{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6a7570a9-dd23-4f22-b660-b698034b4ec0",
          "code": "470-69-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=470-69-9",
          "code_system": "CAS",
          "references": [
            "364c3e82-0ab3-4e65-aa88-db57e5ead78a",
            "3f3e755e-d14d-4c6f-9f7e-99112089c35e"
          ]
        },
        {
          "uuid": "37379dc6-f6b5-4518-9bba-ee1ac62d55a4",
          "code": "207-429-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.756",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "364c3e82-0ab3-4e65-aa88-db57e5ead78a"
          ]
        },
        {
          "uuid": "e92b3610-7bcc-498b-9015-b100bde779fa",
          "code": "440080",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/440080",
          "code_system": "PUBCHEM",
          "references": [
            "364c3e82-0ab3-4e65-aa88-db57e5ead78a"
          ]
        },
        {
          "uuid": "0d8e86e7-dad5-97b1-c7c8-fdbb8f68b8ee",
          "code": "2590592",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2590592/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c3496f93-9e5c-dbd3-22ab-a1678d82e449"
          ]
        },
        {
          "uuid": "8a062254-fdb7-4b4a-a06e-93314072ba1a",
          "code": "02LN7O412C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2ccc5cd5-e3c9-a68b-cc2d-e691c7b3a602",
          "code": "16885",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16885",
          "code_system": "CHEBI",
          "references": [
            "891e6247-59b4-c6a8-abdf-9a9d076cadcd"
          ]
        },
        {
          "uuid": "d29905b9-a746-97b6-2fb5-e6bb3ef611db",
          "code": "DTXSID10963718",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10963718",
          "code_system": "EPA CompTox",
          "references": [
            "c0d099d3-6ab7-27c3-371e-28b5dc777801"
          ]
        },
        {
          "uuid": "f235dbd7-e7e1-37a1-8415-f3492d369953",
          "code": "02LN7O412C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=02LN7O412C",
          "code_system": "DAILYMED",
          "references": [
            "682ed8c4-5c9d-9a70-dfd9-c083d8fe666a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d4c2dcd9-da0a-44cd-98c8-fa1ef5209b37",
          "name": ".ALPHA.-D-GLUCOPYRANOSIDE, O-.BETA.-D-FRUCTOFURANOSYL-(2->1)-.BETA.-D-FRUCTOFURANOSYL",
          "stdName": ".ALPHA.-D-GLUCOPYRANOSIDE, O-.BETA.-D-FRUCTOFURANOSYL-(2->1)-.BETA.-D-FRUCTOFURANOSYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "619b0e6f-deab-431a-9ac1-572d00f0330c"
          ],
          "display_name": false
        },
        {
          "uuid": "48f1efeb-3e14-491a-a4c4-2570d6c6880c",
          "name": "1-FRUCTOSYLSUCROSE",
          "stdName": "1-FRUCTOSYLSUCROSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a1a3e43-3fed-4c2a-a884-42528430ae26"
          ],
          "display_name": false
        },
        {
          "uuid": "bcb0afc5-05dd-4f0a-ab55-233a4ac54b7d",
          "name": "1-KESTOSE",
          "stdName": "1-KESTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f709f682-5308-4519-a2ad-128e4b6c0b1e"
          ],
          "display_name": true
        },
        {
          "uuid": "e4552321-a53b-4067-a16a-37c563e0e87a",
          "name": "1-KESTOTRIOSE",
          "stdName": "1-KESTOTRIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "619b0e6f-deab-431a-9ac1-572d00f0330c"
          ],
          "display_name": false
        },
        {
          "uuid": "911ed80e-cbdb-45a2-8d7d-a1681a4043e1",
          "name": "1F-.BETA.-D-FRUCTOSYLSUCROSE",
          "stdName": "1F-.BETA.-D-FRUCTOSYLSUCROSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca85a1de-0665-4c36-800d-e54df810bd75"
          ],
          "display_name": false
        },
        {
          "uuid": "13f5d154-fe74-412b-a6f0-016577f3912c",
          "name": "GF-2",
          "stdName": "GF-2",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "180f4ab9-de1d-4bf9-b01a-9a5d15e41204"
          ],
          "display_name": false
        },
        {
          "uuid": "095fd328-fb0d-491e-a3a5-a60361a308ce",
          "name": "GF2",
          "stdName": "GF2",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c89240e7-e197-4271-9b3e-7853317c1852"
          ],
          "display_name": false
        },
        {
          "uuid": "83cb90a7-db4b-4d6f-8c1d-8a9b55079af1",
          "name": "GLUCOPYRANOSIDE, O-.BETA.-D-FRUCTOFURANOSYL-(2->1)-.BETA.-D-FRUCTOFURANOSYL, .ALPHA.-D-",
          "stdName": "GLUCOPYRANOSIDE, O-.BETA.-D-FRUCTOFURANOSYL-(2->1)-.BETA.-D-FRUCTOFURANOSYL, .ALPHA.-D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a1a3e43-3fed-4c2a-a884-42528430ae26"
          ],
          "display_name": false
        },
        {
          "uuid": "d8fa39bf-f7c6-4c5c-9eec-009a0dab6c1f",
          "name": "J196.187J",
          "stdName": "J196.187J",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca85a1de-0665-4c36-800d-e54df810bd75"
          ],
          "display_name": false
        },
        {
          "uuid": "13ac756d-e81c-4662-b9ab-35528bf1cc00",
          "name": "KESTOSE, 1-",
          "stdName": "KESTOSE, 1-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e6bdcce-eb26-48b6-92fe-cbc402cb5c95"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f709f682-5308-4519-a2ad-128e4b6c0b1e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c89240e7-e197-4271-9b3e-7853317c1852",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "180f4ab9-de1d-4bf9-b01a-9a5d15e41204",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e6bdcce-eb26-48b6-92fe-cbc402cb5c95",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a1a3e43-3fed-4c2a-a884-42528430ae26",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "619b0e6f-deab-431a-9ac1-572d00f0330c",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca85a1de-0665-4c36-800d-e54df810bd75",
          "citation": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907059195047108&q=J196.187J&t=7",
          "url": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=200907059195047108&q=J196.187J&t=7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "364c3e82-0ab3-4e65-aa88-db57e5ead78a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392138000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "617e9f5d-3089-457a-b725-861c9a86c469",
          "citation": "SRS import [02LN7O412C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=02LN7O412C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392138000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3496f93-9e5c-dbd3-22ab-a1678d82e449",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "891e6247-59b4-c6a8-abdf-9a9d076cadcd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3f3e755e-d14d-4c6f-9f7e-99112089c35e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "682ed8c4-5c9d-9a70-dfd9-c083d8fe666a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c0d099d3-6ab7-27c3-371e-28b5dc777801",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "23427f2f-3896-46ec-bacc-589e0396023b",
          "id": "23427f2f-3896-46ec-bacc-589e0396023b",
          "molfile": "\n  Marvin  01132101582D          \n\n 34 36  0  0  1  0            999 V2000\n    4.0075   -1.4985    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.1903   -1.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8648   -0.6430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4085   -2.2183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2202   -2.0580    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.0481   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4491   -2.8022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2970   -2.8824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5501   -3.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4786   -4.0554    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.6659   -3.9002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1281   -4.5257    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.3154   -4.3706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7775   -4.9914    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.9650   -4.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4271   -5.4618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0479   -5.7720    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.5102   -6.3975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8607   -5.9272    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.1309   -6.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3984   -5.3017    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.2111   -5.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2416   -4.8421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9171   -5.3142    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.9171   -6.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6570   -6.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5766   -4.8185    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3634   -5.0555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3016   -4.0554    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.7736   -3.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3166   -1.2408    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.0412   -0.8352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5675   -0.8928    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.4071   -0.0811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  4  1  0  0  0  0\n  1 33  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  6  0  0  0\n 31  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 23  1  0  0  0  0\n 29 10  1  0  0  0  0\n 12 11  1  6  0  0  0\n 12 13  1  0  0  0  0\n 21 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 17 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  6  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  6  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  1  0  0  0\n 27 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 28  1  6  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  1  0  0  0\n 31 32  1  6  0  0  0\n 33 31  1  0  0  0  0\n 33 34  1  1  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@]2(CO[C@@]3(CO)[C@H]([C@@H]([C@@H](CO)O3)O)O)[C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O)O",
          "formula": "C18H32O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c8286234-d590-433a-bb1c-70eaeeaf7050"
          },
          "defined_stereo": 13,
          "ez_centers": 0,
          "molecular_weight": "504.4378",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 13
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "65f563f5-8cc8-4ab1-996b-a65b4fa0ef0f",
      "version": "8",
      "structure": {
        "id": "dc2e7e4c-547e-49eb-9469-b5fa5a1536b9",
        "molfile": "\n  Marvin  01132111252D          \n\n 34 36  0  0  1  0            999 V2000\n    5.2202   -2.0580    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.4085   -2.2183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0075   -1.4985    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.5675   -0.8928    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3166   -1.2408    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.0412   -0.8352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4071   -0.0811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1903   -1.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8648   -0.6430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2970   -2.8824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5501   -3.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4786   -4.0554    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2416   -4.8421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9171   -5.3142    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9171   -6.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6570   -6.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5766   -4.8185    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3016   -4.0554    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7736   -3.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3634   -5.0555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6659   -3.9002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1281   -4.5257    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.3154   -4.3706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7775   -4.9914    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.9650   -4.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4271   -5.4618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0479   -5.7720    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8607   -5.9272    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3984   -5.3017    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2111   -5.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1309   -6.7078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5102   -6.3975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0481   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4491   -2.8022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  4  7  1  1  0  0  0\n  3  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n  1 10  1  6  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  6  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 15 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 12 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 17 20  1  6  0  0  0\n 21 12  1  0  0  0  0\n 22 21  1  6  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  1  0  0  0\n 25 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 22 29  1  0  0  0  0\n 29 30  1  6  0  0  0\n 28 31  1  1  0  0  0\n 27 32  1  6  0  0  0\n  1 33  1  1  0  0  0\n 34 33  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@]2(CO[C@@]3(CO)[C@H]([C@@H]([C@@H](CO)O3)O)O)[C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)O)O",
        "formula": "C18H32O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 13,
        "ez_centers": 0,
        "molecular_weight": "504.4378",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f709f682-5308-4519-a2ad-128e4b6c0b1e",
          "617e9f5d-3089-457a-b725-861c9a86c469"
        ],
        "stereo_centers": 13
      },
      "unii": "02LN7O412C"
    }
  ]
}