{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a863c8c5-aa9b-4b1b-8f6a-4bfba044983e",
          "code": "145701-23-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=145701-23-1",
          "code_system": "CAS",
          "references": [
            "e983c144-fd57-4bf7-9d4e-5d64d7829bea",
            "69c0d788-e1a4-4c0a-b02d-0a2f4944c494"
          ]
        },
        {
          "uuid": "5122f96e-e843-4ab1-a922-2bf530e1803d",
          "code": "C413390",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67413390",
          "code_system": "MESH",
          "references": [
            "e983c144-fd57-4bf7-9d4e-5d64d7829bea"
          ]
        },
        {
          "uuid": "02cb182a-e8f4-47f3-8d03-75582a1d3940",
          "code": "129108",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2383",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e983c144-fd57-4bf7-9d4e-5d64d7829bea"
          ]
        },
        {
          "uuid": "9b8438d9-d248-49f3-9341-15cd9ab77406",
          "code": "m5409",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5409?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e983c144-fd57-4bf7-9d4e-5d64d7829bea"
          ]
        },
        {
          "uuid": "57b61a26-2fe5-488b-935f-7a826334bbe5",
          "code": "11700495",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11700495",
          "code_system": "PUBCHEM",
          "references": [
            "e983c144-fd57-4bf7-9d4e-5d64d7829bea"
          ]
        },
        {
          "uuid": "7a4ca167-ae6f-c0fc-042c-b90902f72208",
          "code": "7941",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7941",
          "code_system": "HSDB",
          "references": [
            "6af885c5-22c7-1556-96e2-3ec05cc1ab66"
          ]
        },
        {
          "uuid": "68449e17-e1f5-bf89-e536-05aeb2d44218",
          "code": "DTXSID7044340",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044340",
          "code_system": "EPA CompTox",
          "references": [
            "a4bf86b4-daff-23c9-0963-d191b45b70b5"
          ]
        },
        {
          "uuid": "e5173462-942f-dbbc-0d1c-a3c0647ddea8",
          "code": "DB15316",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15316",
          "code_system": "DRUG BANK",
          "references": [
            "39435cd2-c7d1-aa93-7609-6d19634bb2a4"
          ]
        },
        {
          "uuid": "db705bb8-274e-4f73-b5ea-113a1e440592",
          "code": "00A64ZX8NB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa8e5905-234f-6f89-db06-14b9fe36b63c",
          "code": "florasulam",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/florasulam.html",
          "code_system": "ALANWOOD",
          "references": [
            "656bc601-dcd2-4965-4852-ed9b6eb9bccb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19c861e7-4285-4324-8eb3-2705bacd221e",
          "name": "(1,2,4)TRIAZOLO(1,5-C)PYRIMIDINE-2-SULFONAMIDE, N-(2,6-DIFLUOROPHENYL)-8-FLUORO-5-METHOXY-",
          "stdName": "(1,2,4)TRIAZOLO(1,5-C)PYRIMIDINE-2-SULFONAMIDE, N-(2,6-DIFLUOROPHENYL)-8-FLUORO-5-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfc407cf-969d-4062-810b-39938b9b1b3d",
            "794f04de-1f54-4881-8dfc-935ba915c3e1"
          ],
          "display_name": false
        },
        {
          "uuid": "6da4ff43-07e1-4b4f-9d9c-053f164c2480",
          "name": "2',6',8-TRIFLUORO-5-METHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDINE-2-SULFONANILIDE",
          "stdName": "2',6',8-TRIFLUORO-5-METHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDINE-2-SULFONANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28a398d9-e7f3-4670-9ee1-28a7b7de1bb8",
            "821ce2ec-1971-4f05-a7af-861aa1c5bacf"
          ],
          "display_name": false
        },
        {
          "uuid": "e2681edb-96cb-4e15-9157-dff0e5ab135e",
          "name": "BOXER",
          "stdName": "BOXER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d6daed0-cbb5-4128-98d9-114ece083715",
            "bfc407cf-969d-4062-810b-39938b9b1b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "2d5b2422-4fb1-4e29-96a7-4dc199f6a4f9",
          "name": "FLORASULAM",
          "stdName": "FLORASULAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8c3533f-fa6d-4c69-b900-e3f20c0200c2",
            "4991d211-aae3-4153-89d9-232aeb7433c2",
            "25cef890-d623-4d2e-84d2-90b445374adf",
            "bfc407cf-969d-4062-810b-39938b9b1b3d",
            "bd81e547-d706-4519-a304-bd191d816ad6",
            "3b699ffd-f2a6-472c-9f70-f2a49b50df28"
          ],
          "display_name": true
        },
        {
          "uuid": "3976ebc1-dd7f-4b5e-8496-76f098facf2d",
          "name": "FLORASULAM [ISO]",
          "stdName": "FLORASULAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfc407cf-969d-4062-810b-39938b9b1b3d",
            "3b699ffd-f2a6-472c-9f70-f2a49b50df28"
          ],
          "display_name": false
        },
        {
          "uuid": "dce71322-bcc1-4156-8a44-963b404431cd",
          "name": "FLORASULAM [MI]",
          "stdName": "FLORASULAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4991d211-aae3-4153-89d9-232aeb7433c2",
            "bfc407cf-969d-4062-810b-39938b9b1b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "2ce4796d-f980-4119-bf41-de469534e206",
          "name": "N-(2,6-DIFLUOROPHENYL)-8-FLUORO-5-METHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDINE-2-SULFONAMIDE",
          "stdName": "N-(2,6-DIFLUOROPHENYL)-8-FLUORO-5-METHOXY(1,2,4)TRIAZOLO(1,5-C)PYRIMIDINE-2-SULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8b95c6d-d461-4093-b2f8-6cc95e5f7366",
            "821ce2ec-1971-4f05-a7af-861aa1c5bacf"
          ],
          "display_name": false
        },
        {
          "uuid": "5072560c-5c8f-49bc-9c1d-8c30417aab1a",
          "name": "NIKOS",
          "stdName": "NIKOS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d6daed0-cbb5-4128-98d9-114ece083715",
            "bfc407cf-969d-4062-810b-39938b9b1b3d"
          ],
          "display_name": false
        },
        {
          "uuid": "d7ad190d-73ab-4b55-8d75-77853fb070d6",
          "name": "PRIMUS",
          "stdName": "PRIMUS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d6daed0-cbb5-4128-98d9-114ece083715",
            "bfc407cf-969d-4062-810b-39938b9b1b3d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bd81e547-d706-4519-a304-bd191d816ad6",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "821ce2ec-1971-4f05-a7af-861aa1c5bacf",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28a398d9-e7f3-4670-9ee1-28a7b7de1bb8",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8b95c6d-d461-4093-b2f8-6cc95e5f7366",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4991d211-aae3-4153-89d9-232aeb7433c2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfc407cf-969d-4062-810b-39938b9b1b3d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d6daed0-cbb5-4128-98d9-114ece083715",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "794f04de-1f54-4881-8dfc-935ba915c3e1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b699ffd-f2a6-472c-9f70-f2a49b50df28",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e983c144-fd57-4bf7-9d4e-5d64d7829bea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76567893-1b78-4e45-9791-7a75a275f8fa",
          "citation": "SRS import [00A64ZX8NB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=00A64ZX8NB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19a3d3aa-138b-4f33-b3f1-77c188fecedc",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25cef890-d623-4d2e-84d2-90b445374adf",
          "citation": "FLORASULAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f8c3533f-fa6d-4c69-b900-e3f20c0200c2",
          "citation": "FLORASULAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6af885c5-22c7-1556-96e2-3ec05cc1ab66",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+145701-23-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4bf86b4-daff-23c9-0963-d191b45b70b5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=145701-23-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "656bc601-dcd2-4965-4852-ed9b6eb9bccb",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "39435cd2-c7d1-aa93-7609-6d19634bb2a4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "69c0d788-e1a4-4c0a-b02d-0a2f4944c494",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8ad5a0a2-8d7d-4894-81a1-d9b3f5db8467",
          "id": "8ad5a0a2-8d7d-4894-81a1-d9b3f5db8467",
          "molfile": "\n  Marvin  01132107132D          \n\n 24 26  0  0  0  0            999 V2000\n    4.3362   -6.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0752   -6.5377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0752   -5.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -5.2824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -4.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1040   -4.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1040   -3.2302    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7918   -4.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5925   -4.2407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0728   -4.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5767   -5.5766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7918   -5.3067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8977   -4.9250    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2991   -5.6403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3109   -4.2128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7221   -4.9250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1057   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6661   -3.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8374   -3.4647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0458   -2.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8737   -2.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3135   -3.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9298   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3732   -4.8269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n 12  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 12  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 13  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 23  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "COc1ncc(c2nc(nn21)S(=O)(=O)Nc3c(cccc3F)F)F",
          "formula": "C12H8F3N5O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "85cf40c3-5058-4fde-83d7-301465e88338"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "359.2854",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "80756b42-1350-4bd0-81d5-a6a0cfc3fcd6",
      "version": "6",
      "structure": {
        "id": "33dc3067-c00e-4c70-af5c-33ead6dec2c2",
        "molfile": "\n  Marvin  01132102462D          \n\n 24 26  0  0  0  0            999 V2000\n    6.5767   -5.5766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7918   -5.3067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0752   -5.7128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -5.2824    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3778   -4.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1040   -4.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7918   -4.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5925   -4.2407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0728   -4.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8977   -4.9250    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7221   -4.9250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1057   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9298   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3135   -3.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8737   -2.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0458   -2.7002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6661   -3.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8374   -3.4647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3732   -4.8269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2991   -5.6403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3109   -4.2128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1040   -3.2302    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0752   -6.5377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3362   -6.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 12  1  0  0  0  0\n 17 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 10 20  2  0  0  0  0\n 10 21  2  0  0  0  0\n  1  9  2  0  0  0  0\n  2  7  1  0  0  0  0\n  6 22  1  0  0  0  0\n  3 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
        "smiles": "COc1ncc(c2nc(nn21)S(=O)(=O)Nc3c(cccc3F)F)F",
        "formula": "C12H8F3N5O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "359.2854",
        "optical_activity": "NONE",
        "references": [
          "19a3d3aa-138b-4f33-b3f1-77c188fecedc",
          "76567893-1b78-4e45-9791-7a75a275f8fa"
        ],
        "stereo_centers": 0
      },
      "unii": "00A64ZX8NB"
    }
  ]
}