{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "63dea71f-befb-41c7-a34a-967be4ac9f96",
          "code": "6035-50-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6035-50-3",
          "code_system": "CAS",
          "references": [
            "dc0dacf4-5794-46d3-bed6-5509773cf3c2",
            "69813475-0b15-4b3a-9a71-aa1651aa35bd"
          ]
        },
        {
          "uuid": "63dcb15b-d333-4fb4-8ed1-3290558ecb18",
          "code": "30237-26-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=30237-26-4",
          "code_system": "CAS",
          "references": [
            "dc0dacf4-5794-46d3-bed6-5509773cf3c2",
            "832340ac-1ce6-4566-a7d3-ee8f27bf3164"
          ]
        },
        {
          "uuid": "61b084aa-09d2-48fa-ae16-5b9238fb2809",
          "code": "m5573",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5573?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "dc0dacf4-5794-46d3-bed6-5509773cf3c2"
          ]
        },
        {
          "uuid": "965a8a04-70e6-8fd9-a85f-b2d2d895d38d",
          "code": "DTXSID301352154",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301352154",
          "code_system": "EPA CompTox",
          "references": [
            "e9b6dd7f-0eda-1456-f339-5b9c7e5f6dc1"
          ]
        },
        {
          "uuid": "313739a2-24fd-6287-3e5c-be30660a78ad",
          "code": "2374739",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2374739/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c9d3a967-6f8a-2950-a265-f75d6c5bfa53"
          ]
        },
        {
          "uuid": "80996789-6d31-49d1-a5d6-0eaccfa05a0f",
          "code": "02T79V874P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8a7ea588-9006-e65d-46b0-aa3aeaf94969",
          "code": "300000040287",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "185a783c-c799-16f6-966e-4ea4bad68aa9"
          ]
        },
        {
          "uuid": "a3439e46-3338-8aca-cafd-b65d12ac81be",
          "code": "02T79V874P",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=02T79V874P",
          "code_system": "DAILYMED",
          "references": [
            "a6c3ac26-986c-e1a2-232c-16f82995c9f0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c5abeea-3728-48e6-911b-71cd1dcc6721",
          "name": "(±)-FRUCTOSE",
          "stdName": "(+/-)-FRUCTOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94627166-1b6b-4036-8f35-6ae2570c2305",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": false
        },
        {
          "uuid": "62ad4210-e6bf-4c03-8c04-627795b425dd",
          "name": ".ALPHA.-ACROSE",
          "stdName": ".ALPHA.-ACROSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94627166-1b6b-4036-8f35-6ae2570c2305",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": false
        },
        {
          "uuid": "bee8440b-7c41-4bfd-b7c8-215b2eb04621",
          "name": "ARABINO-2-HEXULOSE",
          "stdName": "ARABINO-2-HEXULOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94627166-1b6b-4036-8f35-6ae2570c2305",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": false
        },
        {
          "uuid": "15ed3cdb-a142-4bba-8219-013155e23ec1",
          "name": "DL-FRUCTOSE",
          "stdName": "DL-FRUCTOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c50ee13-d2bd-4ce8-bdb2-3b1ab30127bc",
            "94627166-1b6b-4036-8f35-6ae2570c2305",
            "50365c1d-a17c-4665-93a9-0b0143baf01c",
            "7268b924-3342-4495-97e7-c39384ec0512"
          ],
          "display_name": false
        },
        {
          "uuid": "11425069-8ecf-4073-961e-b92e3c57a074",
          "name": "DL-FRUCTOSE [MI]",
          "stdName": "DL-FRUCTOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c50ee13-d2bd-4ce8-bdb2-3b1ab30127bc",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": false
        },
        {
          "uuid": "d92aaef4-c2b5-4b04-9fdd-9110fb8545ff",
          "name": "FRUCTOSE, (±)-",
          "stdName": "FRUCTOSE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94627166-1b6b-4036-8f35-6ae2570c2305",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": false
        },
        {
          "uuid": "2f8abcb8-5b5d-4bbf-af64-a53eaf3204e3",
          "name": "FRUCTOSE, DL-",
          "stdName": "FRUCTOSE, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97c42787-11b7-488b-ab18-35fc19f7b47a",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": true
        },
        {
          "uuid": "b156d8ee-5ffd-446d-af4d-d47c5cedfad4",
          "name": "METHOSE",
          "stdName": "METHOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94627166-1b6b-4036-8f35-6ae2570c2305",
            "50365c1d-a17c-4665-93a9-0b0143baf01c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "97c42787-11b7-488b-ab18-35fc19f7b47a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "50365c1d-a17c-4665-93a9-0b0143baf01c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c50ee13-d2bd-4ce8-bdb2-3b1ab30127bc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94627166-1b6b-4036-8f35-6ae2570c2305",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc0dacf4-5794-46d3-bed6-5509773cf3c2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392327000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f43e069-32ca-4a99-8e14-efb26e831ab5",
          "citation": "SRS import [02T79V874P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=02T79V874P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392327000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7268b924-3342-4495-97e7-c39384ec0512",
          "citation": "DL-FRUCTOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "185a783c-c799-16f6-966e-4ea4bad68aa9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c9d3a967-6f8a-2950-a265-f75d6c5bfa53",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "832340ac-1ce6-4566-a7d3-ee8f27bf3164",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "69813475-0b15-4b3a-9a71-aa1651aa35bd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a6c3ac26-986c-e1a2-232c-16f82995c9f0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e9b6dd7f-0eda-1456-f339-5b9c7e5f6dc1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "5423a3f5-c24c-1d24-2cc2-6fc3752cd947",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f48594e0-ff7f-428f-95ef-c915c662411a",
          "id": "f48594e0-ff7f-428f-95ef-c915c662411a",
          "molfile": "\n  Marvin  01132112412D          \n\n 12 11  0  0  0  0            999 V2000\n    5.5913   -5.0061    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.5913   -5.8311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8768   -4.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1624   -5.0061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3057   -4.5936    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3057   -3.7686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0202   -5.0061    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.0202   -5.8311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7347   -4.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7347   -3.7686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4491   -5.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1636   -4.5936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9f236640-b5b1-4498-9932-0f31fbccd65d"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ca389c82-8fb3-4ac2-8450-92066bd0ddb8",
      "version": "15",
      "structure": {
        "id": "67458e11-c260-468d-a254-51020b647f9d",
        "molfile": "\n  Marvin  01132105222D          \n\n 12 11  0  0  0  0            999 V2000\n    6.3057   -4.5936    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5913   -5.0061    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0202   -5.0061    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3057   -3.7686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5913   -5.8311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8768   -4.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1624   -5.0061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0202   -5.8311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7347   -4.5936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7347   -3.7686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4491   -5.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1636   -4.5936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  1  0  0  0\n  2  5  1  6  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  1  0  0  0\n  3  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "C([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "( + / - )",
        "references": [
          "94627166-1b6b-4036-8f35-6ae2570c2305",
          "4f43e069-32ca-4a99-8e14-efb26e831ab5"
        ],
        "stereo_centers": 3
      },
      "unii": "02T79V874P"
    }
  ]
}