{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e95649d4-2742-4553-bf21-d00aef86b927",
          "code": "FCN NO. 189",
          "comments": "FCN|CLARIFIER|POLYPROPYLENE POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=189",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "220b91b2-70d9-46a8-b664-b2fcb0b94435"
          ]
        },
        {
          "uuid": "9d07d762-4777-41fb-a938-7bff16fa41e3",
          "code": "81541-12-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81541-12-0",
          "code_system": "CAS",
          "references": [
            "220b91b2-70d9-46a8-b664-b2fcb0b94435",
            "7d232544-8a50-49d5-8638-09e6f8158323"
          ]
        },
        {
          "uuid": "4ab8d8e1-b430-461c-9ddb-81de6726bb4c",
          "code": "197809-37-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=197809-37-3",
          "code_system": "CAS",
          "references": [
            "220b91b2-70d9-46a8-b664-b2fcb0b94435",
            "632cb823-6c34-490d-be47-478b42778611"
          ]
        },
        {
          "uuid": "5081ea3c-afb1-4c47-b04a-e1622300d59a",
          "code": "FCN NO. 686",
          "comments": "FCN|NUCLEATING AGENT|POLYPROPYLENE POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=686",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "220b91b2-70d9-46a8-b664-b2fcb0b94435"
          ]
        },
        {
          "uuid": "d2707f79-eb65-43ad-b03d-50d538a7e64a",
          "code": "FCN NO. 352",
          "comments": "FCN|CLARIFIER|POLYPROPYLENE POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=352",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "220b91b2-70d9-46a8-b664-b2fcb0b94435"
          ]
        },
        {
          "uuid": "dfa6982f-19a7-4b84-a416-2ce4269c92e3",
          "code": "6850837",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6850837",
          "code_system": "PUBCHEM",
          "references": [
            "220b91b2-70d9-46a8-b664-b2fcb0b94435"
          ]
        },
        {
          "uuid": "f3c5eda6-b760-4b75-a163-92dcab21a95c",
          "code": "00YK2U88F9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d21f19da-86dc-c8f6-035c-0773da519552",
          "code": "DTXSID3051381",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3051381",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f21cf24a-f364-4323-a702-2516a68c97a7",
          "name": "1,3:2,4-BIS(P-METHYLBENZYLIDENE)SORBITOL",
          "stdName": "1,3:2,4-BIS(P-METHYLBENZYLIDENE)SORBITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "99be0147-e6c9-4c21-b4d3-2af14065abf3",
          "name": "1,3:2,4-BIS-O-(4-METHYLBENZYLIDENE)SORBITOL",
          "stdName": "1,3:2,4-BIS-O-(4-METHYLBENZYLIDENE)SORBITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "b6812f29-44e5-4acb-8770-0eb99aa50458",
          "name": "D-GLUCITOL, 1,3:2,4-BIS-O-((4-METHYLPHENYL)METHYLENE)-",
          "stdName": "D-GLUCITOL, 1,3:2,4-BIS-O-((4-METHYLPHENYL)METHYLENE)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "a0702f31-4ebf-4617-b900-efb86a705657",
          "name": "DI-P-METHYLBENZYLIDENESORBITOL",
          "stdName": "DI-P-METHYLBENZYLIDENESORBITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": true
        },
        {
          "uuid": "de05ab76-e7d7-46a1-84b7-6cc7d5a1a434",
          "name": "GEL ALL MD",
          "stdName": "GEL ALL MD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "46fefbbc-68fe-45a6-8d8d-e4ccc9d1fb90",
          "name": "GEL ALL MD-LM30G",
          "stdName": "GEL ALL MD-LM30G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ba212fb-8942-4754-b3ca-957f8b9ba8dd",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "d9751663-5f15-461a-a515-f8e4211b2e94",
          "name": "IRGACLEAR DM",
          "stdName": "IRGACLEAR DM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "d4717c7a-2084-481d-a298-76ae01f6703e",
          "name": "NA-98",
          "stdName": "NA-98",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        },
        {
          "uuid": "dff256ae-e2d5-496e-a472-e55749757975",
          "name": "NC-6",
          "stdName": "NC-6",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fc25135-ec09-4020-bea7-53664a55e114",
            "54dd82f1-ff23-44f1-a083-a0962fc15c74"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1fc25135-ec09-4020-bea7-53664a55e114",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "54dd82f1-ff23-44f1-a083-a0962fc15c74",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ba212fb-8942-4754-b3ca-957f8b9ba8dd",
          "citation": "http://www.nj-chem.co.jp/en/products/chem/pdf/71-md-lm30g.pdf",
          "url": "http://www.nj-chem.co.jp/en/products/chem/pdf/71-md-lm30g.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "220b91b2-70d9-46a8-b664-b2fcb0b94435",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391968000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6bc67e7-dad0-4cc3-a15f-82153b9c4522",
          "citation": "SRS import [00YK2U88F9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=00YK2U88F9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391968000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d232544-8a50-49d5-8638-09e6f8158323",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "632cb823-6c34-490d-be47-478b42778611",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "366a6eef-bd30-43d7-9ee0-fea15ec7fd23",
          "id": "366a6eef-bd30-43d7-9ee0-fea15ec7fd23",
          "molfile": "\n  Marvin  01132102542D          \n\n 28 31  0  0  1  0            999 V2000\n    8.1862   -2.4031    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4714   -1.9911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9010   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9010   -1.1675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1862   -3.2267    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.9358   -3.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9010   -4.4623    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.1862   -4.8742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4714   -4.4623    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.7565   -4.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0417   -4.4623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0417   -3.6386    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.7565   -3.2267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4714   -3.6386    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.3269   -3.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -3.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9017   -3.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9017   -2.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1869   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3269   -2.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6159   -4.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3262   -4.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0410   -4.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0410   -5.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7558   -6.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3262   -6.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6159   -5.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 22  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 14  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 15  1  0  0  0  0\n 14 13  1  1  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 28  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)C2OC[C@H]3[C@H]([C@@H]([C@@H](CO)O)OC(c4ccc(C)cc4)O3)O2",
          "formula": "C22H26O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c67d11ab-544c-4981-b8f5-f17c42ab4fb4"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "386.4391",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "987025aa-8bfc-4911-8e54-aa466d604f4f",
      "version": "4",
      "structure": {
        "id": "fc1d63b2-12c5-427f-ad10-fd35f3d300c7",
        "molfile": "\n  Marvin  01132113032D          \n\n 31 34  0  0  1  0            999 V2000\n    6.0417   -4.4623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7565   -4.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4714   -4.4623    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1862   -4.8742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9010   -4.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6159   -4.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3262   -4.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0410   -4.8742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0410   -5.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3262   -6.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6159   -5.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7558   -6.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9358   -3.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1862   -3.2267    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4714   -3.6386    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7565   -3.2267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0417   -3.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3269   -3.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -3.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9017   -3.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9017   -2.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3269   -2.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1869   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4982   -2.6101    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1862   -2.4031    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4714   -1.9911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9010   -1.9911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9010   -1.1675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1898   -2.6845    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4714   -5.7203    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n  6 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n  3 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 18 23  2  0  0  0  0\n 21 24  1  0  0  0  0\n 15 25  1  6  0  0  0\n 14 26  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 14 30  1  6  0  0  0\n  3 31  1  6  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)C2OC[C@@]3([H])[C@]([H])([C@@]([H])([C@@H](CO)O)OC(c4ccc(C)cc4)O3)O2",
        "formula": "C22H26O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "386.4391",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d6bc67e7-dad0-4cc3-a15f-82153b9c4522",
          "1fc25135-ec09-4020-bea7-53664a55e114"
        ],
        "stereo_centers": 6
      },
      "unii": "00YK2U88F9"
    }
  ]
}