{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7fa3339f-fd2d-498a-b0eb-8cb8455d3fb5",
          "code": "15872-89-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15872-89-6",
          "code_system": "CAS",
          "references": [
            "8ca4a395-5c6c-4f0c-9fe2-426f6d094765",
            "099917d8-1f93-4a60-aa23-1c7677610884"
          ]
        },
        {
          "uuid": "986d3def-8876-42c4-9dbf-3ee401fbaa56",
          "code": "239-996-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.346",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8ca4a395-5c6c-4f0c-9fe2-426f6d094765"
          ]
        },
        {
          "uuid": "09c7d760-9c7b-4cff-938f-c4cebccf2d8b",
          "code": "1488055",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1488055/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8ca4a395-5c6c-4f0c-9fe2-426f6d094765"
          ]
        },
        {
          "uuid": "822d200f-7fe8-48ad-adab-d0eda1874e0b",
          "code": "85155",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/85155",
          "code_system": "PUBCHEM",
          "references": [
            "8ca4a395-5c6c-4f0c-9fe2-426f6d094765"
          ]
        },
        {
          "uuid": "cd5104d5-0df9-fb74-4b20-6d746cfdab3f",
          "code": "DTXSID10166505",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10166505",
          "code_system": "EPA CompTox",
          "references": [
            "7cc53dcc-0f3a-3692-91af-cb68ac51faf6"
          ]
        },
        {
          "uuid": "fa202221-b5f9-4e9f-95e5-bfa3910abe56",
          "code": "057N7SS26Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3f6030d7-4031-618b-a616-884bfb394401",
          "code": "057N7SS26Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=057N7SS26Y",
          "code_system": "DAILYMED",
          "references": [
            "9423832e-6bc5-9137-f24a-9fcfda5ee979"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fd4e91e2-dbc2-4bc5-a72d-b7a083bd7319",
          "name": "BUTANEDIOIC ACID, 1,4-DIHEPTYL ESTER",
          "stdName": "BUTANEDIOIC ACID, 1,4-DIHEPTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f4d09af-7b36-404a-b72b-4157344ea71a",
            "3d8fcfed-3e0f-43e2-9b93-8f9d3b70810e"
          ],
          "display_name": false
        },
        {
          "uuid": "efe7b39b-8aa9-4d0e-9cef-184af072835a",
          "name": "BUTANEDIOIC ACID, DIHEPTYL ESTER",
          "stdName": "BUTANEDIOIC ACID, DIHEPTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "841c656b-4073-4348-af03-1e70d70f825a",
            "3d8fcfed-3e0f-43e2-9b93-8f9d3b70810e"
          ],
          "display_name": false
        },
        {
          "uuid": "3e3d370a-5a68-4316-b1ba-c9857366e3bf",
          "name": "DIHEPTYL SUCCINATE",
          "stdName": "DIHEPTYL SUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f4d09af-7b36-404a-b72b-4157344ea71a",
            "3d8fcfed-3e0f-43e2-9b93-8f9d3b70810e",
            "75872680-70f8-4d9e-8314-6f0ddc3f8e7f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b9c77b14-1bab-4afe-8d25-5821e9132b89",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "68b2c277-29db-4afe-b2af-77ba78ec575a",
          "name": "LEXFEEL DHS",
          "stdName": "LEXFEEL DHS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f4d09af-7b36-404a-b72b-4157344ea71a",
            "3d8fcfed-3e0f-43e2-9b93-8f9d3b70810e"
          ],
          "display_name": false
        },
        {
          "uuid": "ca8ccc9b-8207-4ee6-9cd9-967da42e3aef",
          "name": "SUCCINIC ACID, DIHEPTYL ESTER",
          "stdName": "SUCCINIC ACID, DIHEPTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "841c656b-4073-4348-af03-1e70d70f825a",
            "3d8fcfed-3e0f-43e2-9b93-8f9d3b70810e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8f4d09af-7b36-404a-b72b-4157344ea71a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3d8fcfed-3e0f-43e2-9b93-8f9d3b70810e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "841c656b-4073-4348-af03-1e70d70f825a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ca4a395-5c6c-4f0c-9fe2-426f6d094765",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4f431d1-bb08-4156-a762-a26f34d77933",
          "citation": "SRS import [057N7SS26Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=057N7SS26Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75872680-70f8-4d9e-8314-6f0ddc3f8e7f",
          "citation": "DIHEPTYL SUCCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7cc53dcc-0f3a-3692-91af-cb68ac51faf6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15872-89-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "099917d8-1f93-4a60-aa23-1c7677610884",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9423832e-6bc5-9137-f24a-9fcfda5ee979",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "499319e7-b712-4f4f-bec7-e603dc351d71",
          "id": "499319e7-b712-4f4f-bec7-e603dc351d71",
          "molfile": "\n  Marvin  01132103512D          \n\n 22 21  0  0  0  0            999 V2000\n   11.8490   -2.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2615   -2.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -3.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2615   -4.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -5.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2615   -5.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -6.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0240   -6.4684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6115   -7.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0240   -7.8974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7865   -7.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3740   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5490   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1365   -7.1829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1365   -8.6118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3115   -8.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8990   -9.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0740   -9.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6615  -10.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8365  -10.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4240  -10.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5990  -10.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCOC(=O)CCC(=O)OCCCCCCC",
          "formula": "C18H34O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e80ca3aa-5910-4500-87ef-f06c12b703e1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "314.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5202c047-d69f-4ac4-9f10-12a5c61dd57a",
      "version": "5",
      "structure": {
        "id": "35efa473-e925-4fce-a5ff-3ed929b6f207",
        "molfile": "\n  Marvin  01132102522D          \n\n 22 21  0  0  0  0            999 V2000\n   10.6115   -7.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0240   -6.4684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -6.4684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2615   -5.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -5.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2615   -4.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -3.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2615   -2.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8490   -2.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0240   -7.8974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7865   -7.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3740   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5490   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1365   -8.6118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3115   -8.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8990   -9.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0740   -9.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6615  -10.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8365  -10.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4240  -10.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5990  -10.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1365   -7.1829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1 10  2  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 13 22  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCOC(=O)CCC(=O)OCCCCCCC",
        "formula": "C18H34O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "314.4609",
        "optical_activity": "NONE",
        "references": [
          "e4f431d1-bb08-4156-a762-a26f34d77933",
          "841c656b-4073-4348-af03-1e70d70f825a"
        ],
        "stereo_centers": 0
      },
      "unii": "057N7SS26Y"
    }
  ]
}