{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "30cf4308-4d2a-4f0d-9cb0-e41fd88d6ca7",
          "code": "14644-61-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14644-61-2",
          "code_system": "CAS",
          "references": [
            "36216d61-27e6-4f38-ab24-351637384bea",
            "04063705-9ac0-4689-a7e2-12382ddc44c0"
          ]
        },
        {
          "uuid": "251d31d7-1e8f-4259-b556-463809d72ec8",
          "code": "m11652",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11652?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "36216d61-27e6-4f38-ab24-351637384bea"
          ]
        },
        {
          "uuid": "de912e95-414a-474b-83a1-1540f6cb58c7",
          "code": "26793",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26793",
          "code_system": "PUBCHEM",
          "references": [
            "36216d61-27e6-4f38-ab24-351637384bea"
          ]
        },
        {
          "uuid": "43d2fc74-b849-4c7e-83f5-c6e34679033a",
          "code": "238-694-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.162",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "36216d61-27e6-4f38-ab24-351637384bea"
          ]
        },
        {
          "uuid": "f8e7dc2b-c498-c0eb-4623-8a08e64c336c",
          "code": "Zirconium sulfate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zirconium_sulfate",
          "code_system": "WIKIPEDIA",
          "references": [
            "13a87017-696f-d5f9-2173-e93871f10057"
          ]
        },
        {
          "uuid": "5326b958-a35d-0ad3-2cc2-15f3b07fce51",
          "code": "2530",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2530",
          "code_system": "HSDB",
          "references": [
            "29862701-12fd-6d0e-8ec7-6f171f8e5e43"
          ]
        },
        {
          "uuid": "3773a097-0436-433a-73f1-628654b4267a",
          "code": "DTXSID0021466",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0021466",
          "code_system": "EPA CompTox",
          "references": [
            "cb69886e-e872-87f0-8ee5-b7c04d2e11bb"
          ]
        },
        {
          "uuid": "e3ae78d2-7541-438d-b5ff-b912095a0d00",
          "code": "01SJA33642",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c15a661a-24c5-e466-78dc-fa29d6707df6",
          "code": "115915",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=115915",
          "code_system": "NSC",
          "references": [
            "d35aec34-4a6a-0425-9f84-abac9c4bfb9d"
          ]
        },
        {
          "uuid": "04c53e19-33c7-75da-c279-1b97f6fa99a6",
          "code": "01SJA33642",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(01SJA33642)",
          "code_system": "DAILYMED",
          "references": [
            "c5722422-511a-6b60-bd06-de9342d778a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "45143eb7-df23-496f-ad6a-d8f0a0c0506f",
          "name": "NSC-115915",
          "stdName": "NSC-115915",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4dc13b01-b829-41fa-a004-ac0857515563"
          ],
          "display_name": false
        },
        {
          "uuid": "594024cd-8661-437c-a77f-b9c1021da073",
          "name": "SULFURIC ACID, ZIRCONIUM(4+) SALT (2:1)",
          "stdName": "SULFURIC ACID, ZIRCONIUM(4+) SALT (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0b6af44-7bb5-4a31-94e7-ddc731388def"
          ],
          "display_name": false
        },
        {
          "uuid": "4b82db89-55ca-4eab-ac0d-82b661e64dcf",
          "name": "ZIRCONIUM DISULFATE",
          "stdName": "ZIRCONIUM DISULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0b6af44-7bb5-4a31-94e7-ddc731388def"
          ],
          "display_name": false
        },
        {
          "uuid": "1eb12c69-fc53-4b26-839b-284cf9f20d37",
          "name": "ZIRCONIUM ORTHOSULFATE",
          "stdName": "ZIRCONIUM ORTHOSULFATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0b6af44-7bb5-4a31-94e7-ddc731388def"
          ],
          "display_name": false
        },
        {
          "uuid": "5bb751de-659b-43d7-9b14-05e6b6f4dbc0",
          "name": "ZIRCONIUM SULFATE",
          "stdName": "ZIRCONIUM SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bb4489e-9d24-4d19-8eae-1daaac695ad6",
            "ce910665-3569-4a56-92d0-f193dfcddeb6",
            "19a7ab18-ab3f-4824-9238-f6e04d64c328"
          ],
          "display_name": true
        },
        {
          "uuid": "266a1739-bc7b-462f-af98-00517c10761a",
          "name": "ZIRCONIUM SULFATE (1:2)",
          "stdName": "ZIRCONIUM SULFATE (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0b6af44-7bb5-4a31-94e7-ddc731388def"
          ],
          "display_name": false
        },
        {
          "uuid": "ad4f3f7e-22fc-47ed-bd6c-0d2fb27c4ca4",
          "name": "ZIRCONIUM SULFATE (ZR(SO4)2)",
          "stdName": "ZIRCONIUM SULFATE (ZR(SO4)2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0b6af44-7bb5-4a31-94e7-ddc731388def"
          ],
          "display_name": false
        },
        {
          "uuid": "1cb88032-0735-418d-831f-2af790026d06",
          "name": "ZIRCONIUM SULFATE [MI]",
          "stdName": "ZIRCONIUM SULFATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19a7ab18-ab3f-4824-9238-f6e04d64c328"
          ],
          "display_name": false
        },
        {
          "uuid": "bb63c82e-25b0-4a09-a235-fc895aaeb4c5",
          "name": "ZIRCONIUM(IV) SULFATE",
          "stdName": "ZIRCONIUM(IV) SULFATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5344221e-bbcd-413f-a6ba-bc35b1488adc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ce910665-3569-4a56-92d0-f193dfcddeb6",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5344221e-bbcd-413f-a6ba-bc35b1488adc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19a7ab18-ab3f-4824-9238-f6e04d64c328",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0b6af44-7bb5-4a31-94e7-ddc731388def",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dc13b01-b829-41fa-a004-ac0857515563",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36216d61-27e6-4f38-ab24-351637384bea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392793000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85dc2d89-3dde-4d5f-89cf-43a4ddd1f188",
          "citation": "SRS import [01SJA33642]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=01SJA33642",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392793000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bb4489e-9d24-4d19-8eae-1daaac695ad6",
          "citation": "ZIRCONIUM SULFATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "13a87017-696f-d5f9-2173-e93871f10057",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Zirconium_sulfate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "29862701-12fd-6d0e-8ec7-6f171f8e5e43",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+14644-61-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb69886e-e872-87f0-8ee5-b7c04d2e11bb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14644-61-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04063705-9ac0-4689-a7e2-12382ddc44c0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d35aec34-4a6a-0425-9f84-abac9c4bfb9d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c5722422-511a-6b60-bd06-de9342d778a1",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "41cc1ba7-2b26-4ce0-b07e-bdc2589b8987",
          "id": "41cc1ba7-2b26-4ce0-b07e-bdc2589b8987",
          "molfile": "\n  Marvin  01132103282D          \n\n  1  0  0  0  0  0            999 V2000\n   11.2430  -15.1479    0.0000 Zr  0  0  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   4\nM  END",
          "smiles": "[Zr+4]",
          "formula": "Zr",
          "atropisomerism": "No",
          "charge": 4,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a202e96d-44dd-407b-8764-df986166b84f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "91.2236",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c1d93696-deb1-453d-af3f-e31205b6f6c3",
          "id": "c1d93696-deb1-453d-af3f-e31205b6f6c3",
          "molfile": "\n  Marvin  01132110012D          \n\n  5  4  0  0  0  0            999 V2000\n    8.6788  -15.0680    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8538  -15.0680    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0288  -15.0680    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8538  -14.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8538  -15.8930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  CHG  2   1  -1   3  -1\nM  END",
          "smiles": "O=S(=O)([O-])[O-]",
          "formula": "O4S",
          "atropisomerism": "No",
          "charge": -2,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "a31312ba-b8ae-4824-9313-17dbd550fafa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "96.0637",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ebb9ed7e-061b-4167-8c32-a1a2d315076b",
      "version": "7",
      "structure": {
        "id": "68bd5033-4c7b-4913-b437-e6a42a73d029",
        "molfile": "\n  Marvin  01132105272D          \n\n 11  8  0  0  0  0            999 V2000\n   11.2430  -15.1479    0.0000 Zr  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6788  -15.0680    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.0288  -15.0680    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8538  -14.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8538  -15.8930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8538  -15.0680    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6788  -15.0680    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.0288  -15.0680    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.8538  -14.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8538  -15.8930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8538  -15.0680    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  6  5  2  0  0  0  0\n  6  4  2  0  0  0  0\n  6  3  1  0  0  0  0\n  6  2  1  0  0  0  0\n 11  7  1  0  0  0  0\n 11  8  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 10  2  0  0  0  0\nM  CHG  5   1   4   2  -1   3  -1   7  -1   8  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 10   2   3   4   5   6   7   8   9  10  11\nM  SPA   1  5   2   3   4   5   6\nM  SDI   1  4    6.6088  -16.3130    6.6088  -13.8230\nM  SDI   1  4    9.0988  -13.8230    9.0988  -16.3130\nM  SMT   1 2\nM  END",
        "smiles": "O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[Zr+4]",
        "formula": "2O4S.Zr",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "283.3511",
        "optical_activity": "NONE",
        "references": [
          "85dc2d89-3dde-4d5f-89cf-43a4ddd1f188",
          "5344221e-bbcd-413f-a6ba-bc35b1488adc"
        ],
        "stereo_centers": 0
      },
      "unii": "01SJA33642"
    }
  ]
}