{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3824bf00-d564-4bff-9134-19ad5bdf0d43",
          "code": "447399-55-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=447399-55-5",
          "code_system": "CAS",
          "references": [
            "1cf155a5-37c4-4b9d-9823-daa78f15482b",
            "3f1f589f-27c8-4b4a-ad9f-7fd5cbaf44b6"
          ]
        },
        {
          "uuid": "97094922-21ef-42d1-9969-e3f857cbccff",
          "code": "90099",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3682",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "1cf155a5-37c4-4b9d-9823-daa78f15482b"
          ]
        },
        {
          "uuid": "ed55f130-e4b7-49b9-a1b8-6f21e0a6308b",
          "code": "m9393",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9393?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1cf155a5-37c4-4b9d-9823-daa78f15482b"
          ]
        },
        {
          "uuid": "4c0371f0-2d9a-4e21-a9b5-3c432f3c9b60",
          "code": "11556910",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11556910",
          "code_system": "PUBCHEM",
          "references": [
            "1cf155a5-37c4-4b9d-9823-daa78f15482b"
          ]
        },
        {
          "uuid": "ab7506b6-79a8-528e-bb3b-f7ab005ab443",
          "code": "DTXSID4058104",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4058104",
          "code_system": "EPA CompTox",
          "references": [
            "e894a53e-bc21-b168-94da-718613fdd0d9"
          ]
        },
        {
          "uuid": "fe051c12-9f98-44b7-b4ef-65a3a7d0cef5",
          "code": "04XP114422",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6cde061b-e31c-2ab4-9061-12e9de8fae38",
          "code": "Pyroxasulfone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pyroxasulfone",
          "code_system": "WIKIPEDIA",
          "references": [
            "c5f51a7f-fcc7-17da-82bb-a40c2dce8900"
          ]
        },
        {
          "uuid": "b5dad085-e57b-9aa3-eb6a-eec30cb07d63",
          "code": "pyroxasulfone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pyroxasulfone.html",
          "code_system": "ALANWOOD",
          "references": [
            "6515211b-0a71-00f9-6c52-470e020655a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "37432593-1d91-4eb3-aa65-42bc0a4509de",
          "name": "3-(((5-(DIFLUOROMETHOXY)-1-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-4-YL)METHYL)SULFONYL)-4,5-DIHYDRO-5,5-DIMETHYLISOXAZOLE",
          "stdName": "3-(((5-(DIFLUOROMETHOXY)-1-METHYL-3-(TRIFLUOROMETHYL)-1H-PYRAZOL-4-YL)METHYL)SULFONYL)-4,5-DIHYDRO-5,5-DIMETHYLISOXAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9839f8e-3d23-44f3-ad47-f473328277be",
            "8d891038-3294-47ec-8c17-edcb2532b9a2"
          ],
          "display_name": false
        },
        {
          "uuid": "056c00c5-0c85-4e80-a1e4-1f26311a58db",
          "name": "5-(DIFLUOROMETHOXY)-1-METHYL-3-(TRIFLUOROMETHYL)PYRAZOL-4-YLMETHYL 4,5-DIHYDRO-5,5-DIMETHYL-1,2-OXAZOL-3-YL SULFONE",
          "stdName": "5-(DIFLUOROMETHOXY)-1-METHYL-3-(TRIFLUOROMETHYL)PYRAZOL-4-YLMETHYL 4,5-DIHYDRO-5,5-DIMETHYL-1,2-OXAZOL-3-YL SULFONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9839f8e-3d23-44f3-ad47-f473328277be",
            "04d33541-f98b-4844-8999-c4c5a0f1cbff"
          ],
          "display_name": false
        },
        {
          "uuid": "60c42ad7-96f7-46c5-b463-d4b437181c24",
          "name": "PYROXASULFONE",
          "stdName": "PYROXASULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d4ec22a-cdf2-4b8f-a4f6-ee085417de12",
            "0893cd23-b085-4c38-befa-f7f467856718",
            "c4d55624-8085-47fd-92bc-913eeb169a95",
            "0978adf4-f045-4135-9ec0-0b19a42cd609",
            "6630080a-7da5-4bd8-8570-bdcb9e300655",
            "fce50e42-6357-4ac2-98a4-5a50b4beb612"
          ],
          "display_name": true
        },
        {
          "uuid": "9bfc9a03-e6f5-4bf2-8e76-5249171565c0",
          "name": "PYROXASULFONE [ISO]",
          "stdName": "PYROXASULFONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4d55624-8085-47fd-92bc-913eeb169a95",
            "fce50e42-6357-4ac2-98a4-5a50b4beb612"
          ],
          "display_name": false
        },
        {
          "uuid": "94530fcb-082d-4500-9c0e-986205fa3db0",
          "name": "PYROXASULFONE [MI]",
          "stdName": "PYROXASULFONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d4ec22a-cdf2-4b8f-a4f6-ee085417de12",
            "c4d55624-8085-47fd-92bc-913eeb169a95"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c9839f8e-3d23-44f3-ad47-f473328277be",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "04d33541-f98b-4844-8999-c4c5a0f1cbff",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d891038-3294-47ec-8c17-edcb2532b9a2",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0978adf4-f045-4135-9ec0-0b19a42cd609",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fce50e42-6357-4ac2-98a4-5a50b4beb612",
          "citation": "http://www.alanwood.net/pesticides/pyroxasulfone.html",
          "url": "http://www.alanwood.net/pesticides/pyroxasulfone.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4d55624-8085-47fd-92bc-913eeb169a95",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d4ec22a-cdf2-4b8f-a4f6-ee085417de12",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cf155a5-37c4-4b9d-9823-daa78f15482b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390982000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93b68afe-f621-4f0b-b1b8-cde28da4e1ea",
          "citation": "SRS import [04XP114422]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=04XP114422",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390982000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea2fe2e6-6364-4c00-a20a-2debd1062236",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6630080a-7da5-4bd8-8570-bdcb9e300655",
          "citation": "PYROXASULFONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0893cd23-b085-4c38-befa-f7f467856718",
          "citation": "PYROXASULFONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e894a53e-bc21-b168-94da-718613fdd0d9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=447399-55-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c5f51a7f-fcc7-17da-82bb-a40c2dce8900",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "6515211b-0a71-00f9-6c52-470e020655a1",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "3f1f589f-27c8-4b4a-ad9f-7fd5cbaf44b6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7c3074e8-929b-44a6-86c0-ef215b6c0723",
          "id": "7c3074e8-929b-44a6-86c0-ef215b6c0723",
          "molfile": "\n  Marvin  01132106272D          \n\n 25 26  0  0  0  0            999 V2000\n    9.9303   -6.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1485   -5.7884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4934   -6.2664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8246   -5.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0782   -5.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5920   -4.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7761   -4.4276    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8613   -5.2488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6834   -3.6039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9521   -4.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3377   -3.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6324   -4.3716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7920   -5.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0209   -4.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9630   -5.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6130   -5.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8992   -5.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3792   -4.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2001   -4.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6845   -3.7567    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5364   -5.1805    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0385   -6.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4769   -6.4570    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2927   -6.8274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2297   -5.5847    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 22  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 17  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 16 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CC(=NO1)S(=O)(=O)Cc2c(C(F)(F)F)nn(C)c2OC(F)F",
          "formula": "C12H14F5N3O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad1a6d8e-e115-4ed1-9204-05d4f08cf434"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "391.3158",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f2292b31-63a5-4375-b17a-6ad4d17dddd7",
      "version": "5",
      "structure": {
        "id": "95532112-19db-43bc-9234-a43d7b3011c7",
        "molfile": "\n  Marvin  01132107452D          \n\n 25 26  0  0  0  0            999 V2000\n    8.0782   -5.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5920   -4.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7761   -4.4276    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9521   -4.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3377   -3.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6324   -4.3716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7920   -5.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0209   -4.8805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9630   -5.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6130   -5.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8613   -5.2488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6834   -3.6039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8246   -5.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0385   -6.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4769   -6.4570    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2927   -6.8274    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2297   -5.5847    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4934   -6.2664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1485   -5.7884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8992   -5.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3792   -4.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2001   -4.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6845   -3.7567    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5364   -5.1805    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9303   -6.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10  4  1  0  0  0  0\n  3 11  2  0  0  0  0\n  3 12  2  0  0  0  0\n 13  1  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n  1 20  2  0  0  0  0\n 19 25  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CC(=NO1)S(=O)(=O)Cc2c(C(F)(F)F)nn(C)c2OC(F)F",
        "formula": "C12H14F5N3O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "391.3158",
        "optical_activity": "NONE",
        "references": [
          "ea2fe2e6-6364-4c00-a20a-2debd1062236",
          "93b68afe-f621-4f0b-b1b8-cde28da4e1ea"
        ],
        "stereo_centers": 0
      },
      "unii": "04XP114422"
    }
  ]
}