{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f93e17ef-cea2-41e2-a3d3-43102a2ab149",
          "code": "N0000175696",
          "comments": "Established Pharmacologic Class [EPC]|Serotonin Reuptake Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175696",
          "code_system": "NDF-RT",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "ac476800-9033-4163-83b8-4522e002418f",
          "code": "QN06AB03",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Selective serotonin reuptake inhibitors|fluoxetine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AB03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "fa170433-31f1-4a6e-8f76-2d8cd127bc19",
          "code": "QN06CA03",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOLEPTICS AND PSYCHOANALEPTICS IN COMBINATION|Antidepressants in combination with psycholeptics|fluoxetine and psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06CA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "053dccb4-8eb6-444f-98f2-6bf98fb3f3dc",
          "code": "54910-89-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54910-89-3",
          "code_system": "CAS",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305",
            "3e6bb114-681c-4d2d-b7c8-2ccabdf50dc9"
          ]
        },
        {
          "uuid": "a2b10253-cbc7-4760-a0ee-54add1fdfbca",
          "code": "C506",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C506",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "6c33daad-bd7b-4253-a2da-d854edef3900",
          "code": "NBK548010",
          "comments": "LiverTox|CNS|Antidepressant|SSRI",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548010/",
          "code_system": "LIVERTOX",
          "references": [
            "baeb6488-2e11-128f-3970-b840f042d24f"
          ]
        },
        {
          "uuid": "e7200ade-4138-4db4-b38a-c7d574a1f3a9",
          "code": "D005473",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005473",
          "code_system": "MESH",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "03097327-8220-4e6c-8e16-0cc8c8c1e142",
          "code": "FLUOXETINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fluoxetine",
          "code_system": "WIKIPEDIA",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "d5032d16-d380-487f-be81-692217d018ac",
          "code": "8.4",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Antineoplastic, immunosuppressives and medicines used in Palliative care|Medicines used in palliative care",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/193/?section=81#type485",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "c24c1b90-015d-40ab-b1eb-4ba992587617",
          "code": "24.2.1",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Medicines for mental and behavioural disorders|Medicines used in mood disorders|Medicines used in depressive disorders",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/193/?section=151#type485",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "a615914d-d50f-42be-8bc6-26c0283278af",
          "code": "N06CA03",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOLEPTICS AND PSYCHOANALEPTICS IN COMBINATION|Antidepressants in combination with psycholeptics|fluoxetine and psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06CA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "0f8413b7-6a5c-4189-a1d1-fd1884e02b29",
          "code": "SUB07723MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "dfbc8d4a-bafa-4ac6-b131-2907a332ef9c",
          "code": "3883",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3883",
          "code_system": "INN",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "ac096293-ffbf-47a4-887d-53f93a207191",
          "code": "203",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=203",
          "code_system": "IUPHAR",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "8bc7a0b1-cec1-4188-b3bb-246618123807",
          "code": "4493",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4493/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "036b6a76-7599-4aa8-9491-f584916c01e0",
          "code": "m5487",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5487?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "e424e832-0acd-4a47-bfc9-18a0ec80f28c",
          "code": "DB00472",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00472",
          "code_system": "DRUG BANK",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "d9c1590a-ad96-47b9-8ae0-408632a9ee15",
          "code": "21 CFR 520.980",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.980 Fluoxetine.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.980",
          "code_system": "CFR",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "35cbdc35-565e-47e9-9127-2347fb8e0b3f",
          "code": "N06AB03",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Selective serotonin reuptake inhibitors|fluoxetine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AB03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "3077e941-1e61-47a8-b419-0ac23a570cfc",
          "code": "N0000000109",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Serotonin Transporter Interactions [MoA]|Serotonin Uptake Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000109",
          "code_system": "NDF-RT",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "d4d3569b-7def-404f-a919-0704ab3f6177",
          "code": "3386",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3386",
          "code_system": "PUBCHEM",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "094fac36-ee79-4c8a-9ecb-b8e103f3a232",
          "code": "CHEMBL41",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL41",
          "code_system": "ChEMBL",
          "references": [
            "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305"
          ]
        },
        {
          "uuid": "443159b8-138f-4f4e-9f2c-84d107eb250a",
          "code": "RECONCILE [AUTHORIZED]",
          "comments": "EMA VET. EPAR|DOGS|ASSIST FOR THE TREATMENT OF SEPARATION RELATED DISORDERS",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/000133/vet_med_000183.jsp&mid=WC0b01ac058001fa1c",
          "code_system": "EMA VETERINARY ASSESSMENT REPORTS",
          "references": [
            "22719b21-376b-036a-969f-3fdeb6990030"
          ]
        },
        {
          "uuid": "a3b085e1-2d01-d8ab-2779-25c73989dc46",
          "code": "DTXSID7023067",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023067",
          "code_system": "EPA CompTox",
          "references": [
            "88710fe3-1b92-6a2d-628b-86678d186ef7"
          ]
        },
        {
          "uuid": "5664c2bb-38cf-59fe-ce48-1a47d2618783",
          "code": "123199",
          "comments": "ORPHAN DRUG|Designated|Treatment of autism.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=123199",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "06ca8d76-9a43-7a35-6f74-45e4b57d898e",
          "code": "183504",
          "comments": "ORPHAN DRUG|Designated|Treatment of body dysmorphic disorder in children and adolescents",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=183504",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "d892223e-145c-eaa9-312c-111bbc8c5ff5",
          "code": "C94725",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Selective Serotonin Reuptake Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C94725",
          "code_system": "NCI_THESAURUS",
          "references": [
            "baeb6488-2e11-128f-3970-b840f042d24f"
          ]
        },
        {
          "uuid": "eff26c9c-9a5c-0568-8559-92ef9600f2cc",
          "code": "C265",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265",
          "code_system": "NCI_THESAURUS",
          "references": [
            "baeb6488-2e11-128f-3970-b840f042d24f"
          ]
        },
        {
          "uuid": "180d61d0-d562-427f-ba30-979786021167",
          "code": "01K63SUP8D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f122d683-aa70-696b-6b38-55bd1339334f",
          "code": "Fluoxetine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM323/",
          "code_system": "LACTMED",
          "references": [
            "baeb6488-2e11-128f-3970-b840f042d24f"
          ]
        },
        {
          "uuid": "516669e3-7d6c-bd89-9d93-06e082a4a054",
          "code": "1209",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1209",
          "code_system": "DRUG CENTRAL",
          "references": [
            "baeb6488-2e11-128f-3970-b840f042d24f"
          ]
        },
        {
          "uuid": "c4b106f0-6247-4669-0d4d-f632421c2069",
          "code": "5118",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5118",
          "code_system": "CHEBI",
          "references": [
            "baeb6488-2e11-128f-3970-b840f042d24f"
          ]
        },
        {
          "uuid": "fc5cdb4f-61cf-f172-cc5a-91d3e1212d1b",
          "code": "100000092819",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "df554480-712b-b10e-6b2b-bba01d256774"
          ]
        },
        {
          "uuid": "402f285a-e1dd-3455-3631-7a1e7a221cb9",
          "code": "01K63SUP8D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=01K63SUP8D",
          "code_system": "DAILYMED",
          "references": [
            "e865a775-3258-bb4a-625c-4b361aeebfaf"
          ]
        },
        {
          "uuid": "ea5388ca-5ca0-1190-10ba-1b99eb072811",
          "code": "758685",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758685",
          "code_system": "NSC",
          "references": [
            "0aa3f5d3-9c35-d330-917e-3db60ae6f273"
          ]
        },
        {
          "uuid": "516c2196-28a2-6cc9-70e6-cba0cd230a95",
          "code": "283480",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=283480",
          "code_system": "NSC",
          "references": [
            "0aa3f5d3-9c35-d330-917e-3db60ae6f273"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "b0af8863-c6ae-416a-863d-19fdf072febf",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e9cda5a-b0a0-421f-8b93-c980217a0bf0",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b4b628d-acec-45cf-ad69-2ba743685115",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2fb44ce-2d6a-45e0-a32f-e672c008af8d",
          "citation": "INN Proposed List 34",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL34.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f132e9e1-5b26-4e26-b789-739bca2f511f",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68fd9896-7f51-4fb8-9e4f-4cb01255ed3d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77304008-777a-48b4-9379-efaa450b79ab",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db11d021-7f97-4b19-a21c-36a416ac701a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0ee766c-17fd-463a-a54c-54535d619dfa",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "367575b3-e35a-43d3-a4f6-78db54ec8dc4",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ac3a545-ce47-44d5-ac4c-d7bf40c9b305",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390477000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56881f1f-9a28-42f7-86c9-e84818e703d6",
          "citation": "EUR J CLIN PHARMACOL (2004) 59: 869?873",
          "url": "http://download.springer.com/static/pdf/293/art%253A10.1007%252Fs00228-003-0707-y.pdf?auth66=1363974486_81a3472b6d1f622cc3504ed8655b0e59&ext=.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87f64ca1-7062-47b6-bac1-f784f936df7c",
          "citation": "SRS import [01K63SUP8D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=01K63SUP8D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390477000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee970b2e-4c20-4392-9651-5cf2d2366325",
          "citation": "FLUOXETINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e0dcbc1-0297-4610-b00a-482864746e3b",
          "citation": "FLUOXETINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "449e0ce5-8eab-4174-bf48-3b14752b4898",
          "citation": "FLUOXETINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01ed2b5c-cb2f-4619-8786-d34a13c212cf",
          "citation": "FLUOXETINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "106dd3a5-45fe-4bd3-9052-6b3247adaf65",
          "citation": "FLUOXETINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22719b21-376b-036a-969f-3fdeb6990030",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/000133/vet_med_000183.jsp&mid=WC0b01ac058001fa1c",
          "doc_type": "EMA REVIEW",
          "public_domain": true
        },
        {
          "uuid": "88710fe3-1b92-6a2d-628b-86678d186ef7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54910-89-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aaa5e686-ed92-d14c-3c93-a9cb80c04bd5",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+54910-89-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "df554480-712b-b10e-6b2b-bba01d256774",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "966e7811-fe2f-b72a-d98d-70a4cbe6f189",
          "citation": "FLUOXETINE",
          "doc_type": "MICROMEDEX",
          "public_domain": true
        },
        {
          "uuid": "baeb6488-2e11-128f-3970-b840f042d24f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3e6bb114-681c-4d2d-b7c8-2ccabdf50dc9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5fdfda39-fbf4-4531-84ab-02d51d9668fc",
          "citation": "Clin Chem 1982;28(10):2100",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9b90e9e6-4493-46a2-bda0-e34b079bcdae",
          "citation": "J Chromatogr B Biomed Sci Appl 1997 Sep 26;698(1-2):103-9",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0aa3f5d3-9c35-d330-917e-3db60ae6f273",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e865a775-3258-bb4a-625c-4b361aeebfaf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ed94a445-8f76-5468-11a9-8903cce85bf3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b0ee6ab7-37d7-4f26-831b-2fb873a03a9e",
          "citation": "Lesche, Dorothea, et al. \"Impact of CYP1A2, CYP2C19, and CYP2D6 genotype-and phenoconversion-predicted enzyme activity on clozapine exposure and symptom severity.\" The pharmacogenomics journal 20.2 (2020): 192-201.",
          "url": "https://citeseerx.ist.psu.edu/documhttps://www.nature.com/articles/s41397-019-0108-yent?repid=rep1&type=pdf&doi=0ec80cd71823890e44654525cd33661ca3369640",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8ed17648-97ce-47fb-84cb-6553cbe4ea74",
          "id": "8ed17648-97ce-47fb-84cb-6553cbe4ea74",
          "molfile": "\n  Marvin  01132107242D          \n\n 22 23  0  0  0  0            999 V2000\n    5.5319   -6.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8160   -6.3239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1029   -6.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3870   -6.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3840   -5.5056    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.6651   -5.0994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9526   -5.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9547   -6.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2359   -6.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5212   -6.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5221   -5.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -5.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1957   -6.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9111   -6.3462    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1972   -7.5881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9147   -7.1713    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0942   -5.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8107   -5.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5204   -5.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5139   -4.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7919   -3.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0852   -4.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 17  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 12  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 13  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 22 17  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CNCCC(c1ccccc1)Oc2ccc(cc2)C(F)(F)F",
          "formula": "C17H18F3NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e0890b65-34ef-4af3-a1ab-262d402ebc37"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "309.3268",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "288a962b-7ef1-4a4e-9cfe-0eb1bb3ce661",
      "version": "48",
      "structure": {
        "id": "62f2b660-7a81-4060-855d-c57f2e07adc1",
        "molfile": "\n  Marvin  01132105082D          \n\n 22 23  0  0  0  0            999 V2000\n    0.5221   -5.5202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5212   -6.3489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2359   -6.7641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9547   -6.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9526   -5.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2347   -5.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6651   -5.0994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3840   -5.5056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0942   -5.0878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8107   -5.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5204   -5.0796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5139   -4.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7919   -3.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0852   -4.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3870   -6.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1029   -6.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8160   -6.3239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5319   -6.7330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1957   -6.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9111   -6.3462    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1972   -7.5881    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9147   -7.1713    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n 10 11  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11 12  2  0  0  0  0\n  6  1  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n 15 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n  8  9  1  0  0  0  0\n  2 19  1  0  0  0  0\n  4  5  1  0  0  0  0\n 19 20  1  0  0  0  0\n  9 10  2  0  0  0  0\n 19 21  1  0  0  0  0\n  2  3  1  0  0  0  0\n 19 22  1  0  0  0  0\nM  END",
        "smiles": "CNCCC(c1ccccc1)Oc2ccc(cc2)C(F)(F)F",
        "formula": "C17H18F3NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "309.3268",
        "optical_activity": "( + / - )",
        "references": [
          "87f64ca1-7062-47b6-bac1-f784f936df7c",
          "b0af8863-c6ae-416a-863d-19fdf072febf",
          "a2fb44ce-2d6a-45e0-a32f-e672c008af8d"
        ],
        "stereo_centers": 1
      },
      "unii": "01K63SUP8D",
      "relationships": [
        {
          "uuid": "429c7f83-d13d-4090-a2ce-5635d4eca3eb",
          "amount": {
            "uuid": "cafd8258-50c2-4c90-8d37-fa8f813526b6"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4a2e7414-c29f-4bca-829c-6d461aa8cbde",
            "refuuid": "288a962b-7ef1-4a4e-9cfe-0eb1bb3ce661",
            "name": "FLUOXETINE",
            "unii": "01K63SUP8D",
            "linking_id": "01K63SUP8D",
            "ref_pname": "FLUOXETINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dcbcf3a1-78e6-400d-901b-08e473d0f018",
          "amount": {
            "uuid": "38cde944-49b1-463f-8493-ce22da9af997"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1d208e5e-3935-4db6-b63c-77be55f68990",
            "refuuid": "56a9323e-cf6b-4802-afdc-367d3a227f09",
            "name": "FLUOXETINE HYDROCHLORIDE",
            "unii": "I9W7N6B1KJ",
            "linking_id": "I9W7N6B1KJ",
            "ref_pname": "FLUOXETINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6376339e-873b-4c63-82ab-917fd9c05cad",
          "amount": {
            "uuid": "c4a986ae-d27e-4ddb-9290-6b10bce3067e"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "687f781c-95b7-440d-90d1-d944134f7d29",
            "refuuid": "aac3739b-2320-485b-b8b4-a0768135dca7",
            "name": "FLUOXETINE OXALATE",
            "unii": "640AZ74IZB",
            "linking_id": "640AZ74IZB",
            "ref_pname": "FLUOXETINE OXALATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b6a688cc-1d6e-4245-9eb8-5ff4b4c90589",
          "amount": {
            "uuid": "af454a93-a923-48ba-9b32-61d70ff431c6"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "5fdfda39-fbf4-4531-84ab-02d51d9668fc"
          ],
          "related_substance": {
            "uuid": "5e35dc60-e93f-45b0-89b0-54a4f3d9c04f",
            "refuuid": "2947e7b6-36fb-4683-8c6f-d397ef54bfc4",
            "name": "NORFLUOXETINE",
            "unii": "K8D70XE2F4",
            "linking_id": "K8D70XE2F4",
            "ref_pname": "NORFLUOXETINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2eff4480-4d46-4f1f-8eb0-532221b7100a",
          "amount": {
            "uuid": "2d61c829-b4b8-42a2-bbc1-c228be074025"
          },
          "comments": "Strong inhibitor",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "b0ee6ab7-37d7-4f26-831b-2fb873a03a9e"
          ],
          "related_substance": {
            "uuid": "ba19d7fc-f792-4640-b925-bfada1d8e4bd",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "12751b7c-de01-4d90-904b-056054ef943c",
          "amount": {
            "uuid": "63adade5-3e28-473e-9e70-b19e96849d76"
          },
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "966e7811-fe2f-b72a-d98d-70a4cbe6f189"
          ],
          "related_substance": {
            "uuid": "dfea5269-03f0-4fa0-8272-4f5b3914eac6",
            "refuuid": "50fbc0e6-a35d-4d72-849b-84bfc9d44cd5",
            "name": "CYTOCHROME P450 2C9",
            "unii": "L9DP834D1P",
            "linking_id": "L9DP834D1P",
            "ref_pname": "CYTOCHROME P450 2C9",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b7d1a9ea-2f65-4506-8a50-40ead458dd9d",
          "amount": {
            "uuid": "20fe007b-b204-4b86-8755-2116d3c0ed44"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "966e7811-fe2f-b72a-d98d-70a4cbe6f189"
          ],
          "related_substance": {
            "uuid": "8755d6e2-fdc5-44e8-bb56-8c25ca59e85b",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "041432e9-3723-48dd-9926-98519a5888fe",
          "amount": {
            "uuid": "99f817be-8b06-464b-83aa-5c9a0b9ae59f"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "related_substance": {
            "uuid": "da9bc64e-2f7c-4337-b6d0-5a105102fda8",
            "refuuid": "067f0cda-3bfe-4af9-ba1e-dcd127c8a228",
            "name": "CYTOCHROME P450 3A5",
            "unii": "805SU96HKF",
            "linking_id": "805SU96HKF",
            "ref_pname": "CYTOCHROME P450 3A5",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2e27ae26-ed1a-4cb4-bce9-498770b5a44d",
          "amount": {
            "uuid": "50b67146-6389-497e-9c80-01937fe6179d"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "966e7811-fe2f-b72a-d98d-70a4cbe6f189"
          ],
          "related_substance": {
            "uuid": "0fa6bfcb-20cf-4ace-8cd3-32864fec20ef",
            "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405",
            "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "unii": "CJZ26L1EGI",
            "linking_id": "CJZ26L1EGI",
            "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5167f145-3245-4a39-b4e8-41c07a7779de",
          "amount": {
            "uuid": "5b7ab9f1-a9eb-4c2a-9633-2f9a11e4f933"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "9b90e9e6-4493-46a2-bda0-e34b079bcdae"
          ],
          "related_substance": {
            "uuid": "f64d5e6d-344d-4877-861a-2a0d1aa943ce",
            "refuuid": "089e7922-b336-4b12-8e19-83ba82fb9cb1",
            "name": "4-TRIFLUOROMETHYLPHENOL",
            "unii": "G8PMO13PO4",
            "linking_id": "G8PMO13PO4",
            "ref_pname": "4-TRIFLUOROMETHYLPHENOL"
          }
        },
        {
          "uuid": "20f27ca3-5ab2-45d5-b399-e186159ee7a5",
          "amount": {
            "uuid": "841de82c-2d94-4ee1-8e48-088ce27018b9"
          },
          "comments": "Moderate inhibitor",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "b0ee6ab7-37d7-4f26-831b-2fb873a03a9e"
          ],
          "related_substance": {
            "uuid": "1dcd6b84-fcc6-47b7-9bdc-22de01324218",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "4b59af77-6b53-4e1e-bc45-317f9f748949",
          "name": "(±)-N-METHYL-3-PHENYL-3-((.ALPHA.,ALPHA.,.ALPHA.-TRIFLUORO-P-TOLYL)OXY)PROPYLAMINE",
          "stdName": "(+/-)-N-METHYL-3-PHENYL-3-((.ALPHA.,ALPHA.,.ALPHA.-TRIFLUORO-P-TOLYL)OXY)PROPYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e9cda5a-b0a0-421f-8b93-c980217a0bf0"
          ],
          "display_name": false
        },
        {
          "uuid": "cc98596b-c39a-4aa6-9244-9bba0a858e41",
          "name": "BENZENEPROPANAMINE, N-METHYL-G-(4-(TRIFLUOROMETHYL)PHENOXY)-, (±)-",
          "stdName": "BENZENEPROPANAMINE, N-METHYL-G-(4-(TRIFLUOROMETHYL)PHENOXY)-, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b4b628d-acec-45cf-ad69-2ba743685115"
          ],
          "display_name": false
        },
        {
          "uuid": "651941de-cced-4057-8251-028ad8427d26",
          "name": "DL-N-METHYL-3-(P-TRIFLUOROMETHYLPHENOXY)-3-PHENYLPROPYLAMINE",
          "stdName": "DL-N-METHYL-3-(P-TRIFLUOROMETHYLPHENOXY)-3-PHENYLPROPYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77304008-777a-48b4-9379-efaa450b79ab"
          ],
          "display_name": false
        },
        {
          "uuid": "52bf889c-d888-40f0-97bd-69779b65a6f7",
          "name": "FLUOXETIN RATIOPHARM",
          "stdName": "FLUOXETIN RATIOPHARM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "367575b3-e35a-43d3-a4f6-78db54ec8dc4"
          ],
          "display_name": false
        },
        {
          "uuid": "b7460fbd-1acb-42b3-bc9a-b96b778e6ace",
          "name": "FLUOXETINE",
          "stdName": "FLUOXETINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0ee766c-17fd-463a-a54c-54535d619dfa",
            "b0af8863-c6ae-416a-863d-19fdf072febf",
            "68fd9896-7f51-4fb8-9e4f-4cb01255ed3d",
            "2e0dcbc1-0297-4610-b00a-482864746e3b",
            "449e0ce5-8eab-4174-bf48-3b14752b4898",
            "ee970b2e-4c20-4392-9651-5cf2d2366325",
            "01ed2b5c-cb2f-4619-8786-d34a13c212cf",
            "db11d021-7f97-4b19-a21c-36a416ac701a",
            "f132e9e1-5b26-4e26-b789-739bca2f511f",
            "106dd3a5-45fe-4bd3-9052-6b3247adaf65",
            "a2fb44ce-2d6a-45e0-a32f-e672c008af8d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "419a95f8-4327-4052-a5cd-fe809b2b2454",
              "name_org": "INN"
            },
            {
              "uuid": "7e869023-c800-41a2-83af-99cfbc273879",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "a8318d0a-2c60-4106-919f-e8ae17659790",
          "name": "FLUOXETINE [EMA EPAR VETERINARY]",
          "stdName": "FLUOXETINE [EMA EPAR VETERINARY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22719b21-376b-036a-969f-3fdeb6990030"
          ],
          "display_name": false
        },
        {
          "uuid": "c2db56a9-6a4b-4f36-b9d1-37b273bd52f9",
          "name": "FLUOXETINE [MI]",
          "stdName": "FLUOXETINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68fd9896-7f51-4fb8-9e4f-4cb01255ed3d"
          ],
          "display_name": false
        },
        {
          "uuid": "659c0393-558c-4fd7-8ac7-b6a537e77600",
          "name": "FLUOXETINE [USAN]",
          "stdName": "FLUOXETINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f132e9e1-5b26-4e26-b789-739bca2f511f"
          ],
          "display_name": false
        },
        {
          "uuid": "b40ec0a5-9996-4119-b6fe-0ce6ccb45046",
          "name": "FLUOXETINE [VANDF]",
          "stdName": "FLUOXETINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0ee766c-17fd-463a-a54c-54535d619dfa"
          ],
          "display_name": false
        },
        {
          "uuid": "c88f7eb3-17b0-4f95-a34f-f38238d4ce73",
          "name": "FLUVAL",
          "stdName": "FLUVAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "367575b3-e35a-43d3-a4f6-78db54ec8dc4"
          ],
          "display_name": false
        },
        {
          "uuid": "9eb57935-270b-1d2c-8ad3-2f90b4836ab4",
          "name": "Fluoxetine [WHO-DD]",
          "stdName": "FLUOXETINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed94a445-8f76-5468-11a9-8903cce85bf3"
          ],
          "display_name": false
        },
        {
          "uuid": "c1d1f121-abe6-4f9a-94d4-31a5c578de94",
          "name": "N-METHYL-.GAMMA.-(4-(TRIFLUOROMETHYL)PHENOXY)BENZENEPROPANAMINE",
          "stdName": "N-METHYL-.GAMMA.-(4-(TRIFLUOROMETHYL)PHENOXY)BENZENEPROPANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77304008-777a-48b4-9379-efaa450b79ab"
          ],
          "display_name": false
        },
        {
          "uuid": "730be026-9f20-4e74-bec8-09ba103f38b6",
          "name": "NSC-283480",
          "stdName": "NSC-283480",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "367575b3-e35a-43d3-a4f6-78db54ec8dc4"
          ],
          "display_name": false
        },
        {
          "uuid": "8234be4d-5160-ea28-d6e7-40301ce2f621",
          "name": "NSC-758685",
          "stdName": "NSC-758685",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aa3f5d3-9c35-d330-917e-3db60ae6f273"
          ],
          "display_name": false
        },
        {
          "uuid": "296462d5-527b-4b49-be86-fdce9050d6f3",
          "name": "fluoxetine [INN]",
          "stdName": "FLUOXETINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2fb44ce-2d6a-45e0-a32f-e672c008af8d"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "27528786-8f2d-41a8-8630-4bc327e54724",
          "name": "MAXIMUM TOLERATED DOSE",
          "value": {
            "uuid": "4110bf7d-f731-4e6b-9abf-da1edb1b7529",
            "average": 80,
            "units": "mg/day"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "38b7777a-4c9e-47fe-bdf4-1340526fbff4",
              "name": "RAPID METABOLIZERS OR THOSE WITH INADEQUATE RESPONSE AFTER 8 WEEKS",
              "value": {
                "uuid": "26045901-3a78-47c3-adf7-064a004d0fd7",
                "high": 120,
                "low": 80,
                "units": "mg/day",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "TOXICITY",
          "references": [
            "966e7811-fe2f-b72a-d98d-70a4cbe6f189"
          ]
        },
        {
          "uuid": "b007cd5e-f31d-408c-bb32-104b00b8cc8d",
          "name": "Tmax",
          "value": {
            "uuid": "3b8f5a2d-33da-4521-a0f6-7a6bfd6799bf",
            "high": 8,
            "low": 6,
            "units": "hours",
            "non_numeric_value": "ORAL"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "966e7811-fe2f-b72a-d98d-70a4cbe6f189"
          ]
        },
        {
          "uuid": "b54ae6c6-f85b-440f-9e52-74dcede1046b",
          "name": "Biological Half-life",
          "value": {
            "uuid": "d890e43f-0bd6-46e1-bed6-0cb226b755fb",
            "high": 6,
            "low": 4,
            "units": "DAYS"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "ab947633-a896-43dd-8719-8a27ffdbe1e9",
              "name": "LIVER CIRRHOSIS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "6781a9ed-47a3-46d2-9bd7-26b750fa66fe",
                "average": 7.6,
                "units": "DAYS",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "9865e655-8255-4dd0-ab63-82107dcdbe5d",
              "name": "NORFLUOXETINE",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "2b97adf7-b3d1-4dca-bfed-7dd8ec4f5443",
                "average": 9.3,
                "units": "DAYS",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "a980766c-ff4a-4d7e-9982-57f481c4c1e1",
              "name": "NORFLUOXETINE, LIVER CIRRHOSIS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "b212bab0-6a60-411d-aeec-f15fdf668edb",
                "average": 12,
                "units": "DAYS",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "966e7811-fe2f-b72a-d98d-70a4cbe6f189"
          ]
        }
      ]
    }
  ]
}