{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2a0e1ceb-3529-448c-ac48-a3a6e549b908", "code": "67874-67-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=67874-67-3", "code_system": "CAS", "references": [ "c15f7377-3491-4670-ad10-f39110d95964", "1de62220-6c20-49f4-b10d-76fddf92350e" ] }, { "uuid": "2bc91387-0724-4ec1-8fd1-15c71ac6cc7f", "code": "267-495-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.061.340", "code_system": "ECHA (EC/EINECS)", "references": [ "c15f7377-3491-4670-ad10-f39110d95964" ] }, { "uuid": "8a94180c-df74-471c-aeb4-213432c46566", "code": "105896", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/105896", "code_system": "PUBCHEM", "references": [ "c15f7377-3491-4670-ad10-f39110d95964" ] }, { "uuid": "9ad0f8ea-6685-7069-5d77-ccc7bf2bc38e", "code": "DTXSID9070743", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9070743", "code_system": "EPA CompTox", "references": [ "522fef40-a024-2386-0021-3ede596f1019" ] }, { "uuid": "481c2fcb-4c2d-46b4-9a79-1152b1867fd9", "code": "04ZKF7V5JS", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "db12eeb4-30a1-4db6-ac16-ffd11892bcd6", "name": "BENZOIC ACID, 2-(DECYLIDENEAMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-(DECYLIDENEAMINO)-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6ea5e655-fd95-421a-8b1a-30645e85387c" ], "display_name": false }, { "uuid": "9a493d29-ecff-e83d-bc60-d0657637a577", "name": "METHYL 2-(DECYLIDENEAMINO)BENZOATE", "stdName": "METHYL 2-(DECYLIDENEAMINO)BENZOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0e73ceb8-a2ec-e79c-3386-dedac370e78a" ], "display_name": true } ], "references": [ { "uuid": "6ea5e655-fd95-421a-8b1a-30645e85387c", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c15f7377-3491-4670-ad10-f39110d95964", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392525000, "tags": [ "NOMEN" ] }, { "uuid": "522fef40-a024-2386-0021-3ede596f1019", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67874-67-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0e73ceb8-a2ec-e79c-3386-dedac370e78a", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1de62220-6c20-49f4-b10d-76fddf92350e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fc743a39-ec05-4692-898f-3766ee713d63", "id": "fc743a39-ec05-4692-898f-3766ee713d63", "molfile": "\n Marvin 01132113042D \n\n 21 21 0 0 0 0 999 V2000\n 0.0000 -1.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7143 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4387 -1.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1531 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8774 -1.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5918 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3161 -1.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0305 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7448 -1.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4692 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1835 -1.6600 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9079 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9079 -0.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6223 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3466 -0.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3466 -1.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6223 -1.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6223 -2.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9079 -2.9076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3466 -2.9076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0610 -2.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC/C=N/c1ccccc1C(=O)OC", "formula": "C18H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "11323ea4-dea6-440d-9852-7dc7c2639d1d" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "289.4132", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3f47f127-0e6c-46d4-a547-ed847c1c433e", "version": "6", "structure": { "id": "ffaf6f28-f204-4d14-bd08-a84503d43036", "molfile": "\n Marvin 01132113142D \n\n 21 21 0 0 0 0 999 V2000\n 10.2303 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9446 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6689 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3833 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1076 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8219 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5462 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2605 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9748 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6992 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4134 -4.2756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1378 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1378 -3.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8522 -2.6158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5764 -3.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5764 -3.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8522 -4.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8522 -5.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1378 -5.5232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5764 -5.5232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2908 -5.1107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC/C=N/c1ccccc1C(=O)OC", "formula": "C18H27NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "289.4132", "optical_activity": "NONE", "references": [ "6ea5e655-fd95-421a-8b1a-30645e85387c" ], "stereo_centers": 0 }, "unii": "04ZKF7V5JS" } ] }