{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d9af6e5e-9126-4cf5-9f76-32e1a2f0bb1b", "code": "95-35-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=95-35-2", "code_system": "CAS", "references": [ "c06be1fa-598f-44bb-8102-87812428aa7d", "d5ad6ab4-1cbc-4617-aaa6-517900005609" ] }, { "uuid": "30730a1c-35cb-4a81-b9ed-82843f880d75", "code": "21 CFR 177.2600", "comments": "PART 177 -- INDIRECT FOOD ADDITIVES: POLYMERS|Subpart C--Substances for Use Only as Components of Articles Intended for Repeated Use|Sec. 177.2600 Rubber articles intended for repeated use.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=177.2600", "code_system": "CFR", "references": [ "c06be1fa-598f-44bb-8102-87812428aa7d" ] }, { "uuid": "8b1ff696-d6de-40f6-83a0-039af9bb7ef3", "code": "1742748", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1742748/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "c06be1fa-598f-44bb-8102-87812428aa7d" ] }, { "uuid": "6729622e-b230-497e-b542-520d1623e952", "code": "202-412-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.194", "code_system": "ECHA (EC/EINECS)", "references": [ "c06be1fa-598f-44bb-8102-87812428aa7d" ] }, { "uuid": "8a06d744-a457-4e61-8403-8c6b7f1996bd", "code": "66766", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66766", "code_system": "PUBCHEM", "references": [ "c06be1fa-598f-44bb-8102-87812428aa7d" ] }, { "uuid": "fb34f74b-a922-4c26-82b3-a35aa5c625d6", "code": "0214C2T14J", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2bfb3edf-37ed-0053-08af-fdf679650844", "code": "4826", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4826", "code_system": "NSC", "references": [ "b83380cf-8ce4-ba62-0c13-a391d3f3ac65" ] }, { "uuid": "297523b0-5e1f-48c9-72dd-49602128251d", "code": "0214C2T14J", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=0214C2T14J", "code_system": "DAILYMED", "references": [ "93dee5a2-b251-96cc-8d9d-3133566039d7" ] }, { "uuid": "bbf59468-7d61-8cf4-5aee-3c37cba8364b", "code": "DTXSID901358667", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901358667", "code_system": "EPA CompTox", "references": [ "e47c41bd-bca5-dd97-ae0b-aa228ea26078" ] } ], "substance_class": "chemical", "names": [ { "uuid": "3c7bb0c1-59b7-4f54-a6e2-ec0a2767f631", "name": "1,3-BIS((2-BENZOTHIAZOLYLTHIO)METHYL)UREA", "stdName": "1,3-BIS((2-BENZOTHIAZOLYLTHIO)METHYL)UREA", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9a464f37-15da-4d85-b80c-f7bd89054535", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": false }, { "uuid": "b6cbc20f-194f-4955-ac87-668774df2756", "name": "1,3-BIS(2-BENZOTHIAZOLEMERCAPTOMETHYL)UREA", "stdName": "1,3-BIS(2-BENZOTHIAZOLEMERCAPTOMETHYL)UREA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "94e491e1-97b1-4db2-82b6-baca08798b9e", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": false }, { "uuid": "1dd0af65-4dc4-4b52-96b7-eeb9d362578b", "name": "1,3-BIS(BENZOTHIAZOL-2-YLTHIOMETHYL)UREA", "stdName": "1,3-BIS(BENZOTHIAZOL-2-YLTHIOMETHYL)UREA", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9a464f37-15da-4d85-b80c-f7bd89054535", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": true }, { "uuid": "5976ce96-b0b8-48cc-85f4-27d2ed976549", "name": "N,N'-BIS(2-BENZOTHIAZOLYLTHIOMETHYLENE)UREA", "stdName": "N,N'-BIS(2-BENZOTHIAZOLYLTHIOMETHYLENE)UREA", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9a464f37-15da-4d85-b80c-f7bd89054535", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": false }, { "uuid": "6704d8a1-cb89-4331-a506-0ef535ced3c1", "name": "NSC-4826", "stdName": "NSC-4826", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "94e491e1-97b1-4db2-82b6-baca08798b9e", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": false }, { "uuid": "3b827614-3101-44a2-9e09-67a1c2c2f620", "name": "UREA, 1,3-BIS((2-BENZOTHIAZOLYLTHIO)METHYL)-", "stdName": "UREA, 1,3-BIS((2-BENZOTHIAZOLYLTHIO)METHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "94e491e1-97b1-4db2-82b6-baca08798b9e", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": false }, { "uuid": "be792436-cfb7-464a-aead-03d24a1865e4", "name": "UREA, N,N'-BIS((2-BENZOTHIAZOLYLTHIO)METHYL)-", "stdName": "UREA, N,N'-BIS((2-BENZOTHIAZOLYLTHIO)METHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "94e491e1-97b1-4db2-82b6-baca08798b9e", "42c2f11a-8c2e-4386-8dba-4cda87abbb4f" ], "display_name": false } ], "references": [ { "uuid": "94e491e1-97b1-4db2-82b6-baca08798b9e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "42c2f11a-8c2e-4386-8dba-4cda87abbb4f", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9a464f37-15da-4d85-b80c-f7bd89054535", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c06be1fa-598f-44bb-8102-87812428aa7d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391031000, "tags": [ "NOMEN" ] }, { "uuid": "e3228b1a-06f3-47f9-a723-77b1211c2679", "citation": "SRS import [0214C2T14J]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0214C2T14J", "doc_type": "SRS", "public_domain": true, "document_date": 1493391031000, "tags": [ "NOMEN" ] }, { "uuid": "dc51ba69-085c-4d9d-a1bc-0bed128b8212", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d5ad6ab4-1cbc-4617-aaa6-517900005609", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "93dee5a2-b251-96cc-8d9d-3133566039d7", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "b83380cf-8ce4-ba62-0c13-a391d3f3ac65", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "e47c41bd-bca5-dd97-ae0b-aa228ea26078", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c05391e7-3ae3-4ca9-a443-5ea8ecea0c48", "id": "c05391e7-3ae3-4ca9-a443-5ea8ecea0c48", "molfile": "\n Marvin 01132109562D \n\n 26 29 0 0 0 0 999 V2000\n 8.4234 -3.4660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4234 -4.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6982 -4.6918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9814 -4.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2562 -4.6934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5338 -4.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7685 -4.6132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2168 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3800 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9641 -3.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3756 -2.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2124 -2.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6328 -3.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4480 -3.4639 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1401 -4.6948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8654 -4.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5874 -4.6978 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5874 -5.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2701 -6.0013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0159 -6.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4326 -7.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0210 -8.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1917 -8.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7674 -7.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1786 -6.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9198 -5.9963 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 15 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 14 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 13 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 26 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 20 25 2 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)nc(SCNC(=O)NCSc3nc4ccccc4s3)s2", "formula": "C17H14N4OS4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6127cbe2-932f-44f8-bb53-c4372ccd41a1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "418.5842", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "976e487f-94df-4624-99b8-5881637e3f23", "version": "5", "structure": { "id": "e4ff67bf-28a4-4b0f-8388-04b35659a946", "molfile": "\n Marvin 01132111512D \n\n 26 29 0 0 0 0 999 V2000\n 8.4234 -3.4660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4234 -4.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6982 -4.6918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9814 -4.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2562 -4.6934 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5338 -4.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7685 -4.6132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2168 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6328 -3.2907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2124 -2.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3756 -2.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9641 -3.2957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3800 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4480 -3.4639 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1401 -4.6948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8654 -4.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5874 -4.6978 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5874 -5.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2701 -6.0013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0159 -6.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1786 -6.7774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7674 -7.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1917 -8.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0210 -8.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4326 -7.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9198 -5.9963 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 8 2 0 0 0 0\n 9 14 1 0 0 0 0\n 14 6 1 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 20 2 0 0 0 0\n 21 26 1 0 0 0 0\n 26 18 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)nc(SCNC(=O)NCSc3nc4ccccc4s3)s2", "formula": "C17H14N4OS4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "418.5842", "optical_activity": "NONE", "references": [ "dc51ba69-085c-4d9d-a1bc-0bed128b8212", "e3228b1a-06f3-47f9-a723-77b1211c2679" ], "stereo_centers": 0 }, "unii": "0214C2T14J" } ] }