{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "35c847fe-f5e0-47d2-93c7-02991ac44501",
          "code": "2490-97-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2490-97-3",
          "code_system": "CAS",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d",
            "8bee5fba-567e-427c-8f5b-bf5a8f914fbd"
          ]
        },
        {
          "uuid": "20eca4ce-b055-4785-a177-c2e97fe1d655",
          "code": "C032007",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67032007",
          "code_system": "MESH",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "4bbecc2d-a054-4bc4-ac32-653ce25bbf6e",
          "code": "ACEGLUTAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Aceglutamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "cc5d1441-5267-4e5d-9b02-24d723d90727",
          "code": "SUB05208MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "3cc608cd-3c47-4e6f-83e8-fdd44834d315",
          "code": "1887",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1887",
          "code_system": "INN",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "b49d56ef-bbc9-45f9-b2cb-940c47aae747",
          "code": "219-647-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.862",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "6450b140-8db4-4a31-a546-a1862df357c7",
          "code": "C77843",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77843",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "b5fb469e-587e-4f22-b82a-d6de8ef4a19d",
          "code": "1426379",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426379/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "3ed4b605-ba24-4471-b23a-0f37003b95ef",
          "code": "m1296",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1296?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "2d196e98-aefd-44d6-b8a3-e480750197ba",
          "code": "182230",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/182230",
          "code_system": "PUBCHEM",
          "references": [
            "c39a890b-2c44-4726-8105-0a7324c2ba8d"
          ]
        },
        {
          "uuid": "4ffb11b8-11f9-3cf2-f547-9bf5f6e919b5",
          "code": "DTXSID2048959",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2048959",
          "code_system": "EPA CompTox",
          "references": [
            "eab6a7f9-7796-e37c-11c8-8c0b765ef0ee"
          ]
        },
        {
          "uuid": "d6d10b78-2b16-0f13-b56d-f7a238ac1257",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c49b221d-cfd8-d1f6-462b-0829f4e663ff"
          ]
        },
        {
          "uuid": "ab2340e0-e573-4c93-a9f3-d9689098647b",
          "code": "01J18G9G97",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d4f75210-d205-421c-0da0-602af4763758",
          "code": "46",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/46",
          "code_system": "DRUG CENTRAL",
          "references": [
            "c49b221d-cfd8-d1f6-462b-0829f4e663ff"
          ]
        },
        {
          "uuid": "095ce292-299d-d28b-d17c-83e77aa6a247",
          "code": "2422 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|chemical|N-acetyl glutamine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2422&item=N-acetyl glutamine",
          "code_system": "DSLD",
          "references": [
            "c49b221d-cfd8-d1f6-462b-0829f4e663ff"
          ]
        },
        {
          "uuid": "294b4754-2dfc-f2ae-63be-58f8200e70ba",
          "code": "DB04167",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04167",
          "code_system": "DRUG BANK",
          "references": [
            "c49b221d-cfd8-d1f6-462b-0829f4e663ff"
          ]
        },
        {
          "uuid": "9dfa5515-e353-39d1-286f-f2c0176664de",
          "code": "143879",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:143879",
          "code_system": "CHEBI",
          "references": [
            "c49b221d-cfd8-d1f6-462b-0829f4e663ff"
          ]
        },
        {
          "uuid": "d084bb0e-835c-e6db-92d2-9b8cf1753002",
          "code": "73685",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:73685",
          "code_system": "CHEBI",
          "references": [
            "c49b221d-cfd8-d1f6-462b-0829f4e663ff"
          ]
        },
        {
          "uuid": "434e5ae9-99c9-9a8e-17e1-efd51c90cf3d",
          "code": "100000087914",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "17a83af0-c823-7c7b-2e4f-663005023dfc"
          ]
        },
        {
          "uuid": "4a31cd58-29d2-61bf-f03b-7ec66406dd6d",
          "code": "01J18G9G97",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=01J18G9G97",
          "code_system": "DAILYMED",
          "references": [
            "4d3a26fb-23f2-bd47-833c-a1315c37ac8f"
          ]
        },
        {
          "uuid": "37ec2062-dabe-2145-ba20-d1940bf664b2",
          "code": "186896",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=186896",
          "code_system": "NSC",
          "references": [
            "4dfe8ad0-8df9-0ad8-4353-c96c254fc82c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ce6169f1-4a28-4cba-951c-5658eb2bbc3d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d1241706-6e1c-405f-9b4e-deee164a5876",
            "refuuid": "ad1a8684-7d26-4b99-ade0-a69992600ed9",
            "name": "ACEGLUTAMIDE",
            "unii": "01J18G9G97",
            "linking_id": "01J18G9G97",
            "ref_pname": "ACEGLUTAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7717806c-5130-42f8-bcc9-68d6aa1678eb",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a5ac8ca2-1dde-49d7-af66-3a7ac54a2478",
            "refuuid": "3d952b3f-3df5-4e91-b618-9517fbfc4c4e",
            "name": "ACEGLUTAMIDE ALUMINUM",
            "unii": "R7QTG0PMPX",
            "linking_id": "R7QTG0PMPX",
            "ref_pname": "ACEGLUTAMIDE ALUMINUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b197ecaf-dda7-439b-a9b4-e15a049405e7",
          "name": ".ALPHA.-N-ACETYL-L-GLUTAMINE",
          "stdName": ".ALPHA.-N-ACETYL-L-GLUTAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "939dac38-5f36-421c-bab7-4461a1a88e8c",
          "name": "ACEGLUTAMIDE",
          "stdName": "ACEGLUTAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35becea7-112b-4230-9da8-cf6330d89f90",
            "596a2ff8-fc35-4ced-a170-336c6c886008",
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "474a92b1-806a-4c44-9f4a-c049602c9141",
            "3a5178b9-fc22-4172-8a70-c6af0a673546",
            "34bc58fb-b2da-4038-b2dc-5d8aef4ab3c4",
            "f50306f2-3f28-4417-8c3f-78eaa134ad8c",
            "69ffb4fc-029c-4683-81b7-41d5c524e269",
            "4dc8fad9-1a6f-4673-9d22-505e9cdd922b",
            "b1396ebf-b4c7-4ff9-a21d-3c83d08d5a37"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ba2ad0d7-e55e-4f6f-8a17-91cbb8d3bba7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "0b53ac85-c58e-4132-91bf-9bf9e9edc337",
          "name": "ACEGLUTAMIDE [MART.]",
          "stdName": "ACEGLUTAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a5178b9-fc22-4172-8a70-c6af0a673546"
          ],
          "display_name": false
        },
        {
          "uuid": "3fe62e45-a8bb-496e-a379-4e10f76754ec",
          "name": "ACEGLUTAMIDE [MI]",
          "stdName": "ACEGLUTAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "b1396ebf-b4c7-4ff9-a21d-3c83d08d5a37"
          ],
          "display_name": false
        },
        {
          "uuid": "156ea099-773a-4119-a63b-9f4c743d4772",
          "name": "ACETYL GLUTAMINE",
          "stdName": "ACETYL GLUTAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ebddf34a-496b-4ff9-8816-89b90062e74c",
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "4a225777-b4d1-4411-9339-9da63a8d64a2"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "56ae2177-4f58-41fd-99c3-8e6737af0830",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "99c41b65-c168-4de3-bf4f-637bec34c10b",
          "name": "ACUTIL S",
          "stdName": "ACUTIL S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "00533f75-670d-c058-b75d-93f2364a1adb",
          "name": "Aceglutamide [WHO-DD]",
          "stdName": "ACEGLUTAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e301a401-d0a8-a9ca-0eab-dbca148fea03"
          ],
          "display_name": false
        },
        {
          "uuid": "995124fe-0554-4803-bc5f-a2045e370257",
          "name": "GLUTAMINE, N2-ACETYL-, L-",
          "stdName": "GLUTAMINE, N2-ACETYL-, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "77e413c8-e09d-4cb9-b15e-fc90b7c94a0e",
          "name": "L-GLUTAMINE, N2-ACETYL-",
          "stdName": "L-GLUTAMINE, N2-ACETYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "cbcb1960-0e50-44c1-b0cf-ba37efedfaee",
          "name": "N-ACETYL-L-GLUTAMINE",
          "stdName": "N-ACETYL-L-GLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "c74264ef-b35a-43f1-9c1e-01206ac666b5"
          ],
          "display_name": false
        },
        {
          "uuid": "532c4fd7-0ed9-46b1-a218-d2415ab7861f",
          "name": "N-ACETYLGLUTAMINE",
          "stdName": "N-ACETYLGLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "a1254965-089e-4c93-95ed-f2972d4b9b99"
          ],
          "display_name": false
        },
        {
          "uuid": "f2ab71b5-c228-44e5-bdc9-c8d03f4e8045",
          "name": "N2-ACETYL-L-GLUTAMINE",
          "stdName": "N2-ACETYL-L-GLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "ad223bac-7df3-4552-ace2-784d3f27e552",
          "name": "N2-ACETYLGLUTAMINE",
          "stdName": "N2-ACETYLGLUTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "49b89434-bcac-5c4b-7982-0cf3745d48c5",
          "name": "NEURAMINA",
          "stdName": "NEURAMINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3e2ed28-bf23-d0c6-1416-923e81077a10"
          ],
          "display_name": false
        },
        {
          "uuid": "3993e402-b04d-4e71-941d-3618fc3c25df",
          "name": "NSC-186896",
          "stdName": "NSC-186896",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "691f9249-907e-4354-9f69-1d1a7070c946",
            "cab1a3c6-caa7-4cae-801e-5254a273166f"
          ],
          "display_name": false
        },
        {
          "uuid": "fc31a5b9-0a53-4d9a-81f4-1abcaf8efff3",
          "name": "PENTAKIS(N(SUP 2)-ACETYL-L-GLUTAMINATO)",
          "stdName": "PENTAKIS(N(SUP 2)-ACETYL-L-GLUTAMINATO)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "596a2ff8-fc35-4ced-a170-336c6c886008"
          ],
          "display_name": false
        },
        {
          "uuid": "50899f8f-3f15-422b-8c7c-937d9d6a86a7",
          "name": "aceglutamide [INN]",
          "stdName": "ACEGLUTAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35becea7-112b-4230-9da8-cf6330d89f90"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "596a2ff8-fc35-4ced-a170-336c6c886008",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c74264ef-b35a-43f1-9c1e-01206ac666b5",
          "citation": "pcpc-db",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "691f9249-907e-4354-9f69-1d1a7070c946",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35becea7-112b-4230-9da8-cf6330d89f90",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a5178b9-fc22-4172-8a70-c6af0a673546",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1396ebf-b4c7-4ff9-a21d-3c83d08d5a37",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cab1a3c6-caa7-4cae-801e-5254a273166f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a225777-b4d1-4411-9339-9da63a8d64a2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "474a92b1-806a-4c44-9f4a-c049602c9141",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1254965-089e-4c93-95ed-f2972d4b9b99",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c39a890b-2c44-4726-8105-0a7324c2ba8d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c466c55-aa1a-4e4c-a5b2-d399388fe113",
          "citation": "SRS import [01J18G9G97]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=01J18G9G97",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390811000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69ffb4fc-029c-4683-81b7-41d5c524e269",
          "citation": "ACEGLUTAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4dc8fad9-1a6f-4673-9d22-505e9cdd922b",
          "citation": "ACEGLUTAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f50306f2-3f28-4417-8c3f-78eaa134ad8c",
          "citation": "ACEGLUTAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebddf34a-496b-4ff9-8816-89b90062e74c",
          "citation": "ACETYL GLUTAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "34bc58fb-b2da-4038-b2dc-5d8aef4ab3c4",
          "citation": "ACEGLUTAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eab6a7f9-7796-e37c-11c8-8c0b765ef0ee",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2490-97-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "17a83af0-c823-7c7b-2e4f-663005023dfc",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c49b221d-cfd8-d1f6-462b-0829f4e663ff",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8bee5fba-567e-427c-8f5b-bf5a8f914fbd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b3e2ed28-bf23-d0c6-1416-923e81077a10",
          "citation": "https://en.wikipedia.org/wiki/Aceglutamide",
          "url": "https://en.wikipedia.org/wiki/Aceglutamide",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d3a26fb-23f2-bd47-833c-a1315c37ac8f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4dfe8ad0-8df9-0ad8-4353-c96c254fc82c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e301a401-d0a8-a9ca-0eab-dbca148fea03",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bb626124-cd88-4200-81a9-e79146809eb0",
          "id": "bb626124-cd88-4200-81a9-e79146809eb0",
          "molfile": "\n  Marvin  01132109412D          \n\n 13 12  0  0  1  0            999 V2000\n    4.2206   -0.1219    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.9301   -0.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6478   -0.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3656   -0.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3677   -1.3594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0751   -0.1219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5029   -0.5344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5021   -1.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2160   -1.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7844   -1.7676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2227    0.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9404    1.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5132    1.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  6  0  0  0\n  1 11  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](CCC(=O)N)C(=O)O",
          "formula": "C7H12N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "68fd94a0-4075-42d3-9c10-fa54b21c208f"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "188.1815",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ad1a8684-7d26-4b99-ade0-a69992600ed9",
      "version": "20",
      "structure": {
        "id": "13bba5b2-7144-4e0a-9f63-62c03efededf",
        "molfile": "\n  Marvin  01132101142D          \n\n 13 12  0  0  1  0            999 V2000\n    2.7844   -1.7676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5021   -1.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5029   -0.5344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2206   -0.1219    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2227    0.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9404    1.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5132    1.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9301   -0.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6478   -0.1219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3656   -0.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0751   -0.1219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3677   -1.3594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2160   -1.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  6  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  2 13  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](CCC(=O)N)C(=O)O",
        "formula": "C7H12N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "188.1815",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3c466c55-aa1a-4e4c-a5b2-d399388fe113",
          "596a2ff8-fc35-4ced-a170-336c6c886008",
          "35becea7-112b-4230-9da8-cf6330d89f90"
        ],
        "stereo_centers": 1
      },
      "unii": "01J18G9G97"
    }
  ]
}