ee",
          "code": "8617",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8617",
          "code_system": "PUBCHEM",
          "references": [
            "af353e6b-a4c0-4386-8203-e30657e1eed7"
          ]
        },
        {
          "uuid": "c6503375-417d-e8c5-e831-01e2ca9a727a",
          "code": "7214",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7214",
          "code_system": "HSDB",
          "references": [
            "10b6134f-c197-be00-a5c7-73061986e14f"
          ]
        },
        {
          "uuid": "3f4cff49-8bde-662a-7bd0-ae59ce2430d1",
          "code": "DTXSID8032623",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8032623",
          "code_system": "EPA CompTox",
          "references": [
            "0b44d9d5-89ad-b66c-8237-2bf4fdd0b893"
          ]
        },
        {
          "uuid": "d620b419-87cd-a580-fd93-2f1ef94fad38",
          "code": "C54677",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Ring Compound[C1933]|Aromatic Compounds[C1915]|Indole Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C54677",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b6cc45b6-5800-e7a6-225c-352c1df6150e"
          ]
        },
        {
          "uuid": "c65ab497-12a1-a5e8-f7a3-c5a6328b31d9",
          "code": "DB02740",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02740",
          "code_system": "DRUG BANK",
          "references": [
            "b6cc45b6-5800-e7a6-225c-352c1df6150e"
          ]
        },
        {
          "uuid": "9e24551e-e495-43c5-baf0-e509990be174",
          "code": "061SKE27JP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f462ab1c-6922-e424-01cf-c036a0456f32",
          "code": "33070",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33070",
          "code_system": "CHEBI",
          "references": [
            "b6cc45b6-5800-e7a6-225c-352c1df6150e"
          ]
        },
        {
          "uuid": "2c3883b7-6eda-4b8c-c52b-c2e233c9d3db",
          "code": "3130",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3130",
          "code_system": "NSC",
          "references": [
            "702ea1eb-9d02-900c-22f1-b401c3eb6134"
          ]
        },
        {
          "uuid": "914630d3-59b0-5d75-e712-8ce96330deb5",
          "code": "300000053401",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "27011afa-ef95-bba4-191a-4b6dd7bff935"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5d31f9ff-94e5-4a0b-a206-7d8c49377fec",
          "name": "1H-INDOLE-3-BUTANOIC ACID",
          "stdName": "1H-INDOLE-3-BUTANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53c8457e-4e10-42d4-a782-83fb880b30a1",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        },
        {
          "uuid": "96454ad2-8719-4f84-860f-3906247407d4",
          "name": "4-(3-INDOLYL)BUTYRIC ACID",
          "stdName": "4-(3-INDOLYL)BUTYRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53c8457e-4e10-42d4-a782-83fb880b30a1",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        },
        {
          "uuid": "1714b800-c731-4036-8a07-a528e7982c9b",
          "name": "4-INDOL-3-YLBUTYRIC ACID",
          "stdName": "4-INDOL-3-YLBUTYRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59304d2a-2af5-4156-949b-aa1daad2d1ac",
            "6a0fe9eb-707a-4f7a-9798-6961cc3ecb9c",
            "6a345c42-e231-47c5-be34-4d74f1b6ef81",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd",
            "f98534ef-7cef-4f7a-8038-899af4972471"
          ],
          "display_name": false
        },
        {
          "uuid": "14cb1723-ce86-4afc-9cae-bfb55c3e115b",
          "name": "4-INDOL-3-YLBUTYRIC ACID [HSDB]",
          "stdName": "4-INDOL-3-YLBUTYRIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a345c42-e231-47c5-be34-4d74f1b6ef81",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        },
        {
          "uuid": "e178755a-17f4-4dae-a781-b0d474b9daed",
          "name": "4-INDOL-3-YLBUTYRIC ACID [ISO]",
          "stdName": "4-INDOL-3-YLBUTYRIC ACID [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59304d2a-2af5-4156-949b-aa1daad2d1ac",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        },
        {
          "uuid": "6391af25-c53a-401d-8179-6bec30f12795",
          "name": "INDOLE-3-BUTYRIC ACID",
          "stdName": "INDOLE-3-BUTYRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d90cab66-7daf-4e39-98db-d927e84ed9ae"
          ],
          "display_name": false
        },
        {
          "uuid": "1bc47bd5-d476-4f7c-82bc-d98c8887729a",
          "name": "INDOLEBUTYRIC ACID",
          "stdName": "INDOLEBUTYRIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53c8457e-4e10-42d4-a782-83fb880b30a1",
            "bfcb2c5e-fe5a-463a-b492-62fe23629aac",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd",
            "d170c633-5191-4d1a-93f4-792d19649d1a"
          ],
          "display_name": true
        },
        {
          "uuid": "e32ab4de-9645-44d1-bf27-1a489ae9845d",
          "name": "INDOLEBUTYRIC ACID [MI]",
          "stdName": "INDOLEBUTYRIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfcb2c5e-fe5a-463a-b492-62fe23629aac",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        },
        {
          "uuid": "dfcd35d5-eded-4ea5-9ab2-ecce1fa5857d",
          "name": "NSC-3130",
          "stdName": "NSC-3130",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf9eceed-116c-4c81-8c23-5987a5e3f68a",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        },
        {
          "uuid": "550a1f74-c3b9-45ea-b462-211dd7d7ee2b",
          "name": "SERADIX",
          "stdName": "SERADIX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e95536de-7a05-43ef-841d-60e693d7e878",
            "96e778e9-68b7-44fc-ab6c-74e441ff03bd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d90cab66-7daf-4e39-98db-d927e84ed9ae",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bfcb2c5e-fe5a-463a-b492-62fe23629aac",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96e778e9-68b7-44fc-ab6c-74e441ff03bd",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53c8457e-4e10-42d4-a782-83fb880b30a1",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf9eceed-116c-4c81-8c23-5987a5e3f68a",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e95536de-7a05-43ef-841d-60e693d7e878",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a345c42-e231-47c5-be34-4d74f1b6ef81",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59304d2a-2af5-4156-949b-aa1daad2d1ac",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af353e6b-a4c0-4386-8203-e30657e1eed7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce66ab5a-7904-4141-bc2f-33a9446131d3",
          "citation": "SRS import [061SKE27JP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=061SKE27JP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "590e165d-79e1-4a58-be99-52f7019d8b10",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d170c633-5191-4d1a-93f4-792d19649d1a",
          "citation": "INDOLEBUTYRIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a0fe9eb-707a-4f7a-9798-6961cc3ecb9c",
          "citation": "4-INDOL-3-YLBUTYRIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f98534ef-7cef-4f7a-8038-899af4972471",
          "citation": "4-INDOL-3-YLBUTYRIC ACID [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10b6134f-c197-be00-a5c7-73061986e14f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+133-32-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0b44d9d5-89ad-b66c-8237-2bf4fdd0b893",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=133-32-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6cc45b6-5800-e7a6-225c-352c1df6150e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ec968344-ae6e-410a-8124-e6954aa2221f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "702ea1eb-9d02-900c-22f1-b401c3eb6134",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "27011afa-ef95-bba4-191a-4b6dd7bff935",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7f465122-88a0-4c72-925c-8c50fa86955f",
          "id": "7f465122-88a0-4c72-925c-8c50fa86955f",
          "molfile": "\n  Marvin  07202116552D          \n\n 15 16  0  0  0  0            999 V2000\n   16.4814   -2.3661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0596   -3.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2347   -3.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8130   -3.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9881   -3.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1388   -3.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3510   -4.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1691   -5.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7749   -5.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5628   -5.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7448   -4.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5663   -4.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2719   -5.7741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8921   -5.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4722   -3.7790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 12  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 13  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 13  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(CCCC(=O)O)c[nH]2",
          "formula": "C12H13NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ceeb9b2a-2b5a-4b8a-bbc3-66b89e438a17"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "203.2376",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a1493450-b5ac-4aec-84a0-2379955072cb",
      "version": "10",
      "structure": {
        "id": "8cbdd6e0-4bff-461b-834c-a1bd1b547712",
        "molfile": "\n   JSDraw207202116552D\n\n 15 16  0  0  0  0              0 V2000\n   31.1641   -4.4740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.3666   -5.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8067   -5.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0094   -7.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4496   -7.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.9529   -7.5401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4632   -8.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1192   -9.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2647  -10.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.7546  -10.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0987   -8.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6521   -8.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.0954  -10.9180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2681   -9.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1466   -7.1456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 11  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 13  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 13  1  0  0  0  0\n 12  5  1  0  0  0  0\n  2 15  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(CCCC(=O)O)c[nH]2",
        "formula": "C12H13NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "203.2376",
        "optical_activity": "NONE",
        "references": [
          "590e165d-79e1-4a58-be99-52f7019d8b10",
          "ce66ab5a-7904-4141-bc2f-33a9446131d3"
        ],
        "stereo_centers": 0
      },
      "unii": "061SKE27JP"
    }
  ]
}