{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "329af2e8-61a5-42bf-963c-8994a83b648b",
          "code": "77-95-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-95-2",
          "code_system": "CAS",
          "references": [
            "4a19ab5d-769a-474a-a83c-dd10f8c65b3d",
            "7f016568-f3fe-46d4-b3cf-f18d374d96cb"
          ]
        },
        {
          "uuid": "df3b0fa4-9a20-4273-bbd6-727c3ce650cf",
          "code": "QUINIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Quinic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "4a19ab5d-769a-474a-a83c-dd10f8c65b3d"
          ]
        },
        {
          "uuid": "e7fdce07-66b8-4188-af58-840ad4f0ae41",
          "code": "1427232",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427232/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4a19ab5d-769a-474a-a83c-dd10f8c65b3d"
          ]
        },
        {
          "uuid": "2faf520f-ec62-409e-802d-0b1de9ec5342",
          "code": "m9445",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9445?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4a19ab5d-769a-474a-a83c-dd10f8c65b3d"
          ]
        },
        {
          "uuid": "070b7fb3-0ccd-4821-a84c-a3ef0df0e655",
          "code": "201-072-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.976",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a19ab5d-769a-474a-a83c-dd10f8c65b3d"
          ]
        },
        {
          "uuid": "8dc32202-d34d-bb89-fffa-07d1265fb5e8",
          "code": "227 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|Chemical|Quinic Acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=227&item=Quinic Acid",
          "code_system": "DSLD",
          "references": [
            "597ee4be-9841-0ebe-7771-f6f191e9486d"
          ]
        },
        {
          "uuid": "55ec5fcd-6b1b-41a5-bac2-443762534a44",
          "code": "058C04BGYI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0331d0f0-43c1-4e38-1f0a-bedb7cf59420",
          "code": "1594506",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1594506",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "597ee4be-9841-0ebe-7771-f6f191e9486d"
          ]
        },
        {
          "uuid": "334b9d10-3508-d901-2739-88eacecb259c",
          "code": "17521",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17521",
          "code_system": "CHEBI",
          "references": [
            "597ee4be-9841-0ebe-7771-f6f191e9486d"
          ]
        },
        {
          "uuid": "dc2656a9-b809-e2a0-49d2-545f5ab3bd67",
          "code": "59258",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=59258",
          "code_system": "NSC",
          "references": [
            "1f0f9803-6aaf-e08a-f377-b45a161a7eb1"
          ]
        },
        {
          "uuid": "730b2059-7a8d-4c3d-be96-cd93c41b2447",
          "code": "058C04BGYI",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=058C04BGYI",
          "code_system": "DAILYMED",
          "references": [
            "65104290-1a17-fae3-f37c-3d3c979d0706"
          ]
        },
        {
          "uuid": "655898dd-b4fd-9dcc-0735-af97bb34b28d",
          "code": "300000037939",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1c07f9c4-2121-5998-e006-1dfc6bc58ed1"
          ]
        },
        {
          "uuid": "d26f4743-b0e3-45bf-c611-09ae073795a9",
          "code": "DTXSID70998288",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70998288",
          "code_system": "EPA CompTox",
          "references": [
            "597ee4be-9841-0ebe-7771-f6f191e9486d"
          ]
        },
        {
          "uuid": "5d501fca-3e23-439a-8cbd-2fe566ea58a3",
          "code": "562-73-2",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=562-73-2",
          "code_system": "CAS",
          "references": [
            "7f016568-f3fe-46d4-b3cf-f18d374d96cb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9a2e7ebc-ca89-44e8-aa95-faa66cd77443",
          "amount": {
            "uuid": "0a391d0d-5879-4236-ac7f-24051548f694"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "55967acf-3ec6-4b6c-8a24-683f3f15a326",
            "refuuid": "1415c81c-0f43-4488-9d84-bdb597e6f4d5",
            "name": "Quinic Acid",
            "unii": "058C04BGYI",
            "linking_id": "058C04BGYI",
            "ref_pname": "Quinic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3eaefd1e-a943-4bcd-acfb-dac96b97b408",
          "amount": {
            "uuid": "9c944692-fa42-4e0e-9acb-202295b52940"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "7ee4ea65-038a-4064-baf1-60e8ba5d33ac",
            "refuuid": "f98173bf-9ddf-481a-b456-325744b70230",
            "name": "CALCIUM QUINATE GLUCONATE",
            "unii": "KWI1NH797Q",
            "linking_id": "KWI1NH797Q",
            "ref_pname": "CALCIUM QUINATE GLUCONATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e53797a8-2c7c-49ad-b66c-738e3ec4b7d0",
          "name": "(-)-QUINIC ACID",
          "stdName": "(-)-QUINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43714c0c-54f2-45fe-b1f8-be8d43a25ca9",
            "d84b2685-6bb6-4a7e-84d9-41554fec2431"
          ],
          "display_name": false
        },
        {
          "uuid": "815a533e-30e7-4e03-9efa-e506d6aa0690",
          "name": "(-)-QUINIC ACID (CONSTITUENT OF CRANBERRY LIQUID PREPARATION) [DSC]",
          "stdName": "(-)-QUINIC ACID (CONSTITUENT OF CRANBERRY LIQUID PREPARATION) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d84b2685-6bb6-4a7e-84d9-41554fec2431",
            "39d2c141-9cf5-4ceb-afc5-5efd4d253e9a"
          ],
          "display_name": false
        },
        {
          "uuid": "b891a3cb-e820-4503-bcee-f516b3f26958",
          "name": "(1α,3R,4α,5R)-1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid",
          "stdName": "(1.ALPHA.,3R,4.ALPHA.,5R)-1,3,4,5-TETRAHYDROXYCYCLOHEXANECARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f016568-f3fe-46d4-b3cf-f18d374d96cb"
          ],
          "display_name": false
        },
        {
          "uuid": "e7a09bd3-d0b0-4b92-aa24-a133f83c975b",
          "name": "1,3,4,5-Tetrahydroxycyclohexane-1-carboxylic acid",
          "stdName": "1,3,4,5-TETRAHYDROXYCYCLOHEXANE-1-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f016568-f3fe-46d4-b3cf-f18d374d96cb"
          ],
          "display_name": false
        },
        {
          "uuid": "eb514658-e611-40db-a70f-9c5997354258",
          "name": "Cyclohexanecarboxylic acid, 1,3,4,5-tetrahydroxy-, (-)-",
          "stdName": "CYCLOHEXANECARBOXYLIC ACID, 1,3,4,5-TETRAHYDROXY-, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43714c0c-54f2-45fe-b1f8-be8d43a25ca9",
            "d84b2685-6bb6-4a7e-84d9-41554fec2431"
          ],
          "display_name": false
        },
        {
          "uuid": "6288b566-96a9-485c-befd-1109ec2648c2",
          "name": "Cyclohexanecarboxylic acid, 1,3,4,5-tetrahydroxy-, (1α,3R,4α,5R)-",
          "stdName": "CYCLOHEXANECARBOXYLIC ACID, 1,3,4,5-TETRAHYDROXY-, (1.ALPHA.,3R,4.ALPHA.,5R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43714c0c-54f2-45fe-b1f8-be8d43a25ca9",
            "d84b2685-6bb6-4a7e-84d9-41554fec2431"
          ],
          "display_name": false
        },
        {
          "uuid": "a1f337ed-3ebe-4018-9dd6-20effc992017",
          "name": "D-(-)-Quinic acid",
          "stdName": "D-(-)-QUINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f016568-f3fe-46d4-b3cf-f18d374d96cb"
          ],
          "display_name": false
        },
        {
          "uuid": "5fb49e65-5ee9-4d4c-bd1a-647331b37419",
          "name": "NSC-59258",
          "stdName": "NSC-59258",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d84b2685-6bb6-4a7e-84d9-41554fec2431",
            "87d1f2e8-db27-413b-bed6-b1a1c1ab5847"
          ],
          "display_name": false
        },
        {
          "uuid": "523dfff2-9407-4fa6-95a6-6bb9eca85a42",
          "name": "QUINIC ACID [MI]",
          "stdName": "QUINIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc6de79-845f-4198-bb05-1e6ee2ba2431",
            "d84b2685-6bb6-4a7e-84d9-41554fec2431"
          ],
          "display_name": false
        },
        {
          "uuid": "e1be78ec-8f56-4a22-b98d-f1d03c3389a6",
          "name": "QUINIC ACID [USP-RS]",
          "stdName": "QUINIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efda755c-ddf5-4426-9fb6-5f8c43887dc2",
            "d84b2685-6bb6-4a7e-84d9-41554fec2431"
          ],
          "display_name": false
        },
        {
          "uuid": "4b2a6f6d-af3c-4e29-bc70-dcaf41e83354",
          "name": "Quinic Acid",
          "stdName": "QUINIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dbbd819-7b85-42fc-b976-07ea8dd75df2",
            "efda755c-ddf5-4426-9fb6-5f8c43887dc2",
            "afc0e362-7cc5-4d11-a27b-ba04b2c0127f",
            "d84b2685-6bb6-4a7e-84d9-41554fec2431",
            "e1fd2007-d22f-4a7e-99ab-a6409beb74f9",
            "361d018d-fa36-4084-b2ab-b7f0505bc3aa",
            "8c2e6111-c599-40ec-9604-3d7c8d330a39",
            "1fc6de79-845f-4198-bb05-1e6ee2ba2431",
            "527aacff-e92a-4074-9b3d-0192f988c0e6",
            "d2fae9b2-21c7-479d-a13e-e3754e8046a8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e1e5097e-de5a-4c5d-a4b6-fccdeac1a057",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "24745202-0d18-2759-9faf-6e5c41502eb8",
          "name": "Quinic acid [WHO-DD]",
          "stdName": "QUINIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1455156d-6b59-a4f9-da6a-e460f0bcc9b7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8c2e6111-c599-40ec-9604-3d7c8d330a39",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d84b2685-6bb6-4a7e-84d9-41554fec2431",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fc6de79-845f-4198-bb05-1e6ee2ba2431",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43714c0c-54f2-45fe-b1f8-be8d43a25ca9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87d1f2e8-db27-413b-bed6-b1a1c1ab5847",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2fae9b2-21c7-479d-a13e-e3754e8046a8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efda755c-ddf5-4426-9fb6-5f8c43887dc2",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afc0e362-7cc5-4d11-a27b-ba04b2c0127f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39d2c141-9cf5-4ceb-afc5-5efd4d253e9a",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a19ab5d-769a-474a-a83c-dd10f8c65b3d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05523d04-0dc7-4549-8e10-f2733c37d278",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10e354f1-41ba-43c5-a072-20208f68d35e",
          "citation": "SRS import [058C04BGYI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=058C04BGYI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dbbd819-7b85-42fc-b976-07ea8dd75df2",
          "citation": "QUINIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "361d018d-fa36-4084-b2ab-b7f0505bc3aa",
          "citation": "QUINIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1fd2007-d22f-4a7e-99ab-a6409beb74f9",
          "citation": "QUINIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "527aacff-e92a-4074-9b3d-0192f988c0e6",
          "citation": "QUINIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c07f9c4-2121-5998-e006-1dfc6bc58ed1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "597ee4be-9841-0ebe-7771-f6f191e9486d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7f016568-f3fe-46d4-b3cf-f18d374d96cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c5b1aeb9-dfc0-ac04-3419-3d1a014c4244",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "1f0f9803-6aaf-e08a-f377-b45a161a7eb1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "65104290-1a17-fae3-f37c-3d3c979d0706",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1455156d-6b59-a4f9-da6a-e460f0bcc9b7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dd22feba-2b4e-4601-8137-48725b936582",
          "id": "dd22feba-2b4e-4601-8137-48725b936582",
          "molfile": "\n  Marvin  10112307012D          \n\n 13 13  0  0  1  0            999 V2000\n   14.4759   -3.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2511   -3.8218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3326   -2.7273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4759   -4.6003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1939   -2.6410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1939   -5.4990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3689   -4.0701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8439   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.4314   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4314   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6064   -3.3555    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.6064   -4.7845    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.1939   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  8  1  1  1  0  0  0\n  8  4  1  0  0  0  0\n 11  5  1  6  0  0  0\n 12  6  1  1  0  0  0\n 13  7  1  6  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
          "smiles": "C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)O)O)O",
          "formula": "C7H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "69c2e760-fa29-4427-92d7-81e39f0561e8"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "192.1669",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1415c81c-0f43-4488-9d84-bdb597e6f4d5",
      "version": "22",
      "structure": {
        "id": "c6c8c154-6bd5-49a1-b309-97df7e50840b",
        "molfile": "(1?,3S,4?,5S)-1,3,4,5-Tetrahydroxycyclohexanecarboxylic acid\n   JSDraw210112307012D\n\n 13 13  0  0  1  0              0 V2000\n   27.3726   -6.6933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.8385   -7.2267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1016   -5.1570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3726   -8.6988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0575   -4.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0575  -10.3981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4975   -7.6961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.1775   -7.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3975   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3975   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8375   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8375   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0575   -7.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  8  1  1  1  0  0  0\n  8  4  1  0  0  0  0\n 11  5  1  6  0  0  0\n 12  6  1  1  0  0  0\n 13  7  1  6  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 13  1  0  0  0  0\nM  END",
        "smiles": "C1[C@H]([C@H]([C@@H](C[C@@]1(C(=O)O)O)O)O)O",
        "formula": "C7H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "192.1669",
        "optical_activity": "( - )",
        "references": [
          "43714c0c-54f2-45fe-b1f8-be8d43a25ca9",
          "10e354f1-41ba-43c5-a072-20208f68d35e"
        ],
        "stereo_centers": 4
      },
      "unii": "058C04BGYI"
    }
  ]
}