{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "935a9925-5ea5-4a9b-ac97-1b87f40c6ef3",
          "code": "4419-11-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4419-11-8",
          "code_system": "CAS",
          "references": [
            "09d5786e-7c94-4a2c-9837-b4fe575fcf3e",
            "26969aaa-76a6-4e35-b273-5ede512deebd"
          ]
        },
        {
          "uuid": "ad37bf8a-e08c-45a7-81d4-c2dde8f2f26e",
          "code": "1547296-70-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1547296-70-7",
          "code_system": "CAS",
          "references": [
            "09d5786e-7c94-4a2c-9837-b4fe575fcf3e",
            "5fb8d757-d542-419b-9320-928735d2e276"
          ]
        },
        {
          "uuid": "13ea4a46-3084-4626-800e-4ccf959e2ebb",
          "code": "224-583-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.350",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "09d5786e-7c94-4a2c-9837-b4fe575fcf3e"
          ]
        },
        {
          "uuid": "4ede2654-572e-239f-a1ff-169c9f93bc11",
          "code": "DTXSID3044675",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3044675",
          "code_system": "EPA CompTox",
          "references": [
            "5b6d200c-cd31-b235-e800-69a67ca70630"
          ]
        },
        {
          "uuid": "706d52b4-b73f-45f7-880f-107507f2ac47",
          "code": "02830LWZ4X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "be125c28-be54-4ae5-9f98-1bede4433e98",
          "name": "2,2'-AZOBIS(2,4-DIMETHYLPENTANENITRILE)",
          "stdName": "2,2'-AZOBIS(2,4-DIMETHYLPENTANENITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1754728-71e1-4b36-bf37-5c34fe899019"
          ],
          "display_name": false
        },
        {
          "uuid": "6c027dff-2cc6-4b74-bf8a-2a9b52ff32fb",
          "name": "2,2'-AZOBIS(2,4-DIMETHYLVALERONITRILE)",
          "stdName": "2,2'-AZOBIS(2,4-DIMETHYLVALERONITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69dbc6eb-8cbe-4470-bf02-69625039cdb8"
          ],
          "display_name": true
        },
        {
          "uuid": "34ea71d2-b9e5-4fce-a114-6898b210355f",
          "name": "ADVN",
          "stdName": "ADVN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1754728-71e1-4b36-bf37-5c34fe899019"
          ],
          "display_name": false
        },
        {
          "uuid": "6503da79-51f8-4790-ba14-567522f0391b",
          "name": "PENTANENITRILE, 2,2'-(1,2-DIAZENEDIYL)BIS(2,4-DIMETHYL-",
          "stdName": "PENTANENITRILE, 2,2'-(1,2-DIAZENEDIYL)BIS(2,4-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1754728-71e1-4b36-bf37-5c34fe899019"
          ],
          "display_name": false
        },
        {
          "uuid": "1b81eb5e-ea3d-4dc8-adda-527be1793558",
          "name": "PENTANENITRILE, 2,2'-(1E)-1,2-DIAZENEDIYLBIS(2,4-DIMETHYL-",
          "stdName": "PENTANENITRILE, 2,2'-(1E)-1,2-DIAZENEDIYLBIS(2,4-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1754728-71e1-4b36-bf37-5c34fe899019"
          ],
          "display_name": false
        },
        {
          "uuid": "2f242dbf-d4cc-4747-b86c-b4d8d8262f04",
          "name": "PENTANENITRILE, 2,2'-AZOBIS(2,4-DIMETHYL-",
          "stdName": "PENTANENITRILE, 2,2'-AZOBIS(2,4-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1754728-71e1-4b36-bf37-5c34fe899019"
          ],
          "display_name": false
        },
        {
          "uuid": "d22e3c49-a16e-45fa-a8df-238d8f2ba8ad",
          "name": "VALERONITRILE, 2,2'-AZOBIS(2,4-DIMETHYL-",
          "stdName": "VALERONITRILE, 2,2'-AZOBIS(2,4-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1754728-71e1-4b36-bf37-5c34fe899019"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "69dbc6eb-8cbe-4470-bf02-69625039cdb8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c1754728-71e1-4b36-bf37-5c34fe899019",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09d5786e-7c94-4a2c-9837-b4fe575fcf3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392084000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db879ec0-b166-4750-8431-a6a7fb2d8b7d",
          "citation": "SRS import [02830LWZ4X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=02830LWZ4X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392084000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b6d200c-cd31-b235-e800-69a67ca70630",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4419-11-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "26969aaa-76a6-4e35-b273-5ede512deebd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5fb8d757-d542-419b-9320-928735d2e276",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f39dfe5d-8818-41ee-a45f-f14860039ffb",
          "id": "f39dfe5d-8818-41ee-a45f-f14860039ffb",
          "molfile": "\n  Marvin  01132112382D          \n\n 18 17  0  0  0  0            999 V2000\n    9.9757   -8.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9757   -7.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2612   -7.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -7.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -6.2576    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.8651   -6.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -5.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -4.6076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5152   -6.2576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9277   -5.5431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -5.5431    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.5777   -5.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -4.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4672   -4.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4672   -3.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1817   -4.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -6.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -7.1932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  9  1  0  0  0  0\n  7  8  3  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 17 18  3  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(C)(C#N)/N=N/C(C)(CC(C)C)C#N",
          "formula": "C14H24N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "be4f7a90-c8a9-450a-bb4b-4cb60522288b"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "248.3677",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "899d49b3-f1b7-4033-8056-f70ced8568a3",
      "version": "4",
      "structure": {
        "id": "9e3eb6cc-5a05-47e7-8357-65adf62584d6",
        "molfile": "\n  Marvin  01132108132D          \n\n 18 17  0  0  0  0            999 V2000\n   10.6902   -6.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8651   -6.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -5.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -4.6076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6902   -7.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9757   -7.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9757   -8.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2612   -7.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5152   -6.2576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9277   -5.5431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -5.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5777   -5.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -6.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -7.1932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7527   -4.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4672   -4.3056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4672   -3.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1817   -4.7181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  3  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  3  0  0  0  0\n 11 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(C)(C#N)/N=N/C(C)(CC(C)C)C#N",
        "formula": "C14H24N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "248.3677",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "69dbc6eb-8cbe-4470-bf02-69625039cdb8",
          "db879ec0-b166-4750-8431-a6a7fb2d8b7d"
        ],
        "stereo_centers": 2
      },
      "unii": "02830LWZ4X"
    }
  ]
}