{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e0248ca0-5a37-48a0-8c51-b643a12ccf26", "code": "6199-67-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6199-67-3", "code_system": "CAS", "references": [ "6b808a47-ab00-4f46-9690-c27d0fe646dd", "b01f0ff4-4508-4289-bebe-f0ae3f6b6e64" ] }, { "uuid": "9d8d7305-dd5a-489f-a29b-803c93d8dded", "code": "m3874", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m3874?q=authorize", "code_system": "MERCK INDEX", "references": [ "6b808a47-ab00-4f46-9690-c27d0fe646dd" ] }, { "uuid": "03eb54df-0710-4871-a386-787885522090", "code": "5281316", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281316", "code_system": "PUBCHEM", "references": [ "6b808a47-ab00-4f46-9690-c27d0fe646dd" ] }, { "uuid": "e5440a42-770f-c792-675e-c8fe41f31949", "code": "3476", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3476", "code_system": "HSDB", "references": [ "3a287e5c-1ca5-0f10-1a47-6273bcb48a3d" ] }, { "uuid": "79c978a5-ccfd-4173-8730-7179481ed14c", "code": "0115W5MABF", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8815d5e2-ca14-90b8-5eb8-7590aaefa4fe", "code": "3941", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3941", "code_system": "CHEBI", "references": [ "2ab9bd82-9ce8-9261-2bfe-7a08d3c9ace9" ] }, { "uuid": "dffa18e0-de96-37ce-0d12-34ef0e901a6e", "code": "DTXSID501316196", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501316196", "code_system": "EPA CompTox", "references": [ "d199d703-826c-7048-59e1-a3c0840a7eef" ] }, { "uuid": "c930046e-324c-d2c9-6e3b-2bee758b1fdf", "code": "144154", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=144154", "code_system": "NSC", "references": [ "b5bb05ba-9dfa-f07c-7bc4-f0a447803c71" ] }, { "uuid": "6732381d-4818-6729-c4ad-19fe639d0b03", "code": "49451", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=49451", "code_system": "NSC", "references": [ "b5bb05ba-9dfa-f07c-7bc4-f0a447803c71" ] } ], "relationships": [ { "uuid": "4325851f-a0c5-45ad-9f78-0d7b5fa227c1", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "69a231cd-e1e7-40bd-b24f-b012873175be", "refuuid": "f415ef6d-c736-48e6-9b13-d7930c4c3ac9", "name": "CUCURBITACIN B", "unii": "0115W5MABF", "linking_id": "0115W5MABF", "ref_pname": "CUCURBITACIN B", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "0c5bed1c-c1bc-4d74-ad1a-fb60f0785561", "name": "(+)-CUCURBITACIN B", "stdName": "(+)-CUCURBITACIN B", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0b785579-b7da-4554-88c5-135a3d5d4541", "d0024af4-f8e7-42ba-b347-d48573791d05" ], "display_name": false }, { "uuid": "f5d953f6-99bc-47df-8cc7-929a586b5d1b", "name": "(2.BETA.,9.BETA.,10.ALPHA.,16.ALPHA.,23E)-25-(ACETYLOXY)-2,16,20-TRIHYDROXY-9-METHYL-19-NORLANOSTA-5,23-DIENE-3,11,22-TRIONE", "stdName": "(2.BETA.,9.BETA.,10.ALPHA.,16.ALPHA.,23E)-25-(ACETYLOXY)-2,16,20-TRIHYDROXY-9-METHYL-19-NORLANOSTA-5,23-DIENE-3,11,22-TRIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0b785579-b7da-4554-88c5-135a3d5d4541", "d0024af4-f8e7-42ba-b347-d48573791d05" ], "display_name": false }, { "uuid": "c93b06b3-a789-4e59-89da-4f32ef5e205f", "name": "1,2-DIHYDRO-.ALPHA.-ELATERIN", "stdName": "1,2-DIHYDRO-.ALPHA.-ELATERIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0b785579-b7da-4554-88c5-135a3d5d4541", "d0024af4-f8e7-42ba-b347-d48573791d05" ], "display_name": false }, { "uuid": "d653dd35-4831-42ff-b0ac-439a9f664e77", "name": "19-NORLANOSTA-5,23-DIENE-3,11,22-TRIONE, 25-(ACETYLOXY)-2,16,20-TRIHYDROXY-9-METHYL-, (2.BETA.,9.BETA.,10.ALPHA.,16.ALPHA.,23E)-", "stdName": "19-NORLANOSTA-5,23-DIENE-3,11,22-TRIONE, 25-(ACETYLOXY)-2,16,20-TRIHYDROXY-9-METHYL-, (2.BETA.,9.BETA.,10.ALPHA.,16.ALPHA.,23E)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d0024af4-f8e7-42ba-b347-d48573791d05", "d406a1f3-f1a0-4cec-86f5-f57311a13789" ], "display_name": false }, { "uuid": "a72d5757-dbe8-464a-bb52-b73751a6b828", "name": "AMARINE", "stdName": "AMARINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d0024af4-f8e7-42ba-b347-d48573791d05", "d406a1f3-f1a0-4cec-86f5-f57311a13789" ], "display_name": false }, { "uuid": "89d65f4a-0fbf-4f6c-b872-0797f5048361", "name": "CUCURBITACIN B", "stdName": "CUCURBITACIN B", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "d4c17364-9436-4506-8ae8-9ff1efa41879", "0b785579-b7da-4554-88c5-135a3d5d4541", "d0024af4-f8e7-42ba-b347-d48573791d05", "41256ceb-4075-4599-b4b4-8d243969b0de", "d406a1f3-f1a0-4cec-86f5-f57311a13789", "add97974-b744-4752-98ff-56fb2c5d8940" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "93bac41c-1626-4ab0-b011-e72c8802e1b4", "name_org": "INCI" } ] }, { "uuid": "07706581-4ac2-4424-9634-a7f72cc7d6d0", "name": "CUCURBITACIN B [MI]", "stdName": "CUCURBITACIN B [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0b785579-b7da-4554-88c5-135a3d5d4541", "d0024af4-f8e7-42ba-b347-d48573791d05" ], "display_name": false }, { "uuid": "95d05a94-4974-4644-a36e-73b5bc0571e8", "name": "DATISCACIN", "stdName": "DATISCACIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d0024af4-f8e7-42ba-b347-d48573791d05", "d406a1f3-f1a0-4cec-86f5-f57311a13789" ], "display_name": false }, { "uuid": "75dbdc00-3663-416c-9513-d65c67556104", "name": "NSC-144154", "stdName": "NSC-144154", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "d0024af4-f8e7-42ba-b347-d48573791d05", "d406a1f3-f1a0-4cec-86f5-f57311a13789" ], "display_name": false }, { "uuid": "dcf6268d-aaa9-46e9-97a5-5f2e9843c074", "name": "NSC-49451", "stdName": "NSC-49451", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "d0024af4-f8e7-42ba-b347-d48573791d05", "d406a1f3-f1a0-4cec-86f5-f57311a13789" ], "display_name": false } ], "references": [ { "uuid": "add97974-b744-4752-98ff-56fb2c5d8940", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d0024af4-f8e7-42ba-b347-d48573791d05", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d406a1f3-f1a0-4cec-86f5-f57311a13789", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0b785579-b7da-4554-88c5-135a3d5d4541", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6b808a47-ab00-4f46-9690-c27d0fe646dd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392436000, "tags": [ "NOMEN" ] }, { "uuid": "b7695688-a639-4c15-aa45-eb1e46ef7dbc", "citation": "SRS import [0115W5MABF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=0115W5MABF", "doc_type": "SRS", "public_domain": true, "document_date": 1493392436000, "tags": [ "NOMEN" ] }, { "uuid": "d4c17364-9436-4506-8ae8-9ff1efa41879", "citation": "CUCURBITACIN B [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "41256ceb-4075-4599-b4b4-8d243969b0de", "citation": "CUCURBITACIN B [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3a287e5c-1ca5-0f10-1a47-6273bcb48a3d", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+6199-67-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2ab9bd82-9ce8-9261-2bfe-7a08d3c9ace9", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b5bb05ba-9dfa-f07c-7bc4-f0a447803c71", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "d199d703-826c-7048-59e1-a3c0840a7eef", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "b01f0ff4-4508-4289-bebe-f0ae3f6b6e64", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "733ec3a7-d71b-4870-aaf3-ce0017a2864c", "id": "733ec3a7-d71b-4870-aaf3-ce0017a2864c", "molfile": "\n Marvin 01132105582D \n\n 40 43 0 0 1 0 999 V2000\n 5.5360 -2.7770 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.3610 -2.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -3.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2665 -3.1895 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.3527 -4.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5520 -3.6020 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.5520 -4.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8376 -4.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -4.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -3.6020 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 1.4086 -3.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6941 -3.6020 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -0.0203 -3.1895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6941 -4.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0203 -4.8395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4086 -4.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9389 -5.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8783 -5.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8376 -3.1895 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.1231 -2.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8376 -2.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -1.9520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5520 -1.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2665 -2.3645 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 4.3527 -1.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -2.1096 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.3061 -1.3250 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.1345 -0.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5214 -1.0700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1130 -1.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6651 -1.7665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3679 -0.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1749 -0.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4298 0.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6452 0.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2583 1.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2368 0.7588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4918 1.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2987 1.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9397 2.1566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 26 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 24 4 1 0 0 0 0\n 6 7 1 6 0 0 0\n 6 19 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 9 16 1 0 0 0 0\n 10 11 1 1 0 0 0\n 19 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 1 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 14 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 20 1 1 0 0 0\n 19 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 23 21 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 24 1 1 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 1 0 0 0\n 27 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 34 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 2 0 0 0 0\nM END", "smiles": "CC(=O)OC(C)(C)/C=C/C(=O)[C@@](C)([C@H]1[C@@H](C[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@@H](C(=O)C4(C)C)O)[C@]3(C)C(=O)CC12C)O)O", "formula": "C32H46O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8b59ed8d-e8e6-4ae5-8f6d-1bced764ab0e" }, "defined_stereo": 8, "ez_centers": 1, "molecular_weight": "558.7041", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "f415ef6d-c736-48e6-9b13-d7930c4c3ac9", "version": "8", "structure": { "id": "fde6c463-86ad-4192-9486-34cb140aa806", "molfile": "\n Marvin 01132113092D \n\n 43 46 0 0 1 0 999 V2000\n 4.2665 -3.1895 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.2665 -2.3645 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.0511 -2.1096 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.3061 -1.3250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.1130 -1.1534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3679 -0.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1749 -0.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4298 0.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2368 0.7588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4918 1.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2987 1.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9397 2.1566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6452 0.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2583 1.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6651 -1.7665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1345 -0.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5214 -1.0700 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5360 -2.7770 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.0511 -3.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3610 -2.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8761 -2.1096 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5520 -1.9520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8376 -2.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -1.9520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8376 -3.1895 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.5520 -3.6020 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.5520 -4.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8376 -4.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -4.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -3.6020 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.4086 -3.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6941 -3.6020 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.0203 -3.1895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6941 -4.4270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4086 -4.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9389 -5.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8783 -5.4715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0203 -4.8395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4086 -4.0145 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5520 -2.7770 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1231 -2.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3527 -1.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3527 -4.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 8 13 1 0 0 0 0\n 8 14 1 0 0 0 0\n 5 15 2 0 0 0 0\n 4 16 1 0 0 0 0\n 4 17 1 1 0 0 0\n 3 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 1 19 1 0 0 0 0\n 18 20 1 6 0 0 0\n 3 21 1 6 0 0 0\n 2 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 25 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 1 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 30 29 1 0 0 0 0\n 25 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 1 0 0 0\n 32 34 1 0 0 0 0\n 35 34 1 0 0 0 0\n 29 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 1 0 0 0 0\n 34 38 2 0 0 0 0\n 30 39 1 6 0 0 0\n 26 40 1 1 0 0 0\n 25 41 1 1 0 0 0\n 2 42 1 1 0 0 0\n 1 43 1 6 0 0 0\nM END", "smiles": "CC(=O)OC(C)(C)/C=C/C(=O)[C@@](C)([C@@]1([H])[C@@H](C[C@@]2(C)[C@]3([H])CC=C4[C@@]([H])(C[C@@H](C(=O)C4(C)C)O)[C@]3(C)C(=O)C[C@]12C)O)O", "formula": "C32H46O8", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 9, "ez_centers": 1, "molecular_weight": "558.7041", "optical_activity": "UNSPECIFIED", "references": [ "b7695688-a639-4c15-aa45-eb1e46ef7dbc", "d406a1f3-f1a0-4cec-86f5-f57311a13789" ], "stereo_centers": 9 }, "unii": "0115W5MABF" } ] }