{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cb05f895-fbc3-4625-9a55-94458c82c3df", "code": "62249", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62249", "code_system": "PUBCHEM", "references": [ "426eaff5-defc-4875-8edc-e28cb6d3710a" ] }, { "uuid": "10fc3d7f-f1c2-4255-aa6a-1fb860dbcaa0", "code": "68427-35-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68427-35-0", "code_system": "CAS", "references": [ "426eaff5-defc-4875-8edc-e28cb6d3710a", "4e5c6aab-9fb9-4e2f-b0ed-3137c92dabb5" ] }, { "uuid": "c8691373-b751-4496-b82c-1b8f73ae8f28", "code": "270-393-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.975", "code_system": "ECHA (EC/EINECS)", "references": [ "426eaff5-defc-4875-8edc-e28cb6d3710a" ] }, { "uuid": "3afd8a65-73cc-9609-8184-a34acd4b90c8", "code": "DTXSID6041476", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6041476", "code_system": "EPA CompTox", "references": [ "316ed3d1-e8e1-9504-0faa-07d3968fdd3c" ] }, { "uuid": "43528b1f-e941-474e-b8c1-195420bd1ed4", "code": "05ZE90DQA4", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b480932f-e0a5-447d-be02-5a1c9d09d683", "name": "3-(5-(AMINOSULFONYL)BENZOXAZOL-2-YL)-7-(DIETHYLAMINO)COUMARIN", "stdName": "3-(5-(AMINOSULFONYL)BENZOXAZOL-2-YL)-7-(DIETHYLAMINO)COUMARIN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d4d22ade-cd4e-47c0-8435-e248fb266047" ], "display_name": true }, { "uuid": "cb976a3c-9a27-4087-963d-cb623de2657f", "name": "5-BENZOXAZOLESULFONAMIDE, 2-(7-(DIETHYLAMINO)-2-OXO-2H-1-BENZOPYRAN-3-YL)-", "stdName": "5-BENZOXAZOLESULFONAMIDE, 2-(7-(DIETHYLAMINO)-2-OXO-2H-1-BENZOPYRAN-3-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "04f93cb6-e376-46a4-8e0d-8d195b8ee473" ], "display_name": false } ], "references": [ { "uuid": "d4d22ade-cd4e-47c0-8435-e248fb266047", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "04f93cb6-e376-46a4-8e0d-8d195b8ee473", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "426eaff5-defc-4875-8edc-e28cb6d3710a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392566000, "tags": [ "NOMEN" ] }, { "uuid": "2a1c900c-9231-4880-8b8c-4508d6829239", "citation": "SRS import [05ZE90DQA4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=05ZE90DQA4", "doc_type": "SRS", "public_domain": true, "document_date": 1493392566000, "tags": [ "NOMEN" ] }, { "uuid": "316ed3d1-e8e1-9504-0faa-07d3968fdd3c", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68427-35-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4e5c6aab-9fb9-4e2f-b0ed-3137c92dabb5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4182f6a1-d0aa-4f8d-8565-81722e0b29ad", "id": "4182f6a1-d0aa-4f8d-8565-81722e0b29ad", "molfile": "\n Marvin 01132103272D \n\n 29 32 0 0 0 0 999 V2000\n 8.6504 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0660 -0.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6602 -1.4252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0760 -2.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8975 -2.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8387 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4231 -0.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6016 -0.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1859 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3644 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9487 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1272 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6423 -2.8109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8505 -2.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1378 -2.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4252 -2.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4252 -1.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1378 -1.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8505 -1.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6423 -1.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7126 -2.9693 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.3849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2969 -2.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1283 -3.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3644 -2.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9487 -3.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1958 -2.8604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6016 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4330 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 6 1 0 0 0 0\n 4 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 29 6 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 28 2 0 0 0 0\n 11 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 25 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 20 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 2 0 0 0 0\n 26 25 2 0 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\nM END", "smiles": "CCN(CC)c1ccc2cc(-c3nc4cc(ccc4o3)S(=O)(=O)N)c(=O)oc2c1", "formula": "C20H19N3O5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b96fe677-46dc-4f9f-9b9a-d51d90b0face" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "413.4488", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "19c59e9d-01c6-444f-a254-aed0accfefe4", "version": "3", "structure": { "id": "b559b8ca-6bea-4d34-9a9e-7aa714af0d89", "molfile": "\n Marvin 01132109232D \n\n 29 32 0 0 0 0 999 V2000\n 4.9487 -3.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7126 -2.9693 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.3849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2969 -2.2566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1283 -3.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6602 -1.4252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0660 -0.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0760 -2.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6504 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8975 -2.1280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9487 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3644 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3644 -2.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1859 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1958 -2.8604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6016 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6016 -0.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4330 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4231 -0.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8387 -1.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1272 -2.1478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6423 -2.8109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6423 -1.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8505 -2.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8505 -1.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1378 -2.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1378 -1.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4252 -2.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4252 -1.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 13 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 2 5 2 0 0 0 0\n 2 28 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 6 20 1 0 0 0 0\n 7 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 11 21 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 28 29 2 0 0 0 0\nM END", "smiles": "CCN(CC)c1ccc2cc(-c3nc4cc(ccc4o3)S(=O)(=O)N)c(=O)oc2c1", "formula": "C20H19N3O5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "413.4488", "optical_activity": "NONE", "references": [ "2a1c900c-9231-4880-8b8c-4508d6829239", "d4d22ade-cd4e-47c0-8435-e248fb266047" ], "stereo_centers": 0 }, "unii": "05ZE90DQA4" } ] }