{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "962aae46-4658-4309-bc65-7d9e683bb515",
          "code": "21646-00-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21646-00-4",
          "code_system": "CAS",
          "references": [
            "6c57e73f-f103-4005-9a1a-e2ee4020ea68",
            "3e3965ce-78a5-40f4-a1aa-3841034d3ae9"
          ]
        },
        {
          "uuid": "7f607599-b868-81ed-df6e-c6d5f358d405",
          "code": "DTXSID201309514",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201309514",
          "code_system": "EPA CompTox",
          "references": [
            "c1134fb4-1a50-e67b-c630-41cca38c9aa3"
          ]
        },
        {
          "uuid": "3a496e56-2016-1f1a-5043-34db5cf12ccf",
          "code": "884595-19-1",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=884595-19-1",
          "code_system": "CAS",
          "references": [
            "39b09d1f-2dd0-4b96-b397-7011a9446301"
          ]
        },
        {
          "uuid": "5e2bde3f-3115-4935-40f4-8d03ebdfcd87",
          "code": "444885",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/444885",
          "code_system": "PUBCHEM",
          "references": [
            "a12b9ec1-1679-5aea-36bf-436720a3d585"
          ]
        },
        {
          "uuid": "dcf97597-b904-423d-a0a4-dc567a7dcdc7",
          "code": "04A90EXP8V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6c542f35-9b13-4004-a74b-4fb87756b151",
          "name": ".ALPHA.-NEURAMINIC ACID, N-ACETYL-",
          "stdName": ".ALPHA.-NEURAMINIC ACID, N-ACETYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab61a434-9d56-45fb-b6e8-be8ecb862e7c",
            "2161b80d-bf16-4ac9-8bd9-2c1310260974"
          ],
          "display_name": false
        },
        {
          "uuid": "57bd0a68-d058-48d0-84bd-3fc5f819ddc9",
          "name": "D-GLYCERO-.ALPHA.-D-GALACTO-2-NONULOPYRANOSONIC ACID, 5-(ACETYLAMINO)-3,5-DIDEOXY-",
          "stdName": "D-GLYCERO-.ALPHA.-D-GALACTO-2-NONULOPYRANOSONIC ACID, 5-(ACETYLAMINO)-3,5-DIDEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab61a434-9d56-45fb-b6e8-be8ecb862e7c",
            "2161b80d-bf16-4ac9-8bd9-2c1310260974"
          ],
          "display_name": false
        },
        {
          "uuid": "9810ddb9-f44e-4bca-965c-83e13b86c9ec",
          "name": "N-ACETYL-.ALPHA.-D-NEURAMINIC ACID",
          "stdName": "N-ACETYL-.ALPHA.-D-NEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab61a434-9d56-45fb-b6e8-be8ecb862e7c",
            "2161b80d-bf16-4ac9-8bd9-2c1310260974"
          ],
          "display_name": false
        },
        {
          "uuid": "78d54e8d-fa70-42e9-9861-19758fb8f5e7",
          "name": "N-ACETYL-.ALPHA.-NEURAMINIC ACID",
          "stdName": "N-ACETYL-.ALPHA.-NEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab61a434-9d56-45fb-b6e8-be8ecb862e7c",
            "2161b80d-bf16-4ac9-8bd9-2c1310260974"
          ],
          "display_name": true
        },
        {
          "uuid": "346b47c4-f08d-4728-bf6d-63fdc590e0a6",
          "name": "N-ACETYL-.ALPHA.-NEURAMINIC ACID, (-)-",
          "stdName": "N-ACETYL-.ALPHA.-NEURAMINIC ACID, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2161b80d-bf16-4ac9-8bd9-2c1310260974",
            "3f14531f-4d21-46e5-8a1f-cfa9cbe44544"
          ],
          "display_name": false
        },
        {
          "uuid": "2a7a530c-9553-451e-b7d5-6ede27b52291",
          "name": "SIALIC ACIDS, N-ACETYL-.ALPHA.-NEURAMINIC ACID-",
          "stdName": "SIALIC ACIDS, N-ACETYL-.ALPHA.-NEURAMINIC ACID-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2161b80d-bf16-4ac9-8bd9-2c1310260974",
            "3eeeb327-8fa2-4e1d-8749-167022771178"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ab61a434-9d56-45fb-b6e8-be8ecb862e7c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2161b80d-bf16-4ac9-8bd9-2c1310260974",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f14531f-4d21-46e5-8a1f-cfa9cbe44544",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3eeeb327-8fa2-4e1d-8749-167022771178",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c57e73f-f103-4005-9a1a-e2ee4020ea68",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392725000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "816f16f5-c7a2-45ff-a8dc-51512c0cd565",
          "citation": "SRS import [04A90EXP8V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=04A90EXP8V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392725000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a12b9ec1-1679-5aea-36bf-436720a3d585",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "3e3965ce-78a5-40f4-a1aa-3841034d3ae9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "39b09d1f-2dd0-4b96-b397-7011a9446301",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c1134fb4-1a50-e67b-c630-41cca38c9aa3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "77b9d781-c8da-492d-9bed-7bd81369daba",
          "id": "77b9d781-c8da-492d-9bed-7bd81369daba",
          "molfile": "\n  Marvin  01132106132D          \n\n 21 21  0  0  1  0            999 V2000\n   12.4749   -7.8209    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.9429   -7.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2885   -7.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5700   -6.8991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1935   -8.5939    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.7209   -9.2274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798   -8.7381    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.3798   -7.9139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6662   -7.4995    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.1937   -6.8707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9528   -7.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9528   -8.7381    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.2393   -9.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6662   -9.1526    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.6662   -9.9769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798  -10.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798  -11.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0934   -9.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1342   -6.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3207   -7.0103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4157   -6.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n 14  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n  9 19  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  6  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H]1[C@H](C[C@@](C(=O)O)(O)O[C@H]1[C@@H]([C@@H](CO)O)O)O",
          "formula": "C11H19NO9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cf2766e4-18df-4640-bba5-720339c9a367"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "309.2703",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cedd65aa-cf94-4029-88d1-6e3d7636d1de",
      "version": "10",
      "structure": {
        "id": "d8f270cf-817c-42a3-a938-83b53407a864",
        "molfile": "\n  Marvin  01132111152D          \n\n 22 22  0  0  1  0            999 V2000\n    9.9528   -7.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6662   -7.4995    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.1937   -6.8707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1342   -6.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3207   -7.0103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4157   -6.0931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798   -7.9139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798   -8.7381    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.6614   -9.5112    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1935   -8.5939    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.4749   -7.8209    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.2885   -7.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5700   -6.8991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9429   -7.1875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7209   -9.2274    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6662   -9.1526    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6662   -9.9769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798  -10.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3798  -11.2109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0934   -9.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9528   -8.7381    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2393   -9.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  1  0  0  0\n  2  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 11 14  1  6  0  0  0\n 10 15  1  1  0  0  0\n 16  8  1  0  0  0  0\n 16 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 16  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H]1[C@H](C[C@@](C(=O)O)(O)O[C@@]1([H])[C@@H]([C@@H](CO)O)O)O",
        "formula": "C11H19NO9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "309.2703",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ab61a434-9d56-45fb-b6e8-be8ecb862e7c",
          "816f16f5-c7a2-45ff-a8dc-51512c0cd565"
        ],
        "stereo_centers": 6
      },
      "unii": "04A90EXP8V"
    }
  ]
}