{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "072655fc-8c6c-4bc4-a2a0-c68d3f0e93e7",
          "code": "N06AX12",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|bupropion",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AX12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "a8661dc0-bc3a-40f2-961d-bd14267ac3d8",
          "code": "N0000000102",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Norepinephrine Transporter Interactions [MoA]|Norepinephrine Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000102",
          "code_system": "NDF-RT",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "55370bdd-54a2-415c-94da-a4636311ef44",
          "code": "N0000000114",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Dopamine Transporter Interactions [MoA]|Dopamine Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000114",
          "code_system": "NDF-RT",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "dfe39362-b604-4595-8c50-a3c921ac2e4c",
          "code": "N0000180855",
          "comments": "Established Pharmacologic Class [EPC]|Aminoketone [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000180855",
          "code_system": "NDF-RT",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "3df7d1b9-c485-4f3b-84b6-3b91d203ffe1",
          "code": "N0000009282",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Neurotransmitter & Neuromuscular Transmitter Activity Alteration [PE]|Dopamine Activity Alteration [PE]|Increased Dopamine Activity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000009282",
          "code_system": "NDF-RT",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "8bb6f2d1-58ce-46a7-ac5c-763b8ea4c081",
          "code": "N0000009456",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Neurotransmitter & Neuromuscular Transmitter Activity Alteration [PE]|Norepinephrine Activity Alteration [PE]|Increased Norepinephrine Activity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000009456",
          "code_system": "NDF-RT",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "6b11643d-39d0-4832-a08e-2459a961dfce",
          "code": "QN06AX12",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|bupropion",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AX12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "a32d1a83-f2bc-45ad-8ed9-c771fce51b1f",
          "code": "34911-55-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34911-55-2",
          "code_system": "CAS",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e",
            "5afbd016-71c7-4df4-a91d-2d338dcb1233"
          ]
        },
        {
          "uuid": "3ec8d035-37db-468f-aa83-2a0d125eaf76",
          "code": "C62012",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62012",
          "code_system": "NCI_THESAURUS",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "a1513d64-93e7-46fc-a837-cff727de3b2f",
          "code": "D016642",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68016642",
          "code_system": "MESH",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "0cc8dbf6-47f1-46a4-8366-1bfe965d9513",
          "code": "NBK559444",
          "comments": "LiverTox|CNS|Antidepressant|Aminoketone",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK559444/",
          "code_system": "LIVERTOX",
          "references": [
            "db74c7fc-8c9f-7b80-b70d-5da036a38b77"
          ]
        },
        {
          "uuid": "57dd6fb3-ce3a-4540-86f5-2e29373cd390",
          "code": "BUPROPION",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bupropion",
          "code_system": "WIKIPEDIA",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "dfe1755f-d076-47d6-aebc-e10a3e6ff219",
          "code": "SUB05413MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "0644dfee-f27e-4c42-850b-b87b1c97d72a",
          "code": "3562",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3562",
          "code_system": "INN",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "fee102e4-fe35-4f1e-8c76-65a880ee2772",
          "code": "7135",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7135",
          "code_system": "IUPHAR",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "6815ef04-74fc-4937-968d-e1d9115d1613",
          "code": "42347",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/42347/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "8ed67e2c-0174-4243-ad32-7846603e83ea",
          "code": "34841-39-9",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34841-39-9",
          "code_system": "CAS",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e",
            "7487c86d-b2be-484b-a794-a4dbebe1020d"
          ]
        },
        {
          "uuid": "1a203c6a-cc5f-4dff-9fbb-800edc93a82b",
          "code": "m2773",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2773?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "a6ffdb1d-ff1d-4b91-88d6-ba84496cf9e3",
          "code": "CHEMBL894",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL894",
          "code_system": "ChEMBL",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "7836dff8-500d-4f00-8ea0-55bf5793a8dc",
          "code": "A08AA62",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|Centrally acting antiobesity products|bupropion and naltrexone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A08AA62&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "c9b7d25b-3d9c-45b1-8c3f-d44ecd40600c",
          "code": "444",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/444",
          "code_system": "PUBCHEM",
          "references": [
            "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e"
          ]
        },
        {
          "uuid": "f1f7ae14-d99a-43f5-bda9-2edcbb9cf57e",
          "code": "6988",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6988",
          "code_system": "HSDB",
          "references": [
            "c9c9a1d6-dffc-8471-1c6a-846fb1cdf792"
          ]
        },
        {
          "uuid": "6f194251-55c9-dd21-377c-5c396cc95c40",
          "code": "DTXSID7022706",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7022706",
          "code_system": "EPA CompTox",
          "references": [
            "1fb12cf4-06af-80ec-c2bf-5e463b70c147"
          ]
        },
        {
          "uuid": "be8b6fcd-b726-2498-55b4-a47a2f98e98d",
          "code": "C265",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265",
          "code_system": "NCI_THESAURUS",
          "references": [
            "db74c7fc-8c9f-7b80-b70d-5da036a38b77"
          ]
        },
        {
          "uuid": "9da5459a-f0c3-4f7e-9bf0-ff1e5e42a377",
          "code": "01ZG3TPX31",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5bfeed1d-5a38-30d6-b730-14ddd3786a62",
          "code": "Bupropion",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM321/",
          "code_system": "LACTMED",
          "references": [
            "db74c7fc-8c9f-7b80-b70d-5da036a38b77"
          ]
        },
        {
          "uuid": "797d28e8-3466-afda-bdb1-b4a144ef31d5",
          "code": "435",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/435",
          "code_system": "DRUG CENTRAL",
          "references": [
            "db74c7fc-8c9f-7b80-b70d-5da036a38b77"
          ]
        },
        {
          "uuid": "3c4d8f21-47f7-7cba-b041-47d35b2b070b",
          "code": "DB01156",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01156",
          "code_system": "DRUG BANK",
          "references": [
            "db74c7fc-8c9f-7b80-b70d-5da036a38b77"
          ]
        },
        {
          "uuid": "01057a07-3904-71e4-e2af-b855e77d802c",
          "code": "3219",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3219",
          "code_system": "CHEBI",
          "references": [
            "db74c7fc-8c9f-7b80-b70d-5da036a38b77"
          ]
        },
        {
          "uuid": "0106bc2a-0aab-f68a-0a64-9e3a9e47387b",
          "code": "100000088891",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "62fcc717-87f9-26eb-26f5-f73c20695f00"
          ]
        },
        {
          "uuid": "9eeb367c-71ee-e5f2-6005-186b86fd8bc8",
          "code": "01ZG3TPX31",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=01ZG3TPX31",
          "code_system": "DAILYMED",
          "references": [
            "cde6ecde-abcc-2d33-178d-03ec39f29c4d"
          ]
        },
        {
          "uuid": "903ba5db-ca96-c060-2b77-c66463a565a9",
          "code": "758686",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758686",
          "code_system": "NSC",
          "references": [
            "160c50af-c115-6fd4-a1fd-db8328d5b7f2"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "490125c9-280c-4718-89dc-a2ee1c215c38",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b5b36c12-c9aa-42de-aa3b-ae5cf109ca76",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd490ecc-96e8-4f92-9c02-88114c30d99e",
          "citation": "http://www.orexigen.com/candidates/candidates_contrave.php",
          "url": "http://www.orexigen.com/candidates/candidates_contrave.php",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2dd8b89-9aa3-4006-af44-1acf2d147a90",
          "citation": "INN Proposed List 84",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL84.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "402f3857-b7eb-44e7-b9b5-3b23cf6be534",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "282b63b9-ede1-43d2-bc60-369df04675c6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80dd1598-7771-496e-aaff-88c78d3a4a7f",
          "citation": "EMPIRICA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7404ab17-4e53-4a95-ad23-424af704f440",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53a99ef2-3381-495d-a202-340d66627632",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53ae9547-090a-4bd0-a5e3-1b2d70b3de5e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390169000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "898cf49c-758e-45fb-9b48-e9572c0c3702",
          "citation": "JOURNAL OF PHARMACEUTICAL SCIENCES, VOLUME 73, ISSUE 8, PAGES 1104?1107, AUGUST 1984",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/jps.2600730820/abstract",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9f551e3-202e-42d5-9085-2443037d9581",
          "citation": "JOURNAL OF PHARMACEUTICAL SCIENCES, VOLUME 73, ISSUE 8, PAGES 1104?1107, AUGUST 1984",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/jps.2600730820/epdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7672d889-1c97-4465-876c-b67b6a5e2647",
          "citation": "SRS import [01ZG3TPX31]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=01ZG3TPX31",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390169000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7773af3-42bd-4e91-b025-efefed3ebaa9",
          "citation": "BUPROPION [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "861d0d9b-c2ed-4f46-8fd6-53bef8ada401",
          "citation": "BUPROPION [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c44e6ac-b63e-481f-92c6-3f6acfd417b6",
          "citation": "BUPROPION [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20bbad0c-2cb5-4cff-b209-3303400f5453",
          "citation": "BUPROPION [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0a846568-c3bf-4ef7-8af1-6b56c5bbdb07",
          "citation": "BUPROPION [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c9c9a1d6-dffc-8471-1c6a-846fb1cdf792",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+34911-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1fb12cf4-06af-80ec-c2bf-5e463b70c147",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=34911-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6b73a146-6734-ede6-a3f6-ee9e0485986e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+34911-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7e26f8f-fe63-9424-6ae5-6d66a7d4bf4d",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5549303#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "103cc06e-5337-ea39-d63e-ca368b175aa6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "62fcc717-87f9-26eb-26f5-f73c20695f00",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "db74c7fc-8c9f-7b80-b70d-5da036a38b77",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7487c86d-b2be-484b-a794-a4dbebe1020d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5afbd016-71c7-4df4-a91d-2d338dcb1233",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3c4c3fde-71b7-5bcd-2797-9bfaedfcd120",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2011/022497s000lbl.pdf",
          "doc_type": "FDA APPROVED DRUG LABEL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "052632ef-ff44-4233-a09e-f80c4b27b410",
          "citation": "Brain Res 1986;367(1-2):385",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e352fd21-4a34-41ab-bace-0f420434790e",
          "citation": "Nephron Clin Pract 2004;97(3):c83-9",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "160c50af-c115-6fd4-a1fd-db8328d5b7f2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cde6ecde-abcc-2d33-178d-03ec39f29c4d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3817bf67-2ad4-f6be-40c3-ee5f53b3a1a2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "057703f2-6aeb-47ed-a67b-32cd431abb80",
          "citation": "Nephron Clin Pract 2004;97(3):c83-9",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5cc1190f-e371-47a9-b238-0537f4c420e3",
          "id": "5cc1190f-e371-47a9-b238-0537f4c420e3",
          "molfile": "\n  Marvin  01132104482D          \n\n 16 16  0  0  0  0            999 V2000\n    4.6275   -9.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6618   -9.9575    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.3949  -10.3431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1433   -9.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -9.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6548   -9.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5671  -10.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9555  -10.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9860  -11.2136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2301  -10.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2072   -9.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4665   -8.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7678   -9.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8021  -10.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1034  -10.4920    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.5352  -10.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  4  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC(C(=O)c1cccc(c1)Cl)NC(C)(C)C",
          "formula": "C13H18ClNO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1c0a9a03-1a7a-4e21-91fb-fa7c25588aae"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "239.7415",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3d473a96-77e0-4eeb-8cdc-822fde105b5c",
      "version": "36",
      "structure": {
        "id": "f2fc49b1-4dfa-4148-9543-b5c779c4bc0c",
        "molfile": "\n  Marvin  01132112362D          \n\n 16 16  0  0  0  0            999 V2000\n    3.9555  -10.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2301  -10.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3949  -10.3431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6618   -9.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5352  -10.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9860  -11.2136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1433   -9.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8021  -10.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1034  -10.4920    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.2072   -9.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4665   -8.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6275   -9.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9412   -9.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6548   -9.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5671  -10.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7678   -9.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  2  0  0  0  0\n  4 12  1  0  0  0  0\n 13  7  1  0  0  0  0\n 14  7  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16 11  1  0  0  0  0\n 16  8  2  0  0  0  0\nM  END",
        "smiles": "CC(C(=O)c1cccc(c1)Cl)NC(C)(C)C",
        "formula": "C13H18ClNO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "239.7415",
        "optical_activity": "( + / - )",
        "references": [
          "7672d889-1c97-4465-876c-b67b6a5e2647",
          "490125c9-280c-4718-89dc-a2ee1c215c38",
          "c2dd8b89-9aa3-4006-af44-1acf2d147a90"
        ],
        "stereo_centers": 1
      },
      "unii": "01ZG3TPX31",
      "relationships": [
        {
          "uuid": "34a5c6f6-9ac1-44a3-8f7a-fbebb86e95d2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "21821c44-8362-4aa0-950a-df78e2da4519",
            "refuuid": "3d473a96-77e0-4eeb-8cdc-822fde105b5c",
            "name": "BUPROPION",
            "unii": "01ZG3TPX31",
            "linking_id": "01ZG3TPX31",
            "ref_pname": "BUPROPION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6476ccb9-2c47-4066-9104-75188526470a",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "052632ef-ff44-4233-a09e-f80c4b27b410"
          ],
          "related_substance": {
            "uuid": "7e2d183e-c06f-41be-a5cb-42ce29385913",
            "refuuid": "dc59c633-5da9-4e5a-a5e0-40a31f9c2dfa",
            "name": "HYDROXYBUPROPION, (±)-",
            "unii": "V94F513635",
            "linking_id": "V94F513635",
            "ref_pname": "HYDROXYBUPROPION, (±)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9eb1e9b4-892c-4704-be61-a0d2acc34742",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "b9f551e3-202e-42d5-9085-2443037d9581"
          ],
          "related_substance": {
            "uuid": "82ddaa62-0d84-4b19-b9ac-69ebe7dd5814",
            "refuuid": "9a688404-03bb-4dac-a02f-523940516d32",
            "name": "ERYTHROHYDROBUPROPION",
            "unii": "YI65RR2TFJ",
            "linking_id": "YI65RR2TFJ",
            "ref_pname": "ERYTHROHYDROBUPROPION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f3da3975-0030-4392-ad21-ea27cdb921ab",
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "898cf49c-758e-45fb-9b48-e9572c0c3702"
          ],
          "related_substance": {
            "uuid": "b6b370fa-f37e-4225-ab34-340e77d52117",
            "refuuid": "5baa6de5-0040-479c-bf5e-b259755195fd",
            "name": "THREOHYDROBUPROPION",
            "unii": "988C8SFV4F",
            "linking_id": "988C8SFV4F",
            "ref_pname": "THREOHYDROBUPROPION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6573a543-584e-494a-ae08-52239d5c3291",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "4d477ada-203a-4320-ab40-b22a34f88ecc",
            "refuuid": "06522103-3580-47c7-ab6d-a6896316c2ae",
            "name": "BUPROPION HYDROBROMIDE",
            "unii": "E70G3G5863",
            "linking_id": "E70G3G5863",
            "ref_pname": "BUPROPION HYDROBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eda77c43-c01e-4d6a-9e77-4a301b784f13",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "216aa635-fa91-4bff-abdc-33e523680023",
            "refuuid": "f3b5bb2d-17a1-4ada-83c5-de430691aaa9",
            "name": "Bupropion Hydrochloride",
            "unii": "ZG7E5POY8O",
            "linking_id": "ZG7E5POY8O",
            "ref_pname": "Bupropion Hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2a62f575-a8fa-4fd3-ad13-ffaa8a6359f3",
          "amount": {
            "uuid": "9327b44f-a1d0-43ec-a359-3010ac527553"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "057703f2-6aeb-47ed-a67b-32cd431abb80"
          ],
          "related_substance": {
            "uuid": "e3a8ac24-0e09-417b-96c4-25824f75c6b6",
            "refuuid": "57986d82-0c50-4163-ad76-b434f1220ec5",
            "name": "Radafaxine",
            "unii": "Q47741214K",
            "linking_id": "Q47741214K",
            "ref_pname": "Radafaxine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0344c944-5d89-4915-bf78-299c9882ec59",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f7217384-854a-4506-b3bf-a82891ea6a7e",
            "refuuid": "e05c727c-0fc6-4280-b81d-1a5b64d45e82",
            "name": "BUPROPION, (R)-",
            "unii": "8KZL6AO7H4",
            "linking_id": "8KZL6AO7H4",
            "ref_pname": "BUPROPION, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f8ea5c05-17b2-4bc1-ae57-11f8ec487093",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "0a4c6c54-eca4-4ca9-af71-c95f85522ff9",
            "refuuid": "14a46320-dfd5-460c-bdf7-7d7a208d10fb",
            "name": "BUPROPION, (S)-",
            "unii": "69BL03TL5X",
            "linking_id": "69BL03TL5X",
            "ref_pname": "BUPROPION, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "28fd9ade-59b8-4a94-b7be-588bae1d1934",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "103cc06e-5337-ea39-d63e-ca368b175aa6"
          ],
          "related_substance": {
            "uuid": "e30df612-fd66-47b8-95d2-9fd44ee84849",
            "refuuid": "6e02b890-7464-4847-ad74-3214a0cf480b",
            "name": "BUPROPION MALEATE",
            "unii": "26NV8NXO4A",
            "linking_id": "26NV8NXO4A",
            "ref_pname": "BUPROPION MALEATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d4aeccc5-871b-4306-8727-916c69e92e3f",
          "amount": {
            "uuid": "bcc9d558-c88b-4d47-ae87-16b597bc395e",
            "average": 84,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "a7e26f8f-fe63-9424-6ae5-6d66a7d4bf4d"
          ],
          "related_substance": {
            "uuid": "85a77082-11b5-473f-be3f-c88d0a5b85da",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "34bdcfdf-1145-4739-b415-ad79a3bf44b2",
          "amount": {
            "uuid": "d1ade898-dd5f-4d30-9e23-48fbfef31d42",
            "average": 0.5,
            "units": "%"
          },
          "qualification": "FECAL; URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "3c4c3fde-71b7-5bcd-2797-9bfaedfcd120"
          ],
          "related_substance": {
            "uuid": "3c8db964-7b31-4098-ab2d-28886796705e",
            "refuuid": "3d473a96-77e0-4eeb-8cdc-822fde105b5c",
            "name": "BUPROPION",
            "unii": "01ZG3TPX31",
            "linking_id": "01ZG3TPX31",
            "ref_pname": "BUPROPION",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "a5eda63e-87cf-4ec4-ad62-061c0a7e9e4b",
          "name": "(±)-2-(TERT-BUTYLAMINO)-3'-CHLOROPROPIOPHENONE",
          "stdName": "(+/-)-2-(TERT-BUTYLAMINO)-3'-CHLOROPROPIOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "490125c9-280c-4718-89dc-a2ee1c215c38"
          ],
          "display_name": false
        },
        {
          "uuid": "28d64ce5-17b9-414e-bdbf-f263aaac9579",
          "name": "1-PROPANONE, 1-(3-CHLOROPHENYL)-2-((1,1-DIMETHYLETHYL)AMINO)-(±)-",
          "stdName": "1-PROPANONE, 1-(3-CHLOROPHENYL)-2-((1,1-DIMETHYLETHYL)AMINO)-(+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "490125c9-280c-4718-89dc-a2ee1c215c38"
          ],
          "display_name": false
        },
        {
          "uuid": "21f82e8c-601f-40c7-b932-2557dc69da00",
          "name": "AMFEBUTAMONE",
          "stdName": "AMFEBUTAMONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5b36c12-c9aa-42de-aa3b-ae5cf109ca76"
          ],
          "display_name": false
        },
        {
          "uuid": "b2943e86-de1e-4d40-8f08-a33821fb71bf",
          "name": "BUPROPION",
          "stdName": "BUPROPION",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a99ef2-3381-495d-a202-340d66627632",
            "c2dd8b89-9aa3-4006-af44-1acf2d147a90",
            "282b63b9-ede1-43d2-bc60-369df04675c6",
            "0a846568-c3bf-4ef7-8af1-6b56c5bbdb07",
            "490125c9-280c-4718-89dc-a2ee1c215c38",
            "861d0d9b-c2ed-4f46-8fd6-53bef8ada401",
            "402f3857-b7eb-44e7-b9b5-3b23cf6be534",
            "c7773af3-42bd-4e91-b025-efefed3ebaa9",
            "3c44e6ac-b63e-481f-92c6-3f6acfd417b6",
            "7404ab17-4e53-4a95-ad23-424af704f440",
            "20bbad0c-2cb5-4cff-b209-3303400f5453"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "bb42aa07-4c8e-4f12-ae54-045219c08f6f",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "f5782bf8-d368-4d46-bcd7-498adcb2a47f",
          "name": "BUPROPION EXTENDED RELEASE",
          "stdName": "BUPROPION EXTENDED RELEASE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80dd1598-7771-496e-aaff-88c78d3a4a7f"
          ],
          "display_name": false
        },
        {
          "uuid": "1e94a281-8d44-48e6-a2bd-49fb19ac2af6",
          "name": "BUPROPION SLOW RELEASE",
          "stdName": "BUPROPION SLOW RELEASE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80dd1598-7771-496e-aaff-88c78d3a4a7f"
          ],
          "display_name": false
        },
        {
          "uuid": "fb1f6d76-9eaa-40ca-a8b2-0483deee43c7",
          "name": "BUPROPION [MART.]",
          "stdName": "BUPROPION [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "402f3857-b7eb-44e7-b9b5-3b23cf6be534"
          ],
          "display_name": false
        },
        {
          "uuid": "167a4f72-4f95-437d-8598-b6280863e43a",
          "name": "BUPROPION [MI]",
          "stdName": "BUPROPION [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "282b63b9-ede1-43d2-bc60-369df04675c6"
          ],
          "display_name": false
        },
        {
          "uuid": "e99f2e7a-97c7-4acf-b908-9ed5ba33408d",
          "name": "BUPROPION [VANDF]",
          "stdName": "BUPROPION [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53a99ef2-3381-495d-a202-340d66627632"
          ],
          "display_name": false
        },
        {
          "uuid": "59f85f34-3f2a-65e2-4f23-a52ddf65eb04",
          "name": "Bupropion [WHO-DD]",
          "stdName": "BUPROPION [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3817bf67-2ad4-f6be-40c3-ee5f53b3a1a2"
          ],
          "display_name": false
        },
        {
          "uuid": "06c3ba64-c145-5300-64e4-a195d4836690",
          "name": "NSC-758686",
          "stdName": "NSC-758686",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "160c50af-c115-6fd4-a1fd-db8328d5b7f2"
          ],
          "display_name": false
        },
        {
          "uuid": "637c0b88-88aa-47cc-890b-af10049801e7",
          "name": "bupropion [INN]",
          "stdName": "BUPROPION [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2dd8b89-9aa3-4006-af44-1acf2d147a90"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "b2f1c805-4812-40ae-8f4a-2ddd3c84d5eb",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "a711fdf0-74cd-4e88-a2c1-d46b39d30a7f",
            "high": 47,
            "low": 20,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "a7e26f8f-fe63-9424-6ae5-6d66a7d4bf4d"
          ]
        },
        {
          "uuid": "98f2fbb9-accf-4bf9-8673-d232144c54de",
          "name": "Biological Half-life",
          "value": {
            "uuid": "2981ab0e-d2a0-42c9-af76-ce2da43ff9cb",
            "high": 3,
            "low": 2,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "a7e26f8f-fe63-9424-6ae5-6d66a7d4bf4d"
          ]
        },
        {
          "uuid": "c4776919-62f4-4094-b3cb-c2bc9dfd7205",
          "name": "Tmax",
          "value": {
            "uuid": "2f5f7ce4-dcbe-40b8-ae2c-05a129c22c9c",
            "average": 5,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "a2060377-f880-4d9c-bfbe-1b8f2bf35185",
              "name": "ORAL ADMINISTRATION",
              "references": []
            },
            {
              "uuid": "e06d1d51-deb7-4284-a3de-ccf1b1947830",
              "name": "SINGLE DOSE",
              "references": []
            },
            {
              "uuid": "4e171379-3f98-44d0-89c9-ac6c07866ad1",
              "name": "FASTED STATE",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "3c4c3fde-71b7-5bcd-2797-9bfaedfcd120"
          ]
        },
        {
          "uuid": "ef4b2236-0dde-4f2b-966b-9367778d9d36",
          "name": "Tmax",
          "value": {
            "uuid": "54bf8579-1013-43e5-a262-eba3149fdc33",
            "average": 12,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "b9ba77d2-4e57-44ff-8004-7965d3076b48",
              "name": "ORAL ADMINISTRATION",
              "references": []
            },
            {
              "uuid": "b802af43-2689-4f62-827c-3f591bf89aa2",
              "name": "SINGLE DOSE",
              "references": []
            },
            {
              "uuid": "f7470b12-4a7f-469c-82d0-0eede51d2ccd",
              "name": "FED CONDITION",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "3c4c3fde-71b7-5bcd-2797-9bfaedfcd120"
          ]
        }
      ]
    }
  ]
}