{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a7ff3c53-dcf0-4851-a17c-492ffeef1738",
          "code": "3818-62-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3818-62-0",
          "code_system": "CAS",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d",
            "91d91ced-58a0-484a-b7a4-b22fc28ebcd9"
          ]
        },
        {
          "uuid": "94135050-3fc6-4d66-90ae-d641d0e8b070",
          "code": "C72175",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72175",
          "code_system": "NCI_THESAURUS",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d"
          ]
        },
        {
          "uuid": "f97458fa-bf33-445f-a985-0ebea55fb1ee",
          "code": "SUB05807MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d"
          ]
        },
        {
          "uuid": "4fddc79a-a6fc-4003-9c32-d4ff7b4c8d4d",
          "code": "1406",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1406",
          "code_system": "INN",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d"
          ]
        },
        {
          "uuid": "0f9b2e6f-0de3-493f-af9d-0cfe7b702b66",
          "code": "m2459",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2459?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d"
          ]
        },
        {
          "uuid": "0bdf9348-2660-413d-8efa-fa3d847021b8",
          "code": "CHEMBL2110889",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110889",
          "code_system": "ChEMBL",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d"
          ]
        },
        {
          "uuid": "41f13018-711d-4c68-97ee-672d4dc8e413",
          "code": "19668",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19668",
          "code_system": "PUBCHEM",
          "references": [
            "64e51394-2d26-4bca-a5ba-6f2b9b32a03d"
          ]
        },
        {
          "uuid": "ed4bd9c2-0555-af70-764e-278eb3ab2265",
          "code": "DTXSID80191561",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80191561",
          "code_system": "EPA CompTox",
          "references": [
            "a626352c-c002-28fe-855c-2ce288143c84"
          ]
        },
        {
          "uuid": "4a6991d2-b8c5-c639-c831-6e47b9bbb055",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "325f990e-a0c9-28e9-8e80-165a1cbe173f"
          ]
        },
        {
          "uuid": "3f93855f-f386-42d6-a200-7e77eb9f3e63",
          "code": "03DB58Y9DO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9004bbef-dcc7-180c-c2d1-3484b9ad892d",
          "code": "3023",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3023",
          "code_system": "DRUG CENTRAL",
          "references": [
            "325f990e-a0c9-28e9-8e80-165a1cbe173f"
          ]
        },
        {
          "uuid": "6e21e569-fd26-1777-abcf-7c516af484e4",
          "code": "100000085873",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bcd30b2b-8323-1229-71c8-786739ca5d03"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f31e52ee-7f40-42af-9b34-bfeea66e4dbf",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d79a0f39-334c-446e-9347-bf15a08ea525",
            "refuuid": "f55704aa-f1e0-4af3-80a8-38022ee92450",
            "name": "BETOXYCAINE",
            "unii": "03DB58Y9DO",
            "linking_id": "03DB58Y9DO",
            "ref_pname": "BETOXYCAINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8c3f68c2-0a5e-4f4e-bcaf-15e4c72ecdc1",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "7f460386-9fb6-4274-800c-0b5798863b8d",
            "refuuid": "0d45d5e3-6ef3-47d8-85ab-0ec76e2a8ce1",
            "name": "BETOXYCAINE HYDROCHLORIDE",
            "unii": "8II47759Z3",
            "linking_id": "8II47759Z3",
            "ref_pname": "BETOXYCAINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3fe66ded-ac7f-4910-95e5-e1fa36e827d3",
          "name": "2-(2-(DIETHYLAMINO)ETHOXY)ETHYL 3-AMINO-4-BUTOXYBENZOATE",
          "stdName": "2-(2-(DIETHYLAMINO)ETHOXY)ETHYL 3-AMINO-4-BUTOXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffc02e0b-c326-42e8-a690-4dccadb26a5b"
          ],
          "display_name": false
        },
        {
          "uuid": "145eefe1-e122-4df7-a4ed-3bb008fadf83",
          "name": "BETOXYCAINE",
          "stdName": "BETOXYCAINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "680073aa-9c3d-49d3-9372-2cca8c744487",
            "3dd247aa-ff08-4219-a7d8-91a4b46704f1",
            "5f9d933f-7ce0-4465-9ea8-e01f46465b50",
            "7ab849e6-ad5c-4ea5-8bea-7df87b525da7",
            "2dbe7ee6-ef10-498c-8b76-3dc245a4755d",
            "ffc02e0b-c326-42e8-a690-4dccadb26a5b",
            "5a6b5ac3-2ce2-4bbd-bb34-a437e8078c12",
            "ef37076a-e81b-4bd2-ac80-ffbf793bc15f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "cfad7afb-43a0-46f8-92bc-290d03d72511",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "7f822ae2-2a9a-4c77-886f-a2b52184ad6f",
          "name": "BETOXYCAINE [MI]",
          "stdName": "BETOXYCAINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a6b5ac3-2ce2-4bbd-bb34-a437e8078c12",
            "ef37076a-e81b-4bd2-ac80-ffbf793bc15f"
          ],
          "display_name": false
        },
        {
          "uuid": "62faa3d6-3222-9ab9-91d9-632e8bbbde48",
          "name": "Betoxycaine [WHO-DD]",
          "stdName": "BETOXYCAINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f9bdff2-47f7-9396-e90e-b0ed65bb1ca6"
          ],
          "display_name": false
        },
        {
          "uuid": "a279c292-e865-4a91-9d0f-c07ba9d22d5f",
          "name": "betoxycaine [INN]",
          "stdName": "BETOXYCAINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dbe7ee6-ef10-498c-8b76-3dc245a4755d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ffc02e0b-c326-42e8-a690-4dccadb26a5b",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2dbe7ee6-ef10-498c-8b76-3dc245a4755d",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef37076a-e81b-4bd2-ac80-ffbf793bc15f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a6b5ac3-2ce2-4bbd-bb34-a437e8078c12",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ab849e6-ad5c-4ea5-8bea-7df87b525da7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64e51394-2d26-4bca-a5ba-6f2b9b32a03d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30da1dd9-320b-4369-8a6f-cbba50f9c6a8",
          "citation": "SRS import [03DB58Y9DO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=03DB58Y9DO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb705c03-7e3c-4a61-a72e-e727bf6ae04a",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f9d933f-7ce0-4465-9ea8-e01f46465b50",
          "citation": "BETOXYCAINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3dd247aa-ff08-4219-a7d8-91a4b46704f1",
          "citation": "BETOXYCAINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "680073aa-9c3d-49d3-9372-2cca8c744487",
          "citation": "BETOXYCAINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a626352c-c002-28fe-855c-2ce288143c84",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3818-62-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bcd30b2b-8323-1229-71c8-786739ca5d03",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "325f990e-a0c9-28e9-8e80-165a1cbe173f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "91d91ced-58a0-484a-b7a4-b22fc28ebcd9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6f9bdff2-47f7-9396-e90e-b0ed65bb1ca6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d7060ef1-83c2-455b-92ec-6aef3a971d2d",
          "id": "d7060ef1-83c2-455b-92ec-6aef3a971d2d",
          "molfile": "\n  Marvin  01132111092D          \n\n 25 25  0  0  0  0            999 V2000\n   -6.1089   -0.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.4184   -0.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6871   -0.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0000   -0.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2518   -0.9116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5205   -0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5205    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8197    0.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1055    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1055   -0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8197   -0.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8197   -1.7415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3776    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3776    1.6088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3300    0.3469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0306    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7450    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4627    0.7823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1633    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8674    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5783    0.3469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2994    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0001    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5783   -0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8674   -0.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCCCOc1ccc(cc1N)C(=O)OCCOCCN(CC)CC",
          "formula": "C19H32N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6fd44c59-3f32-4da9-afc8-2124dd518185"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "352.4691",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f55704aa-f1e0-4af3-80a8-38022ee92450",
      "version": "9",
      "structure": {
        "id": "691a21a8-a91b-4a32-980f-2c7f890a8832",
        "molfile": "\n  Marvin  01132105282D          \n\n 25 25  0  0  0  0            999 V2000\n   -1.1055    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1055   -0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8197    0.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3776    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8197   -0.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5205    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3300    0.3469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3776    1.6088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5205   -0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8197   -1.7415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0306    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2518   -0.9116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7450    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0000   -0.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4627    0.7823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6871   -0.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1633    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.4184   -0.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8674    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -6.1089   -0.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5783    0.3469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2994    0.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5783   -0.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0001    0.3469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8674   -0.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n  6  9  2  0  0  0  0\nM  END",
        "smiles": "CCCCOc1ccc(cc1N)C(=O)OCCOCCN(CC)CC",
        "formula": "C19H32N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "352.4691",
        "optical_activity": "NONE",
        "references": [
          "cb705c03-7e3c-4a61-a72e-e727bf6ae04a",
          "30da1dd9-320b-4369-8a6f-cbba50f9c6a8",
          "2dbe7ee6-ef10-498c-8b76-3dc245a4755d"
        ],
        "stereo_centers": 0
      },
      "unii": "03DB58Y9DO"
    }
  ]
}