{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "161f2085-5f2f-4ece-a25c-07ab2b5af687",
          "code": "158099-19-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=158099-19-5",
          "code_system": "CAS",
          "references": [
            "1cce22b5-d5f5-4053-a4fe-00731ad574d2",
            "74640837-32a1-4fd3-8d49-beeda8aa3856"
          ]
        },
        {
          "uuid": "91d4eaeb-2cec-4aa9-b9fd-f2e0450360af",
          "code": "23689668",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23689668",
          "code_system": "PUBCHEM",
          "references": [
            "1cce22b5-d5f5-4053-a4fe-00731ad574d2"
          ]
        },
        {
          "uuid": "5b9f0513-2b01-15ce-9ce3-740526ed6860",
          "code": "DTXSID80166375",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80166375",
          "code_system": "EPA CompTox",
          "references": [
            "56362089-1bf1-6e92-7608-87a22e42bd24"
          ]
        },
        {
          "uuid": "e2fdf26b-0851-4859-b1eb-b55cefeac95d",
          "code": "058078A0QS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "b72aa86b-6fca-43cb-909b-1230953c145c",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "178f43a2-702d-4391-9299-46446b896990",
            "refuuid": "6aac51d6-7e63-4e9f-b50c-88f34d87a786",
            "name": "ENSULIZOLE",
            "unii": "9YQ9DI1W42",
            "linking_id": "9YQ9DI1W42",
            "ref_pname": "ENSULIZOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "90fc1792-0f27-4712-9b4d-38868e511102",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4211e558-2425-44ea-a848-08e682b4d665",
            "refuuid": "6aac51d6-7e63-4e9f-b50c-88f34d87a786",
            "name": "ENSULIZOLE",
            "unii": "9YQ9DI1W42",
            "linking_id": "9YQ9DI1W42",
            "ref_pname": "ENSULIZOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c18cc37c-3c06-4466-a4ed-2cee2236682c",
          "name": "1H-BENZIMIDAZOLE-5-SULFONIC ACID, 2-PHENYL-, MONOPOTASSIUM SALT",
          "stdName": "1H-BENZIMIDAZOLE-5-SULFONIC ACID, 2-PHENYL-, MONOPOTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "93ff6f4c-0922-4dd0-9e2e-82c04bbd166c"
          ],
          "display_name": false
        },
        {
          "uuid": "c8f06bcf-807d-4d7e-acb3-c7f995060857",
          "name": "1H-BENZIMIDAZOLE-6-SULFONIC ACID, 2-PHENYL-, POTASSIUM SALT (1:1)",
          "stdName": "1H-BENZIMIDAZOLE-6-SULFONIC ACID, 2-PHENYL-, POTASSIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "93ff6f4c-0922-4dd0-9e2e-82c04bbd166c"
          ],
          "display_name": false
        },
        {
          "uuid": "5782d745-6dea-4d28-b82e-58549ba2d087",
          "name": "2-PHENYLBENZIMIDAZOLE-5-SULFONIC ACID, POTASSIUM SALT",
          "stdName": "2-PHENYLBENZIMIDAZOLE-5-SULFONIC ACID, POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "4644a7e5-ce3d-4eb1-b67e-71e0eb346237"
          ],
          "display_name": false
        },
        {
          "uuid": "557c8c0a-2a05-4f2c-8bd9-8a53f86cf38f",
          "name": "ENSULIZOLE POTASSIUM",
          "stdName": "ENSULIZOLE POTASSIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "70f205db-c44e-4f73-bbc3-b87820d586f0"
          ],
          "display_name": true
        },
        {
          "uuid": "5762a797-c230-4d0a-b1bb-dd80172fa41e",
          "name": "PHENYLBENZIMIDAZOLE SULFONIC ACID POTASSIUM SALT",
          "stdName": "PHENYLBENZIMIDAZOLE SULFONIC ACID POTASSIUM SALT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "4644a7e5-ce3d-4eb1-b67e-71e0eb346237"
          ],
          "display_name": false
        },
        {
          "uuid": "bcec119d-8dab-4156-b68e-20ccc24f7b25",
          "name": "POTASSIUM 2-PHENYLBENZIMIDAZOLE-5-SULFONATE",
          "stdName": "POTASSIUM 2-PHENYLBENZIMIDAZOLE-5-SULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "93ff6f4c-0922-4dd0-9e2e-82c04bbd166c"
          ],
          "display_name": false
        },
        {
          "uuid": "a9e53b68-6e88-4681-8b47-75014b572f76",
          "name": "POTASSIUM PHENYLBENZIMIDAZOLE SULFONATE",
          "stdName": "POTASSIUM PHENYLBENZIMIDAZOLE SULFONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "5a3cf779-dca1-475f-a04e-7c9b9301022d",
            "4644a7e5-ce3d-4eb1-b67e-71e0eb346237",
            "e29bf78d-de18-4ab2-83c4-b51e1ee12397"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e6b9376a-bf54-4306-a8dc-8977b1b73f3e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "70f205db-c44e-4f73-bbc3-b87820d586f0",
          "citation": "ec.europa.eu/consumers/cosmetics/cosing/i",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5a3cf779-dca1-475f-a04e-7c9b9301022d",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4644a7e5-ce3d-4eb1-b67e-71e0eb346237",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93ff6f4c-0922-4dd0-9e2e-82c04bbd166c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cce22b5-d5f5-4053-a4fe-00731ad574d2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4734193-3991-4e53-b198-4844a11c6a33",
          "citation": "SRS import [058078A0QS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=058078A0QS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e29bf78d-de18-4ab2-83c4-b51e1ee12397",
          "citation": "POTASSIUM PHENYLBENZIMIDAZOLE SULFONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "56362089-1bf1-6e92-7608-87a22e42bd24",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=158099-19-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74640837-32a1-4fd3-8d49-beeda8aa3856",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "362fb65c-bd5f-4936-b528-a1dea0ff4137",
          "id": "362fb65c-bd5f-4936-b528-a1dea0ff4137",
          "molfile": "\n  Marvin  01132102532D          \n\n  1  0  0  0  0  0            999 V2000\n    6.0027   -4.5621    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "475d3566-0e56-4e83-a3f2-ceaa2253e2ea"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2ef6b7d3-2cb2-4f1c-8eb3-c84e2f851828",
          "id": "2ef6b7d3-2cb2-4f1c-8eb3-c84e2f851828",
          "molfile": "\n  Marvin  01132102312D          \n\n 19 21  0  0  0  0            999 V2000\n    6.0750   -3.9438    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.2465   -3.1369    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4395   -2.9653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4180   -2.3299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0535   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3084   -4.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1154   -4.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6674   -3.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4924   -3.6514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7473   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0799   -2.3819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4124   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6055   -2.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5320   -2.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7035   -1.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4881   -1.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1012   -2.1020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9296   -2.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1450   -3.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 13  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 12  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 14  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccc(cc1)-c2[nH]c3ccc(cc3n2)S(=O)(=O)[O-]",
          "formula": "C13H9N2O3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "470e5bd1-6bc9-43fe-a6ed-7a2207ef1285"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "273.2887",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "00293f6f-f741-40a2-9b78-52bb2ab9be06",
      "version": "4",
      "structure": {
        "id": "ea0952b2-5265-47b0-8900-12f9de82a88a",
        "molfile": "\n  Marvin  01132112062D          \n\n 20 21  0  0  0  0            999 V2000\n    9.0799   -2.3819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7473   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4924   -3.6514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6674   -3.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4124   -2.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1154   -4.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3084   -4.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0535   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6055   -2.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5320   -2.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7035   -1.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4881   -1.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1012   -2.1020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9296   -2.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1450   -3.1639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2465   -3.1369    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0750   -3.9438    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4395   -2.9653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4180   -2.3299    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0027   -4.5621    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  1  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  4  6  1  0  0  0  0\n  2 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 11 10  2  0  0  0  0\n 10 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  2  0  0  0  0\nM  CHG  2  17  -1  20   1\nM  END",
        "smiles": "c1ccc(cc1)-c2nc3ccc(cc3[nH]2)S(=O)(=O)[O-].[K+]",
        "formula": "C13H9N2O3S.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "312.387",
        "optical_activity": "NONE",
        "references": [
          "93ff6f4c-0922-4dd0-9e2e-82c04bbd166c",
          "e4734193-3991-4e53-b198-4844a11c6a33"
        ],
        "stereo_centers": 0
      },
      "unii": "058078A0QS"
    }
  ]
}