{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ec4c1f29-4775-4511-a571-d9316dfff2c3", "code": "6441-93-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6441-93-6", "code_system": "CAS", "references": [ "c1987caf-b11a-48ec-9a81-1b31f7ee114c", "d7a525fb-6d19-4a39-a18b-73b4ac576dcf" ] }, { "uuid": "f4a624e7-c86a-449c-a33d-bd3e0df94b72", "code": "229-231-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.574", "code_system": "ECHA (EC/EINECS)", "references": [ "c1987caf-b11a-48ec-9a81-1b31f7ee114c" ] }, { "uuid": "b86429c5-e6d7-a9ff-3a28-73b363c4548e", "code": "DTXSID7064360", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7064360", "code_system": "EPA CompTox", "references": [ "c7d3c081-cf12-c940-8b61-354865935493" ] }, { "uuid": "2d3ac1ee-e255-7f5a-2c66-8cb7b1d5815b", "code": "2274098", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2274098/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "0cf3d82b-4e49-7aeb-20ec-5f374cd6865b" ] }, { "uuid": "abdf9838-eb1b-4e77-b1e7-42818a382ae3", "code": "02BXM5Q7GE", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "54e7480f-2016-1434-9b99-f5225a9c3d0c", "code": "02BXM5Q7GE", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=02BXM5Q7GE", "code_system": "DAILYMED", "references": [ "2796e41e-868c-d4f1-9a94-8638de165a5a" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0ab32dcf-1c83-4960-86a3-7970ec72ada3", "name": "2,7-NAPHTHALENEDISULFONIC ACID, 5-(ACETYLAMINO)-4-HYDROXY-3-((2-METHYLPHENYL)AZO)-, DISODIUM SALT", "stdName": "2,7-NAPHTHALENEDISULFONIC ACID, 5-(ACETYLAMINO)-4-HYDROXY-3-((2-METHYLPHENYL)AZO)-, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ef14092c-9cf9-46c8-91f3-168624da16a1", "636cd78f-a476-4885-9a46-5d3701ef741f" ], "display_name": false }, { "uuid": "99082707-840e-486b-a4ad-3816cf974f40", "name": "5-(ACETYLAMINO)-4-HYDROXY-3-((2-METHYLPHENYL)AZO)-2,7-NAPHTHALENEDISULFONIC ACID, DISODIUM SALT", "stdName": "5-(ACETYLAMINO)-4-HYDROXY-3-((2-METHYLPHENYL)AZO)-2,7-NAPHTHALENEDISULFONIC ACID, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ef14092c-9cf9-46c8-91f3-168624da16a1", "636cd78f-a476-4885-9a46-5d3701ef741f" ], "display_name": false }, { "uuid": "354af315-e971-4089-a111-c1fca540fa6e", "name": "ACID RED 35", "stdName": "ACID RED 35", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "bca6f0ca-f639-47d4-a874-1a4d16803bff", "ef14092c-9cf9-46c8-91f3-168624da16a1", "dc137815-cc26-4bfa-8781-a6f7250a1b78", "636cd78f-a476-4885-9a46-5d3701ef741f" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "d1624eb9-9b69-4e7f-9218-9f8e10ce243a", "name_org": "INCI" } ] }, { "uuid": "ab273396-603f-4cd4-90f9-d034dee94cb7", "name": "C.I. ACID RED 35", "stdName": "C.I. ACID RED 35", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "343f471b-2784-496e-95dc-16dca9fbd032" ], "display_name": false }, { "uuid": "e4ca4bef-0a89-4b12-8211-a75f73f54815", "name": "CI 18065", "stdName": "CI 18065", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "ef14092c-9cf9-46c8-91f3-168624da16a1", "636cd78f-a476-4885-9a46-5d3701ef741f" ], "display_name": false } ], "references": [ { "uuid": "343f471b-2784-496e-95dc-16dca9fbd032", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "636cd78f-a476-4885-9a46-5d3701ef741f", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ef14092c-9cf9-46c8-91f3-168624da16a1", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bca6f0ca-f639-47d4-a874-1a4d16803bff", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c1987caf-b11a-48ec-9a81-1b31f7ee114c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391018000, "tags": [ "NOMEN" ] }, { "uuid": "d3107925-7e9f-428b-af7e-d77f866edbab", "citation": "SRS import [02BXM5Q7GE]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=02BXM5Q7GE", "doc_type": "SRS", "public_domain": true, "document_date": 1493391018000, "tags": [ "NOMEN" ] }, { "uuid": "1c0c2fb1-25c8-4459-80ae-dc6caf6b9353", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dc137815-cc26-4bfa-8781-a6f7250a1b78", "citation": "ACID RED 35 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c7d3c081-cf12-c940-8b61-354865935493", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6441-93-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0cf3d82b-4e49-7aeb-20ec-5f374cd6865b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "d7a525fb-6d19-4a39-a18b-73b4ac576dcf", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "2796e41e-868c-d4f1-9a94-8638de165a5a", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "93a54c07-9d25-4045-8c3e-876bdfb94954", "id": "93a54c07-9d25-4045-8c3e-876bdfb94954", "molfile": "\n Marvin 01132107392D \n\n 1 0 0 0 0 0 999 V2000\n 0.9607 -8.1667 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "81873b3b-ba15-4157-972c-9de78d9b1919" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "73bb34e4-0730-4bbf-91cf-62b1398b2e60", "id": "73bb34e4-0730-4bbf-91cf-62b1398b2e60", "molfile": "\n Marvin 01132106002D \n\n 32 34 0 0 0 0 999 V2000\n 9.6518 -7.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9345 -6.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9345 -6.0849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2173 -7.3202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2173 -8.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9364 -8.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9364 -9.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2235 -9.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5042 -9.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7845 -9.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0770 -9.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0770 -8.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3658 -8.1503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3658 -7.3218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6482 -6.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9336 -7.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2191 -6.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2191 -6.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9336 -5.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6482 -6.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3582 -5.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7845 -8.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7845 -7.3202 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.5042 -8.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3658 -9.7951 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6502 -10.2055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7762 -10.5110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9509 -9.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6537 -9.7921 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3663 -10.1998 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.0614 -9.0749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2414 -10.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 24 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 29 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 9 24 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 11 25 1 0 0 0 0\n 12 13 1 0 0 0 0\n 22 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 20 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 22 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 2 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 29 32 2 0 0 0 0\nM CHG 2 23 -1 30 -1\nM END", "smiles": "Cc1ccccc1/N=N/c2c(cc3cc(cc(c3c2[O-])NC(=O)C)S(=O)(=O)[O-])S(=O)(=O)O", "formula": "C19H15N3O8S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cd8ff628-6698-4c05-afd5-1adc53bcd5cd" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "477.4706", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ff4f23fe-17a4-4c44-b463-94c317449a3a", "version": "6", "structure": { "id": "646d10f4-5d51-4735-8a27-ecbd6686956f", "molfile": "\n Marvin 01132105132D \n\n 34 34 0 0 0 0 999 V2000\n 7.5042 -8.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7845 -8.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7845 -7.3202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0770 -8.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3658 -8.1503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3658 -7.3218 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6482 -6.9114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6482 -6.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3582 -5.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9336 -5.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2191 -6.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2191 -6.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9336 -7.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0770 -9.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3658 -9.7951 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7762 -10.5110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9509 -9.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6502 -10.2055 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.7845 -9.7966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5042 -9.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2235 -9.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9364 -9.3794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6537 -9.7921 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0614 -9.0749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2414 -10.5094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3663 -10.1998 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.9364 -8.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2173 -8.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2173 -7.3202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9345 -6.9024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9345 -6.0849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6518 -7.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9607 -8.1667 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 0.9607 -8.1667 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 7 2 0 0 0 0\n 4 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 2 0 0 0 0\n 15 18 1 0 0 0 0\n 14 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 1 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 23 25 2 0 0 0 0\n 23 26 1 0 0 0 0\n 22 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 1 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 1 2 1 0 0 0 0\nM CHG 4 18 -1 26 -1 33 1 34 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 33 34\nM SPA 1 1 33\nM SDI 1 4 0.5407 -8.5867 0.5407 -7.7467\nM SDI 1 4 1.3807 -7.7467 1.3807 -8.5867\nM SMT 1 2\nM END", "smiles": "Cc1ccccc1/N=N/c2c(cc3cc(cc(c3c2O)NC(=O)C)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]", "formula": "C19H15N3O8S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "523.4502", "optical_activity": "NONE", "references": [ "1c0c2fb1-25c8-4459-80ae-dc6caf6b9353", "d3107925-7e9f-428b-af7e-d77f866edbab" ], "stereo_centers": 0 }, "unii": "02BXM5Q7GE" } ] }