{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b47bfc7c-8191-4f1a-a8fb-cd94d496c2e8",
          "code": "330-55-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=330-55-2",
          "code_system": "CAS",
          "references": [
            "3c4e86b7-400b-4347-8bf7-878375db6205",
            "52ce5703-fa60-47b5-8fe5-079b802b907a"
          ]
        },
        {
          "uuid": "bac0a6b8-2fcc-4eaa-b07a-06535afab40b",
          "code": "D008044",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008044",
          "code_system": "MESH",
          "references": [
            "3c4e86b7-400b-4347-8bf7-878375db6205"
          ]
        },
        {
          "uuid": "a5f3b386-9b0e-476d-9b46-db6704dd88e0",
          "code": "35506",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2691",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3c4e86b7-400b-4347-8bf7-878375db6205"
          ]
        },
        {
          "uuid": "a2f81a00-16b2-44e0-9a51-a918e56ac6d0",
          "code": "m6834",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6834?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3c4e86b7-400b-4347-8bf7-878375db6205"
          ]
        },
        {
          "uuid": "d0f8f862-fad7-485c-bd04-ace4c64e787d",
          "code": "206-356-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.779",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3c4e86b7-400b-4347-8bf7-878375db6205"
          ]
        },
        {
          "uuid": "cbcf5479-b080-44fc-b144-c56610cc15f4",
          "code": "9502",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9502",
          "code_system": "PUBCHEM",
          "references": [
            "3c4e86b7-400b-4347-8bf7-878375db6205"
          ]
        },
        {
          "uuid": "7b6d1e79-ab49-bc67-0f01-4de3efc13f06",
          "code": "Linuron",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Linuron",
          "code_system": "WIKIPEDIA",
          "references": [
            "2b058218-40b3-f49b-b0dc-4d9987c208fc"
          ]
        },
        {
          "uuid": "a4fc52ad-49e3-f7a5-cdb7-7295e44e5f33",
          "code": "1733",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1733",
          "code_system": "HSDB",
          "references": [
            "1e52c693-596b-783c-1176-395e886d5996"
          ]
        },
        {
          "uuid": "e6da7cf4-0052-1917-2df5-1f4453c92655",
          "code": "DTXSID2024163",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2024163",
          "code_system": "EPA CompTox",
          "references": [
            "9719a08c-5acd-2ec6-1837-dbc3817859f3"
          ]
        },
        {
          "uuid": "139b4805-3f13-8666-66fa-77adb7851143",
          "code": "6482",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6482",
          "code_system": "CHEBI",
          "references": [
            "0f798871-d60b-0eb6-5fcd-db859fb92315"
          ]
        },
        {
          "uuid": "3f959e9b-d2a8-4926-9e25-a6c71b190447",
          "code": "01XP1SU59O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "969fb1f7-8365-c552-d16d-a24484cd84f3",
          "code": "linuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/linuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "3fc8eec4-f314-93f7-5cc6-57f2f5fa4aea"
          ]
        },
        {
          "uuid": "57f5f10e-9d2f-2bf4-ea71-e75f85bff30e",
          "code": "300000053399",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "67b6e333-4657-6d8c-87a3-2e6754ceb7e6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "670e7f8a-b758-403d-8332-ab8b412b9de1",
          "name": "3-(3,4-DICHLOROPHENYL)-1-METHOXY-1-METHYLUREA",
          "stdName": "3-(3,4-DICHLOROPHENYL)-1-METHOXY-1-METHYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf130947-ac86-4a34-96e1-f5113abb9ee2",
            "6402f11f-57f6-4f1e-93af-26d0029494b6"
          ],
          "display_name": false
        },
        {
          "uuid": "7451e253-e2e7-4a40-b522-6406422c7c04",
          "name": "LINURON",
          "stdName": "LINURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68073ce5-a74b-421b-90b1-bfd1e36e989e",
            "df7a0d29-97e8-4489-9f06-a9739e095806",
            "22711998-2afa-4ee2-aedb-b19e9ef6bd00",
            "76918e75-b2cb-4a2a-b124-a497b8d4b039",
            "b16fae6b-bc92-454e-ac10-07be6386dcf8",
            "2839486d-6074-40ff-ba80-fae584d1b29c",
            "13c95758-b536-481f-bb83-06e50f22b794",
            "695dc221-57f1-4cc7-a8fb-f0a4a731f576"
          ],
          "display_name": true
        },
        {
          "uuid": "92925c4c-3503-43d0-bc34-f3390aba159a",
          "name": "LINURON [HSDB]",
          "stdName": "LINURON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22711998-2afa-4ee2-aedb-b19e9ef6bd00",
            "2839486d-6074-40ff-ba80-fae584d1b29c"
          ],
          "display_name": false
        },
        {
          "uuid": "ad20b58e-8cf3-4838-955d-1bb6e0c84d6c",
          "name": "LINURON [ISO]",
          "stdName": "LINURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df7a0d29-97e8-4489-9f06-a9739e095806",
            "22711998-2afa-4ee2-aedb-b19e9ef6bd00"
          ],
          "display_name": false
        },
        {
          "uuid": "22a6f2a7-c2e8-4fc3-9882-f6c262568b19",
          "name": "LINURON [MI]",
          "stdName": "LINURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22711998-2afa-4ee2-aedb-b19e9ef6bd00",
            "695dc221-57f1-4cc7-a8fb-f0a4a731f576"
          ],
          "display_name": false
        },
        {
          "uuid": "91dc7a54-cfb7-4782-9a9d-0acb304e08dd",
          "name": "N'-(3,4-DICHLOROPHENYL)-N-METHOXY-N-METHYLUREA",
          "stdName": "N'-(3,4-DICHLOROPHENYL)-N-METHOXY-N-METHYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e70951c3-3f03-4a11-bca0-8dd3db4ef634",
            "cf130947-ac86-4a34-96e1-f5113abb9ee2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b16fae6b-bc92-454e-ac10-07be6386dcf8",
          "citation": "http://www.alanwood.net/pesticides/linuron.html",
          "url": "http://www.alanwood.net/pesticides/linuron.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "22711998-2afa-4ee2-aedb-b19e9ef6bd00",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf130947-ac86-4a34-96e1-f5113abb9ee2",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e70951c3-3f03-4a11-bca0-8dd3db4ef634",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6402f11f-57f6-4f1e-93af-26d0029494b6",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "695dc221-57f1-4cc7-a8fb-f0a4a731f576",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2839486d-6074-40ff-ba80-fae584d1b29c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df7a0d29-97e8-4489-9f06-a9739e095806",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c4e86b7-400b-4347-8bf7-878375db6205",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391081000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e2195de-4d87-414a-9974-01b3547a208a",
          "citation": "SRS import [01XP1SU59O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=01XP1SU59O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391081000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c3016a7-2d08-4e84-93de-60bad4f71e86",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13c95758-b536-481f-bb83-06e50f22b794",
          "citation": "LINURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "76918e75-b2cb-4a2a-b124-a497b8d4b039",
          "citation": "LINURON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68073ce5-a74b-421b-90b1-bfd1e36e989e",
          "citation": "LINURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e52c693-596b-783c-1176-395e886d5996",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+330-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2b058218-40b3-f49b-b0dc-4d9987c208fc",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Linuron",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9719a08c-5acd-2ec6-1837-dbc3817859f3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=330-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3fc8eec4-f314-93f7-5cc6-57f2f5fa4aea",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0f798871-d60b-0eb6-5fcd-db859fb92315",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "52ce5703-fa60-47b5-8fe5-079b802b907a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "67b6e333-4657-6d8c-87a3-2e6754ceb7e6",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d397f293-3bec-4b25-a648-6451d443443a",
          "id": "d397f293-3bec-4b25-a648-6451d443443a",
          "molfile": "\n  Marvin  01132110562D          \n\n 15 15  0  0  0  0            999 V2000\n    5.6851   -1.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9757   -1.2517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2510   -1.6449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2510   -2.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5493   -1.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5493   -0.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8631   -1.6449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1435   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1435   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -0.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7042   -0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7042   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6295    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -1.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 15  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CN(C(=O)Nc1ccc(c(c1)Cl)Cl)OC",
          "formula": "C9H10Cl2N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b2fb21e-1fa7-4370-a83a-65f2ffc65b2a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "249.0941",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a217634f-016d-4e95-9d20-8014e56024f8",
      "version": "8",
      "structure": {
        "id": "54d25ce2-d26c-4f91-96f5-cd6902d8c5b4",
        "molfile": "\n  Marvin  01132104252D          \n\n 15 15  0  0  0  0            999 V2000\n    3.5493   -1.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8631   -1.6449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7042   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2510   -1.6449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -1.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1435   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5493   -0.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7042   -0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4290   -0.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6295    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1435   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9757   -1.2517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2510   -2.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6851   -1.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  5  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  6  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15 13  1  0  0  0  0\n  3  8  1  0  0  0  0\nM  END",
        "smiles": "CN(C(=O)Nc1ccc(c(c1)Cl)Cl)OC",
        "formula": "C9H10Cl2N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "249.0941",
        "optical_activity": "NONE",
        "references": [
          "6c3016a7-2d08-4e84-93de-60bad4f71e86",
          "5e2195de-4d87-414a-9974-01b3547a208a"
        ],
        "stereo_centers": 0
      },
      "unii": "01XP1SU59O"
    }
  ]
}