{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "94402b97-f06f-4795-8aa2-6660d2309d53",
          "code": "36062-04-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=36062-04-1",
          "code_system": "CAS",
          "references": [
            "3afc45ce-bf64-4c54-93e8-4030b9e3ac67",
            "95ee4c3d-d341-4f5e-a814-d7c81873b944"
          ]
        },
        {
          "uuid": "b5be8636-3be7-4aa9-bbf2-2798997a7fab",
          "code": "C096277",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67096277",
          "code_system": "MESH",
          "references": [
            "3afc45ce-bf64-4c54-93e8-4030b9e3ac67"
          ]
        },
        {
          "uuid": "65668d9f-9359-461a-b65e-fb72a58ac9fb",
          "code": "1362136",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362136/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3afc45ce-bf64-4c54-93e8-4030b9e3ac67"
          ]
        },
        {
          "uuid": "cc396313-4a16-4e16-a1b6-ce2c80d5b212",
          "code": "609-201-3",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3afc45ce-bf64-4c54-93e8-4030b9e3ac67"
          ]
        },
        {
          "uuid": "3b396428-2da9-4ca7-abaa-919faec05167",
          "code": "124072",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/124072",
          "code_system": "PUBCHEM",
          "references": [
            "3afc45ce-bf64-4c54-93e8-4030b9e3ac67"
          ]
        },
        {
          "uuid": "6a798b3a-7dd2-63f0-cb97-b6a7469afa1d",
          "code": "DTXSID30865801",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30865801",
          "code_system": "EPA CompTox",
          "references": [
            "6565b8e1-1ab1-fe4d-f89e-acd6641bfa72"
          ]
        },
        {
          "uuid": "04192c04-c424-447e-b315-d9cf925e9a21",
          "code": "00U0645U03",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f554ca80-c9fb-4f14-eecc-a18a961404d3",
          "code": "67263",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:67263",
          "code_system": "CHEBI",
          "references": [
            "6d27e5fb-ceec-becc-24cc-cfce4fee3b87"
          ]
        },
        {
          "uuid": "5e0055c2-5807-49ec-860b-fc23fdc2fb95",
          "code": "00U0645U03",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=00U0645U03",
          "code_system": "DAILYMED",
          "references": [
            "bc7a2854-cc59-41fe-0500-9a0bcb6d1ed1"
          ]
        },
        {
          "uuid": "9564dc36-6a81-6e04-7b2e-84f318ff1152",
          "code": "687845",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=687845",
          "code_system": "NSC",
          "references": [
            "90b961fc-de81-e295-3da5-fbdf044ba617"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "71ca2707-7c2e-4be0-9f11-bd6c9594b660",
          "type": "PARENT->METABOLITE",
          "related_substance": {
            "uuid": "d36a4940-bb33-4e32-8a08-09984d131d7f",
            "refuuid": "cf42852a-3942-4aea-a4d9-0842d85d210d",
            "name": "CURCUMIN",
            "unii": "IT942ZTH98",
            "linking_id": "IT942ZTH98",
            "ref_pname": "CURCUMIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7046202b-24a9-49ec-8feb-843b60bd79ce",
          "name": "1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)HEPTANE-3,5-DIONE",
          "stdName": "1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)HEPTANE-3,5-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa11d4a1-712e-4847-bf69-7b702c0d5bee",
            "02bbd0a4-b290-48fe-9d06-40c5c2eb3bfa"
          ],
          "display_name": false
        },
        {
          "uuid": "cb5f6272-168b-4283-93c0-12688c113b85",
          "name": "3,5-HEPTANEDIONE, 1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)-",
          "stdName": "3,5-HEPTANEDIONE, 1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa11d4a1-712e-4847-bf69-7b702c0d5bee",
            "02bbd0a4-b290-48fe-9d06-40c5c2eb3bfa"
          ],
          "display_name": false
        },
        {
          "uuid": "9a4f16ab-dfdc-424a-a294-1db9afa12cfb",
          "name": "NSC-687845",
          "stdName": "NSC-687845",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa11d4a1-712e-4847-bf69-7b702c0d5bee",
            "02bbd0a4-b290-48fe-9d06-40c5c2eb3bfa"
          ],
          "display_name": false
        },
        {
          "uuid": "ed950ca0-8133-4e79-94f2-99f29b9e8a55",
          "name": "SABIWHITE",
          "stdName": "SABIWHITE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02bbd0a4-b290-48fe-9d06-40c5c2eb3bfa",
            "93cf7fc1-1b6f-4649-a30d-b5c0829d974b"
          ],
          "display_name": false
        },
        {
          "uuid": "65c0f4bb-d1eb-4ebc-8e53-797860375a73",
          "name": "TETRAHYDROCURCUMIN",
          "stdName": "TETRAHYDROCURCUMIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fa00f19-cdf6-45cd-b267-dc650395e34e"
          ],
          "display_name": false
        },
        {
          "uuid": "0e036791-8f37-484f-9733-f4523f4cede2",
          "name": "TETRAHYDRODIFERULOYLMETHANE",
          "stdName": "TETRAHYDRODIFERULOYLMETHANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02bbd0a4-b290-48fe-9d06-40c5c2eb3bfa",
            "d8bc7321-b45f-4f84-9302-1ce4706d8211",
            "93cf7fc1-1b6f-4649-a30d-b5c0829d974b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a6c49459-f804-4627-8a40-86a93e691ef1",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "4fa00f19-cdf6-45cd-b267-dc650395e34e",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "93cf7fc1-1b6f-4649-a30d-b5c0829d974b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02bbd0a4-b290-48fe-9d06-40c5c2eb3bfa",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa11d4a1-712e-4847-bf69-7b702c0d5bee",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3afc45ce-bf64-4c54-93e8-4030b9e3ac67",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390935000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f05879f0-2064-4ae8-bc15-5a7f534d2a84",
          "citation": "SRS import [00U0645U03]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=00U0645U03",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390935000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd39a1d3-1037-4e5b-ba3a-23f34fa7ed6e",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8bc7321-b45f-4f84-9302-1ce4706d8211",
          "citation": "TETRAHYDRODIFERULOYLMETHANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6565b8e1-1ab1-fe4d-f89e-acd6641bfa72",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36062-04-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "49d3aa2c-51b6-390a-086f-86aaf809902d",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "95ee4c3d-d341-4f5e-a814-d7c81873b944",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6d27e5fb-ceec-becc-24cc-cfce4fee3b87",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "90b961fc-de81-e295-3da5-fbdf044ba617",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bc7a2854-cc59-41fe-0500-9a0bcb6d1ed1",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1ca2f485-5ba1-4608-b130-a6646c840b31",
          "id": "1ca2f485-5ba1-4608-b130-a6646c840b31",
          "molfile": "\n  Marvin  01132101392D          \n\n 27 28  0  0  0  0            999 V2000\n   13.0742   -4.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3605   -4.3533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6468   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9238   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2100   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4916   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7825   -4.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0688   -4.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0688   -3.5468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3550   -4.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6321   -4.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6321   -3.5468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9184   -4.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2046   -4.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4908   -4.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4908   -5.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7771   -6.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0633   -5.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3310   -6.0357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0633   -4.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3404   -4.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6267   -4.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7771   -4.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2100   -5.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9238   -6.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6468   -5.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3605   -6.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 26  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n 24  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 23  2  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 23 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(CCC(=O)CC(=O)CCc2ccc(c(c2)OC)O)ccc1O",
          "formula": "C21H24O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e8acc532-d71e-4ec7-9f01-9696f92b713e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "372.4125",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9758ab33-f51d-4397-8d20-e96429b08245",
      "version": "9",
      "structure": {
        "id": "4f1a664b-0355-4381-a188-2e2e974d1adc",
        "molfile": "\n  Marvin  01132104072D          \n\n 27 28  0  0  0  0            999 V2000\n    3.0633   -4.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0633   -5.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7771   -6.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4908   -5.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4908   -4.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7771   -4.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2046   -4.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9184   -4.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6321   -4.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3550   -4.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0688   -4.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0688   -3.5468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7825   -4.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4916   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2100   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9238   -4.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6468   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3605   -4.3533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0742   -4.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6468   -5.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9238   -6.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2100   -5.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3605   -6.0125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6321   -3.5468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3310   -6.0357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3404   -4.3858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6267   -4.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 15  2  0  0  0  0\n 23 20  1  0  0  0  0\n 24  9  2  0  0  0  0\n 25  2  1  0  0  0  0\n 26  1  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(CCC(=O)CC(=O)CCc2ccc(c(c2)OC)O)ccc1O",
        "formula": "C21H24O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "372.4125",
        "optical_activity": "NONE",
        "references": [
          "f05879f0-2064-4ae8-bc15-5a7f534d2a84",
          "cd39a1d3-1037-4e5b-ba3a-23f34fa7ed6e"
        ],
        "stereo_centers": 0
      },
      "unii": "00U0645U03"
    }
  ]
}