{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c42981b4-b00e-446a-985b-fa66163f7511",
          "code": "68527-79-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68527-79-7",
          "code_system": "CAS",
          "references": [
            "dd32a14a-f755-4258-95d1-30573a9ae6e8",
            "e6cbd6fc-cd78-4d7e-963a-cfed28e5ba42"
          ]
        },
        {
          "uuid": "28d0a630-c61b-49e1-9028-b58db9391b7a",
          "code": "271-284-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.064.785",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "dd32a14a-f755-4258-95d1-30573a9ae6e8"
          ]
        },
        {
          "uuid": "5507d3b9-18d0-4e9d-b43a-a6c5e33cb5c8",
          "code": "6435060",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6435060",
          "code_system": "PUBCHEM",
          "references": [
            "dd32a14a-f755-4258-95d1-30573a9ae6e8"
          ]
        },
        {
          "uuid": "a8668020-5437-d6cb-2ed2-dbbf30a4501b",
          "code": "2384441",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2384441/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "aede05a4-d859-c4a1-63d4-5644b9a3cb3e"
          ]
        },
        {
          "uuid": "18d698e0-271f-422d-8df5-813b1360bf38",
          "code": "00NG926C95",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "363c2517-ad30-8ad9-f9ec-26cf486ac6f7",
          "code": "00NG926C95",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=00NG926C95",
          "code_system": "DAILYMED",
          "references": [
            "d0e942d8-11e8-45f3-b658-d6afad17dc30"
          ]
        },
        {
          "uuid": "d9835908-781e-8f94-e27a-501fb0798ea7",
          "code": "DTXSID30867663",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30867663",
          "code_system": "EPA CompTox",
          "references": [
            "2770da77-ae69-d5e5-51c7-bf9a079d76e1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15be8dbc-e832-479c-9294-754b9312e2cb",
          "name": "7-OCTEN-2-OL, 8-(1H-INDOL-1-YL)-2,6-DIMETHYL-",
          "stdName": "7-OCTEN-2-OL, 8-(1H-INDOL-1-YL)-2,6-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc07b693-d00b-411e-bb49-2646997949ee",
            "39598ae0-4285-4b5c-a135-66ec49390c20"
          ],
          "display_name": false
        },
        {
          "uuid": "6e3c10e1-13a8-44ca-a4c3-01e7e693cd2d",
          "name": "8-(N-INDOLYL)-2,6-DIMETHYL-7-OCTEN-2-OL",
          "stdName": "8-(N-INDOLYL)-2,6-DIMETHYL-7-OCTEN-2-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95c6ca70-6679-4ffa-97bf-f5f3164b1799",
            "39598ae0-4285-4b5c-a135-66ec49390c20"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "95c6ca70-6679-4ffa-97bf-f5f3164b1799",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "39598ae0-4285-4b5c-a135-66ec49390c20",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc07b693-d00b-411e-bb49-2646997949ee",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd32a14a-f755-4258-95d1-30573a9ae6e8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392562000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8949113d-39f2-4035-aa52-fa294268189e",
          "citation": "SRS import [00NG926C95]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=00NG926C95",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392562000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cf40102-90fb-432c-9a38-f1a12f6c4a7d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aede05a4-d859-c4a1-63d4-5644b9a3cb3e",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "e6cbd6fc-cd78-4d7e-963a-cfed28e5ba42",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d0e942d8-11e8-45f3-b658-d6afad17dc30",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2770da77-ae69-d5e5-51c7-bf9a079d76e1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a24d41b6-6d5b-446a-9bcd-22697a1d4534",
          "id": "a24d41b6-6d5b-446a-9bcd-22697a1d4534",
          "molfile": "\n  Marvin  01132108262D          \n\n 20 21  0  0  0  0            999 V2000\n    5.1840   -1.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4695   -1.8864    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.7551   -1.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7551   -0.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0406   -0.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0406    0.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0406    1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8656    0.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2156    0.5886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4695   -2.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1840   -3.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1840   -3.9488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8514   -4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5965   -5.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7715   -5.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2194   -5.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4125   -5.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1576   -4.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7096   -4.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5166   -4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 20 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CC(CCCC(C)(C)O)/C=C/n1ccc2ccccc21",
          "formula": "C18H25NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0e0ad063-42e6-413b-9c00-1aa012cf6e6c"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "271.3979",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "58c05a85-d3cd-49e5-9765-71c3fab8fdeb",
      "version": "8",
      "structure": {
        "id": "e6268e37-0063-468a-8ede-c3b3596c887b",
        "molfile": "\n  Marvin  01132111552D          \n\n 20 21  0  0  0  0            999 V2000\n    3.1576   -4.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4125   -5.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2194   -5.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7715   -5.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5166   -4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7096   -4.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1840   -3.9488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8514   -4.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5965   -5.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1840   -3.1238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4695   -2.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4695   -1.8864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7551   -1.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7551   -0.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0406   -0.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0406    0.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0406    1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8656    0.5886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2156    0.5886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1840   -1.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  4  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 12 20  1  0  0  0  0\nM  END",
        "smiles": "CC(CCCC(C)(C)O)/C=C/n1ccc2ccccc21",
        "formula": "C18H25NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "271.3979",
        "optical_activity": "( + / - )",
        "references": [
          "1cf40102-90fb-432c-9a38-f1a12f6c4a7d",
          "8949113d-39f2-4035-aa52-fa294268189e"
        ],
        "stereo_centers": 1
      },
      "unii": "00NG926C95"
    }
  ]
}