{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5f31fba1-b319-435b-aea7-effa5ac0224c",
          "code": "94108-97-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94108-97-1",
          "code_system": "CAS",
          "references": [
            "e15b4bc5-1272-4819-aee0-b69c2f9d5779",
            "307dbfab-5e65-43f0-84ab-3f5663a2bedb"
          ]
        },
        {
          "uuid": "da93d9bc-214c-4e04-99db-adbbc411c24b",
          "code": "302-434-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.093.079",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e15b4bc5-1272-4819-aee0-b69c2f9d5779"
          ]
        },
        {
          "uuid": "8e4103e5-7bc3-4b4b-8daa-9b9c2a3e3b82",
          "code": "175585",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/175585",
          "code_system": "PUBCHEM",
          "references": [
            "e15b4bc5-1272-4819-aee0-b69c2f9d5779"
          ]
        },
        {
          "uuid": "f465c04c-4d87-9bf1-4240-9a88b06745c2",
          "code": "DTXSID7072969",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7072969",
          "code_system": "EPA CompTox",
          "references": [
            "dba5fc08-566e-fb20-976e-ad485ad09e34"
          ]
        },
        {
          "uuid": "6de83b10-caf1-4d07-9a18-fdf7c1db8890",
          "code": "00Z96A58MN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "79dd6f2d-9bfe-45ee-a560-bc5b4a01d264",
          "name": "2-PROPENOIC ACID, 1,1'-(2-((2,2-BIS(((1-OXO-2-PROPEN-1-YL)OXY)METHYL)BUTOXY)METHYL)-2-ETHYL-1,3-PROPANEDIYL) ESTER",
          "stdName": "2-PROPENOIC ACID, 1,1'-(2-((2,2-BIS(((1-OXO-2-PROPEN-1-YL)OXY)METHYL)BUTOXY)METHYL)-2-ETHYL-1,3-PROPANEDIYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47aa031a-046c-4ffc-b907-1e3da83e612d",
            "c79d161d-4053-4a0c-8fc6-64c805d60b2b"
          ],
          "display_name": false
        },
        {
          "uuid": "8538c0fe-9509-4134-b9bc-c54800aa20a1",
          "name": "ARONIX M 408",
          "stdName": "ARONIX M 408",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47aa031a-046c-4ffc-b907-1e3da83e612d",
            "c79d161d-4053-4a0c-8fc6-64c805d60b2b"
          ],
          "display_name": false
        },
        {
          "uuid": "5b714565-5124-4213-86cf-2bd24530075e",
          "name": "BEAMSET 730",
          "stdName": "BEAMSET 730",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47aa031a-046c-4ffc-b907-1e3da83e612d",
            "c79d161d-4053-4a0c-8fc6-64c805d60b2b"
          ],
          "display_name": false
        },
        {
          "uuid": "8313ca4b-9ea1-4b29-8257-7b02aa73243e",
          "name": "DI(TRIMETHYLOLPROPANE) TETRAACRYLATE",
          "stdName": "DI(TRIMETHYLOLPROPANE) TETRAACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d5e786b-15e8-4005-9f2a-98e8b78cd520",
            "c79d161d-4053-4a0c-8fc6-64c805d60b2b"
          ],
          "display_name": false
        },
        {
          "uuid": "c74bb71b-cadc-4bed-9914-04647ecc237c",
          "name": "DITRIMETHYLOLPROPANE TETRAACRYLATE",
          "stdName": "DITRIMETHYLOLPROPANE TETRAACRYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c1c5ad6-a2de-4e2e-b558-e39cbf47ab7d",
            "5c9bf5f8-e4cb-40c9-9b70-37b86a2d0421",
            "c79d161d-4053-4a0c-8fc6-64c805d60b2b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2951b155-b7e3-48ff-86ff-5f1d3d34209d",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "0c1c5ad6-a2de-4e2e-b558-e39cbf47ab7d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c79d161d-4053-4a0c-8fc6-64c805d60b2b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47aa031a-046c-4ffc-b907-1e3da83e612d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d5e786b-15e8-4005-9f2a-98e8b78cd520",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e15b4bc5-1272-4819-aee0-b69c2f9d5779",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392587000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c83a5ad-5ef2-4493-a225-4aee842be176",
          "citation": "SRS import [00Z96A58MN]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=00Z96A58MN",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392587000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c9bf5f8-e4cb-40c9-9b70-37b86a2d0421",
          "citation": "DITRIMETHYLOLPROPANE TETRAACRYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dba5fc08-566e-fb20-976e-ad485ad09e34",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94108-97-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "307dbfab-5e65-43f0-84ab-3f5663a2bedb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "edde20c7-661a-4f1d-9d63-01bcf15f7179",
          "id": "edde20c7-661a-4f1d-9d63-01bcf15f7179",
          "molfile": "\n  Marvin  01132112192D          \n\n 33 32  0  0  0  0            999 V2000\n    1.4588   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796   -2.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8916   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3084   -3.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1333   -3.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5415   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3751   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3751   -3.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0872   -3.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3751   -1.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0872   -1.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7993   -1.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7993   -2.5964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5113   -1.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5113   -0.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2001   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6082   -3.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4418   -3.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8499   -3.9076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8499   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6836   -2.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6037   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6037   -1.2331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3244   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3244    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0365   -1.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7138   -0.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4748   -1.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6499   -1.7628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2331   -1.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6499   -0.3300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4081   -1.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 22  3  1  0  0  0  0\n  3 28  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 10  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 28 29  1  0  0  0  0\n 30 29  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  2  0  0  0  0\nM  END",
          "smiles": "C=CC(=O)OCC(CC)(COCC(CC)(COC(=O)C=C)COC(=O)C=C)COC(=O)C=C",
          "formula": "C24H34O9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63dc66e1-3497-4914-ab13-e02dc8a91eaa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "466.5223",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf2906d2-97ca-49a2-92b9-536578909539",
      "version": "4",
      "structure": {
        "id": "5585346f-7eab-4704-bac9-28de484c66c9",
        "molfile": "\n  Marvin  01132104272D          \n\n 33 32  0  0  0  0            999 V2000\n    3.6037   -2.0580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8916   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4748   -1.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1796   -2.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4588   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3084   -3.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1333   -3.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5415   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3751   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3751   -3.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0872   -3.7165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3751   -1.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0872   -1.3547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7993   -1.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5113   -1.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5113   -0.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7993   -2.5964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2001   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6082   -3.1868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4418   -3.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8499   -2.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6836   -2.4835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8499   -3.9076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3244   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0365   -1.2331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7138   -0.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3244    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6037   -1.2331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2331   -1.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4081   -1.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6499   -0.3300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6499   -1.7628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 28  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3 33  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 18  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  2  0  0  0  0\n 15 16  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 23  2  0  0  0  0\n 21 22  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 27  2  0  0  0  0\n 24 28  1  0  0  0  0\n 25 26  2  0  0  0  0\n 29 30  1  0  0  0  0\n 29 32  2  0  0  0  0\n 29 33  1  0  0  0  0\n 30 31  2  0  0  0  0\nM  END",
        "smiles": "C=CC(=O)OCC(CC)(COCC(CC)(COC(=O)C=C)COC(=O)C=C)COC(=O)C=C",
        "formula": "C24H34O9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "466.5223",
        "optical_activity": "NONE",
        "references": [
          "0c83a5ad-5ef2-4493-a225-4aee842be176",
          "3d5e786b-15e8-4005-9f2a-98e8b78cd520"
        ],
        "stereo_centers": 0
      },
      "unii": "00Z96A58MN"
    }
  ]
}